![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 400 Important Chemistry Questions and Answer.pdf | 2020-11-06 16:10 | 586K | |
| Fish and Amphibians.pdf | 2020-10-27 14:11 | 12M | |
| Fundamentals of Protein Structure and Function - E Buxbaum.pdf | 2020-10-27 14:10 | 17M | |
| Gneral chemistry laboratory manual.pdf | 2020-10-27 14:09 | 1.4M | |
| Handbook of Cathodic Corrosion and Protection.pdf | 2020-10-27 14:09 | 15M | |
| Handbook of Limestone and Dolamite.pdf | 2020-10-27 14:09 | 10M | |
| Organic Chemistry 4th ed - Francis A. Carey(1) (1).pdf | 2020-10-27 14:12 | 23M | |
| essentials_of_pharmaceutical_chemistry_3rd_edition.pdf | 2020-10-27 14:11 | 3.4M | |
| fundamentals_of_environmental_chemistry.pdf | 2020-10-27 14:10 | 4.8M | |