![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Coding For Beginners - April 2022.pdf | 2022-04-11 04:01 | 65M | |
![[ ]](/icons/layout.gif) | Python The Complete Manual - 13th Edition, 2022.pdf | 2022-04-12 03:45 | 12M | |
![[ ]](/icons/layout.gif) | Cloud Computing For Beginners - April 2022.pdf | 2022-04-12 03:45 | 58M | |
![[ ]](/icons/layout.gif) | The Complete Windows 11 Manual - 2nd Edition, 2022.pdf | 2022-04-12 03:45 | 124M | |
![[ ]](/icons/layout.gif) | (R17A0528) BIG DATA ANALYTICS.pdf | 2022-04-16 10:50 | 2.3M | |
![[ ]](/icons/layout.gif) | Big Data and Analytics by Seema Acharya and Subhashini Chellappan Copyright 2015, WILEY INDIA PVT. LTD. Introduction to Pig.pdf | 2022-04-16 10:55 | 853K | |
![[ ]](/icons/layout.gif) | Pro Tableau_ A Step-by-Step Guide ( PDFDrive ).pdf | 2022-04-16 11:00 | 50M | |
![[ ]](/icons/layout.gif) | Big Data Analytics_ A Hands-On Approach ( PDFDrive ).pdf | 2022-04-16 11:03 | 108M | |
![[ ]](/icons/layout.gif) | Data Science & Big Data Analytics ( PDFDrive ).pdf | 2022-04-16 11:04 | 50M | |
![[ ]](/icons/layout.gif) | Big-Data-Analytics-with-R-and-Hadoop.pdf | 2022-04-16 11:14 | 3.6M | |
![[ ]](/icons/layout.gif) | BIG DATA H.pdf | 2022-04-16 11:18 | 4.6M | |
![[ ]](/icons/layout.gif) | Data Science & Big Data Analytics ( PDFDrive ) (1).pdf | 2022-04-18 04:48 | 50M | |
![[ ]](/icons/layout.gif) | National Geographic Little Kids – May 2022.pdf | 2022-04-29 03:26 | 10M | |
![[ ]](/icons/layout.gif) | Cook's Country - April-May 2022.pdf | 2022-04-29 03:26 | 7.0M | |
![[ ]](/icons/layout.gif) | Narayana-Machine_Drawing.pdf | 2022-04-29 03:36 | 10M | |
![[ ]](/icons/layout.gif) | Computer_Networking_A_Top-Down_Approach.pdf | 2022-04-29 03:38 | 8.3M | |
![[ ]](/icons/layout.gif) | Introduction_to_algorithms-3rd Edition.pdf | 2022-04-29 03:38 | 5.4M | |
![[ ]](/icons/layout.gif) | The_C_Programming_language_By_Brian_W_Kernighan,_Dennis_M_Ritchie.pdf | 2022-04-29 03:38 | 20M | |
![[ ]](/icons/layout.gif) | Theory of Computations Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 24M | |
![[ ]](/icons/layout.gif) | Theory of Computation_2.pdf | 2022-04-29 03:39 | 5.3M | |
![[ ]](/icons/layout.gif) | Software Engineering Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 6.8M | |
![[ ]](/icons/layout.gif) | Software Engineering.pdf | 2022-04-29 03:39 | 4.5M | |
![[ ]](/icons/layout.gif) | THEORY OF COMPUTATION CLASS NOTES.pdf | 2022-04-29 03:39 | 18M | |
![[ ]](/icons/layout.gif) | Theory Of Computation.pdf | 2022-04-29 03:39 | 5.5M | |
![[ ]](/icons/layout.gif) | Operating System Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 25M | |
![[ ]](/icons/layout.gif) | OperatingSystems.pdf | 2022-04-29 03:39 | 12M | |
![[ ]](/icons/layout.gif) | network security.pdf | 2022-04-29 03:39 | 1.8M | |
![[ ]](/icons/layout.gif) | Operating system new.pdf | 2022-04-29 03:39 | 12M | |
![[ ]](/icons/layout.gif) | Graph Theory.pdf | 2022-04-29 03:39 | 4.0M | |
![[ ]](/icons/layout.gif) | OPERATING SYSTEM.pdf | 2022-04-29 03:39 | 6.5M | |
![[ ]](/icons/layout.gif) | Mathematics-CSE.pdf | 2022-04-29 03:39 | 11M | |
![[ ]](/icons/layout.gif) | DIGITAL SYSTEM CLASS NOTES.pdf | 2022-04-29 03:39 | 5.3M | |
![[ ]](/icons/layout.gif) | Digital Electronics Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 11M | |
![[ ]](/icons/layout.gif) | Digital Logic_2.pdf | 2022-04-29 03:39 | 2.9M | |
![[ ]](/icons/layout.gif) | DBMS-CS.pdf | 2022-04-29 03:39 | 30M | |
![[ ]](/icons/layout.gif) | COMPUTER ORGANIZATION CLASS NOTES.pdf | 2022-04-29 03:39 | 8.3M | |
![[ ]](/icons/layout.gif) | Computer Organisation.pdf | 2022-04-29 03:39 | 3.8M | |
![[ ]](/icons/layout.gif) | Computer Organization-CS.pdf | 2022-04-29 03:39 | 19M | |
![[ ]](/icons/layout.gif) | Computer Organisation Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 22M | |
![[ ]](/icons/layout.gif) | Computer Architecture.pdf | 2022-04-29 03:39 | 11M | |
![[ ]](/icons/layout.gif) | Work book TOC and Compiler Design Made Easy.pdf | 2022-04-29 03:39 | 14M | |
![[ ]](/icons/layout.gif) | CompilerDesign.pdf | 2022-04-29 03:39 | 3.0M | |
![[ ]](/icons/layout.gif) | Compiler Hand Written Notes Made Easy.pdf | 2022-04-29 03:39 | 18M | |
![[ ]](/icons/layout.gif) | COMPILER DESIGN CLASS NOTES.pdf | 2022-04-29 03:40 | 2.2M | |
![[ ]](/icons/layout.gif) | WorkBook_C_DS_Algorithms_Made Easy.pdf | 2022-04-29 03:40 | 8.2M | |
![[ ]](/icons/layout.gif) | DAAandDS.pdf | 2022-04-29 03:40 | 7.4M | |
![[ ]](/icons/layout.gif) | COMPUTER ORG CLASS NOTES.pdf | 2022-04-29 03:40 | 9.1M | |
![[ ]](/icons/layout.gif) | dbms- III.pdf | 2022-04-29 03:40 | 2.8M | |
![[ ]](/icons/layout.gif) | DBMS Hand Written Notes Made Easy.pdf | 2022-04-29 03:40 | 20M | |
![[ ]](/icons/layout.gif) | DISCREATE MATHS (Graph Theory).pdf | 2022-04-29 03:40 | 8.6M | |
![[ ]](/icons/layout.gif) | digital system clean.pdf | 2022-04-29 03:40 | 8.6M | |
![[ ]](/icons/layout.gif) | Digital Logic.pdf | 2022-04-29 03:40 | 18M | |
![[ ]](/icons/layout.gif) | Operating System-CSE.pdf | 2022-04-29 03:40 | 15M | |
![[ ]](/icons/layout.gif) | DBMS_4.pdf | 2022-04-29 03:40 | 14M | |
![[ ]](/icons/layout.gif) | SOFTWARE Engineering CLASS NOTES.pdf | 2022-04-29 03:40 | 3.6M | |
![[ ]](/icons/layout.gif) | Dbms.pdf | 2022-04-29 03:40 | 57M | |
![[ ]](/icons/layout.gif) | DBMS (1).pdf | 2022-04-29 03:40 | 12M | |
![[ ]](/icons/layout.gif) | DBMS CLASS NOTES.pdf | 2022-04-29 03:40 | 4.0M | |
![[ ]](/icons/layout.gif) | ComputerNetworks.pdf | 2022-04-29 03:40 | 12M | |
![[ ]](/icons/layout.gif) | Computer Networks Hand Written Notes Made Easy.pdf | 2022-04-29 03:40 | 26M | |
![[ ]](/icons/layout.gif) | COMPUTER NETWORKS CLASS NOTES.pdf | 2022-04-29 03:40 | 10M | |
![[ ]](/icons/layout.gif) | COMPUTER NETWORKS NEW.pdf | 2022-04-29 03:40 | 11M | |
![[ ]](/icons/layout.gif) | Compiler Design-CS.pdf | 2022-04-29 03:40 | 8.8M | |
![[ ]](/icons/layout.gif) | Compiler Design Vani Notes.pdf | 2022-04-29 03:40 | 39M | |
![[ ]](/icons/layout.gif) | DataStructures Hand Written Notes Made Easy.pdf | 2022-04-29 03:40 | 18M | |
![[ ]](/icons/layout.gif) | Design Analysis and Algorithm.pdf | 2022-04-29 03:40 | 38M | |
![[ ]](/icons/layout.gif) | Data Structure.pdf | 2022-04-29 03:40 | 35M | |
![[ ]](/icons/layout.gif) | DATA STRUCTURE CLASS NOTES.pdf | 2022-04-29 03:40 | 3.3M | |
![[ ]](/icons/layout.gif) | DESIGN AND ANALYSIS OF ALGORITHMS.pdf | 2022-04-29 03:40 | 14M | |
![[ ]](/icons/layout.gif) | learn_python_the_right_way.pdf | 2022-04-29 03:41 | 4.4M | |
![[ ]](/icons/layout.gif) | Beginning Django CMS (en).pdf | 2022-04-29 03:41 | 5.8M | |
![[ ]](/icons/layout.gif) | Programming for Computations – Python (en).pdf | 2022-04-29 03:41 | 4.4M | |
![[ ]](/icons/layout.gif) | Python Web Scraping (en).pdf | 2022-04-29 03:41 | 7.1M | |
![[ ]](/icons/layout.gif) | Beginners Guide to Python Programming Language (en).pdf | 2022-04-29 03:41 | 699K | |
![[ ]](/icons/layout.gif) | Learning Python Network Programming (en).pdf | 2022-04-29 03:41 | 5.4M | |
![[ ]](/icons/layout.gif) | Pro Python (en).pdf | 2022-04-29 03:41 | 4.3M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch-Quick-Start-Guide (1).pdf | 2022-04-29 03:41 | 6.4M | |
![[ ]](/icons/layout.gif) | Mathematical_Problems_in_Data_Science.pdf | 2022-04-29 03:41 | 4.1M | |
![[ ]](/icons/layout.gif) | Python.Data.Cleaning.Cookbook.pdf | 2022-04-29 03:41 | 3.9M | |
![[ ]](/icons/layout.gif) | Thinking_in_Pandas_How_to_Use_the_Python_Data_Analysis_Library_the.pdf | 2022-04-29 03:41 | 2.3M | |
![[ ]](/icons/layout.gif) | Programming_PyTorch_for_Deep_Learning_Creating_and_Deploying_Deep.pdf | 2022-04-29 03:42 | 6.2M | |
![[ ]](/icons/layout.gif) | Django Tutorial-Build a Travel Blog.pdf | 2022-04-29 03:42 | 13M | |
![[ ]](/icons/layout.gif) | Eyal_Wirsansky_Hands_On_Genetic_Algorithms_with_Python_Applying.pdf | 2022-04-29 03:42 | 9.0M | |
![[ ]](/icons/layout.gif) | Hariom_Tatsat,_Sahil_Puri_,_Brad_Lookabaugh_Machine_Learning_and.pdf | 2022-04-29 03:42 | 14M | |
![[ ]](/icons/layout.gif) | Python Programming for Beginners. The Compl Begin Guide.pdf | 2022-04-29 03:42 | 1.2M | |
![[ ]](/icons/layout.gif) | [H._Bhasin]_Python_Basics_A_Self-Teaching_Introdu.pdf | 2022-04-29 03:42 | 12M | |
![[ ]](/icons/layout.gif) | Beginning Python, 3rd Edition.pdf | 2022-04-29 03:42 | 6.0M | |
![[ ]](/icons/layout.gif) | Python for Bioinformatics by Sebastian Bassi.pdf | 2022-04-29 03:42 | 5.0M | |
![[ ]](/icons/layout.gif) | Practices of the Python Pro (en).pdf | 2022-04-29 03:42 | 4.1M | |
![[ ]](/icons/layout.gif) | OpenCV-4-with-Python-Blueprints-2nd-Ed.pdf | 2022-04-29 03:42 | 35M | |
![[ ]](/icons/layout.gif) | Python Web Scraping (en) (1).pdf | 2022-04-29 03:42 | 7.1M | |
![[ ]](/icons/layout.gif) | The new and improved Flask mega-tutorial by Miguel Grinberg.pdf | 2022-04-29 03:42 | 1.9M | |
![[ ]](/icons/layout.gif) | Mastering IPython 4.0.pdf | 2022-04-29 03:42 | 5.6M | |
![[ ]](/icons/layout.gif) | Python Programming for Beginner.pdf | 2022-04-29 03:43 | 451K | |
![[ ]](/icons/layout.gif) | Complete Guide For Python Programming (2015).pdf | 2022-04-29 03:43 | 812K | |
![[ ]](/icons/layout.gif) | Advanced Data Analytics Using Python - Sayan Mukhopadhyay.pdf | 2022-04-29 03:43 | 2.2M | |
![[ ]](/icons/layout.gif) | Learn Python The Hard Way 3rd Edition V413HAV.pdf | 2022-04-29 03:44 | 2.6M | |
![[ ]](/icons/layout.gif) | Probability_and_statistics_for_data_science_math_+_R_+_data_by_Matloff.pdf | 2022-04-29 03:44 | 6.3M | |
![[ ]](/icons/layout.gif) | mastering_object_oriented_python_by_steven_F_Lott_z_lib_org.pdf | 2022-04-29 03:44 | 6.4M | |
![[ ]](/icons/layout.gif) | Data Science Fundamentals for Python and MongoDB.pdf | 2022-04-29 03:44 | 7.2M | |
![[ ]](/icons/layout.gif) | Python.pdf | 2022-04-29 03:44 | 799K | |
![[ ]](/icons/layout.gif) | Python Programming (en).pdf | 2022-04-29 03:44 | 9.9M | |
![[ ]](/icons/layout.gif) | Mastering Python High Performance.pdf | 2022-04-29 03:44 | 6.1M | |
![[ ]](/icons/layout.gif) | Python for Secret Agents.pdf | 2022-04-29 03:44 | 1.4M | |
![[ ]](/icons/layout.gif) | Deep Learning Architectures.pdf | 2022-04-29 03:44 | 15M | |
![[ ]](/icons/layout.gif) | Python Programming for Teens.pdf | 2022-04-29 03:44 | 3.5M | |
![[ ]](/icons/layout.gif) | More Python Programming for the Absolute Beginner.pdf | 2022-04-29 03:44 | 5.7M | |
![[ ]](/icons/layout.gif) | Numerical Python.pdf | 2022-04-29 03:44 | 12M | |
![[ ]](/icons/layout.gif) | Python Game Programming By Example.pdf | 2022-04-29 03:44 | 3.4M | |
![[ ]](/icons/layout.gif) | Applied Machine Learning with Python by Andrea Giussani.pdf | 2022-04-29 03:45 | 6.5M | |
![[ ]](/icons/layout.gif) | Python Machine Learning.pdf | 2022-04-29 03:45 | 32M | |
![[ ]](/icons/layout.gif) | Data_Visualisation_A_Handbook_For_Data_Driven_Design_by_Andy_Kirk.pdf | 2022-04-29 03:45 | 28M | |
![[ ]](/icons/layout.gif) | The Quick Python Book, Second Edition.pdf | 2022-04-29 03:45 | 4.5M | |
![[ ]](/icons/layout.gif) | Python_Automation_Cookbook_75_Python_automation_ideas_for_web_scraping.pdf | 2022-04-29 03:45 | 12M | |
![[ ]](/icons/layout.gif) | Deep_Learning_Cookbook_Practical_Recipes_to_Get_Started_Quickly.pdf | 2022-04-29 03:45 | 12M | |
![[ ]](/icons/layout.gif) | Python Playground.pdf | 2022-04-29 03:45 | 12M | |
![[ ]](/icons/layout.gif) | A Primer on Scientific Programming with Python, 4th edition.pdf | 2022-04-29 03:45 | 7.0M | |
![[ ]](/icons/layout.gif) | Beginning Python Games Development, Second Edition.pdf | 2022-04-29 03:45 | 4.9M | |
![[ ]](/icons/layout.gif) | Coding Projects in Python (en).pdf | 2022-04-29 03:45 | 22M | |
![[ ]](/icons/layout.gif) | Fundamentals of Python.pdf | 2022-04-29 03:45 | 5.7M | |
![[ ]](/icons/layout.gif) | Practical_time_series_analysis_master_time_series_data_processing.pdf | 2022-04-29 03:45 | 12M | |
![[ ]](/icons/layout.gif) | (by-Ben-Stephenson)-The-Python-Workbook-A-Brief (1).pdf | 2022-04-29 03:45 | 9.6M | |
![[ ]](/icons/layout.gif) | High Performance Python.pdf | 2022-04-29 03:45 | 8.3M | |
![[ ]](/icons/layout.gif) | The Python Workbook.pdf | 2022-04-29 03:45 | 14M | |
![[ ]](/icons/layout.gif) | Python GUI Programming Cookbook.pdf | 2022-04-29 03:45 | 9.1M | |
![[ ]](/icons/layout.gif) | (by-Narasimha-Karumanchi)-Data-Structure-and-Algor.pdf | 2022-04-29 03:46 | 70M | |
![[ ]](/icons/layout.gif) | Qt5_Python_GUI_Programming_Cookbook_Building_responsive_and_powerful.pdf | 2022-04-29 03:46 | 4.7M | |
![[ ]](/icons/layout.gif) | Applied Data Science with Python and Jupyter by Alex Galea.pdf | 2022-04-29 03:46 | 14M | |
![[ ]](/icons/layout.gif) | Machine Learning With Python For Everyone by Mark E. Fenner.pdf | 2022-04-29 03:46 | 9.0M | |
![[ ]](/icons/layout.gif) | A_Complete_Solution_Guide_to_Principles_of_Mathematical_Analysis.pdf | 2022-04-29 03:46 | 7.2M | |
![[ ]](/icons/layout.gif) | Machine_Learning_Refined_Foundations,_Algorithms,_and_Applications.pdf | 2022-04-29 03:46 | 21M | |
![[ ]](/icons/layout.gif) | Apress-Magnus_Lie_Hetland-python_algorithms.pdf | 2022-04-29 03:47 | 4.7M | |
![[ ]](/icons/layout.gif) | Core.Python.Applications.Programming.3rd.Edition.pdf | 2022-04-29 03:47 | 9.3M | |
![[ ]](/icons/layout.gif) | Foundations of Python Network Programming Second Edition.pdf | 2022-04-29 03:47 | 4.8M | |
![[ ]](/icons/layout.gif) | bb-Data Structures and Algorithms with Python.pdf | 2022-04-29 03:47 | 13M | |
![[ ]](/icons/layout.gif) | harrou_f_et_al_statistical_process_monitoring_using_advanced.pdf | 2022-04-29 03:47 | 26M | |
![[ ]](/icons/layout.gif) | Introduction_to_Computation_and.pdf | 2022-04-29 03:47 | 13M | |
![[ ]](/icons/layout.gif) | Python 3 Text Processing with NLTK 3 Cookbook.pdf | 2022-04-29 03:47 | 1.9M | |
![[ ]](/icons/layout.gif) | Python For Dummies.pdf | 2022-04-29 03:47 | 1.5M | |
![[ ]](/icons/layout.gif) | Python Programming for the Absolute Beginner - 3rd Edition.pdf | 2022-04-29 03:47 | 13M | |
![[ ]](/icons/layout.gif) | Beginning Programming with Python for Dummies.pdf | 2022-04-29 03:47 | 10M | |
![[ ]](/icons/layout.gif) | Head_First_Python.pdf | 2022-04-29 03:47 | 28M | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.20 (for Python 2.x) (2005).pdf | 2022-04-29 03:47 | 337K | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.92 (for Python 3.0) (2009).pdf | 2022-04-29 03:47 | 609K | |
![[ ]](/icons/layout.gif) | A_Learner's_Guide_to_Programming.pdf | 2022-04-29 03:47 | 17M | |
![[ ]](/icons/layout.gif) | A Primer on Scientific Programming with Python (2009).pdf | 2022-04-29 03:47 | 6.8M | |
![[ ]](/icons/layout.gif) | Internet_of_Things_with_Python_Interact_with_the_world_and_rapidly.pdf | 2022-04-29 03:48 | 28M | |
![[ ]](/icons/layout.gif) | Machine Learning With Python (en).pdf | 2022-04-29 03:48 | 8.1M | |
![[ ]](/icons/layout.gif) | programarcadegames.pdf | 2022-04-29 03:48 | 8.4M | |
![[ ]](/icons/layout.gif) | Beginning Sensor Networks with XBee (en).pdf | 2022-04-29 03:48 | 15M | |
![[ ]](/icons/unknown.gif) | Python for DevOps Learn Ruthlessly Effective Automation.epub | 2022-04-29 03:48 | 7.3M | |
![[ ]](/icons/layout.gif) | Mastering_Flask_Web_Development_Second_Edition_by_Daniel_Gaspar.pdf | 2022-04-29 03:48 | 7.8M | |
![[ ]](/icons/layout.gif) | (by-John-Paul-Mueller,-Luca-Massaron)-Artificial-I.pdf | 2022-04-29 03:48 | 10M | |
![[ ]](/icons/layout.gif) | Learn Data Analysis with Python.pdf | 2022-04-29 03:48 | 1.7M | |
![[ ]](/icons/layout.gif) | Spark_in_Action,_Second_Edition_by_Jean_Georges_Perrin_z_lib_org.pdf | 2022-04-29 03:48 | 36M | |
![[ ]](/icons/layout.gif) | (by-Brian-Okken)-Python-Testing-with-pytest.pdf | 2022-04-29 03:48 | 2.9M | |
![[ ]](/icons/layout.gif) | Elementary_Math_for_Comp_Sci_with_Python.pdf | 2022-04-29 03:48 | 17M | |
![[ ]](/icons/layout.gif) | AI Darshan Material.pdf | 2022-04-29 06:06 | 2.2M | |
![[ ]](/icons/layout.gif) | AI Material.pdf | 2022-04-29 06:07 | 26M | |
![[ ]](/icons/layout.gif) | Microprocessor and Interfacing (3160712).pdf | 2022-04-29 06:20 | 92M | |
![[ ]](/icons/layout.gif) | Node_js_in_Action_by_Mike_Cantelon,_Marc_Harter,_T_J_Holowaychuk.pdf | 2022-04-29 06:21 | 6.8M | |
![[ ]](/icons/layout.gif) | AngularJS in Action by Lukas Ruebbelke (book drive).pdf | 2022-04-29 06:22 | 5.8M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_by_Kevin_Knight,_Elaine_Rich,_Shivashankar.pdf | 2022-04-29 06:23 | 8.2M | |
![[ ]](/icons/layout.gif) | Control_Systems_Principles_and_Design_by_M_Gopal_book_drive.pdf | 2022-04-29 06:23 | 9.6M | |
![[ ]](/icons/layout.gif) | The_Monkey_Theory_Conquer_Your_Mental_Chatter_Sfurti_Sahare_book.pdf | 2022-04-29 11:28 | 6.1M | |
![[ ]](/icons/layout.gif) | The 8020 Principle The Secret to SuccesS.pdf | 2022-05-01 03:10 | 1.4M | |
![[ ]](/icons/layout.gif) | The Brain Bible John Arden Hardcover.pdf | 2022-05-01 03:10 | 3.3M | |
![[ ]](/icons/layout.gif) | Working Memory Advantage Alloway.pdf | 2022-05-01 03:10 | 3.4M | |
![[ ]](/icons/layout.gif) | The_Joy_of_Mathematics_Marvels,_Novelties,_and_Neglected_Gems_That.pdf | 2022-05-05 03:32 | 13M | |
![[ ]](/icons/layout.gif) | File a cyber Complaint online.pdf | 2022-05-05 06:08 | 1.6M | |
![[ ]](/icons/layout.gif) | DATA ANA.pdf | 2022-05-05 10:45 | 1.1M | |
![[ ]](/icons/layout.gif) | Data Analytics_ Practical Guide to Leveraging the Power of Algorithms, Data Science, Data Mining, Statistics, Big Data, and Predictive Analysis to Improve Business, Work, and Life ( PDFDrive ).pdf | 2022-05-05 10:50 | 1.2M | |
![[ ]](/icons/layout.gif) | Data Analytics_ Practical Guide to Leveraging the Power of Algorithms, Data Science, Data Mining, Statistics, Big Data, and Predictive Analysis to Improve Business, Work, and Life ( PDFDrive ) (1).pdf | 2022-05-06 03:37 | 1.2M | |
![[ ]](/icons/layout.gif) | C++ Notes.pdf | 2022-05-06 05:46 | 17M | |
![[ ]](/icons/layout.gif) | Java notes Codes.learning.pdf | 2022-05-06 05:46 | 34M | |
![[ ]](/icons/layout.gif) | notes of c.pdf | 2022-05-06 05:50 | 229M | |
![[ ]](/icons/layout.gif) | Python_codeslearning.pdf | 2022-05-06 05:50 | 23M | |
![[ ]](/icons/layout.gif) | Data Structures.pdf | 2022-05-06 05:50 | 17M | |
![[ ]](/icons/layout.gif) | DBMS Notes.pdf | 2022-05-06 05:50 | 43M | |
![[ ]](/icons/layout.gif) | Computer Music - Issue 307, May 2022.pdf | 2022-05-06 06:28 | 39M | |
![[ ]](/icons/layout.gif) | Gowrishankar book python.pdf | 2022-05-09 06:53 | 14M | |
![[ ]](/icons/layout.gif) | C++ Short Handwritten Notes.pdf | 2022-05-10 03:22 | 12M | |
![[ ]](/icons/layout.gif) | C Handwritten Notes.pdf | 2022-05-10 03:22 | 12M | |
![[ ]](/icons/layout.gif) | Data Stracture Notes.pdf | 2022-05-10 03:22 | 5.2M | |
![[ ]](/icons/layout.gif) | Java Basics Handwritten.pdf | 2022-05-10 03:22 | 3.7M | |
![[ ]](/icons/layout.gif) | Sql Short Notes Part 3.pdf | 2022-05-10 03:22 | 1.1M | |
![[ ]](/icons/layout.gif) | SQL Short Notes.pdf | 2022-05-10 03:22 | 908K | |
![[ ]](/icons/layout.gif) | Python Ebook Final.pdf | 2022-05-10 03:22 | 4.9M | |
![[ ]](/icons/layout.gif) | C++ Basics Handwritten.pdf | 2022-05-10 03:22 | 30M | |
![[ ]](/icons/layout.gif) | Andriod_ShortNotes.pdf | 2022-05-10 03:22 | 485K | |
![[ ]](/icons/layout.gif) | C Basic Programs.pdf | 2022-05-10 03:22 | 3.0M | |
![[ ]](/icons/layout.gif) | Java Basic programms!.pdf | 2022-05-10 03:22 | 3.9M | |
![[ ]](/icons/layout.gif) | DataStructure Notes.pdf | 2022-05-10 03:22 | 2.2M | |
![[ ]](/icons/layout.gif) | Java_Programs.pdf | 2022-05-10 03:22 | 2.8M | |
![[ ]](/icons/layout.gif) | Python interview Question Handwritten .pdf | 2022-05-10 03:22 | 4.8M | |
![[ ]](/icons/layout.gif) | HTML Handwritten Notes.pdf | 2022-05-10 03:22 | 9.0M | |
![[ ]](/icons/layout.gif) | Python_essential_cheatsheet.pdf | 2022-05-10 03:23 | 698K | |
![[ ]](/icons/layout.gif) | python_programs_handwritten_notes.pdf | 2022-05-10 03:23 | 2.0M | |
![[ ]](/icons/layout.gif) | JAVA HANDWRITTEN NOTES (2).pdf | 2022-05-10 03:23 | 29M | |
![[ ]](/icons/layout.gif) | Python Handwritten Notes (2).pdf | 2022-05-10 03:23 | 3.3M | |
![[ ]](/icons/layout.gif) | Java HandWritten Notes.pdf | 2022-05-10 03:23 | 36M | |
![[ ]](/icons/layout.gif) | Python HandWritten Notes.pdf | 2022-05-10 03:23 | 122M | |
![[ ]](/icons/unknown.gif) | FlappyBird.rar | 2022-05-10 03:23 | 50K | |
![[ ]](/icons/unknown.gif) | GUI-CalcuatorByCuriousProgrammer.rar | 2022-05-10 03:24 | 4.1K | |
![[ ]](/icons/layout.gif) | Python Free Game By Curious Programmer.pdf | 2022-05-10 03:24 | 3.0M | |
![[ ]](/icons/layout.gif) | AI.pdf | 2022-05-10 03:26 | 431K | |
![[ ]](/icons/layout.gif) | AJP.pdf | 2022-05-10 03:26 | 269K | |
![[ ]](/icons/layout.gif) | CPDC.pdf | 2022-05-10 03:26 | 845K | |
![[ ]](/icons/layout.gif) | DM.pdf | 2022-05-10 03:26 | 167K | |
![[ ]](/icons/layout.gif) | IPDC.pdf | 2022-05-10 03:26 | 775K | |
![[ ]](/icons/layout.gif) | MAD.pdf | 2022-05-10 03:26 | 149K | |
![[ ]](/icons/layout.gif) | IOT.pdf | 2022-05-10 03:26 | 161K | |
![[ ]](/icons/layout.gif) | MI.pdf | 2022-05-10 03:26 | 168K | |
![[ ]](/icons/layout.gif) | SE.pdf | 2022-05-10 03:27 | 149K | |
![[ ]](/icons/layout.gif) | TOC.pdf | 2022-05-10 03:27 | 437K | |
![[ ]](/icons/layout.gif) | WP.pdf | 2022-05-10 03:27 | 277K | |
![[IMG]](/icons/image2.gif) | FSUbCC6VEAAM4GX.jpg | 2022-05-10 03:31 | 53K | |
![[ ]](/icons/layout.gif) | SQL_Commands_HandwrittenNotes.pdf | 2022-05-18 05:45 | 3.2M | |
![[ ]](/icons/layout.gif) | C++ Basics Handwritten (1).pdf | 2022-05-18 05:46 | 30M | |
![[ ]](/icons/layout.gif) | Java HandWritten Notes (1).pdf | 2022-05-18 05:46 | 36M | |
![[ ]](/icons/layout.gif) | Step1-Undertaking to be Uploaded on iON.pdf | 2022-05-18 09:36 | 93K | |
![[ ]](/icons/layout.gif) | DATA STRUCTURES THROUGH PYTHON(R20A0503).pdf | 2022-05-19 07:17 | 3.9M | |
![[ ]](/icons/layout.gif) | book DAP.pdf | 2022-05-19 07:18 | 6.0M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms with Python ( PDFDrive ).pdf | 2022-05-19 07:31 | 13M | |
![[ ]](/icons/layout.gif) | Data Structures (E. Balagurusamy) (z-lib.org).pdf | 2022-05-21 05:25 | 6.9M | |
![[ ]](/icons/layout.gif) | C Programming and Data Structures (E Balagurusamy) (z-lib.org).pdf | 2022-05-21 05:26 | 6.5M | |
![[ ]](/icons/layout.gif) | Programming in ANSI C (E. Balagurusamy) (z-lib.org).pdf | 2022-05-21 05:30 | 64M | |
![[ ]](/icons/layout.gif) | data-structures-and-algorithms-concepts-techniques-and-applications-9780070667266-0070667268_compress.pdf | 2022-05-21 05:46 | 38M | |
![[ ]](/icons/layout.gif) | Digital Logic And Computer Design By M. Morris Mano ( PDFDrive ).pdf | 2022-05-23 10:44 | 13M | |
![[ ]](/icons/layout.gif) | Coding Projects in Python ( PDFDrive ).pdf | 2022-05-23 10:55 | 22M | |
![[ ]](/icons/layout.gif) | Data Analysis From Scratch With Python_ Beginner Guide using Python, Pandas, NumPy, Scikit-Learn, IPython, TensorFlow and Matplotlib ( PDFDrive ).pdf | 2022-05-23 10:56 | 2.8M | |
![[ ]](/icons/layout.gif) | Coding Projects in Scratch_ A Step-by-Step Visual Guide to Coding Your Own Animations, Games, Simulations, and More ( PDFDrive ).pdf | 2022-05-23 10:58 | 35M | |
![[ ]](/icons/layout.gif) | Introduction to Machine Learning with Python ( PDFDrive ).pdf | 2022-05-23 11:00 | 32M | |
![[ ]](/icons/layout.gif) | Data Structure and Algorithmic Thinking with Python Data Structure and Algorithmic Puzzles ( PDFDrive ).pdf | 2022-05-23 11:03 | 70M | |
![[ ]](/icons/layout.gif) | The _C++ _Programming _Language _Bjarne Stroustrup.pdf | 2022-05-24 10:09 | 3.2M | |
![[ ]](/icons/layout.gif) | Real_World bug hunting.pdf | 2022-05-24 10:09 | 4.0M | |
![[ ]](/icons/layout.gif) | Let Us C book.pdf | 2022-05-24 10:10 | 7.2M | |
![[ ]](/icons/layout.gif) | cprogramming_tutorial.pdf | 2022-05-24 10:11 | 1.0M | |
![[ ]](/icons/layout.gif) | Cyber Security.pdf | 2022-05-24 10:17 | 162K | |
![[ ]](/icons/layout.gif) | CPDP.pdf | 2022-05-24 10:17 | 427K | |
![[ ]](/icons/layout.gif) | Computer Networks.pdf | 2022-05-24 10:17 | 162K | |
![[ ]](/icons/layout.gif) | ADA.pdf | 2022-05-24 10:17 | 290K | |
![[ ]](/icons/layout.gif) | Computer Graphics.pdf | 2022-05-24 10:17 | 385K | |
![[ ]](/icons/layout.gif) | Data Science.pdf | 2022-05-24 10:17 | 276K | |
![[ ]](/icons/layout.gif) | Data_Structure_GTU_Book_3130702_by_A_A_Putambekar_book_drive_com.pdf | 2022-05-24 10:19 | 84M | |
![[ ]](/icons/layout.gif) | Database_Management_System_GTU_Book_3130703_by_A_A_Puntambekar_book.pdf | 2022-05-24 10:23 | 61M | |
![[ ]](/icons/layout.gif) | Digital_Fundamentals_GTU_Book_3130704_by_DA_Godse,_AP_Godse_book.pdf | 2022-05-24 10:31 | 159M | |
![[ ]](/icons/layout.gif) | CN GTU QUE-ANS.pdf | 2022-05-24 10:32 | 45M | |
![[ ]](/icons/layout.gif) | CPDP TECHNICAL PUBLICATION.pdf | 2022-05-24 10:32 | 21M | |
![[ ]](/icons/layout.gif) | CPDP book .pdf | 2022-05-24 10:33 | 72M | |
![[ ]](/icons/layout.gif) | WD_Technical.pdf | 2022-05-24 10:34 | 190M | |
![[ ]](/icons/layout.gif) | Theory of Computation (3160704).pdf | 2022-05-24 10:34 | 101M | |
![[ ]](/icons/layout.gif) | Software Engineering (3161605).pdf | 2022-05-24 10:35 | 81M | |
![[ ]](/icons/layout.gif) | Mobile App Development (3161612).pdf | 2022-05-24 10:35 | 27M | |
![[ ]](/icons/layout.gif) | IOT and Applications (3160716).pdf | 2022-05-24 10:35 | 53M | |
![[ ]](/icons/layout.gif) | Cryptography and Network Security (3161609).pdf | 2022-05-24 10:36 | 52M | |
![[ ]](/icons/layout.gif) | Advance Java Programming (3160707).pdf | 2022-05-24 10:53 | 225M | |
![[ ]](/icons/layout.gif) | OEC552_Soft_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-05-24 11:19 | 16M | |
![[ ]](/icons/layout.gif) | IT8074_Service_Oriented_Architecture_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:19 | 31M | |
![[ ]](/icons/layout.gif) | GE8151_Problem_Solving_&_Python_Programming_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:20 | 30M | |
![[ ]](/icons/layout.gif) | GE8076_Professional_Ethics_in_Engineering_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:21 | 66M | |
![[ ]](/icons/layout.gif) | GE8073_Fundamentals_of_Nano_Science_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:21 | 12M | |
![[ ]](/icons/layout.gif) | CS8792_Cryptography_&_Network_Security_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:23 | 84M | |
![[ ]](/icons/layout.gif) | CS8791_Cloud_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-05-24 11:23 | 62M | |
![[ ]](/icons/layout.gif) | CS8691_Artificial_Intelligence_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:24 | 204M | |
![[ ]](/icons/layout.gif) | CS8601_Mobile_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-05-24 11:24 | 81M | |
![[ ]](/icons/layout.gif) | CS8592_Object_Oriented_Analysis_and_Design_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:24 | 46M | |
![[ ]](/icons/layout.gif) | CS8501_Theory_of_Computation_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-05-24 11:25 | 85M | |
![[ ]](/icons/layout.gif) | CS8493_Operating_Systems_Scanned_from_Printed_Book_by_Sai_Seena.pdf | 2022-05-24 11:25 | 83M | |
![[ ]](/icons/layout.gif) | CS8492_Database_Management_Systems_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:25 | 12M | |
![[ ]](/icons/layout.gif) | CS8491_Computer_Architecture_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-05-24 11:25 | 102M | |
![[ ]](/icons/layout.gif) | CS8451_Design_and_Analysis_of_Algorithms_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:25 | 85M | |
![[ ]](/icons/layout.gif) | CS8391_Data_Structures_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-05-24 11:26 | 62M | |
![[ ]](/icons/layout.gif) | CS8251_Programming_in_C_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-05-24 11:26 | 111M | |
![[ ]](/icons/layout.gif) | CS8091_Big_Data_Analytics_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-05-24 11:26 | 7.7M | |
![[ ]](/icons/layout.gif) | CS8092_Computer_Graphics_&_Multimedia_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:26 | 76M | |
![[ ]](/icons/layout.gif) | CS8087_Software_Defined_Networks_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:27 | 8.2M | |
![[ ]](/icons/layout.gif) | CS8088_Wireless_Adhoc_and_Sensor_Networks_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:27 | 42M | |
![[ ]](/icons/layout.gif) | CS8085_Social_Network_Analysis_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:27 | 9.8M | |
![[ ]](/icons/layout.gif) | CS8086_Soft_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-05-24 11:27 | 16M | |
![[ ]](/icons/layout.gif) | CS8082_Machine_Learning_Techniques_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:27 | 37M | |
![[ ]](/icons/layout.gif) | CS8081_Internet_of_Things_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-05-24 11:27 | 52M | |
![[ ]](/icons/layout.gif) | CS8075_Data_Warehousing_and_Data_Mining_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:27 | 3.2M | |
![[ ]](/icons/layout.gif) | CS8076_GPU_Architecture_and_Programming_Ripped_from_Amazon_Kindle.pdf | 2022-05-24 11:27 | 15M | |
![[ ]](/icons/layout.gif) | CS8074_Cyber_Forensics_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-05-24 11:27 | 12M | |
![[ ]](/icons/layout.gif) | CS8073_C#_and_Net_Programming_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-05-24 11:28 | 21M | |
![[ ]](/icons/layout.gif) | CS8071_Advanced_Topics_on_Databases_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-05-24 11:28 | 64M | |
![[ ]](/icons/layout.gif) | Deep learning with Python.pdf | 2022-05-28 06:54 | 5.4M | |
![[ ]](/icons/layout.gif) | Cloud_Computing_for_Dummies_ISBN.pdf | 2022-05-28 07:31 | 5.7M | |
![[ ]](/icons/layout.gif) | WIRELESS NETWORKS _unit-2.pdf | 2022-05-30 10:11 | 11M | |
![[ ]](/icons/layout.gif) | WN_UNIT-3(chapter-1).pdf | 2022-05-30 10:11 | 6.4M | |
![[ ]](/icons/layout.gif) | WN_UNIT-3(chapter-2).pdf | 2022-05-30 10:11 | 3.9M | |
![[ ]](/icons/layout.gif) | WIRELESS NETWORKs_UNIT-1.pdf | 2022-05-30 10:11 | 20M | |
![[ ]](/icons/layout.gif) | Ad Hoc Wireless Networks Architectures and Protocols C. Siva Ram Murthy BS Manoj ( PDFDrive ).pdf | 2022-05-30 10:25 | 16M | |
![[ ]](/icons/layout.gif) | Yashavant Kanetkar - Let Us C_ Authentic Guide to C PROGRAMMING Language (17th Edition).pdf | 2022-06-02 10:50 | 5.4M | |
![[ ]](/icons/layout.gif) | CSE 2022 prelims paper-1.pdf | 2022-06-06 03:22 | 5.8M | |
![[ ]](/icons/layout.gif) | SQL_Basics_Handwritten Notes.pdf | 2022-06-06 03:28 | 4.3M | |
![[ ]](/icons/layout.gif) | Sql Notes Part 1 & Part 2 marged.pdf | 2022-06-06 03:28 | 1.6M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence Technical.pdf | 2022-06-07 07:21 | 166M | |
![[ ]](/icons/layout.gif) | CSE 2022 CSAT .pdf | 2022-06-09 04:29 | 9.3M | |
![[ ]](/icons/layout.gif) | OOAD.pdf | 2022-06-09 06:30 | 423K | |
![[ ]](/icons/layout.gif) | CS8080_Information_Retrieval_Technique_Ripped_from_Amazon_Kindle.pdf | 2022-06-09 06:30 | 10M | |
![[ ]](/icons/layout.gif) | CS8079_Human_Computer_Interaction_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-06-09 06:30 | 4.4M | |
![[ ]](/icons/layout.gif) | CS8392_Object_Oriented_Programming_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-06-09 06:33 | 8.3M | |
![[ ]](/icons/layout.gif) | IT8071_Digital_Signal_Processing_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-06-09 06:40 | 4.1M | |
![[ ]](/icons/layout.gif) | Data Warehousing & Data Mining Technical.pdf | 2022-06-10 04:14 | 3.2M | |
![[ ]](/icons/layout.gif) | Internet Of Things.pdf | 2022-06-20 07:08 | 39M | |
![[ ]](/icons/layout.gif) | Machine Learning.pdf | 2022-06-20 07:08 | 53M | |
![[ ]](/icons/layout.gif) | Compiler design.pdf | 2022-06-20 07:08 | 91M | |
![[ ]](/icons/layout.gif) | Cloud Computing.pdf | 2022-06-20 07:09 | 55M | |
![[ ]](/icons/layout.gif) | Information Security.pdf | 2022-06-20 07:09 | 43M | |
![[ ]](/icons/layout.gif) | Introduction Of Artificial Intelligence.pdf | 2022-06-20 07:09 | 62M | |
|