![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | principles of geotenical enginering.pdf | 2022-11-01 06:04 | 33M | |
![[ ]](/icons/layout.gif) | mya-ministry of construction-analysis of rates for road.pdf | 2022-11-01 06:04 | 17M | |
![[ ]](/icons/layout.gif) | mya-ministry of construction-analysis of rates for road-1.pdf | 2022-11-01 06:04 | 17M | |
![[ ]](/icons/layout.gif) | Water and Wastewater Engineering.pdf | 2022-11-01 06:05 | 13M | |
![[ ]](/icons/layout.gif) | Water Supply Engineering Formulae Sheet.pdf | 2022-10-28 10:36 | 3.9M | |
![[ ]](/icons/layout.gif) | WIND and EARTHQUAKE RESISTANT BUILDINGS.pdf | 2022-11-01 06:01 | 7.2M | |
![[ ]](/icons/layout.gif) | Timber as Building Material Study Sheet.pdf | 2022-10-28 10:36 | 1.7M | |
![[ ]](/icons/layout.gif) | Surveying Problem Solving.pdf | 2022-10-28 10:33 | 3.6M | |
![[ ]](/icons/layout.gif) | Structural Engineering Reference Manual by Alan Williams.pdf | 2022-11-01 06:02 | 75M | |
![[ ]](/icons/layout.gif) | Structural Calculations.pdf | 2022-10-28 10:34 | 1.1M | |
![[ ]](/icons/layout.gif) | SUVREy.pdf | 2022-10-28 10:33 | 2.2M | |
![[ ]](/icons/layout.gif) | SURVEYING.pdf | 2022-10-28 10:33 | 18M | |
![[ ]](/icons/layout.gif) | SURVEY337.pdf | 2022-10-28 10:33 | 13M | |
![[ ]](/icons/layout.gif) | SURVEY33.pdf | 2022-10-28 10:33 | 5.2M | |
![[ ]](/icons/layout.gif) | Reinforced_Concrete_Design_To_Eurocode_2_by_W_H_Mosley,_R_Hulse.pdf | 2022-11-01 06:02 | 14M | |
![[ ]](/icons/layout.gif) | ROY SURV.pdf | 2022-10-28 10:33 | 23M | |
![[ ]](/icons/layout.gif) | Quantity Surveying Course Details.pdf | 2022-10-28 10:35 | 1.3M | |
![[ ]](/icons/layout.gif) | Physical Characteristics of Wastewater Simplified Learning.pdf | 2022-10-28 10:37 | 111K | |
![[ ]](/icons/layout.gif) | Multistory Column Design.pdf | 2022-10-28 10:34 | 1.7M | |
![[ ]](/icons/layout.gif) | Matthew_Frederick_101_Things_I_Learned_in_Architecture_School.pdf | 2022-10-20 10:34 | 2.7M | |
![[ ]](/icons/layout.gif) | KUMAR_RAVINDRA_FUNDAMENTALS_OF_HISTORICAL_GEOLOGY_AND_STRATIGRAPHY.pdf | 2022-10-28 10:35 | 2.9M | |
![[ ]](/icons/layout.gif) | JAIN V K_FIRE SAFETY IN BUILDINGS_3e.pdf | 2022-10-28 10:36 | 2.8M | |
![[ ]](/icons/layout.gif) | Interactive Quiz Plate Failure in Connections.pdf | 2022-10-28 10:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Instrumentation_and_Measurement_in_Electrical_Engineering_by_Roman.pdf | 2022-10-28 11:15 | 6.1M | |
![[ ]](/icons/layout.gif) | Hibbeler Structural Analysis 8th solution manual.pdf | 2022-11-01 06:04 | 53M | |
![[ ]](/icons/layout.gif) | Hibbeler Structural Analysis 8th .pdf.pdf | 2022-11-01 06:04 | 30M | |
![[ ]](/icons/layout.gif) | Grandstand Design- Cantilever Roof.pdf | 2022-10-28 10:34 | 1.6M | |
![[ ]](/icons/layout.gif) | GUPTA SANTOSH K _ OPTIMIZATION FOR ENGINEERS.pdf | 2022-10-28 10:36 | 2.5M | |
![[ ]](/icons/layout.gif) | GATE CED.pdf | 2022-10-28 10:33 | 39M | |
![[ ]](/icons/layout.gif) | GARG P K_DIGITAL LAND SURVEYING AND MAPPING.pdf | 2022-10-28 10:36 | 3.0M | |
![[ ]](/icons/layout.gif) | Fluid Properties 99 MCQs by Simplified Learning.pdf | 2022-10-28 10:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Estimating & Costing Complete Formulae.pdf | 2022-10-28 10:36 | 3.4M | |
![[ ]](/icons/layout.gif) | Elevated Water Tank Analysis.pdf | 2022-10-28 10:34 | 2.2M | |
![[ ]](/icons/layout.gif) | E SVUR.pdf | 2022-10-28 10:33 | 65M | |
![[ ]](/icons/layout.gif) | Design Circular Cantilever Curve Fram.pdf | 2022-10-28 10:33 | 1.5M | |
![[ ]](/icons/layout.gif) | DECODE ETHICS (MUDIT JAIN IRS AMRITA JAIN) (z-lib.org).pdf | 2022-10-20 06:56 | 109M | |
![[ ]](/icons/layout.gif) | Construction_Management_Guideline_for_Road_and_Bridge_Myanmar_2.pdf | 2022-11-01 06:04 | 4.5M | |
![[ ]](/icons/layout.gif) | Construction_Management_Guideline_for_Road_and_Bridge_Myanmar.pdf | 2022-11-01 06:04 | 4.5M | |
![[ ]](/icons/layout.gif) | CIVILD.pdf | 2022-10-28 10:33 | 15M | |
![[ ]](/icons/layout.gif) | Building_Const_&_Materials_111+_MCQs_Simplified_Learning.pdf | 2022-10-28 10:36 | 737K | |
![[ ]](/icons/layout.gif) | Bridge Engineering and Tunnelling Formulae Sheet.pdf | 2022-10-28 10:36 | 1.6M | |
![[ ]](/icons/layout.gif) | Bricks as Building Material - Short Notes.pdf | 2022-10-28 10:36 | 8.0M | |
![[ ]](/icons/layout.gif) | Book_no_40_CNC_Programming_Handbook_A_Comprehensive_guide_to_practical.pdf | 2022-11-01 06:06 | 33M | |
![[ ]](/icons/layout.gif) | BHAVIKATTI_S_S_PROBLEMS_AND_SOLUTIONS_IN_ENGINEERING_MECHANICS_3ed.pdf | 2022-10-28 10:36 | 2.6M | |
![[ ]](/icons/layout.gif) | BHAVIKATTI_S_S_DESIGN_OF_RCC_STRUCTURAL_ELEMENTS_RCC_VOLUME_I_3E.pdf | 2022-10-28 10:36 | 2.1M | |
![[ ]](/icons/layout.gif) | BHAVIKATTI S S_INTRODUCTION TO CIVIL ENGINEERING.pdf | 2022-10-28 10:35 | 2.9M | |
![[ ]](/icons/layout.gif) | BASAK SURV.pdf | 2022-10-28 10:33 | 18M | |
![[ ]](/icons/layout.gif) | Architectural Digest India – November 2022.pdf | 2022-11-02 06:01 | 21M | |
![[ ]](/icons/unknown.gif) | 8525. CP 73 - 1998-Concrete Structure.PDF | 2022-11-01 06:06 | 5.1M | |
![[ ]](/icons/layout.gif) | 2120. AutoCAD Civil 3D 2016 Essentials.pdf | 2022-11-01 06:05 | 22M | |
![[ ]](/icons/layout.gif) | 158. Road Maintenance.pdf | 2022-11-01 06:05 | 35M | |
![[ ]](/icons/layout.gif) | 39. Code of Practice for Project Management.pdf | 2022-11-01 06:07 | 3.4M | |
![[ ]](/icons/layout.gif) | 38. Chillers and chilled water systems.pdf | 2022-11-01 06:05 | 39M | |
|