![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | jquery cheatsheet.pdf | 2022-10-20 05:48 | 33K | |
![[ ]](/icons/layout.gif) | Python Cheatsheet.pdf | 2022-10-20 05:48 | 43K | |
![[ ]](/icons/layout.gif) | Javascript Cheatsheet.pdf | 2022-10-20 05:54 | 47K | |
![[ ]](/icons/layout.gif) | web-programming cheatsheet.pdf | 2022-10-20 05:48 | 51K | |
![[ ]](/icons/layout.gif) | Mysql Cheatsheet.pdf | 2022-10-20 05:55 | 56K | |
![[ ]](/icons/layout.gif) | php Cheatsheet.pdf | 2022-10-20 05:48 | 58K | |
![[ ]](/icons/layout.gif) | linux-cheat-sheet.pdf | 2022-10-20 05:48 | 91K | |
![[ ]](/icons/layout.gif) | Python Interview QnAs (1).pdf | 2022-10-29 07:44 | 91K | |
![[ ]](/icons/layout.gif) | Machine Learning Top questions & Answers.pdf | 2022-11-11 11:26 | 98K | |
![[ ]](/icons/layout.gif) | 40 Python Interview Questions.pdf | 2022-10-29 07:26 | 102K | |
![[ ]](/icons/layout.gif) | Machine Learning Cheat Sheet.pdf | 2022-10-29 07:27 | 125K | |
![[ ]](/icons/layout.gif) | Tableau_Cheatsheet.pdf | 2022-10-29 07:22 | 165K | |
![[ ]](/icons/layout.gif) | Python Crash Course – Ole Nielsen (en).pdf | 2022-10-29 07:23 | 173K | |
![[ ]](/icons/layout.gif) | mongodb.pdf | 2022-10-31 03:30 | 187K | |
![[ ]](/icons/layout.gif) | B.TechinDataScience.pdf | 2022-10-29 07:37 | 210K | |
![[ ]](/icons/layout.gif) | ML Q&A (1).pdf | 2022-10-29 07:30 | 214K | |
![[ ]](/icons/layout.gif) | TOP 50 Machine Learning Interview Questions & Answers.pdf | 2022-10-29 07:30 | 261K | |
![[ ]](/icons/layout.gif) | Top 50 Machine Learning Interview Q&A (2).pdf | 2022-10-29 07:26 | 261K | |
![[ ]](/icons/layout.gif) | Top 50 Machine Learning Interview Q&A.pdf | 2022-10-29 07:26 | 261K | |
![[ ]](/icons/layout.gif) | 600 Machine Learning DL NLP CV projects.pdf | 2022-10-28 11:31 | 336K | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.20 (for Python 2.x) (2005).pdf | 2022-10-20 05:41 | 337K | |
![[ ]](/icons/layout.gif) | Numpy Handbook.pdf | 2022-10-29 07:29 | 375K | |
![[ ]](/icons/layout.gif) | arduino programming notebook.pdf | 2022-10-28 11:16 | 376K | |
![[ ]](/icons/layout.gif) | Data Science Interview Questions.pdf | 2022-10-29 07:25 | 382K | |
![[ ]](/icons/layout.gif) | COMPUTER AWARENESS_COMPUTER AWARENESS-1.pdf | 2022-11-06 06:36 | 391K | |
![[ ]](/icons/layout.gif) | Statistical Machine Learning.pdf | 2022-10-28 11:28 | 399K | |
![[ ]](/icons/layout.gif) | SQL_SquidGame.pdf | 2022-10-28 11:27 | 425K | |
![[ ]](/icons/layout.gif) | Password Cracking Techniques.pdf | 2022-10-20 05:42 | 433K | |
![[ ]](/icons/layout.gif) | Rules of Machine Learning (2).pdf | 2022-10-29 07:44 | 449K | |
![[ ]](/icons/layout.gif) | Rules of Machine Learning.pdf | 2022-10-29 07:16 | 449K | |
![[ ]](/icons/layout.gif) | Complete Maths Topics For Data Science.pdf | 2022-10-29 07:26 | 462K | |
![[ ]](/icons/layout.gif) | cracking-php-interviews.pdf | 2022-10-21 09:54 | 479K | |
![[ ]](/icons/layout.gif) | The_Ultimate_Beginners_Guide_to_Learn_kotlin_Programming_Step_by.pdf | 2022-10-20 05:42 | 519K | |
![[ ]](/icons/layout.gif) | Pandas Tricks to Create a DataFrame From an Existing One.pdf | 2022-10-29 07:25 | 532K | |
![[ ]](/icons/layout.gif) | Python_pandas_Cheat_Sheet.pdf | 2022-10-28 11:31 | 549K | |
![[ ]](/icons/layout.gif) | Logic_and_Computer_Design_Fundamentals_4th_Edition_Solutions_textbook.pdf | 2022-10-28 11:15 | 603K | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.92 (for Python 3.0) (2009).pdf | 2022-10-20 05:41 | 609K | |
![[ ]](/icons/layout.gif) | R-intro.pdf | 2022-10-29 07:29 | 613K | |
![[ ]](/icons/layout.gif) | Python_Seaborn_Cheat_Sheet.pdf | 2022-10-28 11:30 | 624K | |
![[ ]](/icons/layout.gif) | Supervised Learning Cheatsheet.pdf | 2022-10-29 07:25 | 641K | |
![[ ]](/icons/layout.gif) | The art of R programming.pdf | 2022-10-20 05:53 | 643K | |
![[ ]](/icons/layout.gif) | PythonOneLiners.pdf | 2022-10-29 07:44 | 664K | |
![[ ]](/icons/layout.gif) | Tor_and_The_Dark_Net_Remain_Anonymous_and_Evade_NSA_Spying_by_James.pdf | 2022-10-20 05:40 | 682K | |
![[ ]](/icons/layout.gif) | math4ml.pdf | 2022-10-29 07:18 | 695K | |
![[ ]](/icons/layout.gif) | DOC-20221019-WA0007..pdf | 2022-10-20 06:02 | 712K | |
![[ ]](/icons/layout.gif) | Jupyter Notebook Basics.pdf | 2022-10-29 07:25 | 743K | |
![[ ]](/icons/layout.gif) | PHP-7-Learn-Object-Oriented-Programming-the-Hard-Way.pdf | 2022-10-21 09:55 | 772K | |
![[ ]](/icons/layout.gif) | pytest_tutorial.pdf | 2022-10-20 05:55 | 858K | |
![[ ]](/icons/compressed.gif) | Ex_Files_ML_with_Python_Foundations.zip | 2022-10-29 07:24 | 904K | |
![[ ]](/icons/layout.gif) | Python Data Science. The Ultimate Crash Course.pdf | 2022-10-29 07:23 | 959K | |
![[ ]](/icons/layout.gif) | Antonio_Leiva_Kotlin_for_Android_Developers_Learn_Kotlin_the_easy.pdf | 2022-10-21 09:52 | 1.0M | |
![[ ]](/icons/layout.gif) | Data Science Cheatsheet Compiled by Maverick Lin.pdf | 2022-10-19 05:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Solutions_Manual_to_Accompany_Nonlinear_Programming_Theory_and_Algorithms.pdf | 2022-10-28 11:15 | 1.1M | |
![[ ]](/icons/layout.gif) | XSS CheatSheet.pdf | 2022-10-20 05:42 | 1.1M | |
![[ ]](/icons/layout.gif) | The secret to cybersecurity.pdf | 2022-10-20 06:10 | 1.1M | |
![[ ]](/icons/layout.gif) | Advanced Java Notes.pdf | 2022-11-01 06:10 | 1.2M | |
![[ ]](/icons/layout.gif) | 50+ Linux Commands before joining a Company.pdf | 2022-10-21 09:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Machine Learning Using Python_Discover The World Of ML.pdf | 2022-10-29 07:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Python_Tricks_A_Buffet_of_Awesome_Python_Features_PDFDrive_com_.pdf | 2022-10-20 06:03 | 1.2M | |
![[ ]](/icons/layout.gif) | 7_essential_finance_dashboards.pdf | 2022-10-29 07:37 | 1.3M | |
![[ ]](/icons/layout.gif) | Deep Learning - John D. Kelleher (The MIT Press, 2019).pdf | 2022-10-29 07:23 | 1.3M | |
![[ ]](/icons/layout.gif) | Basics_for_Linear_Algebra_for_Machine_Learning_Discover_the_Mathematical.pdf | 2022-10-29 07:26 | 1.3M | |
![[ ]](/icons/unknown.gif) | Python and Hacking....epub | 2022-10-20 06:12 | 1.3M | |
![[ ]](/icons/layout.gif) | numpy.pdf | 2022-10-29 07:23 | 1.4M | |
![[ ]](/icons/layout.gif) | SQL handwritten notes .pdf | 2022-10-29 07:27 | 1.4M | |
![[ ]](/icons/layout.gif) | Hacker States by Follis, Luca Fish, Adam Adam Fish.pdf | 2022-10-20 05:42 | 1.4M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Book_4_The_Jewelled_Crown_by_Kalki_R_Krishnamurthy.pdf | 2022-10-20 06:02 | 1.4M | |
![[ ]](/icons/layout.gif) | Digesting React.pdf | 2022-10-21 09:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Top_1000_Java_Interview_Questions_Includes_Spring,_Hibernate,_Microservices.pdf | 2022-10-21 09:54 | 1.5M | |
![[ ]](/icons/layout.gif) | GS2.pdf | 2022-10-20 06:37 | 1.5M | |
![[ ]](/icons/layout.gif) | the-road-to-react.pdf | 2022-10-21 09:53 | 1.5M | |
![[ ]](/icons/layout.gif) | The Art Of Deception Kevin D. Mitnick.pdf | 2022-10-20 05:49 | 1.5M | |
![[ ]](/icons/layout.gif) | SQL for Data Science.pdf.pdf | 2022-10-29 07:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Probabilistic Machine Learning for Fi. ().pdf | 2022-10-28 11:31 | 1.6M | |
![[ ]](/icons/layout.gif) | Machine_Learning_Step_by_Step_Guide_To_Implement_Machine_Learning (2).pdf | 2022-10-29 07:29 | 1.6M | |
![[ ]](/icons/layout.gif) | Machine_Learning_Step_by_Step_Guide_To_Implement_Machine_Learning.pdf | 2022-10-29 07:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Bug Bounty Field Manual.pdf | 2022-10-20 06:10 | 1.6M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Book_2_Whirlwinds_by_Kalki_R_Krishnamurthy_book.pdf | 2022-10-20 06:02 | 1.6M | |
![[ ]](/icons/layout.gif) | 5_6118228544339313094.pdf | 2022-10-29 07:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Data Science Interview Questions-3.pdf | 2022-10-29 07:26 | 1.6M | |
![[ ]](/icons/layout.gif) | GE8077_Total_Quality_Management_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:38 | 1.6M | |
![[ ]](/icons/layout.gif) | Beginners-Python-Cheat-Sheet.pdf | 2022-10-29 07:30 | 1.7M | |
![[ ]](/icons/layout.gif) | Python Cheat Sheet - 58 Pages.pdf | 2022-10-29 07:23 | 1.7M | |
![[ ]](/icons/layout.gif) | The Art of PostgreSQL (Dimitri Fontaine).pdf | 2022-10-28 11:28 | 1.7M | |
![[ ]](/icons/layout.gif) | hadoop with python.pdf | 2022-10-20 05:41 | 1.8M | |
![[ ]](/icons/layout.gif) | Pandas Ebook.pdf | 2022-10-28 11:30 | 1.8M | |
![[ ]](/icons/layout.gif) | Hacking The Hacker.pdf | 2022-10-20 05:54 | 1.8M | |
![[ ]](/icons/layout.gif) | network security.pdf | 2022-10-28 09:48 | 1.8M | |
![[ ]](/icons/layout.gif) | React_Explained_Clearly_All_You_Need_to_Build_Great_React_js_Apps.pdf | 2022-10-21 09:53 | 1.8M | |
![[ ]](/icons/layout.gif) | Arduino_programming_the_ultimate_beginners_guide_to_learn_Arduino.pdf | 2022-10-20 06:14 | 1.8M | |
![[ ]](/icons/layout.gif) | Learn C++ Programming Language-Tutorials Point (2014).pdf | 2022-10-20 05:55 | 1.8M | |
![[ ]](/icons/layout.gif) | The Code Book.pdf | 2022-10-20 06:10 | 1.8M | |
![[ ]](/icons/layout.gif) | The art of invisibility_Kevin D. Mitnick.pdf | 2022-10-20 05:54 | 1.9M | |
![[ ]](/icons/layout.gif) | machine-learning-cheat-sheet.pdf | 2022-10-29 07:25 | 1.9M | |
![[ ]](/icons/layout.gif) | Deep Learning with Python The ultimate beginners guide.pdf | 2022-10-28 11:15 | 1.9M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Book_3_Sword_of_Slaughter_by_Kalki_book_drive.pdf | 2022-10-20 06:02 | 1.9M | |
![[ ]](/icons/layout.gif) | A Practical Introduction to _Python Programming.pdf | 2022-10-20 05:49 | 1.9M | |
![[ ]](/icons/layout.gif) | Python and Hacking....pdf | 2022-10-20 06:12 | 2.0M | |
![[ ]](/icons/layout.gif) | OBM752_Hospital_Management_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 05:38 | 2.0M | |
![[ ]](/icons/layout.gif) | LeetCode Java Practice Solved Questions - by Raj Kumar .pdf | 2022-11-01 06:11 | 2.0M | |
![[ ]](/icons/layout.gif) | Machine Learning Projects in Python (1).pdf | 2022-10-28 09:49 | 2.0M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Book_1_Fresh_Floods_by_Kalki_R_Krishnamurthy_book.pdf | 2022-10-20 06:02 | 2.0M | |
![[ ]](/icons/layout.gif) | Python 3 Guidelines.pdf | 2022-10-29 07:26 | 2.0M | |
![[ ]](/icons/layout.gif) | Machine_Learning_with_Python.pdf | 2022-10-29 07:26 | 2.1M | |
![[ ]](/icons/layout.gif) | Ultimate Guide to Data Cleaning.pdf | 2022-10-29 07:25 | 2.1M | |
![[ ]](/icons/layout.gif) | Smart Girls Guide To Privacy [Violet_Aug 2015 ,176 pp].pdf | 2022-10-20 06:06 | 2.1M | |
![[ ]](/icons/layout.gif) | ubuntu pocket guide-v1-1.pdf | 2022-10-20 05:52 | 2.1M | |
![[ ]](/icons/layout.gif) | COMPILER DESIGN CLASS NOTES.pdf | 2022-10-28 09:47 | 2.2M | |
![[ ]](/icons/layout.gif) | Advanced Data Analytics Using Python.pdf | 2022-10-28 11:30 | 2.2M | |
![[ ]](/icons/layout.gif) | 50-android-hac.pdf | 2022-10-21 09:52 | 2.2M | |
![[ ]](/icons/layout.gif) | Python for Everybody.pdf | 2022-10-20 06:09 | 2.3M | |
![[ ]](/icons/layout.gif) | understanding-soa-with-web-services_compress.pdf | 2022-10-19 06:20 | 2.3M | |
![[ ]](/icons/layout.gif) | Thinking_in_Pandas_How_to_Use_the_Python_Data_Analysis_Library_the.pdf | 2022-10-29 07:26 | 2.3M | |
![[ ]](/icons/layout.gif) | Hackers - Heroes of the computer revolution.pdf | 2022-10-20 05:45 | 2.3M | |
![[ ]](/icons/layout.gif) | the-pinnacle-of-sacrifice-volume-1-ponniyin-selvan-part-5.pdf | 2022-10-20 09:22 | 2.3M | |
![[ ]](/icons/layout.gif) | Python_Complete_cheatsheet.pdf | 2022-10-29 07:25 | 2.4M | |
![[ ]](/icons/layout.gif) | Sandworm A New Era of Cyberwar and the Hunt.....pdf | 2022-10-20 05:44 | 2.4M | |
![[ ]](/icons/layout.gif) | DATA SCIENCE.pdf | 2022-10-29 07:17 | 2.4M | |
![[ ]](/icons/layout.gif) | Machine Learning Mastery with Python PDF.pdf | 2022-10-29 07:29 | 2.4M | |
![[ ]](/icons/layout.gif) | JavaScript_for_impatient_programmers_ES2021_edition_by_Dr_Axel_Rauschmayer.pdf | 2022-10-21 09:54 | 2.4M | |
![[ ]](/icons/layout.gif) | GE8074_Human_Rights_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 05:38 | 2.4M | |
![[ ]](/icons/layout.gif) | Android Quick APIs Reference.pdf | 2022-10-20 05:41 | 2.4M | |
![[ ]](/icons/layout.gif) | whitepaper_datastorytelling.pdf | 2022-10-29 07:30 | 2.4M | |
![[ ]](/icons/layout.gif) | Python for Data Science Book PDF.pdf | 2022-10-29 07:29 | 2.4M | |
![[ ]](/icons/layout.gif) | Python Essential Reference, Fourth Edition (2009).pdf | 2022-10-20 05:41 | 2.4M | |
![[ ]](/icons/layout.gif) | 394599325-Typescript-Deep-Dive.pdf | 2022-10-21 09:53 | 2.5M | |
![[ ]](/icons/layout.gif) | writing Test Cases.pdf | 2022-11-01 06:11 | 2.5M | |
![[ ]](/icons/layout.gif) | Docker for Developers.pdf | 2022-10-21 09:52 | 2.6M | |
![[ ]](/icons/layout.gif) | Data Communication Computer Network Tutorial.pdf | 2022-10-20 06:10 | 2.6M | |
![[ ]](/icons/layout.gif) | Everyday Go - The Fast Track for Golang (Alex Ellis).pdf | 2022-10-21 09:53 | 2.6M | |
![[ ]](/icons/layout.gif) | The Pentester Blueprint.pdf | 2022-10-20 06:11 | 2.7M | |
![[ ]](/icons/layout.gif) | Network Flow Analysis [Michael_June 2010, 224 pp].pdf | 2022-10-20 06:05 | 2.7M | |
![[ ]](/icons/layout.gif) | Big_Data_Surveillance_And_Security_Intelligence_The_Canadian_Case.pdf | 2022-10-28 11:30 | 2.7M | |
![[ ]](/icons/layout.gif) | Adaptive_Computation_and_Machine_Learning_Ralf_Herbrich_Learning.pdf | 2022-10-29 07:23 | 2.7M | |
![[ ]](/icons/layout.gif) | The GNU Make Book [John_April 2015, 256 pp].pdf | 2022-10-20 06:06 | 2.7M | |
![[ ]](/icons/layout.gif) | Game Programming with Python, Lua, and Ruby (2003).pdf | 2022-10-20 05:41 | 2.7M | |
![[ ]](/icons/layout.gif) | Code the hidden language of computer.pdf | 2022-10-20 06:07 | 2.8M | |
![[ ]](/icons/layout.gif) | dbms- III.pdf | 2022-10-28 09:48 | 2.8M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201201.pdf | 2022-10-20 06:12 | 2.8M | |
![[ ]](/icons/layout.gif) | The Ultimate Guide to Machine Learning Job Interviews .pdf | 2022-10-28 11:32 | 2.9M | |
![[ ]](/icons/layout.gif) | Lewis,_Anthony_Rails_crash_course_a_no_nonsense_guide_to_Rails_development.pdf | 2022-10-21 09:54 | 2.9M | |
![[ ]](/icons/layout.gif) | Instructor’s_Manual_for_Logic_and_Computer_Design_Fundamentals_3rd.pdf | 2022-10-28 11:11 | 2.9M | |
![[ ]](/icons/layout.gif) | Machine Learning Quick easy guide for every beginner.pdf | 2022-11-06 06:42 | 2.9M | |
![[ ]](/icons/layout.gif) | CompilerDesign.pdf | 2022-10-28 09:47 | 3.0M | |
![[ ]](/icons/layout.gif) | C++ For Dummies 7th edition.pdf | 2022-10-20 06:07 | 3.1M | |
![[ ]](/icons/layout.gif) | Natural Language Processing with Python (2009).pdf | 2022-10-20 05:41 | 3.1M | |
![[ ]](/icons/layout.gif) | All keyboard shortcuts for data scientist (1).pdf | 2022-10-28 11:30 | 3.1M | |
![[ ]](/icons/layout.gif) | Python Pocket Reference.pdf | 2022-10-20 06:01 | 3.2M | |
![[ ]](/icons/layout.gif) | Bash Cookbook 1st edition .pdf | 2022-10-20 06:04 | 3.2M | |
![[ ]](/icons/layout.gif) | Data Preparation for Machine Learning (SafefilekU.com).pdf | 2022-10-28 11:31 | 3.2M | |
![[ ]](/icons/layout.gif) | Data_Science_John_D_Kelleher,_Brendan_Tierney_The_MIT_Press,_2018.pdf | 2022-10-29 07:23 | 3.2M | |
![[ ]](/icons/layout.gif) | CS8075_Data_Warehousing_and_Data_Mining_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:23 | 3.2M | |
![[ ]](/icons/layout.gif) | 50 shades of JavaScript.pdf | 2022-10-21 09:55 | 3.3M | |
![[ ]](/icons/layout.gif) | Web security for developers - malcolm mcdonald.pdf | 2022-10-29 09:54 | 3.3M | |
![[ ]](/icons/layout.gif) | DATA STRUCTURE CLASS NOTES.pdf | 2022-10-28 09:47 | 3.3M | |
![[ ]](/icons/layout.gif) | Machine Learning With Python Tutorial.pdf | 2022-10-20 06:11 | 3.4M | |
![[ ]](/icons/layout.gif) | machine_learning_with_python_tutorial.pdf | 2022-10-29 07:37 | 3.4M | |
![[ ]](/icons/layout.gif) | the-pinnacle-of-sacrifice-volume-2-ponniyin-selvan-part-5.pdf | 2022-10-20 09:22 | 3.4M | |
![[ ]](/icons/layout.gif) | Python for Unix and Linux System Administration (2008).pdf | 2022-10-20 05:41 | 3.4M | |
![[ ]](/icons/layout.gif) | DSA .pdf | 2022-11-01 06:13 | 3.4M | |
![[ ]](/icons/layout.gif) | Machine Learning CheatSheet.pdf | 2022-10-29 07:26 | 3.4M | |
![[ ]](/icons/layout.gif) | vue_on_rails.pdf | 2022-10-21 09:55 | 3.5M | |
![[ ]](/icons/layout.gif) | data_mining-arun_k_pujari.pdf | 2022-11-09 06:40 | 3.5M | |
![[ ]](/icons/layout.gif) | Python for Data Science Book.pdf | 2022-10-29 07:29 | 3.5M | |
![[ ]](/icons/layout.gif) | Python_Programming_and_Numerical_Methods_A_Guide_for_Engineers_and.pdf | 2022-10-29 07:22 | 3.5M | |
![[ ]](/icons/layout.gif) | SOFTWARE Engineering CLASS NOTES.pdf | 2022-10-28 09:48 | 3.6M | |
![[ ]](/icons/layout.gif) | 50++ Most Important Java Questions.pdf | 2022-11-01 06:10 | 3.6M | |
![[ ]](/icons/layout.gif) | Clean Code.pdf | 2022-10-20 06:05 | 3.6M | |
![[ ]](/icons/layout.gif) | The Principles of Object-Oriented JavaScript.pdf | 2022-10-20 05:45 | 3.6M | |
![[ ]](/icons/layout.gif) | Evaluation of Machine Learning Models.pdf | 2022-10-29 07:44 | 3.7M | |
![[ ]](/icons/layout.gif) | Power_System_Engineering_Planning,_Design,_and_Operation_of_Power.pdf | 2022-10-29 07:11 | 3.7M | |
![[ ]](/icons/layout.gif) | OpenCV_Computer_Vision_with_Python_Learn_to_capture_videos,_manipulate.pdf | 2022-10-29 07:23 | 3.7M | |
![[ ]](/icons/layout.gif) | Building Mobile Applications with Java.pdf | 2022-10-20 05:41 | 3.8M | |
![[ ]](/icons/layout.gif) | Computer Organisation.pdf | 2022-10-28 09:48 | 3.8M | |
![[ ]](/icons/layout.gif) | Python_in_Practice.pdf | 2022-10-29 07:44 | 3.8M | |
![[ ]](/icons/layout.gif) | react-from-zero-book-r3.pdf | 2022-10-21 09:54 | 3.8M | |
![[ ]](/icons/layout.gif) | Introduction to Machine Learnin.pdf | 2022-10-29 07:38 | 3.9M | |
![[ ]](/icons/layout.gif) | hacking_how_to_hack_like_a_pro.pdf | 2022-10-20 06:12 | 3.9M | |
![[ ]](/icons/layout.gif) | The Tangled Web [Michal Zalewski_November 2011, 320 pp].pdf | 2022-10-20 06:03 | 4.0M | |
![[ ]](/icons/layout.gif) | The Good Parts of AWS.pdf | 2022-10-21 09:53 | 4.0M | |
![[ ]](/icons/layout.gif) | real world bug hunting.pdf | 2022-10-20 05:53 | 4.0M | |
![[ ]](/icons/layout.gif) | Machine_Learning_andrewng.pdf | 2022-10-29 07:29 | 4.0M | |
![[ ]](/icons/layout.gif) | Graph Theory.pdf | 2022-10-28 09:48 | 4.0M | |
![[ ]](/icons/layout.gif) | DBMS CLASS NOTES.pdf | 2022-10-28 09:48 | 4.0M | |
![[ ]](/icons/layout.gif) | the-beginners-guide-to-bug-bounty-programs.pdf | 2022-10-20 06:10 | 4.0M | |
![[ ]](/icons/layout.gif) | Mongodb And Python.pdf | 2022-10-20 05:53 | 4.1M | |
![[ ]](/icons/layout.gif) | Weaving the Dark Web Legitimacy on Freenet, Tor, and I2P.pdf | 2022-10-20 06:13 | 4.1M | |
![[ ]](/icons/layout.gif) | The_C_Programming_Language.pdf | 2022-10-20 06:16 | 4.1M | |
![[ ]](/icons/layout.gif) | 20 Python Libraries you aren’t using ( But Should ).pdf | 2022-10-29 07:26 | 4.1M | |
![[ ]](/icons/layout.gif) | 20 python libraries you arent using but should.pdf | 2022-10-20 05:55 | 4.1M | |
![[ ]](/icons/layout.gif) | bug-bounty-field-manual.pdf | 2022-10-20 06:10 | 4.1M | |
![[ ]](/icons/layout.gif) | The Android Game Developer’s Handbook.pdf | 2022-10-20 06:08 | 4.2M | |
![[ ]](/icons/layout.gif) | Java (tutorials point).pdf | 2022-10-20 05:55 | 4.3M | |
![[ ]](/icons/layout.gif) | Python 3 Object-Oriented programming.pdf | 2022-10-20 05:45 | 4.3M | |
![[ ]](/icons/layout.gif) | Cybersecurity_Threats,_Malware_Trends,_and_Strategies_Mitigate_exploits.pdf | 2022-10-20 06:12 | 4.3M | |
![[ ]](/icons/layout.gif) | IOT_TEC_ Manual.pdf | 2022-10-28 10:39 | 4.3M | |
![[ ]](/icons/layout.gif) | Distributed Machine Learning with Pytho.pdf | 2022-10-29 07:29 | 4.4M | |
![[ ]](/icons/layout.gif) | Java_3D_Programming.pdf | 2022-10-20 05:55 | 4.4M | |
![[ ]](/icons/layout.gif) | CS8079_Human_Computer_Interaction_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:22 | 4.4M | |
![[ ]](/icons/layout.gif) | Software Engineering.pdf | 2022-10-28 09:48 | 4.5M | |
![[ ]](/icons/layout.gif) | Pattern Recognition and Machine Learning.pdf | 2022-10-29 07:27 | 4.5M | |
![[ ]](/icons/layout.gif) | The Basics of Hacking and Penetration Testing.pdf | 2022-10-20 06:01 | 4.5M | |
![[ ]](/icons/layout.gif) | The Cloud Data Lake.pdf | 2022-11-14 03:43 | 4.5M | |
![[ ]](/icons/layout.gif) | Machine_Learning_with_Python_Cookbook_Practical_Solutions_from_Preprocessing.pdf | 2022-10-29 07:25 | 4.6M | |
![[ ]](/icons/layout.gif) | Machine_Learning_Fundamentals_A_Concise_Introduction_Hui_Jiang.pdf | 2022-10-29 07:29 | 4.6M | |
![[ ]](/icons/layout.gif) | Python Algorithms.pdf | 2022-10-20 06:07 | 4.6M | |
![[ ]](/icons/layout.gif) | Absolute FreeBSD [Michael_Oct 2018, 704 pp].pdf | 2022-10-20 06:06 | 4.7M | |
![[ ]](/icons/layout.gif) | iOS Hackers Handbook.pdf | 2022-10-20 05:46 | 4.7M | |
![[ ]](/icons/layout.gif) | Practical_Machine_Learning_and_Image_Processing_For_Facial_Recognition.pdf | 2022-10-29 07:23 | 4.8M | |
![[ ]](/icons/layout.gif) | GE8071_Disaster_Management_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 05:38 | 4.8M | |
![[ ]](/icons/layout.gif) | How To Code In Python.pdf | 2022-10-20 06:10 | 4.8M | |
![[ ]](/icons/layout.gif) | 167. UsingMatlab_Simulink.pdf | 2022-11-01 06:06 | 4.8M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201202.pdf | 2022-10-20 06:12 | 4.9M | |
![[ ]](/icons/layout.gif) | Practical SQL A Beginner’s Guide.pdf | 2022-10-29 07:27 | 5.0M | |
![[ ]](/icons/layout.gif) | Data_Science_from_Scratch_First_Principles_with_Python_by_Joel_Grus.pdf | 2022-10-20 06:14 | 5.0M | |
![[ ]](/icons/layout.gif) | 29 AndhraNadu-4.pdf | 2022-10-29 06:47 | 5.0M | |
![[ ]](/icons/layout.gif) | OCE552_Geographic_Information_System_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:38 | 5.1M | |
![[ ]](/icons/layout.gif) | @ASM_Bookzz SQL QuickStart Guide The Simplified Beginner .pdf | 2022-10-20 06:56 | 5.1M | |
![[ ]](/icons/layout.gif) | Hash Crack Password Cracking (v2).pdf | 2022-10-20 06:15 | 5.1M | |
![[ ]](/icons/layout.gif) | Gareth_Dwyer_Flask_By_Example__Unleash.pdf | 2022-10-29 09:54 | 5.1M | |
![[ ]](/icons/layout.gif) | getting-started-v-programming.pdf | 2022-10-21 09:55 | 5.1M | |
![[ ]](/icons/layout.gif) | HS8251_Technical_English_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 05:39 | 5.2M | |
![[ ]](/icons/layout.gif) | A Bug Hunter's Diary [Tobias Klein_November 2011,208 pp].pdf | 2022-10-20 06:10 | 5.2M | |
![[ ]](/icons/layout.gif) | Hacking VoIP [Himanshu Dwivedi_October 2008, 232 pp].pdf | 2022-10-20 06:02 | 5.2M | |
![[ ]](/icons/layout.gif) | Natural_Language_Processing_with_Python_by_Steven_Bird,_Ewan_Klein (2).pdf | 2022-10-29 07:26 | 5.2M | |
![[ ]](/icons/layout.gif) | Natural_Language_Processing_with_Python_by_Steven_Bird,_Ewan_Klein.pdf | 2022-10-29 07:24 | 5.2M | |
![[ ]](/icons/layout.gif) | Think Java - How to Think Like a Computer Scientist (2016).pdf | 2022-10-20 05:44 | 5.2M | |
![[ ]](/icons/layout.gif) | Python_3_for_Machine_Learning_Oswald_Campesato_Mercury_Learning.pdf | 2022-10-29 07:23 | 5.3M | |
![[ ]](/icons/layout.gif) | Machine learning .pdf | 2022-10-29 07:26 | 5.3M | |
![[ ]](/icons/layout.gif) | Butcher M., Farina M. - Go in Practice - 2016.pdf | 2022-10-21 09:53 | 5.3M | |
![[ ]](/icons/layout.gif) | OMF751_Lean_Six_Sigma_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 05:38 | 5.3M | |
![[ ]](/icons/layout.gif) | Theory of Computation_2.pdf | 2022-10-28 09:47 | 5.3M | |
![[ ]](/icons/layout.gif) | Flask_Web_Development_Developing_Web_Applications_with_Python_PDFDrive.pdf | 2022-10-20 05:55 | 5.4M | |
![[ ]](/icons/layout.gif) | HackingThe Unlocking of Transparency Security is a myth….pdf | 2022-10-20 05:56 | 5.4M | |
![[ ]](/icons/layout.gif) | Introduction_to_algorithms-3rd Edition.pdf | 2022-10-28 09:47 | 5.4M | |
![[ ]](/icons/layout.gif) | MachineLearningR__Brett_Lantz.pdf | 2022-10-28 11:31 | 5.4M | |
![[ ]](/icons/layout.gif) | Pro_Android_with_Kotlin_Developing_Modern_Mobile_Apps_by_Peter_Späth.pdf | 2022-10-20 06:14 | 5.4M | |
![[ ]](/icons/layout.gif) | Theory Of Computation.pdf | 2022-10-28 09:48 | 5.5M | |
![[ ]](/icons/layout.gif) | Hash Crack Password Cracking.pdf | 2022-10-20 06:15 | 5.5M | |
![[ ]](/icons/layout.gif) | Data Science from Scratch- First Principles with Python.pdf | 2022-10-29 07:25 | 5.6M | |
![[ ]](/icons/layout.gif) | Build_An_Html5_Game_A_Developers_Guide_With_Css_And_Javascript.pdf | 2022-10-20 05:53 | 5.6M | |
![[ ]](/icons/layout.gif) | John_E_Hopcroft,_Rajeev_Motwani,_Jeffrey_D_Ullman_Introduction_to.pdf | 2022-11-09 06:40 | 5.7M | |
![[ ]](/icons/layout.gif) | The Art of Clean Code.pdf | 2022-10-28 11:30 | 5.7M | |
![[ ]](/icons/layout.gif) | Silence On The Wire.pdf | 2022-10-20 06:01 | 5.9M | |
![[ ]](/icons/layout.gif) | Penetration testing with the bash shell.pdf | 2022-10-20 05:52 | 5.9M | |
![[ ]](/icons/layout.gif) | Approach To Real Hacking World By Probotisop.pdf | 2022-10-20 06:10 | 6.0M | |
![[ ]](/icons/layout.gif) | bash Cookbook 2nd edition.pdf | 2022-10-20 06:04 | 6.0M | |
![[ ]](/icons/layout.gif) | Instrumentation_and_Measurement_in_Electrical_Engineering_by_Roman.pdf | 2022-10-29 07:11 | 6.1M | |
![[ ]](/icons/layout.gif) | Nmap full guide to network scanning.pdf | 2022-10-20 05:53 | 6.1M | |
![[ ]](/icons/layout.gif) | Introduction to Machine Learning.pdf | 2022-10-29 07:26 | 6.1M | |
![[ ]](/icons/layout.gif) | Dayle_Rees_PHP_Pandas_The_PHP_Programming_Language_for_Everyon_Leanpub.pdf | 2022-10-21 09:54 | 6.1M | |
![[ ]](/icons/layout.gif) | Python Power - The Comprehensive Guide (2008).pdf | 2022-10-20 05:41 | 6.1M | |
![[ ]](/icons/layout.gif) | Thoughtful Machine Learning.pdf | 2022-10-29 07:26 | 6.2M | |
![[ ]](/icons/layout.gif) | Hacking and securing ios applications.pdf | 2022-10-20 05:53 | 6.2M | |
![[ ]](/icons/layout.gif) | Mastering Numerical Computing With NumPy.pdf | 2022-10-28 11:30 | 6.2M | |
![[ ]](/icons/layout.gif) | Computer Hacking Beginners Guide.pdf | 2022-10-20 06:07 | 6.2M | |
![[ ]](/icons/layout.gif) | Bayesian_Statistics_The_Fun_Way_Understanding_Statistics_And_Probability.pdf | 2022-10-29 07:23 | 6.3M | |
![[ ]](/icons/layout.gif) | dr-ruchi-doshi-machine-learning-master-supervised-and.pdf | 2022-10-28 11:28 | 6.3M | |
![[ ]](/icons/layout.gif) | Java Collection Framework Hands Written notes .pdf | 2022-11-01 06:11 | 6.3M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch-Quick-Start-Guide (1).pdf | 2022-10-29 07:26 | 6.4M | |
![[ ]](/icons/layout.gif) | Learn HTML 5 by creating fun games.pdf | 2022-10-20 05:53 | 6.4M | |
![[ ]](/icons/layout.gif) | C++ Crash Course_A Fast-Paced Introduction.pdf | 2022-10-20 06:09 | 6.4M | |
![[ ]](/icons/layout.gif) | OPERATING SYSTEM.pdf | 2022-10-28 09:48 | 6.5M | |
![[ ]](/icons/layout.gif) | Hacking Exposed.pdf | 2022-10-20 05:53 | 6.5M | |
![[ ]](/icons/layout.gif) | Doing Math With Python [Amit Saha_August 2015, 264 pp].pdf | 2022-10-20 06:03 | 6.5M | |
![[ ]](/icons/layout.gif) | Reliable Machine Learning.pdf | 2022-11-14 03:43 | 6.7M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence 79.pdf | 2022-10-28 11:31 | 6.7M | |
![[ ]](/icons/layout.gif) | 2nd.Python Crash Course.pdf | 2022-10-20 05:40 | 6.7M | |
![[ ]](/icons/layout.gif) | Eric_Matthes_Python_Crash_Course_A_Hands_On,_Project_Based_Introduction.pdf | 2022-10-29 07:23 | 6.7M | |
![[ ]](/icons/layout.gif) | Gant_Laborde_Learning_Tensorflow_js_Powerful_Machine_Learning_in.pdf | 2022-10-29 07:25 | 6.7M | |
![[ ]](/icons/layout.gif) | project management a managerial approach-7th-ed.pdf | 2022-10-28 11:17 | 6.7M | |
![[ ]](/icons/layout.gif) | Building_Android_Apps_in_Python_Using_Kivy_with_Android_Studio_With.pdf | 2022-10-20 06:14 | 6.8M | |
![[ ]](/icons/layout.gif) | GE8075_Intellectual_Property_Rights_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:38 | 6.8M | |
![[ ]](/icons/layout.gif) | Software Engineering Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 6.8M | |
![[ ]](/icons/layout.gif) | Machine Learning with TensorFlow ( PDFDrive ).pdf | 2022-10-29 07:34 | 6.8M | |
![[ ]](/icons/layout.gif) | betterflutter.pdf | 2022-10-21 09:53 | 6.8M | |
![[ ]](/icons/layout.gif) | CS8494_Software_Engineering_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-10-20 06:19 | 6.9M | |
![[ ]](/icons/layout.gif) | Introduction_to_Data_Science_A_Python.pdf | 2022-10-29 07:22 | 6.9M | |
![[ ]](/icons/layout.gif) | Game Hacking [Nick Cano__July 2016, 304 pp].pdf | 2022-10-20 05:54 | 6.9M | |
![[ ]](/icons/layout.gif) | GE8072_Foundation_Skills_in_Integrated_Product_Development_Ripped.pdf | 2022-10-20 05:38 | 6.9M | |
![[ ]](/icons/layout.gif) | Metasploit [David Kennedy & others_July 2011, 328 pp].pdf | 2022-10-20 05:53 | 6.9M | |
![[ ]](/icons/layout.gif) | The Hundred-Page Machine Learning Book (Andriy Burkov).pdf | 2022-10-21 09:53 | 7.0M | |
![[ ]](/icons/layout.gif) | Think Like A Programmer [V. Anton_August 2012, 256 pp].pdf | 2022-10-20 05:55 | 7.0M | |
![[ ]](/icons/layout.gif) | cyberjutsu_cybersecurity_for_the_modern_ninja_1nbsped_9781718500549.pdf | 2022-10-20 05:40 | 7.1M | |
![[ ]](/icons/layout.gif) | Numerical Methods in Engineering with Python (2005).pdf | 2022-10-20 05:41 | 7.1M | |
![[ ]](/icons/layout.gif) | Data Science from Scratch.pdf | 2022-10-29 07:23 | 7.1M | |
![[ ]](/icons/layout.gif) | MACHINE_LEARNING_FOR_FINANCE @computer_books.pdf | 2022-10-29 07:37 | 7.1M | |
![[ ]](/icons/layout.gif) | The morden web.pdf | 2022-10-20 05:52 | 7.2M | |
![[ ]](/icons/layout.gif) | Advanced_Microcontroller_Harish_G_Narula,_Khushboo_Shah_z_lib_org.pdf | 2022-10-22 07:27 | 7.2M | |
![[ ]](/icons/layout.gif) | Professional_Ethics_and_Human_Values_by_R_S_NAAGARAZAN_By_EasyEngineering.pdf | 2022-10-28 10:38 | 7.3M | |
![[ ]](/icons/layout.gif) | Statistics Done Wrong [Alex_March 2015, 176 pp].pdf | 2022-10-20 06:05 | 7.3M | |
![[ ]](/icons/layout.gif) | DAAandDS.pdf | 2022-10-28 09:47 | 7.4M | |
![[ ]](/icons/layout.gif) | Hands-On Programming with R.pdf | 2022-10-28 11:30 | 7.4M | |
![[ ]](/icons/layout.gif) | A Guide to MATLAB.pdf | 2022-10-28 11:16 | 7.5M | |
![[ ]](/icons/layout.gif) | Learning Robotics using Python 1st.pdf | 2022-10-20 06:03 | 7.5M | |
![[ ]](/icons/layout.gif) | Machine learning mastery with Weka.pdf | 2022-10-28 11:31 | 7.5M | |
![[ ]](/icons/layout.gif) | ML Cheatsheets.pdf | 2022-10-28 11:32 | 7.6M | |
![[ ]](/icons/layout.gif) | Cracking_Codes_with_Python_An_Introduction_to_Building_and_Breaking.pdf | 2022-10-20 05:52 | 7.6M | |
![[ ]](/icons/layout.gif) | Network security hacks.pdf | 2022-10-20 05:52 | 7.6M | |
![[ ]](/icons/layout.gif) | TheHackersHardwareToolkit.pdf | 2022-10-20 05:53 | 7.7M | |
![[ ]](/icons/layout.gif) | Deep Learning for Search.pdf | 2022-10-28 11:30 | 7.7M | |
![[ ]](/icons/layout.gif) | CS8091_Big_Data_Analytics_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 06:21 | 7.7M | |
![[ ]](/icons/layout.gif) | Deploying nodejs.pdf | 2022-10-20 05:51 | 7.7M | |
![[ ]](/icons/layout.gif) | The_MathWorks,_Inc_MATLAB_Deep_Learning_HDL_Toolbox_UG_The_MathWorks.pdf | 2022-10-29 07:30 | 7.7M | |
![[ ]](/icons/layout.gif) | Advanced Topics in Java.pdf | 2022-10-20 05:41 | 7.7M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_3_Zero_To_SysAdmin_Network.pdf | 2022-10-20 06:13 | 7.9M | |
![[ ]](/icons/layout.gif) | Beginning Ethical Hacking with Kali Linux...pdf | 2022-10-20 06:10 | 8.0M | |
![[ ]](/icons/layout.gif) | Beginning_Ethical_Hacking_with.pdf | 2022-10-20 05:42 | 8.0M | |
![[ ]](/icons/layout.gif) | The Essential Guide to HTML5_2nd edition.pdf | 2022-10-20 06:10 | 8.1M | |
![[ ]](/icons/layout.gif) | 2. Computer-Networks-5th-Edition.pdf | 2022-11-09 06:40 | 8.1M | |
![[ ]](/icons/layout.gif) | WorkBook_C_DS_Algorithms_Made Easy.pdf | 2022-10-28 09:47 | 8.2M | |
![[ ]](/icons/layout.gif) | William S. Vincent - Django for Beginners 3.1-leanpub (2020).pdf | 2022-10-21 09:54 | 8.2M | |
![[ ]](/icons/layout.gif) | Android_Security_Internals.pdf | 2022-10-20 05:53 | 8.2M | |
![[ ]](/icons/layout.gif) | Learning Scrapy.pdf | 2022-10-20 06:08 | 8.2M | |
![[ ]](/icons/layout.gif) | CS8087_Software_Defined_Networks_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:22 | 8.2M | |
![[ ]](/icons/layout.gif) | Data_Engineering_with_Google_Cloud_Platform_A_practical_guide_to.pdf | 2022-10-29 07:29 | 8.2M | |
![[ ]](/icons/layout.gif) | CS8392_Object_Oriented_Programming_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:20 | 8.3M | |
![[ ]](/icons/layout.gif) | Computer_Networking_A_Top-Down_Approach.pdf | 2022-10-28 09:47 | 8.3M | |
![[ ]](/icons/unknown.gif) | Fake_News_Detection_Machine_learning_project.rar | 2022-10-29 07:23 | 8.3M | |
![[ ]](/icons/layout.gif) | COMPUTER ORGANIZATION CLASS NOTES.pdf | 2022-10-28 09:48 | 8.3M | |
![[ ]](/icons/layout.gif) | Advanced Git 1Ed.pdf | 2022-10-21 09:54 | 8.4M | |
![[ ]](/icons/layout.gif) | IT8075_Software_Project_Management_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:39 | 8.4M | |
![[ ]](/icons/layout.gif) | Designing BSD rootkit.pdf | 2022-10-20 05:54 | 8.4M | |
![[ ]](/icons/layout.gif) | Advanced Git Understanding Git Collaboration Workflows.pdf | 2022-10-21 09:55 | 8.4M | |
![[ ]](/icons/layout.gif) | Neural Network & Learning Machines _haykin.3ed.2009.pdf | 2022-10-28 11:15 | 8.4M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence Programming.pdf | 2022-10-29 07:37 | 8.5M | |
![[ ]](/icons/layout.gif) | build-api-laravel-thomas-norgaard.pdf | 2022-10-21 09:55 | 8.5M | |
![[ ]](/icons/layout.gif) | Reversing secrets of reverse engineering by Eldad Eilam.pdf | 2022-10-20 06:15 | 8.6M | |
![[ ]](/icons/layout.gif) | Jump start HTML 5.pdf | 2022-10-20 05:53 | 8.6M | |
![[ ]](/icons/layout.gif) | SEO Warrior .pdf | 2022-10-20 06:07 | 8.7M | |
![[ ]](/icons/layout.gif) | FreeBSD Device Drivers [Joseph Kong_May 2012, 352 pp].pdf | 2022-10-20 06:08 | 8.7M | |
![[ ]](/icons/layout.gif) | Building Telegram Bots.pdf | 2022-10-20 06:12 | 8.7M | |
![[ ]](/icons/layout.gif) | building-telegram-bots.pdf | 2022-10-21 09:55 | 8.7M | |
![[ ]](/icons/layout.gif) | Time Series Forecasting using Deep).pdf | 2022-10-29 07:38 | 8.8M | |
![[ ]](/icons/layout.gif) | Compiler Design-CS.pdf | 2022-10-28 09:47 | 8.8M | |
![[ ]](/icons/layout.gif) | Bug Bounty Hunting For Web Security.pdf | 2022-10-20 06:09 | 8.8M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 3.pdf | 2022-10-20 06:15 | 9.0M | |
![[ ]](/icons/layout.gif) | Machine-Learning-With-Python-For-Everyone-Pearson-2020.pdf | 2022-10-29 07:26 | 9.0M | |
![[ ]](/icons/layout.gif) | Machine Learning with Python for Everyone.pdf | 2022-10-29 07:26 | 9.0M | |
![[ ]](/icons/layout.gif) | Android Hacker's Handbook.pdf | 2022-10-20 06:07 | 9.0M | |
![[ ]](/icons/layout.gif) | The Art of Debugging [Norman & others Sept 2008, 280 pp].pdf | 2022-10-20 05:55 | 9.1M | |
![[ ]](/icons/layout.gif) | COMPUTER ORG CLASS NOTES.pdf | 2022-10-28 09:48 | 9.1M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence.pdf | 2022-10-28 11:31 | 9.2M | |
![[ ]](/icons/layout.gif) | 2ed The Book of CSS3 (2014, No Starch Press).pdf | 2022-10-20 06:09 | 9.2M | |
![[ ]](/icons/layout.gif) | Practical Malware Analysis.pdf | 2022-10-20 06:03 | 9.3M | |
![[ ]](/icons/layout.gif) | Programming Your Home.pdf | 2022-10-28 11:17 | 9.3M | |
![[ ]](/icons/layout.gif) | Advancing_into_Analytics_From_Excel_to_Python_and_R_George_Mount.pdf | 2022-10-29 07:29 | 9.5M | |
![[ ]](/icons/layout.gif) | JavaScript Web Applications.pdf | 2022-10-20 06:07 | 9.5M | |
![[ ]](/icons/layout.gif) | Practical_Computer_Vision_Applications_Using_Deep.pdf | 2022-10-29 07:38 | 9.6M | |
![[ ]](/icons/layout.gif) | Mastering_Machine_Learning_with_Python_in_Six_Steps_A_Practical.pdf | 2022-10-29 07:29 | 9.6M | |
![[ ]](/icons/layout.gif) | tomas-beuzen-python-packages-chapman-hall-crc-the.pdf | 2022-10-28 11:30 | 9.6M | |
![[ ]](/icons/layout.gif) | React Quickly 2nd Edition MEAP5.pdf | 2022-10-21 09:53 | 9.6M | |
![[ ]](/icons/layout.gif) | Building.Blockchain.Apps.pdf | 2022-10-21 09:53 | 9.6M | |
![[ ]](/icons/layout.gif) | MySQL for the Internet of Things.pdf | 2022-10-20 06:10 | 9.7M | |
![[ ]](/icons/layout.gif) | Spark_The_Definitive_Guide_Big_Data_Processing_Made_Simple_Bill.pdf | 2022-10-29 07:39 | 9.7M | |
![[ ]](/icons/layout.gif) | Web security testing guide.pdf | 2022-10-20 06:10 | 9.7M | |
![[ ]](/icons/layout.gif) | Python Machine Learning.pdf | 2022-10-20 05:45 | 9.7M | |
![[ ]](/icons/layout.gif) | Efficient Methods for DL.pdf | 2022-10-28 11:30 | 9.7M | |
![[ ]](/icons/layout.gif) | Efficient methods for deep learning .pdf | 2022-11-01 05:03 | 9.7M | |
![[ ]](/icons/layout.gif) | Nader_F_Mir_Computer_and_Communication_Networks_Prentice_Hall_2006.pdf | 2022-10-28 11:15 | 9.7M | |
![[ ]](/icons/layout.gif) | Python by Example Learning to Program in 150 Challenges.pdf | 2022-10-20 06:10 | 9.8M | |
![[ ]](/icons/layout.gif) | CEH v8_Certified Ethical Hacker version 8 study guide.pdf | 2022-10-20 06:10 | 9.8M | |
![[ ]](/icons/layout.gif) | CS8085_Social_Network_Analysis_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:22 | 9.8M | |
![[ ]](/icons/layout.gif) | The Essential Guide to HTML5.pdf | 2022-10-20 06:10 | 9.9M | |
![[ ]](/icons/layout.gif) | Advanced Penetration Testing.pdf | 2022-10-20 06:07 | 9.9M | |
![[ ]](/icons/layout.gif) | _Network_protection_&_automation_guide.pdf | 2022-10-28 11:16 | 9.9M | |
![[ ]](/icons/layout.gif) | Sommerville-Software-Engineering-10ed.pdf | 2022-11-09 06:40 | 10M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms in Java, 6th Edition.pdf | 2022-10-20 05:41 | 10M | |
![[ ]](/icons/layout.gif) | Arduino_Workshop.pdf | 2022-10-20 06:03 | 10M | |
![[ ]](/icons/layout.gif) | Adversarial Robustness for Machine).pdf | 2022-10-28 11:31 | 10M | |
![[ ]](/icons/layout.gif) | Raspberry_Pi_Cookbook_Software_and_Hardware_Problems_and_Solutions.pdf | 2022-10-20 06:03 | 10M | |
![[ ]](/icons/layout.gif) | CS8080_Information_Retrieval_Technique_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:22 | 10M | |
![[ ]](/icons/layout.gif) | thebook_ Introduction to Machine Learning.pdf | 2022-10-29 07:27 | 10M | |
![[ ]](/icons/layout.gif) | Webbots, Spiders, and Screen Scrapers.pdf | 2022-10-20 06:08 | 10M | |
![[ ]](/icons/layout.gif) | Algorithms_for_Data_Science_by_Brian_Steele,_John_Chandler,_Swarna.pdf | 2022-10-20 06:14 | 10M | |
![[ ]](/icons/layout.gif) | Continuous Machine Learning with Kube.).pdf | 2022-10-28 11:30 | 10M | |
![[ ]](/icons/layout.gif) | Beginning_Programming_with_Python.pdf | 2022-10-28 11:30 | 10M | |
![[ ]](/icons/layout.gif) | COMPUTER NETWORKS CLASS NOTES.pdf | 2022-10-28 09:47 | 10M | |
![[ ]](/icons/layout.gif) | vuejs_in_action.pdf | 2022-10-21 09:53 | 10M | |
![[ ]](/icons/layout.gif) | Interpretable Machine Learning with Python (SafefilekU.com).pdf | 2022-10-31 03:30 | 11M | |
![[ ]](/icons/layout.gif) | Computer Architecture.pdf | 2022-10-28 09:48 | 11M | |
![[ ]](/icons/layout.gif) | Hacking_The_Practical_Guide_to_Become_a_Hacker_Field_Manual_for.pdf | 2022-10-20 06:13 | 11M | |
![[ ]](/icons/layout.gif) | PYTHON_PYTHON'S_COMPANION,_A_STEP_BY_STEP_GUIDE_FOR_BEGINNERS_TO.pdf | 2022-10-20 06:06 | 11M | |
![[ ]](/icons/layout.gif) | Step by Step Guide to Python (en).pdf | 2022-10-28 11:30 | 11M | |
![[ ]](/icons/layout.gif) | 2nd_Python Machine Learning.pdf | 2022-10-20 05:45 | 11M | |
![[ ]](/icons/layout.gif) | Practical Forensic Imaging [Bruce_Sep 2016, 320 pp].pdf | 2022-10-20 06:06 | 11M | |
![[ ]](/icons/layout.gif) | Intro_to_Python_forComputer_Science_and_Data_Science_Learning_to.pdf | 2022-10-20 06:13 | 11M | |
![[ ]](/icons/layout.gif) | Hacking__Hacking_Practical_Gui.pdf | 2022-10-20 05:42 | 11M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Deep_Learning,_2nd_Edition_Fourth_Early_Release.pdf | 2022-10-29 07:30 | 11M | |
![[ ]](/icons/layout.gif) | 1. DCN BOOK.pdf | 2022-11-09 06:41 | 11M | |
![[ ]](/icons/layout.gif) | StatisticsMachineLearningPython.pdf | 2022-10-29 07:27 | 11M | |
![[ ]](/icons/layout.gif) | OOPS NOTES CURATED BY SAMEER RAZA.pdf | 2022-11-01 06:11 | 11M | |
![[ ]](/icons/layout.gif) | 100 Days of Machine Learning.pdf | 2022-10-29 07:26 | 11M | |
![[ ]](/icons/layout.gif) | Python-Scripting-for-ArcGIS.pdf | 2022-10-20 06:12 | 11M | |
![[ ]](/icons/layout.gif) | Hacking_for_Dummies.pdf | 2022-10-20 05:43 | 11M | |
![[ ]](/icons/layout.gif) | Hacking for Dummies, 6th Edition ( PDFDrive.com ).pdf | 2022-10-20 06:01 | 11M | |
![[ ]](/icons/layout.gif) | Create Graphical User _Interfaces with Python.pdf | 2022-10-20 05:40 | 11M | |
![[ ]](/icons/layout.gif) | ObjectOrientedPython.pdf | 2022-10-21 09:55 | 11M | |
![[ ]](/icons/layout.gif) | Java_Programming.pdf | 2022-10-20 05:41 | 11M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_2_Zero_To_SysAdmin_Advanced.pdf | 2022-10-20 06:13 | 11M | |
![[ ]](/icons/layout.gif) | Building Tools with GitHub.pdf | 2022-10-20 06:07 | 11M | |
![[ ]](/icons/layout.gif) | 1st_Practical Packet Analysis [Chris_2007 ,164 pp].pdf | 2022-10-20 06:01 | 11M | |
![[ ]](/icons/layout.gif) | react-d3v4_1.pdf | 2022-10-21 09:55 | 12M | |
![[ ]](/icons/layout.gif) | Phishing Dark Waters.pdf | 2022-10-20 06:12 | 12M | |
![[ ]](/icons/layout.gif) | Python_Basics__A_Self_Teaching.pdf | 2022-10-20 06:15 | 12M | |
![[ ]](/icons/layout.gif) | John_Larsen_Get_Programming_with_javascript_Manning_Publications.pdf | 2022-10-21 09:55 | 12M | |
![[ ]](/icons/layout.gif) | Data Science Bookcamp Ten Python projects.pdf | 2022-10-28 11:31 | 12M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence and Machine Learning .pdf | 2022-10-29 07:38 | 12M | |
![[ ]](/icons/layout.gif) | Machine_Learning_For_Dummies_by_John_Paul_Mueller,_Luca_Massaron.pdf | 2022-10-29 07:25 | 12M | |
![[ ]](/icons/layout.gif) | CS8492_Database_Management_Systems_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:19 | 12M | |
![[ ]](/icons/layout.gif) | Python Playground [Mahesh_October 2015, 352 pp].pdf | 2022-10-20 06:03 | 12M | |
![[ ]](/icons/layout.gif) | Deep Learning Illustrated A Visual.pdf | 2022-10-28 11:30 | 12M | |
![[ ]](/icons/layout.gif) | ComputerNetworks.pdf | 2022-10-28 09:47 | 12M | |
![[ ]](/icons/layout.gif) | Practical Video Game Bots.pdf | 2022-10-20 05:44 | 12M | |
![[ ]](/icons/layout.gif) | The_Morgan_Kaufmann_Series_in_Data_Management_Systems_Jiawei_Han.pdf | 2022-11-09 06:40 | 12M | |
![[ ]](/icons/layout.gif) | 3ed_Gray Hat Hacking.pdf | 2022-10-20 06:12 | 12M | |
![[ ]](/icons/layout.gif) | stateinflutter.pdf | 2022-10-21 09:53 | 12M | |
![[ ]](/icons/layout.gif) | Operating system new.pdf | 2022-10-28 09:48 | 12M | |
![[ ]](/icons/layout.gif) | OperatingSystems.pdf | 2022-10-28 09:48 | 12M | |
![[ ]](/icons/layout.gif) | Penetration testing [Georgia Weidman_June 2014, 528 pp].pdf | 2022-10-20 06:03 | 12M | |
![[ ]](/icons/layout.gif) | LEARNING_SOCIAL_MEDIA_ANALYTICS_WITH_R @computer_books.pdf | 2022-10-29 07:37 | 12M | |
![[ ]](/icons/layout.gif) | Hands on Hacking.pdf | 2022-10-20 06:08 | 12M | |
![[ ]](/icons/layout.gif) | Python Pandas for Beginners Pandas Specialization for Data.pdf | 2022-10-29 07:26 | 12M | |
![[ ]](/icons/layout.gif) | Ben_Auffarth_Machine_Learning_for_Time_Series_with_Python_Forecast.pdf | 2022-10-29 07:26 | 12M | |
![[ ]](/icons/layout.gif) | CS8074_Cyber_Forensics_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 06:23 | 12M | |
![[ ]](/icons/layout.gif) | data-science-and-big-data-analy-nieizv_book.pdf | 2022-10-19 05:57 | 13M | |
![[ ]](/icons/layout.gif) | 2ed_Gray Hat Hacking.pdf | 2022-10-20 06:12 | 13M | |
![[ ]](/icons/layout.gif) | Python for Data Analysis.pdf | 2022-10-20 06:08 | 13M | |
![[ ]](/icons/layout.gif) | O'Reilly - Raspberry Pi Cookbook (2014)- Simon Monk.pdf | 2022-10-20 06:03 | 13M | |
![[ ]](/icons/layout.gif) | Simon_Haykin_Communication_Systems_4th_Edition_Wiley_2000.pdf | 2022-10-29 07:11 | 13M | |
![[ ]](/icons/layout.gif) | Google Advertising Tools (2nd edition).pdf | 2022-10-20 06:07 | 13M | |
![[ ]](/icons/layout.gif) | Gray hat hacking.pdf | 2022-10-20 05:52 | 13M | |
![[ ]](/icons/layout.gif) | The-Data-Engineers-Guide-to-Apache-Spark-1.pdf | 2022-10-29 07:37 | 13M | |
![[ ]](/icons/layout.gif) | Kali Linux_Wireless Penetration Testing Beginner's Guide.pdf | 2022-10-20 06:08 | 13M | |
![[ ]](/icons/layout.gif) | field-guide-to-data-science.pdf | 2022-10-28 11:31 | 13M | |
![[ ]](/icons/layout.gif) | Advanced penetration testing for highly-secured environm.pdf | 2022-10-20 05:53 | 13M | |
![[ ]](/icons/layout.gif) | wiley_a_practical_introduction_to_computer_vision_with_opencv_2014.pdf | 2022-10-29 07:23 | 13M | |
![[ ]](/icons/layout.gif) | Head First - Programming.pdf | 2022-10-21 09:53 | 13M | |
![[ ]](/icons/layout.gif) | Penetration_Testing_Azure_for_Ethical_Hackers_Develop_practical.pdf | 2022-10-20 05:40 | 13M | |
![[ ]](/icons/layout.gif) | Natural Language Processing Projects.pdf | 2022-10-28 11:30 | 13M | |
![[ ]](/icons/layout.gif) | Gray Hat C # [Brandon Perry_June 2017, 304 pp].pdf | 2022-10-20 06:01 | 13M | |
![[ ]](/icons/layout.gif) | Deep Learning Patterns and Practices.pdf | 2022-10-29 07:30 | 13M | |
![[ ]](/icons/layout.gif) | Python For Kids [Jason R. Briggs_December 2012, 344 pp].pdf | 2022-10-20 06:03 | 13M | |
![[ ]](/icons/layout.gif) | Practical_Statistics_for_Data_Scientist_by_Peter_Bruce,_Andrew_Bruce.pdf | 2022-10-20 06:13 | 13M | |
![[ ]](/icons/layout.gif) | Introduction to AI Robotics - Murphy R.R.pdf | 2022-10-19 06:14 | 14M | |
![[ ]](/icons/layout.gif) | DBMS_4.pdf | 2022-10-28 09:48 | 14M | |
![[ ]](/icons/layout.gif) | practical statistics for data scientist.pdf | 2022-10-29 07:25 | 14M | |
![[ ]](/icons/layout.gif) | The Quick Python Book (Naomi Ceder).pdf | 2022-10-28 11:30 | 14M | |
![[ ]](/icons/layout.gif) | Grokking Deep Learning by Andrew W. Trask (z-lib.org).pdf | 2022-10-29 07:24 | 14M | |
![[ ]](/icons/layout.gif) | Effective_Data_Storytelling_How_to_Drive_Change_with_Data,_Narrative.pdf | 2022-10-29 07:29 | 14M | |
![[ ]](/icons/layout.gif) | Kubeflow_for_Machine_Learning_From_Lab_to_Production_by_Trevor_Grant.pdf | 2022-10-29 07:25 | 14M | |
![[ ]](/icons/layout.gif) | Android Studio Essentials.pdf | 2022-10-20 05:41 | 14M | |
![[ ]](/icons/layout.gif) | DESIGN AND ANALYSIS OF ALGORITHMS.pdf | 2022-10-28 09:47 | 14M | |
![[ ]](/icons/layout.gif) | Python Master Python OOP Programming. ().pdf | 2022-10-28 11:31 | 14M | |
![[ ]](/icons/layout.gif) | Hacking Wireless Networks For Dummies.pdf | 2022-10-20 06:09 | 14M | |
![[ ]](/icons/layout.gif) | automatetheboringstuffwithpython.pdf | 2022-10-29 07:23 | 14M | |
![[ ]](/icons/layout.gif) | Mastering_Reverse_Engineering.pdf | 2022-10-20 05:44 | 14M | |
![[ ]](/icons/layout.gif) | Work book TOC and Compiler Design Made Easy.pdf | 2022-10-28 09:47 | 14M | |
![[ ]](/icons/layout.gif) | tshilidzi-marwala-handbook-of-machine-learning-volume.pdf | 2022-10-28 11:28 | 14M | |
![[ ]](/icons/layout.gif) | Deep Learning Masterpiece .pdf | 2022-10-29 07:29 | 14M | |
![[ ]](/icons/layout.gif) | The Machine Learning Solutions Architect handbook.pdf | 2022-10-29 07:29 | 14M | |
![[ ]](/icons/layout.gif) | Operating System-CSE.pdf | 2022-10-28 09:48 | 15M | |
![[ ]](/icons/layout.gif) | Data Analysis with Python and PySpark (Final Release).pdf | 2022-10-29 07:27 | 15M | |
![[ ]](/icons/layout.gif) | Machine Learning Notes - TutorialsDuniya.pdf | 2022-10-28 09:50 | 15M | |
![[ ]](/icons/layout.gif) | The web application hacker's handbook.pdf | 2022-10-20 06:07 | 15M | |
![[ ]](/icons/layout.gif) | Machine Learning for Humans.pdf | 2022-10-29 07:24 | 15M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201203.pdf | 2022-10-20 06:12 | 15M | |
![[ ]](/icons/layout.gif) | 3rd_Practical Packet Analysis [Chris_April 2017, 368 pp].pdf | 2022-10-20 06:01 | 15M | |
![[ ]](/icons/layout.gif) | CS8076_GPU_Architecture_and_Programming_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:23 | 15M | |
![[ ]](/icons/layout.gif) | Python Developer's Handbook, First Edition (2000).pdf | 2022-10-20 05:41 | 15M | |
![[ ]](/icons/layout.gif) | 1ed The Book of CSS3 (2011, No Starch Press).pdf | 2022-10-20 06:09 | 15M | |
![[ ]](/icons/layout.gif) | Rootkits and Bootkits [Alex & other_May 2019, 448 pp].pdf | 2022-10-20 06:04 | 15M | |
![[ ]](/icons/layout.gif) | Teach Your Kids To Code [Bryson P_April 2015, 336 pp].pdf | 2022-10-20 06:06 | 15M | |
![[ ]](/icons/layout.gif) | Windows PowerShell Cookbook.pdf | 2022-10-20 06:05 | 15M | |
![[ ]](/icons/layout.gif) | Brendan_G_Lim,_Martin_Conte_Mac_Donell_iOS_7_in_Action_Manning_2014.pdf | 2022-10-21 09:52 | 15M | |
![[ ]](/icons/layout.gif) | 165_DataScience_Interview_Q&A.pdf | 2022-10-28 11:26 | 16M | |
![[ ]](/icons/layout.gif) | Applied Deep Learning Tools.pdf | 2022-10-29 07:37 | 16M | |
![[ ]](/icons/layout.gif) | Java Complete Notes.pdf | 2022-11-01 06:10 | 16M | |
![[ ]](/icons/layout.gif) | CS8086_Soft_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 06:22 | 16M | |
![[ ]](/icons/layout.gif) | OEC552_Soft_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 05:38 | 16M | |
![[ ]](/icons/layout.gif) | Real-World_Machine_Learning.pdf | 2022-10-28 11:30 | 16M | |
![[ ]](/icons/layout.gif) | SQL Injection Strategies.pdf | 2022-10-28 11:30 | 16M | |
![[ ]](/icons/layout.gif) | Fundamentals and Methods of Machine and Deep Learning.pdf | 2022-11-04 11:21 | 16M | |
![[ ]](/icons/layout.gif) | Ethical Hacking A Hands-on Introduction to Breaking In.pdf | 2022-10-20 05:40 | 16M | |
![[ ]](/icons/layout.gif) | Practical_Statistics_for_Data_Scientists_50+_Essential_Concepts.pdf | 2022-10-20 06:14 | 16M | |
![[ ]](/icons/layout.gif) | The Ghidra Book__the Definitive Guide.pdf | 2022-10-20 06:08 | 16M | |
![[ ]](/icons/layout.gif) | Ad Hoc Wireless Networks Architectures and Protocols C. Siva Ram Murthy BS Manoj ( PDFDrive ).pdf | 2022-11-01 09:21 | 16M | |
![[ ]](/icons/layout.gif) | 4ed_Gray Hat Hacking.pdf | 2022-10-20 06:13 | 16M | |
![[ ]](/icons/layout.gif) | Beginning Android Programming with Android Studio.pdf | 2022-10-20 06:06 | 16M | |
![[ ]](/icons/layout.gif) | iOS Application Security [David_February 2016, 296 pp].pdf | 2022-10-20 06:05 | 16M | |
![[ ]](/icons/layout.gif) | Introduction to Deep Learning-2019.pdf | 2022-10-29 07:23 | 16M | |
![[ ]](/icons/layout.gif) | Data Mining_ The Textbook [Aggarwal 2015-04-14].pdf | 2022-10-28 11:30 | 16M | |
![[ ]](/icons/layout.gif) | 2nd_Practical Packet Analysis [Chris_2011,280 pp].pdf | 2022-10-20 06:01 | 16M | |
![[ ]](/icons/layout.gif) | mml-book.pdf | 2022-10-29 07:25 | 17M | |
![[ ]](/icons/layout.gif) | Learning-Kali-Linux.pdf | 2022-10-20 06:10 | 17M | |
![[ ]](/icons/layout.gif) | Programming with Java_ a Primer,3e.pdf | 2022-11-01 06:06 | 17M | |
![[ ]](/icons/layout.gif) | Machine_Learning_Simplified_A_Gentle_Introduction_to_Supervised.pdf | 2022-10-29 07:30 | 17M | |
![[ ]](/icons/layout.gif) | Building Arduino Projects for the Internet of Things.pdf | 2022-10-20 06:10 | 17M | |
![[ ]](/icons/layout.gif) | SHORT_NOTES_POLITY_CONSTITUTION_.pdf | 2022-10-20 06:38 | 17M | |
![[ ]](/icons/layout.gif) | pro-go-programming-efficient.pdf | 2022-10-21 09:53 | 17M | |
![[ ]](/icons/layout.gif) | HANDSON_DATA_SCIENCE_AND_PYTHON_MACHINE_LEARNING_@computer_books.pdf | 2022-10-28 11:31 | 18M | |
![[ ]](/icons/layout.gif) | PV Electrical Engineering.pdf | 2022-10-29 07:11 | 18M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_1_Zero_To_SysAdmin_Getting.pdf | 2022-10-20 06:13 | 18M | |
![[ ]](/icons/layout.gif) | Inside the Dark Web by Erdal Ozkaya Rafiqul Islam.pdf | 2022-10-20 06:12 | 18M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence for Games.pdf | 2022-10-29 07:30 | 18M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_in_Games_P_Roberts,_CRC_Press,_2022.pdf | 2022-10-29 07:29 | 18M | |
![[ ]](/icons/layout.gif) | Compiler Hand Written Notes Made Easy.pdf | 2022-10-28 09:47 | 18M | |
![[ ]](/icons/layout.gif) | The Data Science Design Manual.pdf | 2022-10-29 07:26 | 18M | |
![[ ]](/icons/layout.gif) | Machine Learning on Geographical Data.pdf | 2022-10-29 07:37 | 18M | |
![[ ]](/icons/layout.gif) | Hacking The Xbox .pdf | 2022-10-20 05:53 | 18M | |
![[ ]](/icons/layout.gif) | Autotools [John Calcote_July 2010, 360 pp].pdf | 2022-10-20 06:06 | 18M | |
![[ ]](/icons/layout.gif) | Computer Network-CS.pdf | 2022-10-28 09:47 | 18M | |
![[ ]](/icons/layout.gif) | Digital Logic.pdf | 2022-10-28 09:48 | 18M | |
![[ ]](/icons/layout.gif) | THEORY OF COMPUTATION CLASS NOTES.pdf | 2022-10-28 09:48 | 18M | |
![[ ]](/icons/layout.gif) | DataStructures Hand Written Notes Made Easy.pdf | 2022-10-28 09:47 | 18M | |
![[ ]](/icons/layout.gif) | DataScienceBook1_1.pdf | 2022-10-19 05:52 | 18M | |
![[ ]](/icons/layout.gif) | The IoT Hacker’s Handbook.pdf | 2022-10-20 06:12 | 19M | |
![[ ]](/icons/layout.gif) | Computer Organization-CS.pdf | 2022-10-28 09:48 | 19M | |
![[ ]](/icons/layout.gif) | Learning Robotics Using Python 2nd .pdf | 2022-10-20 06:03 | 19M | |
![[ ]](/icons/layout.gif) | HTML & CSS.pdf | 2022-10-20 05:45 | 19M | |
![[ ]](/icons/layout.gif) | Geography_Ecology_Disha_Experts.pdf | 2022-10-20 06:31 | 19M | |
![[ ]](/icons/layout.gif) | fullstrust.pdf | 2022-10-21 09:55 | 19M | |
![[ ]](/icons/layout.gif) | Data Engineering with AWS.pdf | 2022-10-29 07:27 | 19M | |
![[ ]](/icons/layout.gif) | Practical Machine Learning with Python (en).pdf | 2022-10-29 07:24 | 19M | |
![[ ]](/icons/layout.gif) | Web penetration testing with kali linux.pdf | 2022-10-20 05:53 | 20M | |
![[ ]](/icons/layout.gif) | Kali_Linux_An_Ethical_Hackers_Cookbook_2nd_Edition_Himanshu_Sharma.pdf | 2022-10-20 06:14 | 20M | |
![[ ]](/icons/layout.gif) | angular-11-full-package_1.pdf | 2022-10-21 09:55 | 20M | |
![[ ]](/icons/layout.gif) | The_C_Programming_language_By_Brian_W_Kernighan,_Dennis_M_Ritchie.pdf | 2022-10-28 09:47 | 20M | |
![[ ]](/icons/layout.gif) | DBMS Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 20M | |
![[ ]](/icons/layout.gif) | sql.pdf | 2022-11-01 06:13 | 20M | |
![[ ]](/icons/layout.gif) | Forsyth & Ponce- Computer vision.pdf | 2022-10-20 10:33 | 21M | |
![[ ]](/icons/layout.gif) | CS8073_C#_and_Net_Programming_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-10-20 06:23 | 21M | |
![[ ]](/icons/layout.gif) | Journey to Become a Google Cloud.pdf | 2022-10-28 11:31 | 21M | |
![[ ]](/icons/layout.gif) | Deep web links.pdf | 2022-10-20 06:01 | 21M | |
![[ ]](/icons/layout.gif) | Effective_Java.pdf | 2022-10-20 05:41 | 21M | |
![[ ]](/icons/layout.gif) | Cheng - Hacking Digital Cameras (Wiley, 2005) (2).pdf | 2022-10-20 05:40 | 21M | |
![[ ]](/icons/layout.gif) | Data_Structures_and_Algorithms.pdf | 2022-10-20 05:55 | 21M | |
![[ ]](/icons/layout.gif) | Data_Structures_and_Algorithms_in_C++.pdf | 2022-10-20 06:16 | 21M | |
![[ ]](/icons/layout.gif) | penetration testing essentials 2017.pdf | 2022-10-20 06:16 | 22M | |
![[ ]](/icons/layout.gif) | Absolute_Beginners_Guide_to_Minecraft_Mods_Programming_by_Rogers.pdf | 2022-10-20 06:14 | 22M | |
![[ ]](/icons/layout.gif) | Computer Organisation Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 22M | |
![[ ]](/icons/layout.gif) | Full_Stack_FastAPI,_React,_and_MongoDB_Build_Python_web_applications.pdf | 2022-10-21 09:55 | 22M | |
![[ ]](/icons/layout.gif) | Metasploit for Beginners.pdf | 2022-10-20 06:08 | 22M | |
![[ ]](/icons/layout.gif) | Ethical_Hacking_and_Penetration_Testing_Guide_PDFDrive_com_.pdf | 2022-10-20 06:06 | 22M | |
![[ ]](/icons/layout.gif) | Cybersecurity – Attack and Defense Strategies...pdf | 2022-10-20 06:10 | 23M | |
![[ ]](/icons/layout.gif) | Big Data For Dummies.pdf | 2022-10-28 11:31 | 23M | |
![[ ]](/icons/layout.gif) | Android Cookbook.pdf | 2022-10-20 06:00 | 23M | |
![[ ]](/icons/layout.gif) | Sulaymon_Eshkabilov_Practical_MATLAB_modeling_with_Simulink.pdf | 2022-10-20 10:34 | 23M | |
![[ ]](/icons/layout.gif) | Neural Networks from Scratch in Python.pdf | 2022-10-28 11:30 | 23M | |
![[ ]](/icons/layout.gif) | Ubuntu Made Easy.pdf | 2022-10-20 06:07 | 23M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 2.pdf | 2022-10-20 06:15 | 23M | |
![[ ]](/icons/layout.gif) | Pete_Warden,_Daniel_Situnayake_TinyML_Machine_Learning_with_TensorFlow.pdf | 2022-10-29 07:27 | 23M | |
![[ ]](/icons/layout.gif) | Numerical_Python_Scientific_Computing_and_Data_Science_Applications.pdf | 2022-10-20 06:13 | 23M | |
![[ ]](/icons/layout.gif) | Ethical Hacking.pdf | 2022-10-20 06:11 | 23M | |
![[ ]](/icons/layout.gif) | Professional_C.pdf | 2022-10-20 05:50 | 24M | |
![[ ]](/icons/layout.gif) | sc&sappinact.pdf | 2022-10-21 09:55 | 24M | |
![[ ]](/icons/layout.gif) | The Car Hacker's Handbook [C. Smith_March 2016, 304 pp].pdf | 2022-10-20 06:06 | 24M | |
![[ ]](/icons/layout.gif) | HTML 5 hacks.pdf | 2022-10-20 05:52 | 24M | |
![[ ]](/icons/layout.gif) | Practical Data Science with R.pdf | 2022-10-28 11:28 | 24M | |
![[ ]](/icons/layout.gif) | Theory of Computations Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 24M | |
![[ ]](/icons/layout.gif) | 1 Cyber Crimes Prevention .pdf | 2022-10-31 09:27 | 24M | |
![[ ]](/icons/layout.gif) | Operating System Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 25M | |
![[ ]](/icons/layout.gif) | React_Hooks_in_Action_With_Suspense_and_Concurrent_Mode_2021.pdf | 2022-10-21 09:53 | 25M | |
![[ ]](/icons/layout.gif) | Computer Networks Hand Written Notes Made Easy.pdf | 2022-10-28 09:47 | 26M | |
![[ ]](/icons/layout.gif) | EN-Ethical Hacking.pdf | 2022-10-20 06:11 | 26M | |
![[ ]](/icons/layout.gif) | 3rd_Python Machine Learning.pdf | 2022-10-20 06:08 | 26M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 1.pdf | 2022-10-20 06:15 | 26M | |
![[ ]](/icons/layout.gif) | bernd_klein_python_and_machine_learning_a4.pdf | 2022-10-28 11:31 | 26M | |
![[ ]](/icons/layout.gif) | The_Electrical_engineering_handbook_series_Jerry_C_Whitaker_The.pdf | 2022-10-29 07:11 | 26M | |
![[ ]](/icons/layout.gif) | Big Data Principles and Paradigms.pdf | 2022-10-28 11:31 | 27M | |
![[ ]](/icons/layout.gif) | Comet for Data Science.pdf | 2022-10-28 11:30 | 27M | |
![[ ]](/icons/layout.gif) | Magdi_S__Mahmoud,_Fouad_M__AL_Sunni_auth.pdf | 2022-10-28 11:16 | 27M | |
![[ ]](/icons/layout.gif) | Doing_Data_Science_Straight_Talk_from_the_Frontline_by_Rachel_Schutt.pdf | 2022-10-20 06:14 | 27M | |
![[ ]](/icons/layout.gif) | web penetration testing with kali.pdf | 2022-10-29 09:54 | 28M | |
![[ ]](/icons/compressed.gif) | Effectively Build RESTful APIs using Next.js API Routes.zip | 2022-10-21 09:52 | 28M | |
![[ ]](/icons/layout.gif) | Data_Analysis_Using_SQL_and_Excel_Wiley_2015_Gordon_S_Linoff.pdf | 2022-10-29 07:26 | 28M | |
![[ ]](/icons/layout.gif) | Algorthims Hand Written Notes Made Easy.pdf | 2022-10-28 09:47 | 28M | |
![[ ]](/icons/layout.gif) | The Python Book_The ultimate guide to coding with Python.pdf | 2022-10-20 05:54 | 28M | |
![[ ]](/icons/layout.gif) | Mastering machine learning algorithims.pdf | 2022-10-28 11:30 | 29M | |
![[ ]](/icons/layout.gif) | Snippets of Indian Polity - Rohit Vadhwana IFS.pdf | 2022-10-20 06:31 | 29M | |
![[ ]](/icons/layout.gif) | Applied_Numerical_Methods_with_MATLAB.pdf | 2022-10-28 11:16 | 29M | |
![[ ]](/icons/layout.gif) | Learn Kubernetes in a Month of Lunches (Elton Stoneman).pdf | 2022-10-21 09:53 | 29M | |
![[ ]](/icons/layout.gif) | DBMS-CS.pdf | 2022-10-28 09:48 | 30M | |
![[ ]](/icons/layout.gif) | GE8151_Problem_Solving_&_Python_Programming_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 05:40 | 30M | |
![[ ]](/icons/layout.gif) | CSAT_Decision_Making_Problem_Solving_and_Interpersonal_Skills.pdf | 2022-10-20 06:37 | 30M | |
![[ ]](/icons/layout.gif) | The Hardware Hacker [Andrew_August 2019, 424 pp].pdf | 2022-10-20 06:05 | 30M | |
![[ ]](/icons/layout.gif) | IT8074_Service_Oriented_Architecture_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:40 | 31M | |
![[ ]](/icons/layout.gif) | Hands_On_Machine_Learning_with_Scikit_Learn,_Keras,_and_Tensorflow.pdf | 2022-10-20 06:14 | 32M | |
![[ ]](/icons/layout.gif) | HandsonMachine-Learning-with-Scikit-2E -1.pdf | 2022-10-29 07:24 | 32M | |
![[ ]](/icons/layout.gif) | Data Science and Analytics with Python - Jesus Rogel-Salazar.pdf | 2022-10-29 07:24 | 32M | |
![[ ]](/icons/layout.gif) | Cybersecurity – Attack-and-Defense-Strategies-2nd.pdf | 2022-10-20 06:10 | 33M | |
![[ ]](/icons/layout.gif) | Practical Binary Analysis [Dennis_December 2018, 456 pp].pdf | 2022-10-20 06:05 | 33M | |
![[ ]](/icons/layout.gif) | Python_Tools_for_Scientists.pdf | 2022-11-03 03:32 | 34M | |
![[ ]](/icons/layout.gif) | 2E_Head First Java.pdf | 2022-10-20 06:09 | 34M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Electric_Circuits_McGraw_Hill_Education_2021_7th.pdf | 2022-10-29 07:11 | 34M | |
![[ ]](/icons/layout.gif) | 125. Networking All-in-One For Dummies (2).pdf | 2022-11-01 06:04 | 35M | |
![[ ]](/icons/layout.gif) | Data Structure.pdf | 2022-10-28 09:48 | 35M | |
![[ ]](/icons/layout.gif) | Master Your Mac.pdf | 2022-10-20 06:07 | 35M | |
![[ ]](/icons/layout.gif) | Engineering_Mathematics_Programmes_and_Problems_by_K_A_Stroud_auth.pdf | 2022-11-01 06:03 | 35M | |
![[ ]](/icons/layout.gif) | Nonlinear_Programming_Theory_and_Algorithms_Wiley_Interscience_2006.pdf | 2022-10-29 07:11 | 36M | |
![[ ]](/icons/layout.gif) | Neural_Networks_A_Comprehensive.pdf | 2022-10-28 11:16 | 36M | |
![[ ]](/icons/layout.gif) | Machine Learning Notes 2 - TutorialsDuniya.pdf | 2022-10-28 09:50 | 37M | |
![[ ]](/icons/layout.gif) | IoT-CRC2018.pdf | 2022-10-29 09:54 | 37M | |
![[ ]](/icons/layout.gif) | Machine - Learning - Tom Mitchell.pdf | 2022-10-19 05:53 | 37M | |
![[ ]](/icons/layout.gif) | Rafael_C_Gonzalez_Richard_E_Wods_Digital_Image_Processing_Pearson.pdf | 2022-10-29 09:52 | 37M | |
![[ ]](/icons/layout.gif) | CS8082_Machine_Learning_Techniques_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:22 | 37M | |
![[ ]](/icons/layout.gif) | ByteByteGo_LinkedIn_PDF.pdf | 2022-10-21 09:55 | 38M | |
![[ ]](/icons/layout.gif) | Deep Learning A Visual Approach [2021] Andrew Glassner.pdf | 2022-10-29 07:30 | 38M | |
![[ ]](/icons/layout.gif) | Design Analysis and Algorithm.pdf | 2022-10-28 09:47 | 38M | |
![[ ]](/icons/layout.gif) | Compiler Design Vani Notes.pdf | 2022-10-28 09:47 | 39M | |
![[ ]](/icons/layout.gif) | Machine Learning Bookcamp Build a portfolio of real-life pr.pdf | 2022-10-29 07:26 | 40M | |
![[ ]](/icons/layout.gif) | COMPUTER NETWORKS SEM 5.pdf | 2022-10-20 05:38 | 40M | |
![[ ]](/icons/layout.gif) | HOW TO SUCCEED IN CIVIL SERVICES.pdf | 2022-10-20 06:31 | 41M | |
![[ ]](/icons/layout.gif) | Python__Tricks_And_Tips_-_4e.pdf | 2022-10-29 07:27 | 42M | |
![[ ]](/icons/layout.gif) | Data Science Bookcamp Five real-world Python projects.pdf | 2022-10-29 07:25 | 42M | |
![[ ]](/icons/layout.gif) | CS8088_Wireless_Adhoc_and_Sensor_Networks_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:22 | 42M | |
![[ ]](/icons/layout.gif) | IA (3170925) TECHNICAL.pdf | 2022-10-28 03:05 | 44M | |
![[ ]](/icons/layout.gif) | Hands_On_Machine_Learning_with_Scikit_Learn_and_TensorFlow_Concepts.pdf | 2022-10-29 07:34 | 45M | |
![[ ]](/icons/layout.gif) | Offensive Security OSCP by Offensive Security.pdf | 2022-10-20 06:12 | 46M | |
![[ ]](/icons/layout.gif) | CS8592_Object_Oriented_Analysis_and_Design_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:18 | 46M | |
![[ ]](/icons/layout.gif) | 5ed_Gray Hat Hacking.pdf | 2022-10-20 06:13 | 46M | |
![[ ]](/icons/layout.gif) | Gray_Hat_Hacking___The_Ethical.pdf | 2022-10-20 05:42 | 46M | |
![[ ]](/icons/layout.gif) | Security for Software Engineers.pdf | 2022-10-20 06:09 | 48M | |
![[ ]](/icons/layout.gif) | MG8591_Principles_of_Management_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 05:39 | 48M | |
![[ ]](/icons/layout.gif) | Hands-On_Serverless_Applications_with_Go.pdf | 2022-10-21 09:55 | 49M | |
![[ ]](/icons/layout.gif) | Head_First_Android_Development_A.pdf | 2022-10-29 09:54 | 50M | |
![[ ]](/icons/layout.gif) | Head_First_Android_Development_A_Brain_Friendly_Guide_PDFDrive_com.pdf | 2022-10-20 05:56 | 50M | |
![[ ]](/icons/layout.gif) | GitHub for Dummies.pdf | 2022-10-20 06:07 | 51M | |
![[ ]](/icons/layout.gif) | CS8081_Internet_of_Things_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 06:22 | 52M | |
![[ ]](/icons/layout.gif) | Build_Your_Own_Website_A_Comic_Guide_to_HTML,_CSS,_and_WordPress.pdf | 2022-10-20 06:01 | 52M | |
![[ ]](/icons/layout.gif) | Indian_History_Important_Topics_for_UPSC_Prelims_and_Mains_Exam.pdf | 2022-10-20 06:38 | 52M | |
![[ ]](/icons/layout.gif) | Machine Learning.pdf | 2022-10-19 05:50 | 53M | |
![[ ]](/icons/layout.gif) | PCWorld_-_November_2022.pdf | 2022-11-10 03:09 | 56M | |
![[ ]](/icons/layout.gif) | Linux For Beginners October 1st 2022.pdf | 2022-11-01 04:13 | 56M | |
![[ ]](/icons/layout.gif) | Dbms.pdf | 2022-10-28 09:48 | 57M | |
![[ ]](/icons/layout.gif) | Mastering Computer Vision with TensorFlow 2.x.pdf | 2022-10-29 07:30 | 57M | |
![[ ]](/icons/layout.gif) | 123. Linux All-in-One for Dummies 4th Edition.pdf | 2022-11-01 06:04 | 57M | |
![[ ]](/icons/layout.gif) | Web security exposed.pdf | 2022-10-20 06:12 | 60M | |
![[ ]](/icons/layout.gif) | Play with graphs by Amit aggarwal.pdf | 2022-10-29 07:23 | 61M | |
![[ ]](/icons/layout.gif) | CS8391_Data_Structures_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 06:20 | 62M | |
![[ ]](/icons/layout.gif) | Simon_Monk_Raspberry_Pi_Cookbook_Software_and_Hardware_Problems.pdf | 2022-10-20 06:04 | 62M | |
![[ ]](/icons/layout.gif) | CS8791_Cloud_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai_Seena.pdf | 2022-10-20 05:39 | 62M | |
![[ ]](/icons/layout.gif) | CS8071_Advanced_Topics_on_Databases_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:23 | 64M | |
![[ ]](/icons/layout.gif) | GE8076_Professional_Ethics_in_Engineering_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 05:41 | 66M | |
![[ ]](/icons/layout.gif) | Windows 11 For Beginners – 29 October 2022.pdf | 2022-11-10 03:08 | 67M | |
![[ ]](/icons/layout.gif) | 133. Photoshop Elements 11.pdf | 2022-11-01 06:04 | 69M | |
![[ ]](/icons/layout.gif) | Programming_Computer_Vision_with_Python_Tools_and_algorithms_for.pdf | 2022-10-29 07:34 | 69M | |
![[ ]](/icons/layout.gif) | Open Source for You_Oct 2022.pdf | 2022-10-31 03:28 | 72M | |
![[ ]](/icons/layout.gif) | Hands_On_Machine_Learning_with_Scikit_Learn,_Keras,_and_TensorFlow (2).pdf | 2022-10-29 07:23 | 73M | |
![[ ]](/icons/compressed.gif) | Learn_CSS_By_Use_Cases_[ebook].zip | 2022-10-21 09:54 | 75M | |
![[ ]](/icons/layout.gif) | CS8092_Computer_Graphics_&_Multimedia_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:21 | 76M | |
![[ ]](/icons/layout.gif) | Learning Web Design.pdf | 2022-10-20 06:00 | 76M | |
![[ ]](/icons/layout.gif) | High_Voltage_Engineering_CRC_Press_2014_Farouk_A_M_Rizk,_Giao_N.pdf | 2022-10-29 07:11 | 77M | |
![[ ]](/icons/layout.gif) | Programming_and_Engineering_Computing.pdf | 2022-11-01 06:06 | 79M | |
![[ ]](/icons/layout.gif) | Programming and Engineering Computing with MATLAB 2017.pdf | 2022-11-01 06:06 | 81M | |
![[ ]](/icons/layout.gif) | CS8601_Mobile_Computing_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 06:18 | 81M | |
![[ ]](/icons/layout.gif) | Head_First_Learn_to_Code_A_Learner’s_Guide_to_Coding_and_Computational.pdf | 2022-10-20 06:00 | 81M | |
![[ ]](/icons/layout.gif) | CS8493_Operating_Systems_Scanned_from_Printed_Book_by_Sai_Seena.pdf | 2022-10-20 06:19 | 83M | |
![[ ]](/icons/layout.gif) | CS8792_Cryptography_&_Network_Security_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 05:39 | 84M | |
![[ ]](/icons/layout.gif) | CS8451_Design_and_Analysis_of_Algorithms_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:20 | 85M | |
![[ ]](/icons/layout.gif) | Learn Kali Linux 2019 by Glen D. Singh .pdf | 2022-10-20 06:02 | 85M | |
![[ ]](/icons/layout.gif) | CS8501_Theory_of_Computation_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-10-20 06:19 | 85M | |
![[ ]](/icons/layout.gif) | Introduction to Programming in Java.pdf | 2022-10-29 09:55 | 91M | |
![[ ]](/icons/layout.gif) | GE8291_Environmental_Science_and_Engineering_Ripped_from_Amazon.pdf | 2022-10-20 05:40 | 91M | |
![[ ]](/icons/layout.gif) | JavaScript and JQuery Interactive Front.pdf | 2022-10-20 06:16 | 92M | |
![[ ]](/icons/layout.gif) | Head First HTML and CSS 2nd edition.pdf | 2022-10-20 06:08 | 98M | |
![[ ]](/icons/layout.gif) | CS8491_Computer_Architecture_Ripped_from_Amazon_Kindle_eBooks_by.pdf | 2022-10-20 06:20 | 102M | |
![[ ]](/icons/layout.gif) | Frontend Unicorn (Hype4) (2).pdf | 2022-10-21 09:55 | 103M | |
![[ ]](/icons/layout.gif) | Frontend Unicorn (Hype4).pdf | 2022-10-21 09:56 | 103M | |
![[ ]](/icons/layout.gif) | Head.First.Java.3rd.Edition.by.Kathy.Sierra.Bert.Bates.pdf | 2022-10-21 09:56 | 105M | |
![[ ]](/icons/layout.gif) | CS8251_Programming_in_C_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 06:21 | 111M | |
![[ ]](/icons/layout.gif) | COMPUTER_PROGRAMMING_WITH_MATLAB__J.pdf | 2022-11-01 06:07 | 126M | |
![[ ]](/icons/compressed.gif) | SQL Tips and Tricks for Data Science.zip | 2022-10-29 07:33 | 148M | |
![[ ]](/icons/layout.gif) | CDS_General_Studies_Question_Bank_based_on_Previous_Papers_3000.pdf | 2022-10-20 06:31 | 154M | |
![[ ]](/icons/layout.gif) | UPSC HISTORY QUESTION BANK - SCORER SERIES.pdf | 2022-10-20 06:31 | 171M | |
![[ ]](/icons/layout.gif) | How_Computers_Work__9th_Edition_.pdf | 2022-10-29 09:55 | 193M | |
![[ ]](/icons/layout.gif) | BE8255_Basic_Electrical,_Electronics_and_Measurement_Engineering.pdf | 2022-10-20 06:24 | 197M | |
![[ ]](/icons/layout.gif) | CS8691_Artificial_Intelligence_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:18 | 204M | |
![[ ]](/icons/layout.gif) | [Matt_Lombard]_Solidworks_2013_Bible(b-ok.xyz).pdf | 2022-11-01 06:02 | 229M | |
![[ ]](/icons/compressed.gif) | LinkedIn - Python for Data Science Essential Training Part 2.zip | 2022-10-29 07:37 | 390M | |
![[ ]](/icons/compressed.gif) | LinkedIn - Python for Data Science Essential Training Part 1.zip | 2022-10-29 07:34 | 641M | |
![[ ]](/icons/compressed.gif) | Lynda.com - Data Science Foundations - Fundamentals.zip | 2022-10-29 07:30 | 666M | |
![[ ]](/icons/compressed.gif) | Lynda.com - Python for Data Science Essential Training.zip | 2022-10-29 07:29 | 763M | |
![[ ]](/icons/compressed.gif) | Data Ethics - Making Data-Driven Decisions.zip | 2022-10-29 07:32 | 800M | |
![[ ]](/icons/compressed.gif) | Artificial Intelligence for Students.zip | 2022-10-29 07:33 | 1.1G | |
![[ ]](/icons/unknown.gif) | Udemy - algorithms-and-data-structures-in-python.rar | 2022-10-29 07:37 | 1.4G | |
|