![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | pdfcoffee_com_microelectronic_circuits_sedra_smith_5th_edition_solution.pdf | 2022-10-28 11:07 | 33M | |
| pdfcoffee_com_basic_circuit_theory_charles_a_desoer_ernest_s_kuh.pdf | 2022-10-28 11:08 | 25M | |
| pdfcoffee.com_network-analysis-by-van-valkenberg-pdf-free.pdf | 2022-10-28 11:13 | 23M | |
| microwave_engineering_2nd_ed_david_pozar_(ocred).pdf | 2022-10-28 11:17 | 30M | |
| microelectronic_circuits_8enbsped_9780190853464_9780190853532_compress.pdf | 2022-10-28 11:06 | 60M | |
| intro to speech processing.pdf | 2022-10-28 11:16 | 2.4M | |
| fundamental-of-electronics-devices-nec302-2020.pdf | 2022-10-28 11:10 | 221K | |
| digital system clean.pdf | 2022-10-28 09:48 | 8.6M | |
| cupdf_com_solution_manual_for_analysis_of_linear_circuits_charles.pdf | 2022-10-28 11:09 | 26M | |
| antenna and wave Quantum.pdf | 2022-10-28 11:07 | 41M | |
| all in one DC.pdf | 2022-10-28 10:39 | 33M | |
| [Paul_Taylor]_Text-to-speech_synthesis(b-ok.org).pdf | 2022-10-28 11:16 | 4.9M | |
| Wendy_Holmes_Speech_synthesis_and.pdf | 2022-10-28 11:16 | 2.9M | |
| Thierry_Dutoit_auth__An_Introduction_to_Text.pdf | 2022-10-28 11:16 | 7.4M | |
| The Art of Electronics - Horowitz & Hill.pdf | 2022-10-28 11:17 | 28M | |
| Text-to-Speech Synthesis.pdf | 2022-10-28 11:16 | 4.5M | |
| Simon_Haykin_Communication_Systems_4th_Edition_Wiley_2000.pdf | 2022-10-28 11:14 | 13M | |
| Signals_and_Systems_A_Primer_with_MATLAB_by_MATTHEW_N_O_SADIKU_WARSAME.pdf | 2022-10-28 11:11 | 6.2M | |
| Signals,_Systems_and_Inference_Prentice_Hall_2015_Prentice_Hall.pdf | 2022-10-28 11:14 | 6.1M | |
| Schaums_outline_of_theory_and_problems_of_signal_and_systems_Hwei.pdf | 2022-10-28 11:06 | 6.3M | |
| Schaums_Outline_of_Electronic_Devices_and_Circuits_Jimmie_J_Cathey.pdf | 2022-10-28 11:07 | 7.2M | |
| Schaum’s_Outline_of_Electric_Circuits_by_Mahmood_Nahvi,_Joseph_Edminister.pdf | 2022-10-28 11:11 | 23M | |
| Radio Electronics.pdf | 2022-10-28 11:17 | 23M | |
| Rabiner-Ch123.pdf | 2022-10-28 11:16 | 8.5M | |
| R19 MWOC UNIT -2.pdf | 2022-10-28 10:39 | 7.5M | |
| Professor_Dr__Manfred_R__Schroeder_auth.pdf | 2022-10-28 11:16 | 12M | |
| Principles of Electric Circuits CC Thomas L. Floyd.pdf | 2022-11-01 10:45 | 634M | |
| Principles_of_Communication_Systems,_2nd_edition_by_Herbert_Taub.pdf | 2022-10-20 10:52 | 9.1M | |
| Principles_Of_Linear_Systems_And_Signals_by_B_P_Lathi_z_lib_org.pdf | 2022-10-28 11:13 | 72M | |
| Paul_Horowitz,_Winfield_Hill_The.pdf | 2022-10-28 11:15 | 17M | |
| OEC751_Electronic_Devices_Ripped_from_Amazon_Kindle_eBooks_by_Sai.pdf | 2022-10-20 05:40 | 96M | |
| Networks and systems by Roy Choudhury, D (z-lib.org).pdf | 2022-10-28 11:13 | 11M | |
| Network_Analysis_And_Synthesis_by_Ghosh_and_A_Chakraborty_z_lib.pdf | 2022-10-28 11:13 | 12M | |
| Most Expected Questions.pdf | 2022-10-28 10:40 | 4.6M | |
| Millman_Microelectronics_digital_and_analog_circuits_and_systems.pdf | 2022-10-28 11:06 | 11M | |
| Microelectronics - Razavi.pdf | 2022-10-28 11:16 | 10M | |
| Microelectronic_Devices_and_Circuits_MCGRAW_HILL_SERIES_IN_ELECTRICAL.pdf | 2022-10-28 11:11 | 38M | |
| McGraw_Hill_TAB_Electronics_Build.pdf | 2022-10-28 11:16 | 18M | |
| Malvino_Electronic-Principles 8th.pdf | 2022-10-28 10:39 | 27M | |
| Linear-System-Theory-Design.pdf | 2022-10-28 11:16 | 9.5M | |
| Jacob_Benesty_Prof_,_M_eds_Springer.pdf | 2022-10-28 11:16 | 43M | |
| Introduction_to_Digital_Communications_by_Ali_Grami_Ph_D_z_lib_org.pdf | 2022-10-28 11:08 | 15M | |
| Intro-Electronics-Electricity.pdf | 2022-10-28 10:39 | 26M | |
| Intro-Electronics-Amplifiers.pdf | 2022-10-28 10:39 | 29M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 6 (2).pdf | 2022-10-28 11:17 | 13M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 5 (2).pdf | 2022-10-28 11:17 | 12M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 4.pdf | 2022-10-28 11:15 | 23M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 3.pdf | 2022-10-28 11:15 | 15M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 2 (2).pdf | 2022-10-28 11:17 | 13M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 1.pdf | 2022-10-28 11:16 | 15M | |
| Graf - Encyclopedia of Electronic Circuits - Vol 1 (2).pdf | 2022-10-28 11:17 | 15M | |
| Fundamentals_of_Modern_Electric_Circuit_Analysis_and_Filter_Synthesis.pdf | 2022-10-28 11:12 | 28M | |
| Fundamentals_of_Electric_Circuits_by_Charles_K_Alexander,_Matthew.pdf | 2022-10-28 11:09 | 34M | |
| Fundamentals_of_Analogue_and_Digital_Communication_Systems_by_Sunil.pdf | 2022-10-28 11:07 | 10M | |
| Field_and_wave_electromagnetics_Cheng,_David_Keun_z_lib_org_1.pdf | 2022-10-28 11:06 | 43M | |
| Engineering_Electromagnetics_Kenneth_R_Demarest_z_lib_org.pdf | 2022-10-28 11:06 | 38M | |
| Engineering_Circuit_Analysis_by_William_Hayt,_Jack_Kemmerly,_Jaime.pdf | 2022-10-28 11:09 | 64M | |
| Engineering Electronics.pdf | 2022-10-28 11:16 | 6.3M | |
| Encyclopedia of Electronic Components Volume 1.pdf | 2022-10-28 11:16 | 32M | |
| Electronics For You_Oct 2022.pdf | 2022-10-31 03:28 | 27M | |
| Electronics, A Systems Approach - Neil Storey (2017).pdf | 2022-10-28 10:39 | 18M | |
| Electronic_devices_and_amplifier_circuits_with_MATLAB_applications.pdf | 2022-10-28 11:12 | 11M | |
| Electronic_concepts_an_introduction_by_Jerrold_H_Krenz_z_lib_org.pdf | 2022-10-28 11:11 | 23M | |
| Electronic_Devices_and_Circuits_McGraw_Hill_Education_2018_S_Salivahanan.pdf | 2022-10-28 11:14 | 20M | |
| Electronic_Circuit_Analysis_and_Design,_2nd_Edition_William_H_Hayt.pdf | 2022-10-28 11:07 | 58M | |
| Electronic Devices and Circuit Theory by Robert Boylestad.pdf | 2022-10-28 10:39 | 26M | |
| Electronic Devices and Circuit Theory-1.pdf | 2022-10-28 10:39 | 21M | |
| Electronic Devices and Circuit Applications.pdf | 2022-10-28 10:39 | 7.5M | |
| Electronic Devices Thomas L. Floyd.pdf | 2022-11-01 10:41 | 629M | |
| Electric_Circuits_Problem_Solver_Problem_Solvers_Solution_Guides.pdf | 2022-10-28 11:07 | 45M | |
| Electric Circuits Fundamentals by Sergio Franco (z-lib.org).pdf | 2022-10-28 11:08 | 23M | |
| Ec1.pdf | 2022-10-28 11:07 | 59M | |
| ELECTRONIC_DEVICES_AND_INTEGRATED_CIRCUITS_B_P_Singh,_Rekha_Singh.pdf | 2022-10-28 11:07 | 14M | |
| EC8691_Microprocessors_and_Microcontrollers_Ripped_from_Amazon_Kindle.pdf | 2022-10-20 06:16 | 119M | |
| EC8395_Communication_Engineering_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:17 | 171M | |
| EC8093_Digital_Image_Processing_Ripped_from_Amazon_Kindle_eBooks.pdf | 2022-10-20 06:17 | 18M | |
| EC.pdf | 2022-10-28 11:08 | 21M | |
| Discrete_and_Integrated_Electronics_Analysis_and_Design_for_Engineers.pdf | 2022-10-28 11:07 | 15M | |
| Digital fundamentals Thomas L. Floyd.pdf | 2022-11-01 10:46 | 344M | |
| Digital_electronic_Analog_and_Digital_Allan_D_Tyler_z_lib_org.pdf | 2022-10-28 11:07 | 23M | |
| Digital_Power_Electronics_and_Applications.pdf | 2022-10-28 11:16 | 4.7M | |
| Digital_Integrated_Circuits_A_design.pdf | 2022-10-28 11:15 | 8.4M | |
| Digital_Design_3rd_Edition_by_M_Morris_Mano,_Morris_M_Mano_z_lib.pdf | 2022-10-28 11:11 | 13M | |
| Digital_Communications_Fundamentals_and_Applications_by_Bernard.pdf | 2022-10-28 11:08 | 86M | |
| Digital Logic_2.pdf | 2022-10-28 09:48 | 2.9M | |
| Digital Electronics Hand Written Notes Made Easy.pdf | 2022-10-28 09:48 | 11M | |
| Device_Electronics_for_Integrated_Circuits_3rd_Ed_by_Richard_S_Muller.pdf | 2022-10-28 11:07 | 23M | |
| Design_of_Analog_Multipliers_with_Operational_Amplifiers_by_K_C.pdf | 2022-10-28 11:13 | 29M | |
| DataQuest_Nov 2022.pdf | 2022-11-12 08:00 | 60M | |
| DSP1.pdf | 2022-10-28 11:06 | 7.7M | |
| DSP.pdf | 2022-10-28 11:11 | 4.5M | |
| DIGITAL SYSTEM CLASS NOTES.pdf | 2022-10-28 09:48 | 5.3M | |
| Contemporary Logic Design.pdf | 2022-10-28 11:17 | 41M | |
| Communication_Systems_and_Techniques_by_Mischa_Schwartz,_William.pdf | 2022-10-28 11:08 | 8.6M | |
| Communication_Systems_Engineering_by_John_G_Proakis,_Masoud_Salehi.pdf | 2022-10-28 11:08 | 5.0M | |
| Circuits_and_Networks_Analysis_and_Synthesis_by_A_Sudhakar_Shyammohan.pdf | 2022-10-28 11:12 | 35M | |
| CSP UNIT-5.pdf | 2022-10-28 10:39 | 663K | |
| CSP UNIT-4.pdf | 2022-10-28 10:39 | 666K | |
| CSP UNIT-3.pdf | 2022-10-28 10:39 | 932K | |
| CSP UNIT-2.pdf | 2022-10-28 10:39 | 777K | |
| CSP UNIT-1.pdf | 2022-10-28 10:39 | 786K | |
| CMOS_VLSI_Design_A_Circuits_and_Systems_Perspective_4th_Edition.pdf | 2022-10-28 11:13 | 14M | |
| CMOS_VLSI_Design_A_Circuits_and.pdf | 2022-10-28 11:15 | 14M | |
| CMOS_Circuit_Design,_Layout,_and_Simulation,_by_R_Jacob_Baker_z.pdf | 2022-10-28 11:13 | 21M | |
| Book_no_35_Electronic_Principles_Albert_Malvino_Eighth_Edition_True.pdf | 2022-11-01 06:06 | 27M | |
| Book 4 Oscillators and Advanced Electronics Topics.pdf | 2022-10-28 10:39 | 7.9M | |
| Book 3 Active Filters and Amplifier Frequency Response.pdf | 2022-10-28 10:39 | 7.9M | |
| Book 2 Amplifiers Analysis and Design.pdf | 2022-10-28 10:39 | 7.2M | |
| Basic Electronics Solid State by Theraja B.L. (z-lib.org).pdf | 2022-10-28 11:08 | 23M | |
| Analog and Digital Signals and Systems ( PDFDrive ).pdf | 2022-10-28 11:06 | 8.5M | |
| Analog_Function_Circuits_Fundamentals,_Principles,_Design_and_Applications.pdf | 2022-10-28 11:07 | 25M | |
| All About Electronics – October 2022.pdf | 2022-11-02 06:00 | 22M | |
| Advanced_Microcontroller_Harish_G_Narula,_Khushboo_Shah_z_lib_org.pdf | 2022-10-19 06:44 | 7.2M | |
| Advanced-Electronics-Digital.pdf | 2022-10-28 10:39 | 9.8M | |
| 4th-digital-signal-processing-proakis-and-manolakis1.pdf | 2022-10-28 11:17 | 55M | |
| 097. Electronics Projects.pdf | 2022-11-01 06:04 | 17M | |
| 0495667722microeleccircuits.pdf | 2022-10-28 11:13 | 58M | |
|
|---|