![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Modern Electric, Hybrid Electric, and Fuel Cell Vehicles Fundamentals, Theory, and Design, Second Edition (Power Electronics and Applications Series) by Mehrdad Ehsani, Yimin Gao, Ali Emadi (z-lib.org).pdf | 2022-10-11 06:59 | 9.9M | |
![[ ]](/icons/layout.gif) | PSD DIGITAL NOTES.pdf | 2022-10-13 07:29 | 4.4M | |
![[ ]](/icons/layout.gif) | Power_Electronics_And_Motor_Drives__Advances_and_Trends.pdf | 2022-10-13 07:30 | 13M | |
![[ ]](/icons/layout.gif) | Electricity_and_Magnetism_New_Formulation_by_Introduction_of_Superconductivity.pdf | 2022-10-28 11:05 | 12M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Applied_Electromagnetics_Ulaby,_Fawaz_Ravaioli,.pdf | 2022-10-28 11:06 | 38M | |
![[ ]](/icons/layout.gif) | Electromagnetic_Field_Theory_and_Transmission_Lines_G_S_N_Raju_z.pdf | 2022-10-28 11:06 | 6.0M | |
![[ ]](/icons/layout.gif) | Electromagnetic_Fields_and_Waves_2nd_Edition_Magdy_F_Iskander_z.pdf | 2022-10-28 11:06 | 86M | |
![[ ]](/icons/layout.gif) | Circuit_Analysis_II_with_MATLAB_Applications_by_Steven_Karris_z.pdf | 2022-10-28 11:08 | 6.7M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Electronics_Book_1_Electronic_Devices_and_Circuit.pdf | 2022-10-28 11:08 | 7.5M | |
![[ ]](/icons/layout.gif) | Electrical_Engineering_Concepts_and_Applications_by_S_A_Reza_Zekavat.pdf | 2022-10-28 11:08 | 10M | |
![[ ]](/icons/layout.gif) | Principles_of_Electronics_by_V_K_Mehta,_Rohit_Mehta_z_lib_org.pdf | 2022-10-28 11:08 | 42M | |
![[ ]](/icons/layout.gif) | ISE_Principles_and_Applications_of_Electrical_Engineering_ISE_HED.pdf | 2022-10-28 11:08 | 43M | |
![[ ]](/icons/layout.gif) | Electrical Engineering Paper-I.pdf | 2022-10-28 11:08 | 12M | |
![[ ]](/icons/layout.gif) | Basic_Engineering_Circuit_Analysis_by_J_David_Irwin,_Robert_M_Nelms.pdf | 2022-10-28 11:09 | 9.5M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Electric_Circuits_by_Charles_Alexander,_Matthew.pdf | 2022-10-28 11:09 | 24M | |
![[ ]](/icons/layout.gif) | Electric_Circuits_by_James_William_Nilsson,_Susan_A_Riedel_z_lib.pdf | 2022-10-28 11:10 | 25M | |
![[ ]](/icons/layout.gif) | introduction_to_electronics_and_electrical_engineering_mtar012_2020.pdf | 2022-10-28 11:10 | 156K | |
![[ ]](/icons/layout.gif) | Electricity,_magnetism_and_electromagnetic_theory_by_Shobhit_Mahajan.pdf | 2022-10-28 11:10 | 8.2M | |
![[ ]](/icons/layout.gif) | Introduction_To_Electromagnetic_Theory_A_Modern_Perspective_by_Chow.pdf | 2022-10-28 11:10 | 62M | |
![[ ]](/icons/layout.gif) | Electromagnetic_Fields_Theory,_worked_examples_and_problems_by_Ruth.pdf | 2022-10-28 11:10 | 7.4M | |
![[ ]](/icons/layout.gif) | Calculations_in_Fundamental_Physics_Electricity_and_Magnetism_by.pdf | 2022-10-28 11:11 | 4.8M | |
![[ ]](/icons/layout.gif) | Electromagnetic Waves by Aziz S. Inan (z-lib.org).pdf | 2022-10-28 11:11 | 20M | |
![[ ]](/icons/layout.gif) | Engineering_Electromagnetics_and_Waves_by_Umran_S_Inan,_Aziz_Inan.pdf | 2022-10-28 11:11 | 23M | |
![[ ]](/icons/layout.gif) | Introduction_to_Engineering_Electromagnetics_by_Yeon_Ho_Lee_auth.pdf | 2022-10-28 11:11 | 11M | |
![[ ]](/icons/layout.gif) | PRINCIPLES_AND_APPLICATIONS_OF_Electromagnetic_Fields_by_ROBERT.pdf | 2022-10-28 11:11 | 40M | |
![[ ]](/icons/layout.gif) | Electricity_and_Magnetism_by_D_Chattopadhyay,_P_C_Rakshit_z_lib.pdf | 2022-10-28 11:11 | 104M | |
![[ ]](/icons/layout.gif) | Basic_Engineering_Circuit_Analysis,_Problem_Solving_Companion_by.pdf | 2022-10-28 11:11 | 1.6M | |
![[ ]](/icons/layout.gif) | Network Analysis And Synthesis by Singh (z-lib.org).pdf | 2022-10-28 11:13 | 44M | |
![[ ]](/icons/layout.gif) | Network Analysis by M.E. Van Valkenburg (z-lib.org).pdf | 2022-10-28 11:13 | 18M | |
![[ ]](/icons/layout.gif) | Power_Electronics_Advanced_Conversion_Technologies,_Second_Edition.pdf | 2022-10-28 11:14 | 28M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Electric_Circuits_McGraw_Hill_Education_2021_7th.pdf | 2022-10-28 11:15 | 34M | |
![[ ]](/icons/layout.gif) | Elements_of_Electromagnetics_Oxford_University_Press_2018_Matthew.pdf | 2022-10-28 11:15 | 28M | |
![[ ]](/icons/layout.gif) | PV Electrical Engineering.pdf | 2022-10-28 11:15 | 18M | |
![[ ]](/icons/layout.gif) | Power_System_Engineering_Planning,_Design,_and_Operation_of_Power.pdf | 2022-10-28 11:15 | 3.7M | |
![[ ]](/icons/layout.gif) | @BookUp.Microgrids and Active Distribution Networks.pdf | 2022-10-28 11:15 | 3.1M | |
![[ ]](/icons/layout.gif) | Control System Engineering-Norman S.nise-6th Edition.pdf | 2022-10-28 11:15 | 21M | |
![[ ]](/icons/layout.gif) | Modern Power Electronics And Ac Drives.pdf | 2022-10-28 11:15 | 28M | |
![[ ]](/icons/unknown.gif) | Engineering Circuit Analysis by William Hayt.PDF | 2022-10-28 11:15 | 31M | |
![[ ]](/icons/layout.gif) | electric-drive-systems-and-operation.pdf | 2022-10-28 11:15 | 4.3M | |
![[ ]](/icons/layout.gif) | introduction-to-power-electronics.pdf | 2022-10-28 11:15 | 3.6M | |
![[ ]](/icons/layout.gif) | Power Electronic mohan(2nd).pdf | 2022-10-28 11:15 | 11M | |
![[ ]](/icons/layout.gif) | circuit-analysis.pdf | 2022-10-28 11:16 | 16M | |
![[ ]](/icons/layout.gif) | electrical-power.pdf | 2022-10-28 11:16 | 5.2M | |
![[ ]](/icons/layout.gif) | Power System Analysis and Design -fifth edit.pdf | 2022-10-28 11:16 | 16M | |
![[ ]](/icons/layout.gif) | Power_System_Analysis_John_Grainger_1st.pdf | 2022-10-28 11:16 | 39M | |
![[ ]](/icons/layout.gif) | Renewable Powe Generation.pdf | 2022-10-28 11:16 | 8.4M | |
![[ ]](/icons/layout.gif) | [prabha kundur] power system stability and control.pdf | 2022-10-28 11:16 | 36M | |
![[ ]](/icons/layout.gif) | Power System by C.L. Wadhwa.pdf | 2022-10-28 11:16 | 7.4M | |
![[ ]](/icons/layout.gif) | Practical_Professional_Books_Leslie.pdf | 2022-10-28 11:16 | 6.7M | |
![[ ]](/icons/layout.gif) | Juan_M__Gers,_Edward_J__Holmes_P.pdf | 2022-10-28 11:16 | 7.5M | |
![[ ]](/icons/layout.gif) | Protection.pdf | 2022-10-28 11:16 | 8.4M | |
![[ ]](/icons/layout.gif) | power system analysis - hadi saadat- ElCoM.pdf | 2022-10-28 11:16 | 29M | |
![[ ]](/icons/layout.gif) | Haitham_Abu_Rub,_Atif_Iqbal,_Jar.pdf | 2022-10-28 11:16 | 11M | |
![[ ]](/icons/layout.gif) | Electrical_power_Distribution_System.pdf | 2022-10-28 11:16 | 36M | |
![[ ]](/icons/layout.gif) | pscad_users_guide_v4_6.pdf | 2022-10-28 11:16 | 6.9M | |
![[ ]](/icons/layout.gif) | Gonen,_Turan_Electrical_Machines.pdf | 2022-10-28 11:16 | 55M | |
![[ ]](/icons/layout.gif) | optimal control systems,subbaram naidu.pdf | 2022-10-28 11:16 | 16M | |
![[ ]](/icons/layout.gif) | Gerhard_Henneberger_Electrical_Machines.pdf | 2022-10-28 11:16 | 14M | |
![[ ]](/icons/layout.gif) | The_electrical_engineering_handbook.pdf | 2022-10-28 11:16 | 18M | |
![[ ]](/icons/layout.gif) | Leslie_Hewitson,_Mark_Brown,_Ram.pdf | 2022-10-28 11:16 | 6.7M | |
![[ ]](/icons/layout.gif) | IET_Power_and_Energy_Series_65_Juan.pdf | 2022-10-28 11:16 | 7.5M | |
![[ ]](/icons/layout.gif) | RASHID_Power_Electronics_Handbook.pdf | 2022-10-28 11:16 | 24M | |
![[ ]](/icons/layout.gif) | make -volume 36.pdf | 2022-10-28 11:17 | 30M | |
![[ ]](/icons/layout.gif) | electric power distribution handbook.pdf | 2022-10-28 11:17 | 20M | |
![[ ]](/icons/layout.gif) | Electrical Power System Quality by R C Dugan.pdf | 2022-10-28 11:17 | 4.4M | |
![[ ]](/icons/layout.gif) | Electric Machinery.pdf | 2022-10-28 11:17 | 16M | |
![[ ]](/icons/layout.gif) | Handbook_of_Electrical_Engineering.pdf | 2022-10-28 11:17 | 3.8M | |
![[ ]](/icons/layout.gif) | Power Generation Operation & Control-Allen-Wood.pdf | 2022-10-28 11:17 | 21M | |
![[ ]](/icons/layout.gif) | circuit-analysis (2).pdf | 2022-10-28 11:17 | 16M | |
![[ ]](/icons/layout.gif) | Bedalov,_Zark_Practical_power_plant_engineering_a_guide_for_early.pdf | 2022-10-28 11:17 | 60M | |
![[ ]](/icons/layout.gif) | High_Voltage_Engineering_CRC_Press_2014_Farouk_A_M_Rizk,_Giao_N.pdf | 2022-10-28 11:17 | 77M | |
![[ ]](/icons/layout.gif) | The_Electrical_engineering_handbook_series_Jerry_C_Whitaker_The.pdf | 2022-10-28 11:17 | 26M | |
![[ ]](/icons/layout.gif) | hughes-electrical-and-electronic-technology-10th-edition.pdf | 2022-11-01 06:01 | 12M | |
![[ ]](/icons/layout.gif) | Bird J. Electrical and Electronic Principles and Technology.pdf | 2022-11-01 06:01 | 6.1M | |
![[ ]](/icons/layout.gif) | Textbook of electrical technology by R K Rajput.pdf | 2022-11-01 06:01 | 24M | |
![[ ]](/icons/layout.gif) | CQHP_Electrical Installation 2007.pdf | 2022-11-01 06:02 | 3.6M | |
![[ ]](/icons/layout.gif) | The_Institute_of_Engineering_and_Technology_and_Bz_lib_org.pdf | 2022-11-01 06:02 | 14M | |
![[ ]](/icons/layout.gif) | Electrical Wiring Industrial - Stephen L. Herman.pdf | 2022-11-01 06:03 | 31M | |
![[ ]](/icons/layout.gif) | Power system Engineering by Rajput.pdf | 2022-11-01 06:03 | 45M | |
![[ ]](/icons/layout.gif) | 50. HVAC Controls and Building Automation Systems.pdf | 2022-11-01 06:05 | 20M | |
![[ ]](/icons/unknown.gif) | HVAC Good Practice Guide.PDF | 2022-11-01 06:05 | 10M | |
![[ ]](/icons/layout.gif) | Book_no_19_2_Everything_Electrical_How_to_test_circuits_like_a_pro.pdf | 2022-11-01 06:06 | 3.6M | |
![[ ]](/icons/layout.gif) | Book_no_19_1_Everything_Electrical_How_to_use_all_the_functions.pdf | 2022-11-01 06:06 | 1.4M | |
![[ ]](/icons/layout.gif) | Book_no_61_Robert_J_Alonzo_Electrical_Codes,_Standards,_Recommended.pdf | 2022-11-01 06:06 | 2.2M | |
![[ ]](/icons/layout.gif) | AutoCAD Electrical 2016 7th Edition-1.pdf | 2022-11-01 06:06 | 56M | |
![[ ]](/icons/layout.gif) | 8502_Code_of_Practice_for_the_Eelctricity.pdf | 2022-11-01 06:07 | 3.7M | |
|