![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | the_princess_saves_herself_in_this_one_by_Amanda_Lovelace_z_lib.pdf | 2022-11-12 07:55 | 673K | |
![[ ]](/icons/layout.gif) | lean-product-management-successful-products.pdf | 2022-11-10 03:08 | 14M | |
![[ ]](/icons/layout.gif) | its-not-luck.pdf | 2022-11-10 03:08 | 1.3M | |
![[ ]](/icons/layout.gif) | blackboardeng[4909].pdf | 2022-11-02 05:58 | 2.5M | |
![[ ]](/icons/layout.gif) | [@pdfbooksyouneed] Practical IELTS Speaking.pdf | 2022-10-20 03:39 | 66M | |
![[ ]](/icons/layout.gif) | [@pdfbooksyouneed] IELTS Writing Task 2 SImon.pdf | 2022-11-14 06:39 | 612K | |
![[ ]](/icons/layout.gif) | [@pdfbooksyouneed] 50 Sample Essays book Task 1 & Task 2.pdf | 2022-10-26 11:24 | 1.7M | |
![[ ]](/icons/unknown.gif) | Word Power Made Easy Norman Lewis.PDF | 2022-10-20 06:56 | 20M | |
![[ ]](/icons/layout.gif) | Why_We_Sleep_Unlocking_the_Power_of_Sleep_and_Dreams_by_Matthew.pdf | 2022-11-12 07:56 | 3.4M | |
![[ ]](/icons/layout.gif) | When Breath Becomes Air by Paul Kalanithi (z-lib.org)-1.pdf | 2022-11-12 07:57 | 717K | |
![[ ]](/icons/layout.gif) | University_of_Berkshire_Hathaway_30_Years_of_Lessons_Learned_from.pdf | 2022-11-12 07:50 | 6.9M | |
![[ ]](/icons/layout.gif) | Unfuk_Yourself_Get_Out_of_Your_Head_and_into_Your_Life_by_Gary_John.pdf | 2022-11-12 07:55 | 483K | |
![[ ]](/icons/layout.gif) | Traction_How_Any_Startup_Can_Achieve_Explosive_Customer_Growth_by.pdf | 2022-11-12 07:53 | 1.9M | |
![[ ]](/icons/layout.gif) | Tools_of_Titans_The_Tactics,_Routines,_and_Habits_of_Billionaires.pdf | 2022-11-12 07:50 | 7.5M | |
![[ ]](/icons/layout.gif) | Thirteen Reasons Why by Jay Asher.pdf | 2022-11-12 09:28 | 750K | |
![[ ]](/icons/layout.gif) | Thinking Fast and Slow by Daniel Kahneman.pdf | 2022-11-12 09:28 | 2.9M | |
![[ ]](/icons/layout.gif) | Thinking, Fast and Slow by Daniel Kahneman (z-lib.org).pdf | 2022-11-12 07:55 | 3.5M | |
![[ ]](/icons/layout.gif) | Think_Like_a_Freak_The_Authors_of_Freakonomics_Offer_to_Retrain.pdf | 2022-11-12 07:53 | 1.1M | |
![[ ]](/icons/layout.gif) | The_Tipping_Point_How_Little_Things_Can_Make_a_Big_Difference_by.pdf | 2022-11-12 07:54 | 1.3M | |
![[ ]](/icons/layout.gif) | The_Third_Door_The_Wild_Quest_to_Uncover_How_the_World’s_Most_Successful.pdf | 2022-11-12 07:50 | 2.6M | |
![[ ]](/icons/layout.gif) | The_Snowball_Warren_Buffett_and_the_Business_of_Life_by_Alice_Schroeder.pdf | 2022-11-12 07:56 | 7.1M | |
![[ ]](/icons/layout.gif) | The_Question_Book_What_Makes_You_Tick_by_Mikael_Krogerus_Roman_Tschäppeler.pdf | 2022-11-12 07:55 | 2.0M | |
![[ ]](/icons/layout.gif) | The_Power_of_Now_A_Guide_to_Spiritual_Enlightenment_by_Eckhart_Tolle.pdf | 2022-11-12 07:49 | 758K | |
![[ ]](/icons/layout.gif) | The_Personal_MBA_Master_the_Art_of_Business_by_Josh_Kaufman_z_lib.pdf | 2022-11-12 07:54 | 2.6M | |
![[ ]](/icons/layout.gif) | The_ONE_Thing_The_Surprisingly_Simple_Truth_Behind_Extraordinary.pdf | 2022-11-12 07:53 | 3.5M | |
![[ ]](/icons/layout.gif) | The_Multi_Hyphen_Method_Work_Less,_Create_More_and_Design_a_Career.pdf | 2022-11-12 07:53 | 1.4M | |
![[ ]](/icons/layout.gif) | The_Monk_Who_Sold_His_Ferrari_A_Fable_About_Fulfilling_Your_Dreams.pdf | 2022-11-12 07:52 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Monk_Who_Sold_His_Ferrari_A_Fable_About_Fulfilling_Your_Dreams (2).pdf | 2022-11-12 07:55 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Midnight_Library_Reasons_to_Stay_Alive_By_Matt_Haig_2_Books.pdf | 2022-11-12 07:49 | 2.5M | |
![[ ]](/icons/layout.gif) | The_Little_Prince_by_Antoine_De_Saint_Exupery_z_lib_org_epub.pdf | 2022-11-12 07:55 | 1.0M | |
![[ ]](/icons/layout.gif) | The_Little_Book_of_Common_Sense_Investing_The_Only_Way_to_Guarantee.pdf | 2022-11-12 07:50 | 3.0M | |
![[ ]](/icons/layout.gif) | The_Lean_Startup_How_Todays_Entrepreneurs_Use_Continuous_Innovation.pdf | 2022-11-12 07:53 | 2.0M | |
![[ ]](/icons/layout.gif) | The_Intelligent_Investor_The_Definitive_Book_On_V_859143_z_lib_org.pdf | 2022-11-12 07:57 | 5.1M | |
![[ ]](/icons/layout.gif) | The_Greatest_Trade_Ever_The_Behind_the_Scenes_Story_of_How_John.pdf | 2022-11-12 07:56 | 24M | |
![[ ]](/icons/layout.gif) | The_Great_Gatsby_Wordsworth_Classics_by_F_Scott_Fitzgerald_z_lib.pdf | 2022-11-12 07:54 | 13M | |
![[ ]](/icons/layout.gif) | The_Grain_Brain_Whole_Life_Plan_Boost_Brain_Performance,_Lose_Weight.pdf | 2022-11-12 07:52 | 1.9M | |
![[ ]](/icons/layout.gif) | The_Firm_The_Story_of_McKinsey_and_Its_Secret_Influence_on_American.pdf | 2022-11-12 07:54 | 3.5M | |
![[ ]](/icons/layout.gif) | The_Emotionally_Intelligent_Manager_How_to_Develop_and_Use_the_Four.pdf | 2022-11-12 07:52 | 2.6M | |
![[ ]](/icons/layout.gif) | The_Daily_Stoic_366_Meditations_on_Wisdom,_Perseverance,_and_the.pdf | 2022-11-12 07:56 | 3.3M | |
![[ ]](/icons/layout.gif) | The_Courage_to_be_Disliked_How_to_Change_Your_Life_and_Achieve_Real.pdf | 2022-11-12 07:56 | 2.4M | |
![[ ]](/icons/layout.gif) | The_Courage_to_Be_Disliked_by_Ichiro_Kishimi_Fumitake_Koga_z_lib.pdf | 2022-11-12 07:54 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Big_Leap_Conquer_Your_Hidden_Fear_and_Take_Life_to_the_Next.pdf | 2022-11-12 07:54 | 5.0M | |
![[ ]](/icons/layout.gif) | The_Art_of_Public_Speaking_The_Original_Tool_for_Improving_Public.pdf | 2022-11-12 07:54 | 4.9M | |
![[ ]](/icons/layout.gif) | The_8020_Principle_The_Secret_to_Achieving_More_with_Less_by_Richard.pdf | 2022-11-12 07:56 | 3.4M | |
![[ ]](/icons/layout.gif) | The_7_habits_of_highly_effective_people_restoring_702081_z_lib_org.pdf | 2022-11-12 07:56 | 1.6M | |
![[ ]](/icons/layout.gif) | The_5_Love_Languages_The_Secret_to_Love_That_Lasts_by_Gary_Chapman.pdf | 2022-11-12 07:56 | 1.0M | |
![[ ]](/icons/layout.gif) | The_5_AM_Club_Own_Your_Morning,_Elevate_Your_Life_by_Robin_Sharma.pdf | 2022-11-12 07:55 | 4.3M | |
![[ ]](/icons/layout.gif) | The_4_Hour_Workweek_Escape_9_5,_Live_Anywhere,_and_Join_the_New.pdf | 2022-11-12 07:55 | 3.3M | |
![[ ]](/icons/layout.gif) | The_4_Hour_Body_An_Uncommon_Guide_to_Rapid_Fat_Loss,_Incredible.pdf | 2022-11-12 07:54 | 8.3M | |
![[ ]](/icons/layout.gif) | The World as I See It by Einstein Albert (z-lib.org).epub.pdf | 2022-11-12 07:52 | 1.4M | |
![[ ]](/icons/layout.gif) | The Silent Patient by Alex Michaelides (z-lib.org).epub.pdf | 2022-11-12 07:55 | 1.4M | |
![[ ]](/icons/layout.gif) | The Secret of the Nagas by Amish Tripathi z-liborgepub.pdf | 2022-11-12 07:49 | 1.4M | |
![[ ]](/icons/layout.gif) | The Secret by Rhonda Byrne.pdf | 2022-11-12 09:31 | 4.1M | |
![[ ]](/icons/layout.gif) | The Science of Getting Rich.pdf | 2022-10-22 07:28 | 1.0M | |
![[ ]](/icons/layout.gif) | The Outsider A Novel by King Stephen (z-lib.org).epub.pdf | 2022-11-12 07:50 | 2.9M | |
![[ ]](/icons/layout.gif) | The Oath of The Vayuputras by Amish z-liborgmobi.pdf | 2022-11-12 07:42 | 1.9M | |
![[ ]](/icons/layout.gif) | The Life-Changing Magic of Tidying Up by Marie Kondo.pdf | 2022-11-12 07:41 | 1.4M | |
![[ ]](/icons/layout.gif) | The Kite Runner by Khaled Hosseini (z-lib.org).pdf | 2022-11-12 07:56 | 1.4M | |
![[ ]](/icons/layout.gif) | The Institute by Stephen King (z-lib.org).epub.pdf | 2022-11-12 07:51 | 5.8M | |
![[ ]](/icons/layout.gif) | The Hindu view of Education.pdf | 2022-11-12 07:40 | 866K | |
![[ ]](/icons/layout.gif) | The Godfather by Puzo Mario (z-lib.org).epub.pdf | 2022-11-12 07:49 | 1.4M | |
![[ ]](/icons/layout.gif) | The Four Agreements by Don Miguel Ruiz.pdf | 2022-11-12 09:28 | 648K | |
![[ ]](/icons/layout.gif) | The Final Girl Support Group By Grady Hendrix.pdf | 2022-11-12 09:28 | 3.1M | |
![[ ]](/icons/layout.gif) | The Fault in Our Stars by Green John (z-lib.org).epub.pdf | 2022-11-12 07:55 | 2.3M | |
![[ ]](/icons/layout.gif) | The Compound Effect by Darren Hardy (z-lib.org).epub.pdf | 2022-11-12 07:54 | 1.7M | |
![[ ]](/icons/layout.gif) | The Book Thief by Markus Zusak (z-lib.org).pdf | 2022-11-12 07:56 | 4.2M | |
![[ ]](/icons/layout.gif) | The Art of Seduction by Robert Greene (z-lib.org).epub-1.pdf | 2022-11-12 07:55 | 2.2M | |
![[ ]](/icons/layout.gif) | The Arthashastra - PDFDrive.com (Kautilya) (z-lib.org).pdf | 2022-11-12 07:42 | 18M | |
![[ ]](/icons/layout.gif) | The 50th Law by 50 Cent, Robert Greene (z-lib.org).epub.pdf | 2022-11-12 07:55 | 798K | |
![[ ]](/icons/layout.gif) | The 48 Laws of Power by Robert Greene (z-lib.org).epub.pdf | 2022-11-12 07:56 | 2.7M | |
![[ ]](/icons/layout.gif) | The 5 AM Club - Robin Sharma.pdf | 2022-10-20 10:52 | 4.4M | |
![[ ]](/icons/layout.gif) | Talk_Like_TED_The_9_Public_Speaking_Secrets_of_the_Worlds_Top_Minds.pdf | 2022-11-12 07:53 | 1.7M | |
![[ ]](/icons/layout.gif) | Talk Like Ted #Carmine Gallo.pdf.pdf | 2022-11-06 06:42 | 1.7M | |
![[ ]](/icons/layout.gif) | TED_Talks_The_Official_TED_Guide_to_Public_Speaking_by_Chris_Anderson.pdf | 2022-11-12 07:53 | 1.9M | |
![[ ]](/icons/layout.gif) | Super_memory_it_can_be_yours_by_Devi,_Shakuntala_z_lib_org_epub.pdf | 2022-11-12 07:52 | 3.9M | |
![[ ]](/icons/layout.gif) | Steve Jobs by Walter Isaacson.pdf | 2022-11-12 09:29 | 37M | |
![[ ]](/icons/layout.gif) | Steve Jobs by Isaacson Walter (z-lib.org).epub.pdf | 2022-11-12 07:50 | 7.9M | |
![[ ]](/icons/layout.gif) | Start_with_Why_How_Great_Leaders_Inspire_Everyone_882239_z_lib_org.pdf | 2022-11-12 07:57 | 1.4M | |
![[ ]](/icons/layout.gif) | Spoken English_ Flourish Your Language.pdf | 2022-11-01 10:35 | 5.1M | |
![[ ]](/icons/layout.gif) | Spoken English Course Level 5-AJARUDDIN.pdf | 2022-10-26 09:59 | 1.9M | |
![[ ]](/icons/layout.gif) | Spoken English Course Level 4.pdf | 2022-10-26 09:59 | 839K | |
![[ ]](/icons/layout.gif) | Spoken English Course Level 3.pdf | 2022-10-26 09:59 | 1.4M | |
![[ ]](/icons/layout.gif) | Spoken English Course Level 1.pdf | 2022-10-26 09:59 | 1.2M | |
![[ ]](/icons/layout.gif) | So_good_they_cant_ignore_you_why_skills_trump_passion_in_the_quest.pdf | 2022-11-12 07:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Shoe_Dog_A_Memoir_by_the_Creator_of_Nike_by_Phil_Knight_z_lib_org.pdf | 2022-11-12 07:50 | 2.4M | |
![[ ]](/icons/layout.gif) | Self_Discipline_Mindset_Why_Self_Discipline_Is_Lacking_in_Most_and.pdf | 2022-11-12 07:54 | 459K | |
![[ ]](/icons/layout.gif) | Secrets of Closing the Sale by Zig Ziglar (z-lib.org).epub.pdf | 2022-11-12 07:53 | 1.3M | |
![[ ]](/icons/layout.gif) | Rocket_Fuel_The_One_Essential_Combination_That_Will_Get_You_More.pdf | 2022-11-12 07:53 | 3.7M | |
![[ ]](/icons/layout.gif) | Rich Dad Poor Dad.pdf | 2022-10-20 06:57 | 11M | |
![[ ]](/icons/layout.gif) | Psychology-A-Self-Teaching-Guide-English (1).pdf | 2022-10-20 06:59 | 2.0M | |
![[ ]](/icons/layout.gif) | Prospect Magazine - December 2022.pdf | 2022-11-04 11:21 | 14M | |
![[ ]](/icons/layout.gif) | Project Hail Mary by Andy Weir.pdf | 2022-11-12 09:31 | 6.8M | |
![[ ]](/icons/layout.gif) | Principles Life and Work by Ray Dalio (z-lib.org).epub.pdf | 2022-11-12 07:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Pillow_Thoughts_by_Courtney_Peppernell_Peppernell,_Courtney_z_lib.pdf | 2022-11-12 07:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Objective General English SP Bakshi.pdf | 2022-10-20 06:57 | 124M | |
![[ ]](/icons/layout.gif) | Nothing Ventured Archer Jeffrey.pdf | 2022-11-06 06:32 | 4.3M | |
![[ ]](/icons/layout.gif) | Noise By Daniel Kahneman.pdf | 2022-11-12 09:28 | 3.3M | |
![[ ]](/icons/layout.gif) | Nehru's Fatal Friendship.pdf | 2022-11-12 07:40 | 1.9M | |
![[ ]](/icons/layout.gif) | Moonwalking_with_Einstein_The_Art_and_Science_of_Remembering_Everything.pdf | 2022-11-12 07:55 | 956K | |
![[ ]](/icons/layout.gif) | Milk and Honey by Rupi Kaur (z-lib.org).epub.pdf | 2022-11-12 07:50 | 1.7M | |
![[ ]](/icons/layout.gif) | Me Before You by Moyes Jojo (z-lib.org).epub.pdf | 2022-11-12 07:55 | 2.1M | |
![[ ]](/icons/layout.gif) | Maximum_Influence_The_12_Universal_Laws_of_Power_by_Kurt_W_Mortensen.pdf | 2022-11-12 07:53 | 1.7M | |
![[ ]](/icons/layout.gif) | Mastery by Robert Greene (z-lib.org).epub.pdf | 2022-11-12 07:56 | 2.2M | |
![[ ]](/icons/layout.gif) | Manipulation_Dark_Psychology_to_Manipulate_and_Control_People_by.pdf | 2022-11-12 07:54 | 430K | |
![[ ]](/icons/layout.gif) | Logic_Made_Easy_How_to_Know_When_Language_Deceives_You_by_Deborah.pdf | 2022-11-12 07:54 | 3.7M | |
![[ ]](/icons/layout.gif) | Letter_Writing_An_Art_Upkar_s.pdf | 2022-10-20 03:18 | 18M | |
![[ ]](/icons/layout.gif) | Leadership_Secrets_of_the_Worlds_Most_Successful_CEOs_100_Top_Executives.pdf | 2022-11-12 07:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Its Ok That You're Not Ok by Megan Devine.pdf | 2022-10-25 03:56 | 1.7M | |
![[ ]](/icons/layout.gif) | Indistractable_How_to_Control_Your_Attention_and_Choose_Your_Life.pdf | 2022-11-12 07:52 | 11M | |
![[ ]](/icons/layout.gif) | India Since Independence.pdf | 2022-11-14 03:23 | 3.1M | |
![[ ]](/icons/layout.gif) | India's Struggle for Independence.pdf | 2022-11-14 03:23 | 4.4M | |
![[ ]](/icons/layout.gif) | India’s_Most_Fearless_2_More_Military_Stories_of_Unimaginable_Courage.pdf | 2022-11-12 07:42 | 1.8M | |
![[ ]](/icons/layout.gif) | In_the_Service_of_Free_India_Memoir_of_a_Civil_Servant_by_B_D_Pande.pdf | 2022-11-12 07:40 | 3.7M | |
![[ ]](/icons/layout.gif) | Immortals_of_Meluha_The_Shiva_Trilogy_Book_1_by_Amish_Tripathi_z.pdf | 2022-11-12 07:49 | 1.4M | |
![[ ]](/icons/layout.gif) | INDIA AFTER GANDHI.pdf | 2022-11-14 03:23 | 6.1M | |
![[ ]](/icons/layout.gif) | How to Be a Genius by DK, John Woodward (z-lib.org)-1.pdf | 2022-11-12 07:55 | 81M | |
![[ ]](/icons/layout.gif) | How the Mind Works by Steven Pinker (z-lib.org).pdf | 2022-11-12 07:50 | 5.0M | |
![[ ]](/icons/layout.gif) | How the Mind Works by Steven Pinker (z-lib.org) (2).pdf | 2022-11-12 07:54 | 5.0M | |
![[ ]](/icons/layout.gif) | How_to_stop_worrying_and_start_living_by_Dale_Carnegie_z_lib_org.pdf | 2022-11-12 07:53 | 1.1M | |
![[ ]](/icons/layout.gif) | How_to_Win_Friends_and_Influence_People_in_the_Digital_Age_by_Dale.pdf | 2022-11-12 07:53 | 3.8M | |
![[ ]](/icons/layout.gif) | How_to_Be_an_Introvert_In_an_Extrovert_World.pdf | 2022-10-20 06:58 | 1.5M | |
![[ ]](/icons/layout.gif) | How_Not_to_Die_Discover_the_Foods_Scientifically_Proven_to_Prevent.pdf | 2022-11-12 07:52 | 5.8M | |
![[ ]](/icons/layout.gif) | Her_by_Pierre_Alex_Jeanty_Tremanda_Pewett_Omar_Rodriguez_z_lib_org.pdf | 2022-11-12 07:54 | 1.9M | |
![[ ]](/icons/layout.gif) | Grit_The_Power_of_Passion_and_Perseverance_by_Angela_Duckworth_z.pdf | 2022-11-12 07:52 | 3.6M | |
![[ ]](/icons/layout.gif) | Grain_Brain_The_Surprising_Truth_about_Wheat,_Carbs,_and_Sugar_Your.pdf | 2022-11-12 07:52 | 1.5M | |
![[ ]](/icons/layout.gif) | Gone Girl by Flynn Gillian (z-lib.org).epub-1.pdf | 2022-11-12 07:56 | 2.2M | |
![[ ]](/icons/layout.gif) | Goals by Brian Tracy .pdf | 2022-11-01 10:41 | 704K | |
![[ ]](/icons/layout.gif) | Get a Grip by Gino Wickman (z-lib.org).epub.pdf | 2022-11-12 07:53 | 4.6M | |
![[ ]](/icons/layout.gif) | Gandhi The Master.pdf | 2022-11-12 07:40 | 7.4M | |
![[ ]](/icons/layout.gif) | Games_People_Play_The_Psychology_of_Human_Relationships_by_Eric.pdf | 2022-11-12 07:56 | 1.3M | |
![[ ]](/icons/layout.gif) | Freakonomics_A_Rogue_Economist_Explores_the_Hidden_Side_of_Everything.pdf | 2022-11-12 07:53 | 2.3M | |
![[ ]](/icons/layout.gif) | Follow Mahatma.pdf | 2022-11-12 07:40 | 6.8M | |
![[ ]](/icons/layout.gif) | Finish_What_You_Start_The_Art_of_Following_Through,_Taking_Action.pdf | 2022-11-12 07:56 | 620K | |
![[ ]](/icons/layout.gif) | Exactly_What_to_Say_The_Magic_Words_for_Influence_and_Impact_by.pdf | 2022-11-12 07:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Everything_Is_Figureoutable_by_Forleo,_Marie_z_lib_org_epub.pdf | 2022-11-12 07:50 | 2.8M | |
![[ ]](/icons/layout.gif) | Essentialism_The_Disciplined_Pursuit_of_Less_by_Greg_McKeown_z_lib.pdf | 2022-11-12 07:53 | 1.8M | |
![[ ]](/icons/layout.gif) | Educated A Memoir by Tara Westover (z-lib.org).epub.pdf | 2022-11-12 07:56 | 3.2M | |
![[ ]](/icons/layout.gif) | Eat_That_Frog_21_Great_Ways_to_Stop_Procrastinating_and_Get_More.pdf | 2022-11-12 07:55 | 1.7M | |
![[ ]](/icons/layout.gif) | ETC Book.pdf | 2022-10-20 09:22 | 34M | |
![[ ]](/icons/layout.gif) | Do Epic Shit by Ankur warikoo z-liborgepub.pdf | 2022-11-12 07:49 | 2.1M | |
![[ ]](/icons/layout.gif) | Do Epic Shit by Ankur Warikoo.pdf | 2022-11-12 09:31 | 1.2M | |
![[ ]](/icons/layout.gif) | Deep_Work_Rules_for_focused_success_in_a_distracted_world_by_Cal.pdf | 2022-11-12 07:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Deep Work by Cal Newport.pdf | 2022-11-12 09:29 | 1.5M | |
![[ ]](/icons/layout.gif) | David_and_Goliath_Underdogs,_Misfits,_and_the_Art_of_Battling_Giants.pdf | 2022-11-12 07:52 | 2.3M | |
![[ ]](/icons/layout.gif) | David_and_Goliath_Underdogs,_Misfits,_and_the_Art_of_Battling_Giants (2).pdf | 2022-11-12 07:54 | 2.3M | |
![[ ]](/icons/layout.gif) | Daring_Greatly_How_the_Courage_to_Be_Vulnerable_Transforms_the_Way.pdf | 2022-11-12 07:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Crashed_How_a_Decade_of_Financial_Crises_Changed_the_World_by_Adam.pdf | 2022-11-12 07:51 | 19M | |
![[ ]](/icons/layout.gif) | Correct Your English Errors Second Edition.pdf | 2022-11-01 10:35 | 14M | |
![[ ]](/icons/layout.gif) | Correct Your English Errors, first edition.pdf | 2022-11-01 10:35 | 9.6M | |
![[ ]](/icons/layout.gif) | Constructing A Lexicon of English Verbs.pdf | 2022-10-28 03:07 | 7.5M | |
![[ ]](/icons/layout.gif) | Common_Stocks_and_Uncommon_Profits_and_Other_Writings_by_Philip.pdf | 2022-11-12 07:50 | 2.5M | |
![[ ]](/icons/layout.gif) | Chase_the_lion_if_your_dream_doesnt_scare_you,_its_too_small_by.pdf | 2022-11-12 07:53 | 3.3M | |
![[ ]](/icons/layout.gif) | Chanakya_Neeti_with_Sutras_of_Chanakya_Included_by_B_K_Chaturvedi.pdf | 2022-11-12 07:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Challenge and Strategy, Rethinking India's Foreign Policy - Sikri, Rajiv[freeupscmaterials.wordpress.com]_2.pdf | 2022-11-14 03:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Captivate_The_Science_of_Succeeding_with_People_by_Vanessa_Van_Edwards.pdf | 2022-11-12 07:49 | 12M | |
![[ ]](/icons/layout.gif) | Buyology_Truth_and_Lies_About_Why_We_Buy_by_Martin_Lindstrom_z_lib.pdf | 2022-11-12 07:52 | 753K | |
![[ ]](/icons/layout.gif) | Business_Adventures_Twelve_Classic_Tales_from_the_World_of_Wall.pdf | 2022-11-12 07:42 | 1.7M | |
![[ ]](/icons/layout.gif) | Brain_Maker_The_Power_of_Gut_Microbes_to_Heal_and_Protect_Your_Brain–for.pdf | 2022-11-12 07:52 | 1.8M | |
![[ ]](/icons/layout.gif) | Born_a_Crime_Stories_from_a_South_African_Childhood_by_Trevor_Noah.pdf | 2022-11-12 07:52 | 2.4M | |
![[ ]](/icons/layout.gif) | Blue_Ocean_Strategy,_Expanded_Edition_How_to_Create_Uncontested.pdf | 2022-11-12 07:52 | 4.7M | |
![[ ]](/icons/layout.gif) | Blink_The_Power_of_Thinking_Without_Thinking_by_Malcolm_Gladwell.pdf | 2022-11-12 07:52 | 37M | |
![[ ]](/icons/layout.gif) | Blink_The_Power_of_Thinking_Without_Thinking_by_Malcolm_Gladwell (2).pdf | 2022-11-12 07:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Biting_the_Bullet_Memoirs_of_a_Police_Officer_by_Ajai_Raj_Sharma.pdf | 2022-11-12 07:40 | 2.5M | |
![[ ]](/icons/layout.gif) | Big_Magic_Creative_Living_Beyond_Fear_by_Elizabeth_Gilbert_z_lib.pdf | 2022-11-12 07:54 | 1.8M | |
![[ ]](/icons/layout.gif) | Beloved Delhi_ A Mughal City and her Greatest Poets .pdf | 2022-11-03 03:36 | 2.2M | |
![[ ]](/icons/layout.gif) | Beautiful World, Where Are You.pdf | 2022-11-12 07:41 | 1.9M | |
![[ ]](/icons/layout.gif) | Barrons November 7 2022.pdf | 2022-11-10 03:08 | 10M | |
![[ ]](/icons/layout.gif) | Atomic habits - James Clear.pdf | 2022-11-01 10:41 | 4.4M | |
![[ ]](/icons/layout.gif) | Atomic_Habits_An_Easy_Proven_Way_to_Build_Good_Habits_Break_Bad.pdf | 2022-11-12 07:56 | 5.9M | |
![[ ]](/icons/layout.gif) | And Then There Were None by Agatha Christie (z-lib.org).epub.pdf | 2022-11-12 07:50 | 910K | |
![[ ]](/icons/layout.gif) | And Then There Were None by Agatha Christie (z-lib.org).epub (2).pdf | 2022-11-12 07:55 | 910K | |
![[ ]](/icons/layout.gif) | An_Astronauts_Guide_to_Life_on_Earth_What_Going_to_Space_Taught.pdf | 2022-11-12 07:49 | 6.5M | |
![[ ]](/icons/layout.gif) | Abundance_The_Future_Is_Better_Than_You_Think_by_Peter_H_Diamandis.pdf | 2022-11-12 07:54 | 6.2M | |
![[ ]](/icons/layout.gif) | A_Stubbornly_Persistent_Illusion_The_Essential_Scientific_Works.pdf | 2022-11-12 07:52 | 2.6M | |
![[ ]](/icons/layout.gif) | A_Brief_History_Of_Time_From_the_Big_Bang_to_Blac_5006445_z_lib.pdf | 2022-11-12 07:57 | 2.5M | |
![[ ]](/icons/layout.gif) | A Student's Introduction to English Grammar ( PDFDrive ).pdf | 2022-11-01 10:35 | 4.8M | |
![[ ]](/icons/layout.gif) | @pdfbooksyouneed_IELTS_Academic_Reading_October_November_2022.pdf | 2022-10-26 11:25 | 2.6M | |
![[ ]](/icons/layout.gif) | @pdfbooksyouneed_31_High_scoring_Formulas_to_Answer_the_IELTS_Speaking.pdf | 2022-11-14 03:42 | 16M | |
![[ ]](/icons/layout.gif) | 1984 by George Orwell (z-lib.org).epub.pdf | 2022-11-12 07:53 | 2.0M | |
![[ ]](/icons/layout.gif) | 400 Days by Chetan Bhagat.pdf | 2022-10-20 06:57 | 1.9M | |
![[ ]](/icons/layout.gif) | 12_Rules_for_Life,_An_Antidote_to_Chaos_by_Jordan_B_Peterson_z_lib.pdf | 2022-11-12 07:53 | 4.3M | |
|