![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 🔺C🔺 INTERVIEW SERIES.pdf | 2023-06-07 09:36 | 1.5M | |
![[ ]](/icons/layout.gif) | (by-Brian-Allbee)-Hands-On-Software-Engineering-wi.pdf | 2023-06-07 09:43 | 20M | |
![[ ]](/icons/layout.gif) | (by-Brian-Okken)-Python-Testing-with-pytest.pdf | 2023-06-07 09:42 | 2.9M | |
![[ ]](/icons/layout.gif) | (by-Irv-Kalb)-Learn-to-Program-with-Python-3-A-St.pdf | 2023-06-07 09:42 | 3.9M | |
![[ ]](/icons/layout.gif) | (by-Nichola-Lacey)-Python-by-Example-Learning-to.pdf | 2023-06-07 09:42 | 9.8M | |
![[ ]](/icons/layout.gif) | (by-Wei-Meng-Lee)-Python-Machine-Learning.pdf | 2023-06-07 09:44 | 8.7M | |
![[ ]](/icons/layout.gif) | 0071611436 HTML.pdf | 2023-05-11 03:31 | 11M | |
![[ ]](/icons/layout.gif) | 1.CheatSheet-Python_Keywords1.pdf | 2023-06-07 10:43 | 83K | |
![[ ]](/icons/layout.gif) | 1. DCN BOOK.pdf | 2023-06-07 09:02 | 11M | |
![[ ]](/icons/layout.gif) | 1.Head First Python (2010).pdf | 2023-06-07 11:15 | 28M | |
![[ ]](/icons/layout.gif) | 1.PythonNotesForProfessionals.pdf | 2023-06-07 10:55 | 6.1M | |
![[ ]](/icons/layout.gif) | 1ed The Book of CSS3 (2011, No Starch Press).pdf | 2023-06-07 10:47 | 15M | |
![[ ]](/icons/layout.gif) | 1st_Practical Packet Analysis [Chris_2007 ,164 pp].pdf | 2023-06-07 10:52 | 11M | |
![[ ]](/icons/layout.gif) | 2.CheatSheet-Python 2 Data-Structures.docx.pdf | 2023-06-07 10:43 | 107K | |
![[ ]](/icons/layout.gif) | 2. Computer-Networks-5th-Edition.pdf | 2023-06-07 09:02 | 8.1M | |
![[ ]](/icons/layout.gif) | 2.LinuxNotesForProfessionals.pdf | 2023-06-07 10:55 | 857K | |
![[ ]](/icons/layout.gif) | 2E_Head First Java.pdf | 2023-06-07 10:48 | 34M | |
![[ ]](/icons/layout.gif) | 2_5388669697040320882.pdf | 2023-06-07 09:49 | 2.5M | |
![[ ]](/icons/layout.gif) | 2_5411399226611468192.pdf | 2023-06-07 09:47 | 9.6M | |
![[ ]](/icons/layout.gif) | 2ed The Book of CSS3 (2014, No Starch Press).pdf | 2023-06-07 10:47 | 9.2M | |
![[ ]](/icons/layout.gif) | 2ed_Gray Hat Hacking.pdf | 2023-06-07 10:29 | 13M | |
![[ ]](/icons/layout.gif) | 2nd_Practical Packet Analysis [Chris_2011,280 pp].pdf | 2023-06-07 10:52 | 16M | |
![[ ]](/icons/layout.gif) | 2nd_Python Machine Learning.pdf | 2023-06-07 10:48 | 11M | |
![[ ]](/icons/layout.gif) | 3.CheatSheet-Python-3_Complex-Data-Types.pdf | 2023-06-07 10:43 | 100K | |
![[ ]](/icons/layout.gif) | 3.JavaNotesForProfessionals.pdf | 2023-06-07 10:55 | 7.0M | |
![[ ]](/icons/layout.gif) | 3ed_Gray Hat Hacking.pdf | 2023-06-07 10:29 | 12M | |
![[ ]](/icons/layout.gif) | 3rd_Practical Packet Analysis [Chris_April 2017, 368 pp].pdf | 2023-06-07 10:51 | 15M | |
![[ ]](/icons/layout.gif) | 3rd_Python Machine Learning.pdf | 2023-06-07 10:48 | 26M | |
![[ ]](/icons/layout.gif) | 4.CheatSheet-Python-4_Classes.pdf | 2023-06-07 10:43 | 158K | |
![[ ]](/icons/layout.gif) | 4.JavaScriptNotesForProfessionals.pdf | 2023-06-07 10:55 | 4.1M | |
![[ ]](/icons/layout.gif) | 4_5976293344223955476.pdf | 2023-06-07 09:50 | 4.1M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382316.pdf | 2023-06-07 09:38 | 21M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382356.pdf | 2023-06-07 09:38 | 6.5M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382376.pdf | 2023-06-07 09:38 | 8.9M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382610.pdf | 2023-06-07 09:38 | 33M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382633.pdf | 2023-06-07 09:38 | 13M | |
![[ ]](/icons/layout.gif) | 4_6019153132108382911.pdf | 2023-06-07 09:38 | 13M | |
![[ ]](/icons/layout.gif) | 4_6019153132108383230.pdf | 2023-06-07 09:38 | 15M | |
![[ ]](/icons/layout.gif) | 4_6019153132108383629.pdf | 2023-06-07 09:38 | 10M | |
![[ ]](/icons/layout.gif) | 4ed_Gray Hat Hacking.pdf | 2023-06-07 10:30 | 16M | |
![[ ]](/icons/layout.gif) | 5.CNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.4M | |
![[ ]](/icons/layout.gif) | 5.CheatSheet-Python-5_-Functions-and-Tricks.pdf | 2023-06-07 10:43 | 97K | |
![[ ]](/icons/layout.gif) | 5ed_Gray Hat Hacking.pdf | 2023-06-07 10:30 | 46M | |
![[ ]](/icons/layout.gif) | 6.CPlusPlusNotesForProfessionals.pdf | 2023-06-07 10:55 | 4.9M | |
![[ ]](/icons/layout.gif) | 6.CheatSheet-Python-6_-Coding-Interview-Questions.pdf | 2023-06-07 10:43 | 122K | |
![[ ]](/icons/layout.gif) | 7.CSharpNotesForProfessionals.pdf | 2023-06-07 10:55 | 5.8M | |
![[ ]](/icons/layout.gif) | 7th_ed_software_engineering_a_practitioners_approach_by_roger_s._pressman_.pdf | 2023-04-25 03:49 | 20M | |
![[ ]](/icons/layout.gif) | 8.CSSNotesForProfessionals.pdf | 2023-06-07 10:55 | 3.3M | |
![[ ]](/icons/layout.gif) | 9.HTML5NotesForProfessionals.pdf | 2023-06-07 10:55 | 1.3M | |
![[ ]](/icons/layout.gif) | 10.HTML5CanvasNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.9M | |
![[ ]](/icons/layout.gif) | 10 mindblowing tricks revoling around f-strings.pdf | 2023-06-07 09:37 | 63K | |
![[ ]](/icons/layout.gif) | 11.Angular2NotesForProfessionals.pdf | 2023-06-07 10:55 | 1.7M | |
![[ ]](/icons/layout.gif) | 12.AngularJSNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.1M | |
![[ ]](/icons/layout.gif) | 13.AndroidNotesForProfessionals.pdf | 2023-06-07 10:55 | 12M | |
![[ ]](/icons/compressed.gif) | 13. Data Engineering.zip | 2023-06-07 09:35 | 282M | |
![[ ]](/icons/layout.gif) | 14.iOSNotesForProfessionals.pdf | 2023-06-07 10:55 | 14M | |
![[ ]](/icons/compressed.gif) | 14_Neural_Networks_Deep_Learning,_Transfer_Learning_and_TensorFlow.zip | 2023-06-07 09:36 | 510M | |
![[ ]](/icons/layout.gif) | 15.jQueryNotesForProfessionals.pdf | 2023-06-07 10:55 | 966K | |
![[ ]](/icons/layout.gif) | 16.KotlinNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.0M | |
![[ ]](/icons/compressed.gif) | 16 Appendix - Machine Learning Primer.zip | 2023-06-07 09:34 | 188M | |
![[ ]](/icons/layout.gif) | 17.MATLABNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.8M | |
![[ ]](/icons/layout.gif) | 18.MongoDBNotesForProfessionals.pdf | 2023-06-07 10:55 | 931K | |
![[ ]](/icons/layout.gif) | 19.MySQLNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.9M | |
![[ ]](/icons/layout.gif) | 20+ open source tools for ML Enthusiasts.pdf | 2023-05-02 07:44 | 4.7M | |
![[ ]](/icons/layout.gif) | 20.ObjectiveCNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.3M | |
![[ ]](/icons/layout.gif) | 21.NodeJSNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.8M | |
![[ ]](/icons/layout.gif) | 22.ReactJSNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.0M | |
![[ ]](/icons/layout.gif) | 23.RubyNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.9M | |
![[ ]](/icons/layout.gif) | 24.ReactNativeNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.3M | |
![[ ]](/icons/layout.gif) | 25.RNotesForProfessionals.pdf | 2023-06-07 10:55 | 6.5M | |
![[ ]](/icons/layout.gif) | 26.RubyOnRailsNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.1M | |
![[ ]](/icons/layout.gif) | 27.SQLNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.5M | |
![[ ]](/icons/layout.gif) | 28.GitNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.5M | |
![[ ]](/icons/layout.gif) | 29.PHPNotesForProfessionals.pdf | 2023-06-07 10:55 | 3.5M | |
![[ ]](/icons/layout.gif) | 30.PerlNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.2M | |
![[ ]](/icons/layout.gif) | 31.SwiftNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.7M | |
![[ ]](/icons/layout.gif) | 32.OracleDatabaseNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.2M | |
![[ ]](/icons/layout.gif) | 33.AlgorithmsNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.6M | |
![[ ]](/icons/layout.gif) | 34.BashNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.7M | |
![[ ]](/icons/layout.gif) | 36.EntityFrameworkNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.5M | |
![[ ]](/icons/layout.gif) | 37.ExcelVBANotesForProfessionals.pdf | 2023-06-07 10:55 | 2.5M | |
![[ ]](/icons/layout.gif) | 38.MicrosoftSQLServerNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.6M | |
![[ ]](/icons/layout.gif) | 39.VisualBasic_NETNotesForProfessionals.pdf | 2023-06-07 10:55 | 2.2M | |
![[ ]](/icons/layout.gif) | 40.VBANotesForProfessionals.pdf | 2023-06-07 10:55 | 2.2M | |
![[ ]](/icons/layout.gif) | 41.PowerShellNotesForProfessionals.pdf | 2023-06-07 10:55 | 1.7M | |
![[ ]](/icons/layout.gif) | 42.SpringFrameworkNotesForProfessionals.pdf | 2023-06-07 10:55 | 865K | |
![[ ]](/icons/layout.gif) | 43.HibernateNotesForProfessionals.pdf | 2023-06-07 10:55 | 669K | |
![[ ]](/icons/layout.gif) | 44.HaskellNotesForProfessionals.pdf | 2023-06-07 10:54 | 1.9M | |
![[ ]](/icons/layout.gif) | 45.LaTeXNotesForProfessionals.pdf | 2023-06-07 10:54 | 1.4M | |
![[ ]](/icons/layout.gif) | 46.PostgreSQLNotesForProfessionals.pdf | 2023-06-07 10:54 | 938K | |
![[ ]](/icons/layout.gif) | 47.TypeScriptNotesForProfessionals.pdf | 2023-06-07 10:54 | 1.1M | |
![[ ]](/icons/layout.gif) | 48.XamarinFormsNotesForProfessionals.pdf | 2023-06-07 10:54 | 2.6M | |
![[ ]](/icons/layout.gif) | 50 android hacks.pdf | 2023-06-07 10:54 | 3.4M | |
![[ ]](/icons/layout.gif) | 100 Best AI Tools from April.pdf | 2023-05-02 07:45 | 1.1M | |
![[ ]](/icons/layout.gif) | 100 Days of Machine Learning.pdf | 2023-06-07 09:29 | 11M | |
![[ ]](/icons/layout.gif) | 150 Essential Data Science Interview Q&A.pdf | 2023-06-07 09:37 | 1.8M | |
![[ ]](/icons/layout.gif) | 800_Data_Science_Questions_via_knowdatascience.pdf | 2023-06-07 09:29 | 17M | |
![[ ]](/icons/layout.gif) | 2009.05673.pdf | 2023-06-07 09:29 | 31M | |
![[ ]](/icons/layout.gif) | 2018_Book_NeuralNetworksAndDeepLearning.pdf | 2023-06-07 09:53 | 7.0M | |
![[ ]](/icons/layout.gif) | A Bug Hunter's Diary [Tobias Klein_November 2011,208 pp].pdf | 2023-06-07 10:43 | 5.2M | |
![[ ]](/icons/layout.gif) | ACS_Cybersecurity_Guide.pdf | 2023-04-11 05:24 | 1.9M | |
![[ ]](/icons/layout.gif) | AI 2180703 Decode.pdf | 2023-04-11 06:48 | 121M | |
![[ ]](/icons/layout.gif) | AI_Crash_Course_A_Fun_and_Hands_On_Introduction_to_Reinforcement.pdf | 2023-06-07 09:47 | 9.4M | |
![[ ]](/icons/layout.gif) | A Practical Introduction to _Python Programming.pdf | 2023-06-07 10:53 | 1.9M | |
![[ ]](/icons/layout.gif) | ARTIFICIAL_INTELLIGENCE_FOR_ROBOTICS @computer_books.pdf | 2023-03-31 07:27 | 26M | |
![[ ]](/icons/layout.gif) | Abraham Silberschatz-Operating System Concepts (9th,2012_12).pdf | 2023-06-07 09:02 | 7.6M | |
![[ ]](/icons/layout.gif) | Absolute FreeBSD [Michael_Oct 2018, 704 pp].pdf | 2023-06-07 10:50 | 4.7M | |
![[ ]](/icons/layout.gif) | Absolute_Beginners_Guide_to_Minecraft_Mods_Programming_by_Rogers.pdf | 2023-06-07 10:27 | 22M | |
![[ ]](/icons/layout.gif) | Advanced Data Analytics Using Python.pdf | 2023-06-07 09:54 | 2.2M | |
![[ ]](/icons/layout.gif) | Advanced Data Structures [Brass 2008-09-08].pdf | 2023-06-07 09:36 | 1.6M | |
![[ ]](/icons/layout.gif) | Advanced Penetration Testing.pdf | 2023-06-07 10:49 | 9.9M | |
![[ ]](/icons/layout.gif) | Advanced penetration testing for highly-secured environm.pdf | 2023-06-07 10:54 | 13M | |
![[ ]](/icons/layout.gif) | Agile Software Engineering Skills - 2023.pdf | 2023-03-21 03:43 | 5.3M | |
![[ ]](/icons/layout.gif) | Algorithms Analysis & Design concepts(1).pdf | 2023-06-07 09:36 | 5.4M | |
![[ ]](/icons/layout.gif) | Algorithms_for_Data_Science_by_Brian_Steele,_John_Chandler,_Swarna.pdf | 2023-06-07 10:27 | 10M | |
![[ ]](/icons/compressed.gif) | All_notes_goalkicker_computerbuddy.zip | 2023-06-07 10:54 | 102M | |
![[ ]](/icons/layout.gif) | An Intro to Git_Github.pdf | 2023-06-06 10:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Android Cookbook.pdf | 2023-06-07 10:53 | 23M | |
![[ ]](/icons/layout.gif) | Android Hacker's Handbook.pdf | 2023-06-07 10:49 | 9.0M | |
![[ ]](/icons/layout.gif) | AngularJS in Action by Lukas Ruebbelke (book drive).pdf | 2022-05-24 11:06 | 5.8M | |
![[ ]](/icons/layout.gif) | Applied Data Science with Python and Jupyter.pdf | 2023-04-12 10:41 | 13M | |
![[ ]](/icons/layout.gif) | Applied Deep Learning.pdf | 2023-06-07 09:44 | 13M | |
![[ ]](/icons/layout.gif) | Approach To Real Hacking World By Probotisop.pdf | 2023-06-07 10:43 | 6.0M | |
![[ ]](/icons/layout.gif) | Approaching (Almost) Any Machine Learning Problem.pdf | 2023-06-06 03:56 | 8.0M | |
![[ ]](/icons/layout.gif) | Architecting_Vue_js_3_Enterprise_Ready_Web_Applications_Solomon.pdf | 2023-04-17 11:25 | 14M | |
![[ ]](/icons/layout.gif) | Arduino_Workshop.pdf | 2023-06-07 10:51 | 10M | |
![[ ]](/icons/layout.gif) | Arduino_programming_the_ultimate_beginners_guide_to_learn_Arduino.pdf | 2023-06-07 10:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence Robotics.pdf | 2023-06-07 09:54 | 26M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence for Big Data.pdf | 2023-06-07 09:41 | 24M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence with Python Cookbook (Ben Auffarth).pdf | 2023-05-10 10:48 | 11M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_A_Modern_Approach_Third_Edition_Stuart_Russel.pdf | 2023-06-07 08:59 | 14M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_with_Python_Your_complete_guide_to_building.pdf | 2023-06-07 09:51 | 15M | |
![[ ]](/icons/layout.gif) | Artificial_Neural_Networks_with.pdf | 2023-06-07 09:42 | 12M | |
![[ ]](/icons/layout.gif) | Automated Machine Learning on AWS.pdf | 2023-06-07 09:54 | 5.6M | |
![[ ]](/icons/layout.gif) | Autotools [John Calcote_July 2010, 360 pp].pdf | 2023-06-07 10:50 | 18M | |
![[ ]](/icons/layout.gif) | Bash Cookbook 1st edition .pdf | 2023-06-07 10:51 | 3.2M | |
![[ ]](/icons/layout.gif) | Beginning Android Programming with Android Studio.pdf | 2023-06-07 10:50 | 16M | |
![[ ]](/icons/layout.gif) | Beginning Ethical Hacking with Kali Linux...pdf | 2023-06-07 10:43 | 8.0M | |
![[ ]](/icons/layout.gif) | Beginning Python, 3rd Edition.pdf | 2023-06-07 09:50 | 6.0M | |
![[ ]](/icons/layout.gif) | Beginning Python.pdf | 2023-06-07 11:15 | 3.9M | |
![[ ]](/icons/layout.gif) | Big data and some statistical issues.pdf | 2023-06-07 09:37 | 285K | |
![[ ]](/icons/layout.gif) | Boost Your Data Science Productivity.pdf | 2023-04-06 04:40 | 9.3M | |
![[ ]](/icons/layout.gif) | Bug Bounty Field Manual.pdf | 2023-06-07 10:43 | 1.6M | |
![[ ]](/icons/layout.gif) | Bug Bounty Hunting For Web Security.pdf | 2023-06-07 10:47 | 8.8M | |
![[ ]](/icons/layout.gif) | Build_An_Html5_Game_A_Developers_Guide_With_Css_And_Javascript.pdf | 2023-06-07 10:54 | 5.6M | |
![[ ]](/icons/layout.gif) | Build_Your_Own_Website_A_Comic_Guide_to_HTML,_CSS,_and_WordPress.pdf | 2023-06-07 10:53 | 52M | |
![[ ]](/icons/layout.gif) | Building Arduino Projects for the Internet of Things.pdf | 2023-06-07 10:47 | 17M | |
![[ ]](/icons/layout.gif) | Building Telegram Bots.pdf | 2023-06-07 10:42 | 8.7M | |
![[ ]](/icons/layout.gif) | Building Tools with GitHub.pdf | 2023-06-07 10:49 | 11M | |
![[ ]](/icons/layout.gif) | Building_Android_Apps_in_Python_Using_Kivy_with_Android_Studio_With.pdf | 2023-06-07 10:27 | 6.8M | |
![[ ]](/icons/layout.gif) | C++ & Python Tricks and Tips – 14th Edition 2023 (1).pdf | 2023-05-29 07:10 | 33M | |
![[ ]](/icons/layout.gif) | C++.pdf | 2023-06-07 09:05 | 10M | |
![[ ]](/icons/layout.gif) | C++ Crash Course_A Fast-Paced Introduction.pdf | 2023-06-07 10:47 | 6.4M | |
![[ ]](/icons/layout.gif) | C++ For Dummies 7th edition.pdf | 2023-06-07 10:49 | 3.1M | |
![[ ]](/icons/layout.gif) | CEH v8_Certified Ethical Hacker version 8 study guide.pdf | 2023-06-07 10:47 | 9.8M | |
![[ ]](/icons/layout.gif) | CProgrammingPart1.pdf | 2023-05-11 03:31 | 391K | |
![[ ]](/icons/layout.gif) | CSS Notes.pdf | 2023-06-07 09:36 | 3.0M | |
![[ ]](/icons/layout.gif) | CSS Text.pdf | 2023-06-07 11:15 | 11M | |
![[ ]](/icons/layout.gif) | CYBER SECURITY (R18A0521).pdf | 2023-04-11 04:49 | 1.6M | |
![[ ]](/icons/layout.gif) | C_Programming_Absolute_Beginner’s_Guide_by_Greg_Perry_Dean_Miller.pdf | 2023-06-07 10:27 | 13M | |
![[ ]](/icons/layout.gif) | Chandraish_Sinha_Mastering_Power_BI_Build_Business_Intelligence.pdf | 2023-06-07 09:41 | 8.8M | |
![[ ]](/icons/layout.gif) | ChatGPT-and-Artificial-Intelligence-in-higher-education-Quick-Start-guide_EN_FINAL.pdf | 2023-05-29 04:56 | 1.8M | |
![[ ]](/icons/layout.gif) | ChatGPT.pdf | 2023-03-31 07:04 | 6.1M | |
![[ ]](/icons/layout.gif) | ChatGPT Guide 2023.pdf | 2023-05-26 07:47 | 3.1M | |
![[ ]](/icons/layout.gif) | Classification Algorithms in ML.pdf | 2023-06-06 10:24 | 7.8M | |
![[ ]](/icons/layout.gif) | Clean Code(1).pdf | 2023-06-07 09:36 | 3.6M | |
![[ ]](/icons/layout.gif) | Clean Code.pdf | 2023-06-07 10:50 | 3.6M | |
![[ ]](/icons/layout.gif) | Code the hidden language of computer.pdf | 2023-06-07 10:49 | 2.8M | |
![[ ]](/icons/layout.gif) | Coding For Beginners Apr 2023.pdf | 2023-04-13 06:45 | 56M | |
![[ ]](/icons/layout.gif) | Coding Interview Preparation.pdf | 2023-06-07 09:36 | 904K | |
![[ ]](/icons/layout.gif) | Coding patterns for MAANG Interviews .pdf | 2023-06-07 09:36 | 310K | |
![[ ]](/icons/layout.gif) | Complete 2022 Solved with Hacks & Tricks..!.pdf | 2023-04-06 05:10 | 16M | |
![[ ]](/icons/layout.gif) | Complete CSS Cheat Sheet.pdf | 2023-06-07 09:36 | 2.9M | |
![[ ]](/icons/layout.gif) | Computer Hacking Beginners Guide.pdf | 2023-06-07 10:49 | 6.2M | |
![[ ]](/icons/layout.gif) | Computer Network Techmax.pdf | 2023-05-01 11:00 | 145M | |
![[ ]](/icons/layout.gif) | Computer Vision - 2023.pdf | 2023-03-21 03:43 | 16M | |
![[ ]](/icons/layout.gif) | Core ML Survival Guide - 2020.pdf | 2023-04-12 05:13 | 6.9M | |
![[ ]](/icons/compressed.gif) | Coursera-Machine-Learning-Stanford-master.zip | 2023-06-07 09:52 | 115M | |
![[ ]](/icons/layout.gif) | Cracking_Codes_with_Python_An_Introduction_to_Building_and_Breaking.pdf | 2023-06-07 10:54 | 7.6M | |
![[ ]](/icons/layout.gif) | Create Graphical User _Interfaces with Python.pdf | 2023-06-07 10:44 | 11M | |
![[ ]](/icons/layout.gif) | Cuba by Korda.pdf | 2023-06-08 05:25 | 64M | |
![[ ]](/icons/layout.gif) | Cyber Crimes Chapter from Pro Cyber Security Sai Satish Book.pdf | 2023-05-10 07:24 | 182K | |
![[ ]](/icons/layout.gif) | CyberSecurityConclaveAtVigyanBhavanDelhi_1.pdf | 2023-04-11 05:24 | 2.8M | |
![[ ]](/icons/layout.gif) | Cybersecurity – Attack-and-Defense-Strategies-2nd.pdf | 2023-06-07 10:44 | 33M | |
![[ ]](/icons/layout.gif) | Cybersecurity – Attack and Defense Strategies...pdf | 2023-06-07 10:44 | 23M | |
![[ ]](/icons/layout.gif) | Cybersecurity_Threats,_Malware_Trends,_and_Strategies_Mitigate_exploits.pdf | 2023-06-07 10:42 | 4.3M | |
![[ ]](/icons/layout.gif) | DBMS book1 Silberschatz.pdf | 2023-06-07 09:03 | 17M | |
![[ ]](/icons/layout.gif) | DSStudent_Handbook.pdf | 2023-03-21 03:43 | 4.0M | |
![[ ]](/icons/layout.gif) | DS_Lab_Manual_Final.pdf | 2023-06-07 09:05 | 616K | |
![[ ]](/icons/layout.gif) | DS_Unit-1.pdf | 2023-06-07 09:05 | 160K | |
![[ ]](/icons/layout.gif) | DS_notes_2.pdf | 2023-06-07 09:05 | 178K | |
![[ ]](/icons/layout.gif) | DS_notes_Unit_3.pdf | 2023-06-07 09:05 | 336K | |
![[ ]](/icons/layout.gif) | Daniel-Kahneman-Thinking-Fast-and-Slow-.pdf | 2023-06-07 09:37 | 3.4M | |
![[ ]](/icons/compressed.gif) | Data-Science--Cheat-Sheet-master.zip | 2023-06-07 09:53 | 206M | |
![[ ]](/icons/layout.gif) | Data-Science-Periodic-Table.pdf | 2023-06-07 09:38 | 323K | |
![[ ]](/icons/layout.gif) | Data Communication Computer Network Tutorial.pdf | 2023-06-07 10:47 | 2.6M | |
![[ ]](/icons/layout.gif) | Data Mining The Textbook.pdf | 2023-06-07 11:15 | 16M | |
![[ ]](/icons/layout.gif) | Data Normalization.pdf | 2023-06-06 03:46 | 14M | |
![[ ]](/icons/layout.gif) | Data Science From Scatch.pdf | 2023-06-07 09:54 | 5.0M | |
![[ ]](/icons/layout.gif) | Data Science Interview QnAs.pdf | 2023-06-07 09:37 | 2.0M | |
![[ ]](/icons/layout.gif) | Data Science Interview questions.pdf | 2023-03-31 07:27 | 18M | |
![[ ]](/icons/layout.gif) | Data Science ML Roadmap.pdf | 2023-04-11 06:51 | 372K | |
![[ ]](/icons/layout.gif) | Data Science and Analytics Strategy - 2023.pdf | 2023-05-08 11:18 | 14M | |
![[ ]](/icons/layout.gif) | Data Science for Business.pdf | 2023-06-07 09:51 | 14M | |
![[ ]](/icons/layout.gif) | Data Science for Complex Systems.pdf | 2023-05-15 06:06 | 19M | |
![[ ]](/icons/layout.gif) | Data Scientist RoadMap.pdf | 2023-05-01 03:36 | 262K | |
![[ ]](/icons/layout.gif) | Data Structure and Algorithm Notes-1.pdf | 2023-06-06 03:46 | 5.5M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithm Cheat Sheet.pdf | 2023-06-07 09:37 | 97K | |
![[ ]](/icons/layout.gif) | Data Warehouse and Mining Techmax.pdf | 2023-05-01 11:00 | 282M | |
![[ ]](/icons/layout.gif) | Data_Engineering_with_Python_Work_with_massive_datasets_to_design.pdf | 2023-06-07 09:54 | 11M | |
![[ ]](/icons/layout.gif) | Data_Science_Cheatsheet.pdf | 2023-04-16 06:17 | 1.7M | |
![[ ]](/icons/layout.gif) | Data_Science_from_Scratch_First_Principles_with_Python_by_Joel_Grus (2).pdf | 2023-06-07 10:27 | 5.0M | |
![[ ]](/icons/layout.gif) | Data_Science_from_Scratch_First_Principles_with_Python_by_Joel_Grus.pdf | 2023-06-07 10:27 | 4.2M | |
![[ ]](/icons/layout.gif) | Data_Structures_and_Algorithms_Made_Easy_Data_Structures_and_Algorithmic.pdf | 2023-06-07 09:03 | 33M | |
![[ ]](/icons/layout.gif) | Data and WareHouse Mining Topper Soln.pdf | 2023-05-01 11:00 | 32M | |
![[ ]](/icons/layout.gif) | Data science project using python.pdf | 2023-06-07 09:54 | 17M | |
![[ ]](/icons/layout.gif) | Data structures & algorithms with python.pdf | 2023-06-07 09:54 | 13M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch-Quick-Start-Guide (1) (2).pdf | 2023-06-07 09:40 | 6.4M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch-Quick-Start-Guide (1).pdf | 2023-06-07 09:40 | 6.4M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch.pdf | 2023-06-07 09:51 | 45M | |
![[ ]](/icons/layout.gif) | Deep Learning Architectures.pdf | 2023-06-07 09:44 | 15M | |
![[ ]](/icons/layout.gif) | DeepLearning Notes.pdf | 2023-06-07 09:29 | 19M | |
![[ ]](/icons/layout.gif) | Deep_Learning_Crash_Course_for_Beginners___Python.pdf | 2023-06-06 03:56 | 9.5M | |
![[ ]](/icons/layout.gif) | Deep_Learning_for_Vision_Systems_v6_MEAP.pdf | 2023-06-07 09:46 | 34M | |
![[ ]](/icons/layout.gif) | Deep web links.pdf | 2023-06-07 10:53 | 21M | |
![[ ]](/icons/layout.gif) | Deploying nodejs.pdf | 2023-06-07 10:54 | 7.7M | |
![[ ]](/icons/layout.gif) | Designing BSD rootkit.pdf | 2023-06-07 10:54 | 8.4M | |
![[ ]](/icons/layout.gif) | Distributed_Artificial_Intelligence_A_Modern_Approach_by_Satya_Prakash (2).pdf | 2023-06-07 09:40 | 31M | |
![[ ]](/icons/layout.gif) | Distributed_Artificial_Intelligence_A_Modern_Approach_by_Satya_Prakash.pdf | 2023-06-07 09:40 | 31M | |
![[ ]](/icons/layout.gif) | Dive Into Data Science.pdf | 2023-04-10 04:33 | 5.0M | |
![[ ]](/icons/layout.gif) | Doing Math With Python [Amit Saha_August 2015, 264 pp].pdf | 2023-06-07 10:51 | 6.5M | |
![[ ]](/icons/layout.gif) | Doing_Data_Science_Straight_Talk_from_the_Frontline_by_Rachel_Schutt.pdf | 2023-06-07 10:27 | 27M | |
![[ ]](/icons/layout.gif) | EN-Ethical Hacking.pdf | 2023-06-07 10:43 | 26M | |
![[ ]](/icons/layout.gif) | Easily_ Practical Machine Learning Algorithms.pdf | 2023-06-07 09:54 | 6.7M | |
![[ ]](/icons/layout.gif) | Educational_Data_Science.pdf | 2023-05-10 08:02 | 8.6M | |
![[ ]](/icons/layout.gif) | Effective Java 3rd.pdf | 2023-06-07 09:51 | 2.2M | |
![[ ]](/icons/layout.gif) | Effective_Python_59_Specific_Ways_To_Write_Better_Python_Book_of.pdf | 2023-06-07 10:56 | 12M | |
![[ ]](/icons/layout.gif) | Essential Statistics for Data Science - 2023.pdf | 2023-03-31 07:27 | 6.9M | |
![[ ]](/icons/layout.gif) | Essentials of Data Science.pdf | 2023-06-07 09:41 | 2.9M | |
![[ ]](/icons/layout.gif) | Ethical Hacking.pdf | 2023-06-07 10:43 | 23M | |
![[ ]](/icons/layout.gif) | Ethical_Hacking_and_Penetration_Testing_Guide_PDFDrive_com_.pdf | 2023-06-07 10:50 | 22M | |
![[ ]](/icons/compressed.gif) | Ex_Files_ML_and_AI_Foundations_Adv_Decision_Trees_KNIME.zip | 2023-06-07 09:33 | 15M | |
![[ ]](/icons/layout.gif) | Excel guide .pdf | 2023-05-30 07:55 | 1.8M | |
![[ ]](/icons/layout.gif) | FLUTTER.pdf | 2023-05-11 07:11 | 8.2M | |
![[ ]](/icons/compressed.gif) | Fireship.io course Nextjs 13.zip | 2023-05-11 07:11 | 236M | |
![[ ]](/icons/layout.gif) | Flask_Web_Development_Developing_Web_Applications_with_Python_PDFDrive.pdf | 2023-06-07 10:53 | 5.4M | |
![[ ]](/icons/layout.gif) | For_the_Love_of_Physics_From_the_End_of_the_Rainbow_to_the_Edge.pdf | 2023-06-07 09:03 | 2.8M | |
![[ ]](/icons/layout.gif) | Foster_Provost,_Tom_Fawcett_Data_Science_for_Business_What_you_need.pdf | 2023-05-01 03:39 | 19M | |
![[ ]](/icons/layout.gif) | FreeBSD Device Drivers [Joseph Kong_May 2012, 352 pp].pdf | 2023-06-07 10:49 | 8.7M | |
![[ ]](/icons/layout.gif) | Fundamentals and Methods of Machine and Deep Learning.pdf | 2023-04-18 09:41 | 16M | |
![[ ]](/icons/layout.gif) | Fundamentals of Machine Learning and Deep Learning in Me.pdf | 2023-04-18 09:41 | 6.3M | |
![[ ]](/icons/layout.gif) | Fundamentals of Physics Textbook ( PDFDrive ).pdf | 2023-06-07 09:03 | 51M | |
![[ ]](/icons/layout.gif) | Fundamentals of Python.pdf | 2023-06-07 09:44 | 7.0M | |
![[ ]](/icons/layout.gif) | Fundamentals of python programming.pdf | 2023-06-07 10:56 | 9.5M | |
![[ ]](/icons/layout.gif) | Game Hacking [Nick Cano__July 2016, 304 pp].pdf | 2023-06-07 10:54 | 6.9M | |
![[ ]](/icons/layout.gif) | Gareth_Dwyer_Flask_By_Example__Unleash.pdf | 2023-06-07 09:00 | 5.1M | |
![[ ]](/icons/compressed.gif) | Gate CS 1991 - 2017 Papers.zip | 2023-06-07 09:51 | 8.1M | |
![[ ]](/icons/layout.gif) | Git Essentials Developers Guide to Git.pdf | 2023-06-06 03:55 | 5.6M | |
![[ ]](/icons/layout.gif) | GitHub for Dummies.pdf | 2023-06-07 10:50 | 51M | |
![[ ]](/icons/layout.gif) | Github Essentials.pdf | 2023-06-07 09:48 | 6.7M | |
![[ ]](/icons/layout.gif) | Golden Rules to answer in a System Design Interview.pdf | 2023-06-07 09:36 | 3.1M | |
![[ ]](/icons/layout.gif) | Google Advertising Tools (2nd edition).pdf | 2023-06-07 10:49 | 13M | |
![[ ]](/icons/layout.gif) | Gray Hat C # [Brandon Perry_June 2017, 304 pp].pdf | 2023-06-07 10:51 | 13M | |
![[ ]](/icons/layout.gif) | Greedy Problem Approach by Kapil Bhaiya.pdf | 2023-06-07 09:36 | 20M | |
![[ ]](/icons/layout.gif) | Grokking Deep Learning by Andrew W. Trask (z-lib.org).pdf | 2023-06-07 09:49 | 14M | |
![[ ]](/icons/layout.gif) | HTML & CSS.pdf | 2023-06-07 10:48 | 19M | |
![[ ]](/icons/layout.gif) | HTML 5 hacks.pdf | 2023-06-07 10:54 | 24M | |
![[ ]](/icons/unknown.gif) | Hacked Again .epub | 2023-06-07 10:43 | 2.5M | |
![[ ]](/icons/layout.gif) | Hacked Again .pdf | 2023-06-07 10:43 | 2.5M | |
![[ ]](/icons/layout.gif) | Hacker States by Follis, Luca Fish, Adam Adam Fish.pdf | 2023-06-07 10:29 | 1.4M | |
![[ ]](/icons/layout.gif) | Hackers - Heroes of the computer revolution.pdf | 2023-06-07 10:48 | 2.3M | |
![[ ]](/icons/layout.gif) | Hacking--the art of exploitation.pdf | 2023-06-07 11:15 | 4.4M | |
![[ ]](/icons/layout.gif) | Hacking Ciphers.pdf | 2023-06-07 10:56 | 3.7M | |
![[ ]](/icons/layout.gif) | Hacking Exposed.pdf | 2023-06-07 10:54 | 6.5M | |
![[ ]](/icons/layout.gif) | Hacking The Hacker.pdf | 2023-06-07 10:53 | 1.8M | |
![[ ]](/icons/layout.gif) | HackingThe Unlocking of Transparency Security is a myth….pdf | 2023-06-07 10:53 | 5.4M | |
![[ ]](/icons/layout.gif) | Hacking The Xbox .pdf | 2023-06-07 10:54 | 18M | |
![[ ]](/icons/layout.gif) | Hacking VoIP [Himanshu Dwivedi_October 2008, 232 pp].pdf | 2023-06-07 10:51 | 5.2M | |
![[ ]](/icons/layout.gif) | Hacking Wireless Networks-@computerpdfbooks.pdf | 2023-06-07 09:00 | 67M | |
![[ ]](/icons/layout.gif) | Hacking Wireless Networks For Dummies.pdf | 2023-06-07 10:48 | 14M | |
![[ ]](/icons/unknown.gif) | Hacking_Cheating_in_Online_Games_Start_Hacking_PDFDrive_com_.PDF | 2023-06-07 10:55 | 2.0M | |
![[ ]](/icons/layout.gif) | Hacking_Computer_Hacking,_Security_Testing,Penetration_Testing,.pdf | 2023-06-07 09:42 | 19M | |
![[ ]](/icons/layout.gif) | Hacking_Hacking_Practical_Guide_for_Beginners_Hacking_With_Python.pdf | 2023-06-07 10:56 | 11M | |
![[ ]](/icons/layout.gif) | Hacking_The_Practical_Guide_to_Become_a_Hacker_Field_Manual_for.pdf | 2023-06-07 10:29 | 11M | |
![[ ]](/icons/unknown.gif) | Hacking_The_Ultimate_Hacking_for_Beginners_How_to_Hack_Hacking_Intelligence (2).PDF | 2023-06-07 10:56 | 4.2M | |
![[ ]](/icons/layout.gif) | Hacking_The_Ultimate_Hacking_for_Beginners_How_to_Hack_Hacking_Intelligence.pdf | 2023-06-07 10:55 | 4.2M | |
![[ ]](/icons/layout.gif) | Hacking and securing ios applications.pdf | 2023-06-07 10:54 | 6.2M | |
![[ ]](/icons/layout.gif) | Hacking for Dummies, 6th Edition ( PDFDrive.com ).pdf | 2023-06-07 10:53 | 11M | |
![[ ]](/icons/layout.gif) | Hacks & Tricks Notes.pdf | 2023-04-25 10:54 | 11M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201201.pdf | 2023-06-07 10:42 | 2.8M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201202.pdf | 2023-06-07 10:42 | 4.9M | |
![[ ]](/icons/layout.gif) | Hakin9 On Demand - 201203.pdf | 2023-06-07 10:43 | 15M | |
![[ ]](/icons/layout.gif) | Hands-On Unsupervised Learning Using Python.pdf | 2023-06-07 09:45 | 5.6M | |
![[ ]](/icons/layout.gif) | Hands-On_Graph_Neural_Networks_Using_Python.pdf | 2023-04-12 05:13 | 35M | |
![[ ]](/icons/layout.gif) | Hands_On_Machine_Learning_with_Scikit_Learn,_Keras,_and_Tensorflow.pdf | 2023-06-07 10:27 | 32M | |
![[ ]](/icons/layout.gif) | Hands_On_Machine_Learning_with_Scikit_Learn_Keras_and_Tensorflow.pdf | 2023-06-07 09:53 | 32M | |
![[ ]](/icons/layout.gif) | Hands on Hacking.pdf | 2023-06-07 10:48 | 12M | |
![[ ]](/icons/layout.gif) | Hands on Robotics Programming with C++.pdf | 2023-06-07 09:54 | 41M | |
![[ ]](/icons/layout.gif) | Hands on machine Learning with scikit & tensorflow.pdf | 2023-06-07 09:53 | 7.1M | |
![[ ]](/icons/layout.gif) | Head First HTML and CSS 2nd edition.pdf | 2023-06-07 10:48 | 98M | |
![[ ]](/icons/layout.gif) | Head_First_Android_Development_A.pdf | 2023-06-07 09:00 | 50M | |
![[ ]](/icons/layout.gif) | Head_First_Android_Development_A_Brain_Friendly_Guide_PDFDrive_com.pdf | 2023-06-07 10:53 | 50M | |
![[ ]](/icons/layout.gif) | Head_First_Learn_to_Code_A_Learner’s_Guide_to_Coding_and_Computational.pdf | 2023-06-07 10:53 | 81M | |
![[ ]](/icons/layout.gif) | How To Code In Python.pdf | 2023-06-07 10:43 | 4.8M | |
![[ ]](/icons/layout.gif) | How_Computers_Work__9th_Edition_.pdf | 2023-06-07 09:00 | 193M | |
![[ ]](/icons/layout.gif) | How to Program Java Deitel.pdf | 2023-06-07 09:00 | 24M | |
![[ ]](/icons/layout.gif) | How to Write Business Plan.pdf | 2023-06-07 09:37 | 3.0M | |
![[ ]](/icons/layout.gif) | Immortal Speeches -Harshvardhan Dutta.pdf | 2023-06-08 05:25 | 66M | |
![[ ]](/icons/layout.gif) | Inside the Dark Web by Erdal Ozkaya Rafiqul Islam.pdf | 2023-06-07 10:29 | 18M | |
![[ ]](/icons/layout.gif) | Intermediate Python.pdf | 2023-06-07 09:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Internet of Things with Python.pdf | 2023-06-07 09:48 | 26M | |
![[ ]](/icons/layout.gif) | Interpretability_in_Deep_Learning.pdf | 2023-05-03 07:27 | 12M | |
![[ ]](/icons/layout.gif) | Intro_to_Python_forComputer_Science_and_Data_Science_Learning_to.pdf | 2023-06-07 10:27 | 11M | |
![[ ]](/icons/layout.gif) | Introduction-cyber-security.pdf | 2023-04-11 05:22 | 5.0M | |
![[ ]](/icons/layout.gif) | Introduction to AI and Expert Systems Dan Patterson.pdf | 2023-05-30 09:33 | 61M | |
![[ ]](/icons/layout.gif) | Introduction to Deep Learning-2019.pdf | 2023-06-07 09:46 | 16M | |
![[ ]](/icons/layout.gif) | Introduction to Programming in Java.pdf | 2023-06-07 09:00 | 91M | |
![[ ]](/icons/layout.gif) | Introduction to python programming.pdf | 2023-06-07 10:56 | 14M | |
![[ ]](/icons/layout.gif) | Invent Your Own Computer Games With Python.pdf | 2023-06-07 10:56 | 8.4M | |
![[ ]](/icons/layout.gif) | IoT-CRC2018.pdf | 2023-06-07 09:00 | 37M | |
![[ ]](/icons/layout.gif) | Jason_Brownlee_Master_Machine_Learning_Algorithmz_lib_org.pdf | 2023-06-07 09:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Java (tutorials point).pdf | 2023-06-07 10:53 | 4.3M | |
![[ ]](/icons/layout.gif) | JavaScript Web Applications.pdf | 2023-06-07 10:49 | 9.5M | |
![[ ]](/icons/layout.gif) | JavaScript and JQuery Interactive Front.pdf | 2023-06-07 10:26 | 92M | |
![[ ]](/icons/layout.gif) | Java_3D_Programming.pdf | 2023-06-07 10:53 | 4.4M | |
![[ ]](/icons/layout.gif) | Java _ the complete reference, ninth edition ( PDFDrive ).pdf | 2023-06-07 09:03 | 79M | |
![[ ]](/icons/layout.gif) | Javascript Cheatsheet.pdf | 2023-06-07 10:53 | 47K | |
![[ ]](/icons/layout.gif) | John_E_Hopcroft,_Rajeev_Motwani,_Jeffrey_D_Ullman_Introduction_to.pdf | 2023-06-07 09:02 | 5.7M | |
![[ ]](/icons/layout.gif) | Jump start HTML 5.pdf | 2023-06-07 10:54 | 8.6M | |
![[ ]](/icons/layout.gif) | Kali Linux Wireless Penetration Testing Beginner-s Guide.pdf | 2023-06-07 09:42 | 16M | |
![[ ]](/icons/layout.gif) | Kali Linux_Wireless Penetration Testing Beginner's Guide.pdf | 2023-06-07 10:48 | 13M | |
![[ ]](/icons/layout.gif) | Kali_Linux_An_Ethical_Hackers_Cookbook_2nd_Edition_Himanshu_Sharma.pdf | 2023-06-07 10:27 | 20M | |
![[ ]](/icons/layout.gif) | Keyboard Shortcuts for Data Scientists.pdf | 2023-06-07 09:29 | 5.1M | |
![[ ]](/icons/layout.gif) | Learn C++ Programming Language-Tutorials Point (2014).pdf | 2023-06-07 10:53 | 1.8M | |
![[ ]](/icons/layout.gif) | Learn HTML 5 by creating fun games.pdf | 2023-06-07 10:54 | 6.4M | |
![[ ]](/icons/layout.gif) | Learn Kali Linux 2019 by Glen D. Singh .pdf | 2023-06-07 10:52 | 85M | |
![[ ]](/icons/layout.gif) | Learn Unity for Windows 10 Game Development.pdf | 2023-06-07 11:15 | 22M | |
![[ ]](/icons/layout.gif) | Learning-Kali-Linux.pdf | 2023-06-07 10:43 | 17M | |
![[ ]](/icons/layout.gif) | Learning-OpenCV-4-Computer-Vision-with-Python-3-3rd-Ed.pdf | 2023-06-07 09:44 | 86M | |
![[ ]](/icons/layout.gif) | Learning Robotics Using Python 2nd .pdf | 2023-06-07 10:51 | 19M | |
![[ ]](/icons/layout.gif) | Learning Robotics using Python 1st.pdf | 2023-06-07 10:51 | 7.5M | |
![[ ]](/icons/layout.gif) | Learning SQL.pdf | 2023-05-16 03:34 | 934K | |
![[ ]](/icons/layout.gif) | Learning Scrapy.pdf | 2023-06-07 10:48 | 8.2M | |
![[ ]](/icons/layout.gif) | Learning Web Design.pdf | 2023-06-07 10:53 | 76M | |
![[ ]](/icons/layout.gif) | Learning pandas.pdf | 2023-06-07 11:15 | 8.6M | |
![[ ]](/icons/layout.gif) | LetMeRead_net_PHP_and_MySQL_PHP_Programming_and_MySQL_For_Beginners.pdf | 2023-05-22 11:26 | 1.6M | |
![[ ]](/icons/layout.gif) | Let Us C book.pdf | 2023-06-07 09:05 | 7.2M | |
![[ ]](/icons/layout.gif) | LifestyleBookazine.Net.pdf | 2023-05-25 03:47 | 218M | |
![[ ]](/icons/layout.gif) | Linked_List_Program.pdf | 2023-06-07 09:05 | 91K | |
![[ ]](/icons/layout.gif) | Linux Appliance Design.pdf | 2023-06-07 10:55 | 7.9M | |
![[ ]](/icons/layout.gif) | Linux Firewalls.pdf | 2023-06-07 11:15 | 6.5M | |
![[ ]](/icons/layout.gif) | Logic Development(1).pdf | 2023-06-07 09:36 | 3.6M | |
![[ ]](/icons/layout.gif) | Lott_S_F_,_Phillips_D_Python_Object_Oriented_Programming,_4th_Edition.pdf | 2023-06-07 09:41 | 6.5M | |
![[ ]](/icons/layout.gif) | M&M Technical publication Textbook.pdf | 2023-05-10 07:54 | 69M | |
![[ ]](/icons/layout.gif) | ML supervised learning hand written notes by CloudyML.pdf | 2023-05-02 07:44 | 42M | |
![[ ]](/icons/layout.gif) | Machine Learning Bookcamp Build a portfolio of real-life pr.pdf | 2023-04-08 14:03 | 40M | |
![[ ]](/icons/layout.gif) | Machine Learning Notes - TutorialsDuniya.pdf | 2023-06-07 09:07 | 15M | |
![[ ]](/icons/layout.gif) | Machine Learning Notes 2 - TutorialsDuniya.pdf | 2023-06-07 09:07 | 37M | |
![[ ]](/icons/layout.gif) | Machine Learning Using Python_Discover The World Of ML (2).pdf | 2023-06-07 09:40 | 1.2M | |
![[ ]](/icons/layout.gif) | Machine Learning Using Python_Discover The World Of ML.pdf | 2023-06-07 09:40 | 1.2M | |
![[ ]](/icons/layout.gif) | Machine Learning With Python Tutorial.pdf | 2023-06-07 10:43 | 3.4M | |
![[ ]](/icons/layout.gif) | Machine Learning_cheatsheets.pdf | 2023-06-07 09:29 | 7.6M | |
![[ ]](/icons/layout.gif) | Machine Learning for Everyone.pdf | 2023-05-02 07:45 | 5.4M | |
![[ ]](/icons/layout.gif) | Machine Learning for Text.pdf | 2023-06-07 09:44 | 8.7M | |
![[ ]](/icons/layout.gif) | Machine Learning with Python for Everyone.pdf | 2023-06-07 09:45 | 9.0M | |
![[ ]](/icons/compressed.gif) | Machine_Learning_and_AI_Foundations_Causal_Inference_and_Modeling.zip | 2023-04-08 14:04 | 459M | |
![[ ]](/icons/compressed.gif) | Machine_Learning_and_AI_Foundations__Advanced_Decision_Trees_with.zip | 2023-06-07 09:33 | 258M | |
![[ ]](/icons/layout.gif) | Machine_Learning_with_Python_Cookbook_Practical_Solutions_from_Preprocessing.pdf | 2023-06-07 09:54 | 4.6M | |
![[ ]](/icons/layout.gif) | Machine learning .pdf | 2023-06-07 09:29 | 5.3M | |
![[ ]](/icons/layout.gif) | Machine learning mastery in python.pdf | 2023-06-07 09:54 | 2.4M | |
![[ ]](/icons/layout.gif) | Make Your Own Neural Network by Tariq Rashid.pdf | 2023-06-07 09:29 | 7.5M | |
![[ ]](/icons/layout.gif) | Making Use of Python.pdf | 2023-06-07 11:15 | 5.9M | |
![[ ]](/icons/layout.gif) | Master DSA.pdf | 2023-06-07 09:36 | 21M | |
![[ ]](/icons/layout.gif) | Master Machine Learning Algorithms.pdf | 2023-06-07 09:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Master Your Mac.pdf | 2023-06-07 10:49 | 35M | |
![[ ]](/icons/layout.gif) | Mastering .NET Machine Learning - 2016.pdf | 2023-04-13 10:27 | 5.3M | |
![[ ]](/icons/layout.gif) | Mastering ChatGPT - 2023.pdf | 2023-04-12 05:13 | 472K | |
![[ ]](/icons/layout.gif) | Mastering Kali Linux for Advanced Penetration Testing.pdf | 2023-06-07 09:42 | 9.0M | |
![[ ]](/icons/layout.gif) | Mastering Regular Expressions in python.pdf | 2023-06-07 09:37 | 1.2M | |
![[ ]](/icons/layout.gif) | Mastering_CSS_Grid_A_comprehensive_and_practical_guide_to_creating.pdf | 2023-06-02 07:58 | 29M | |
![[ ]](/icons/layout.gif) | Mastering iOS Frameworks Beyond the Basics (2nd Edition).pdf | 2023-06-07 11:15 | 43M | |
![[ ]](/icons/layout.gif) | McGraw_Hill_Discrete_Mathematics_and_Its_Applications_7th_Edition.pdf | 2023-06-07 09:02 | 10M | |
![[ ]](/icons/layout.gif) | Metasploit [David Kennedy & others_July 2011, 328 pp].pdf | 2023-06-07 10:54 | 6.9M | |
![[ ]](/icons/layout.gif) | Metasploit for Beginners.pdf | 2023-06-07 10:49 | 22M | |
![[ ]](/icons/layout.gif) | Mining the Social Web 3rd edition.pdf | 2023-06-07 10:50 | 30M | |
![[ ]](/icons/layout.gif) | Modern_Physics_for_Scientists_and_Engineers,_4th_ed_under_the_sea.pdf | 2023-06-07 09:03 | 13M | |
![[ ]](/icons/layout.gif) | Modern_Programming_Made_Easy_Using_Java,_Scala,_Groovy,_and_JavaScript (2).pdf | 2023-06-07 09:42 | 2.7M | |
![[ ]](/icons/layout.gif) | Modern_Programming_Made_Easy_Using_Java,_Scala,_Groovy,_and_JavaScript.pdf | 2023-06-07 09:37 | 2.7M | |
![[ ]](/icons/layout.gif) | Modular Programming with Python.pdf | 2023-06-07 09:41 | 2.8M | |
![[ ]](/icons/layout.gif) | MongoDB - Python.pdf | 2023-05-16 03:34 | 758K | |
![[ ]](/icons/layout.gif) | MySQL for the Internet of Things.pdf | 2023-06-07 10:47 | 9.7M | |
![[ ]](/icons/layout.gif) | Mysql Cheatsheet.pdf | 2023-06-07 10:53 | 56K | |
![[ ]](/icons/layout.gif) | Narasimha_Karumanchi_Data_Struct.pdf | 2023-06-07 09:05 | 33M | |
![[ ]](/icons/layout.gif) | Natural_Language_Processing_with_Python_by_Steven_Bird,_Ewan_Klein.pdf | 2023-06-07 09:54 | 5.2M | |
![[ ]](/icons/layout.gif) | Network Flow Analysis [Michael_June 2010, 224 pp].pdf | 2023-06-07 10:50 | 2.7M | |
![[ ]](/icons/layout.gif) | Network security hacks.pdf | 2023-06-07 10:54 | 7.6M | |
![[ ]](/icons/layout.gif) | Nmap full guide to network scanning.pdf | 2023-06-07 10:54 | 6.1M | |
![[ ]](/icons/layout.gif) | NumPy_SciPy_Pandas_Quandl_Cheat_Sheet.pdf | 2023-05-01 07:52 | 135K | |
![[ ]](/icons/layout.gif) | Numerical_Python_Scientific_Computing_and_Data_Science_Applications.pdf | 2023-06-07 10:29 | 23M | |
![[ ]](/icons/layout.gif) | O'Reilly - Raspberry Pi Cookbook (2014)- Simon Monk.pdf | 2023-06-07 10:51 | 13M | |
![[ ]](/icons/layout.gif) | OOAD.pdf | 2023-06-07 09:05 | 423K | |
![[ ]](/icons/layout.gif) | OOP Concepts in C++.pdf | 2023-06-07 09:36 | 3.2M | |
![[ ]](/icons/layout.gif) | OOP with C++ book.pdf | 2023-06-07 09:05 | 2.0M | |
![[ ]](/icons/layout.gif) | Obe_R_,_Hsu_L_PostgreSQL_Up_and_Running,_3rd_Edition_2018.pdf | 2023-06-07 09:42 | 4.7M | |
![[ ]](/icons/layout.gif) | Offensive Security OSCP by Offensive Security.pdf | 2023-06-07 10:42 | 46M | |
![[ ]](/icons/layout.gif) | Online_Security_Tricks_and_Tips_-_14th_Edition,_2023.pdf | 2023-05-15 06:03 | 60M | |
![[ ]](/icons/layout.gif) | Open Source Projects - Beyond Code.pdf | 2023-05-30 09:33 | 20M | |
![[ ]](/icons/layout.gif) | PYTHON_DATA_SCIENCE_ESSENTIALS_THIRD_EDITION @computer_books.pdf | 2023-05-22 11:26 | 6.6M | |
![[ ]](/icons/layout.gif) | PYTHON_PYTHON'S_COMPANION,_A_STEP_BY_STEP_GUIDE_FOR_BEGINNERS_TO.pdf | 2023-06-07 10:50 | 11M | |
![[ ]](/icons/layout.gif) | Packt.Frontend.Development.Projects.with.Vue.js.3.pdf | 2023-04-06 05:48 | 23M | |
![[ ]](/icons/layout.gif) | Packt.Learn.Three.js.pdf | 2023-04-24 09:57 | 125M | |
![[ ]](/icons/layout.gif) | Parallel and High Performance Programming Python - 2023.pdf | 2023-04-18 09:41 | 9.3M | |
![[ ]](/icons/layout.gif) | Password Cracking Techniques.pdf | 2023-06-07 10:29 | 433K | |
![[ ]](/icons/layout.gif) | Paul_Azunre_Transfer_Learning_for_Natural_Language_Processing_Manning.pdf | 2023-06-07 09:40 | 6.0M | |
![[ ]](/icons/layout.gif) | Penetration_Testing_Azure_for_Ethical_Hackers_Develop_practical.pdf | 2023-06-07 10:26 | 13M | |
![[ ]](/icons/layout.gif) | Penetration testing [Georgia Weidman_June 2014, 528 pp].pdf | 2023-06-07 10:51 | 12M | |
![[ ]](/icons/layout.gif) | Penetration testing with the bash shell.pdf | 2023-06-07 10:54 | 5.9M | |
![[ ]](/icons/layout.gif) | Perrotta_P_Programming_Machine_Learning_From_Coding_to_Deep_Learning.pdf | 2023-06-07 09:45 | 7.6M | |
![[ ]](/icons/layout.gif) | Phishing Dark Waters.pdf | 2023-06-07 10:42 | 12M | |
![[ ]](/icons/layout.gif) | Practical Binary Analysis [Dennis_December 2018, 456 pp].pdf | 2023-06-07 10:50 | 33M | |
![[ ]](/icons/layout.gif) | Practical Forensic Imaging [Bruce_Sep 2016, 320 pp].pdf | 2023-06-07 10:50 | 11M | |
![[ ]](/icons/layout.gif) | Practical Malware Analysis.pdf | 2023-06-07 10:51 | 9.3M | |
![[ ]](/icons/layout.gif) | Practical Video Game Bots.pdf | 2023-06-07 10:44 | 12M | |
![[ ]](/icons/layout.gif) | Practical_Statistics_for_Data_Scientist_by_Peter_Bruce,_Andrew_Bruce.pdf | 2023-06-07 10:27 | 13M | |
![[ ]](/icons/layout.gif) | Practical_Statistics_for_Data_Scientists_50+_Essential_Concepts.pdf | 2023-06-07 10:27 | 16M | |
![[ ]](/icons/layout.gif) | Practices_of_the_Python_Pro.pdf | 2023-06-07 09:38 | 4.1M | |
![[ ]](/icons/layout.gif) | Pro Docker 2016.pdf | 2023-06-07 09:41 | 18M | |
![[ ]](/icons/layout.gif) | Pro_Android_with_Kotlin_Developing_Modern_Mobile_Apps_by_Peter_Späth.pdf | 2023-06-07 10:27 | 5.4M | |
![[ ]](/icons/layout.gif) | Pro_Python_Best_Practices_Debugging,_Testing_and_Maintenance_by.pdf | 2023-06-07 09:42 | 5.3M | |
![[ ]](/icons/layout.gif) | Problem_Solving_with_Algorithms_and_Data_Structures_Using_Python.pdf | 2023-06-07 09:54 | 4.9M | |
![[ ]](/icons/layout.gif) | Programming for Computations - Python 2Ed.pdf | 2023-06-07 09:44 | 7.1M | |
![[ ]](/icons/layout.gif) | Python, PyGame and Raspberry Pi Game Development.pdf | 2023-06-07 11:15 | 3.4M | |
![[ ]](/icons/layout.gif) | Python-Scripting-for-ArcGIS.pdf | 2023-06-07 10:42 | 11M | |
![[ ]](/icons/layout.gif) | Python 3 Object-Oriented Programming, Second Edition.pdf | 2023-06-07 09:43 | 3.1M | |
![[ ]](/icons/layout.gif) | Python 3 Object-Oriented programming.pdf | 2023-06-07 10:48 | 4.3M | |
![[ ]](/icons/layout.gif) | Python Algorithms.pdf | 2023-06-07 10:49 | 4.6M | |
![[ ]](/icons/layout.gif) | Python Brain Teasers_ Exercise Your Mind.pdf | 2023-05-10 07:48 | 3.6M | |
![[ ]](/icons/layout.gif) | Python Cheat Sheet - 58 Pages.pdf | 2023-06-07 09:41 | 1.7M | |
![[ ]](/icons/layout.gif) | Python Cheat Sheet.pdf | 2023-06-07 09:36 | 165K | |
![[ ]](/icons/layout.gif) | Python Cheatsheet.pdf | 2023-06-07 10:53 | 43K | |
![[ ]](/icons/layout.gif) | Python Cookbook, 2nd Edition.pdf | 2023-06-07 11:15 | 4.1M | |
![[ ]](/icons/layout.gif) | Python For Kids [Jason R. Briggs_December 2012, 344 pp].pdf | 2023-06-07 10:51 | 13M | |
![[ ]](/icons/layout.gif) | Python Handwritten Notes - TutorialsDuniya.pdf | 2023-06-07 09:29 | 23M | |
![[ ]](/icons/layout.gif) | Python Machine Learning.pdf | 2023-04-13 10:27 | 8.7M | |
![[ ]](/icons/layout.gif) | Python Notes.pdf | 2023-06-07 09:29 | 6.1M | |
![[ ]](/icons/layout.gif) | Python One-Liners.pdf | 2023-06-07 09:48 | 2.5M | |
![[ ]](/icons/layout.gif) | Python Playground [Mahesh_October 2015, 352 pp].pdf | 2023-06-07 10:51 | 12M | |
![[ ]](/icons/layout.gif) | Python Pocket Reference.pdf | 2023-06-07 10:53 | 3.2M | |
![[ ]](/icons/layout.gif) | Python Power - The Comprehensive Guide (2008).pdf | 2023-06-07 10:26 | 6.1M | |
![[ ]](/icons/layout.gif) | Python Programming for Beginners & Inter.pdf | 2023-06-07 09:38 | 9.9M | |
![[ ]](/icons/layout.gif) | Python Seaborn Statistical Data Visualization.pdf | 2023-06-07 09:52 | 624K | |
![[ ]](/icons/layout.gif) | Python_End_to_end_Data_Analysis_Leveraging_the_power_of_Python_to.pdf | 2023-06-07 09:47 | 22M | |
![[ ]](/icons/layout.gif) | Python_Machine_Learning_Workbook_for_Beginners.pdf | 2023-06-06 03:56 | 15M | |
![[ ]](/icons/layout.gif) | Python_Machine_Learning__The_U.pdf | 2023-06-07 10:27 | 2.3M | |
![[ ]](/icons/layout.gif) | Python_NumPy_for_Beginners_NumPy_Specialization_for_Data_Sc.pdf | 2023-04-13 10:27 | 6.5M | |
![[ ]](/icons/layout.gif) | Python_Programming_for_begineers.pdf | 2023-06-07 09:48 | 1.2M | |
![[ ]](/icons/layout.gif) | Python_SciPy_Cheat_Sheet_Linear_Algebra.pdf | 2023-06-07 09:38 | 146K | |
![[ ]](/icons/layout.gif) | Python_Tricks_A_Buffet_of_Awesome_Python_Features_PDFDrive_com_.pdf | 2023-06-07 10:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Python and Data Science Tips!! .pdf | 2023-04-29 06:54 | 55M | |
![[ ]](/icons/unknown.gif) | Python and Hacking....epub | 2023-06-07 10:42 | 1.3M | |
![[ ]](/icons/layout.gif) | Python and Hacking....pdf | 2023-06-07 10:42 | 2.0M | |
![[ ]](/icons/layout.gif) | Python by Example Learning to Program in 150 Challenges.pdf | 2023-06-07 10:47 | 9.8M | |
![[ ]](/icons/layout.gif) | Python for Data Analysis.pdf | 2023-06-07 09:53 | 14M | |
![[ ]](/icons/layout.gif) | Python for Everybody (2).pdf | 2023-06-07 09:53 | 2.3M | |
![[ ]](/icons/layout.gif) | Python for Everybody.pdf | 2023-06-07 09:38 | 2.3M | |
![[ ]](/icons/layout.gif) | Python for Science.pdf | 2023-06-07 09:36 | 7.5M | |
![[ ]](/icons/layout.gif) | Python for Unix and Linux System Administration (2008).pdf | 2023-06-07 10:26 | 3.4M | |
![[ ]](/icons/layout.gif) | Python in a Nutshell, 2nd Edition.pdf | 2023-06-07 11:15 | 5.0M | |
![[ ]](/icons/layout.gif) | Python network programming.pdf | 2023-06-07 10:56 | 22M | |
![[ ]](/icons/compressed.gif) | Python vs. R for Data Science.zip | 2023-04-06 04:41 | 232M | |
![[ ]](/icons/layout.gif) | RNotesForProfessionals.pdf | 2023-06-07 09:29 | 6.5M | |
![[ ]](/icons/layout.gif) | R_Programming_for_Data_Science_by_Roger_D_Peng.pdf | 2023-05-01 03:41 | 10M | |
![[ ]](/icons/layout.gif) | Rafael_C_Gonzalez_Richard_E_Wods_Digital_Image_Processing_Pearson.pdf | 2023-06-07 08:59 | 37M | |
![[ ]](/icons/layout.gif) | Random Matrix Methods for Machine Learning - 2022.pdf | 2023-05-22 11:26 | 9.9M | |
![[ ]](/icons/layout.gif) | Raspberry_Pi_Cookbook_Software_and_Hardware_Problems_and_Solutions.pdf | 2023-06-07 10:51 | 10M | |
![[ ]](/icons/layout.gif) | React js_ The Ultimate Beginner_s Guide to Learn React js.pdf | 2023-06-07 09:52 | 569K | |
![[ ]](/icons/layout.gif) | Real_World bug hunting.pdf | 2023-06-07 09:05 | 4.0M | |
![[ ]](/icons/layout.gif) | Responsible Graph Neural Networks - 2023.pdf | 2023-04-18 09:41 | 10M | |
![[ ]](/icons/layout.gif) | Reversing secrets of reverse engineering by Eldad Eilam.pdf | 2023-06-07 10:29 | 8.6M | |
![[ ]](/icons/layout.gif) | R for SAS and SPSS Users - Robert A. Muenchen.pdf | 2023-05-01 03:41 | 5.6M | |
![[ ]](/icons/layout.gif) | Rick_J_Scavetta,_Boyan_Angelov_Python_and_R_for_the_Modern_Data.pdf | 2023-05-02 07:45 | 18M | |
![[ ]](/icons/layout.gif) | Rootkits and Bootkits [Alex & other_May 2019, 448 pp].pdf | 2023-06-07 10:51 | 15M | |
![[ ]](/icons/layout.gif) | SEO Warrior .pdf | 2023-06-07 10:49 | 8.7M | |
![[ ]](/icons/layout.gif) | SPSS 16.0 Brief Guide - SPSS Inc_.pdf | 2023-05-01 03:42 | 2.4M | |
![[ ]](/icons/layout.gif) | SPSS Survival Manual - Julie Pallant.pdf | 2023-05-01 03:42 | 31M | |
![[ ]](/icons/layout.gif) | SPSS_Demystified_A_Step_by_Step_Guide_to_Successful_Data_Analysis.pdf | 2023-05-01 03:42 | 27M | |
![[ ]](/icons/layout.gif) | SPSS_for_Intermediate_Statistics_Use_a_Leech_Nancy_L_;_Barrett_Karen.pdf | 2023-05-01 03:42 | 19M | |
![[ ]](/icons/layout.gif) | SPSS for Starters - Ton J. Cleophas.pdf | 2023-05-01 03:42 | 10M | |
![[ ]](/icons/layout.gif) | SQL & NoSQL Databases. Models, Languages.pdf | 2023-06-07 09:45 | 4.0M | |
![[ ]](/icons/layout.gif) | SQL - The Ultimate Beginners Guide.pdf | 2023-06-07 09:43 | 1.8M | |
![[ ]](/icons/layout.gif) | SQL-cheat-sheet.pdf | 2023-04-16 06:17 | 225K | |
![[ ]](/icons/layout.gif) | SQL.pdf | 2023-05-25 03:40 | 3.2M | |
![[ ]](/icons/layout.gif) | SQL BASIC HANDS-WRITTEN NOTE.pdf | 2023-05-02 07:44 | 7.0M | |
![[ ]](/icons/layout.gif) | SQL Server 2008 R2 Unleashed - Ray Rankins.pdf | 2023-05-01 03:42 | 48M | |
![[ ]](/icons/layout.gif) | SQL for DS.pdf | 2023-06-07 09:52 | 3.5M | |
![[ ]](/icons/layout.gif) | SQL for Data Science.pdf.pdf | 2023-06-07 09:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Sandworm A New Era of Cyberwar and the Hunt.....pdf | 2023-06-07 10:44 | 2.4M | |
![[ ]](/icons/layout.gif) | Sass and Compass for Designers.pdf | 2023-06-07 11:15 | 6.8M | |
![[ ]](/icons/layout.gif) | Scary_Smart_The_Future_of_Artificial_Intelligence_and_How_You_Can.pdf | 2023-05-11 03:32 | 3.1M | |
![[ ]](/icons/layout.gif) | Security for Software Engineers.pdf | 2023-06-07 10:47 | 48M | |
![[ ]](/icons/layout.gif) | Silence On The Wire.pdf | 2023-06-07 10:52 | 5.9M | |
![[ ]](/icons/layout.gif) | Simon_Monk_Raspberry_Pi_Cookbook_Software_and_Hardware_Problems.pdf | 2023-06-07 10:51 | 62M | |
![[ ]](/icons/layout.gif) | Simple Basic Python SQLite Tutorial.pdf | 2023-06-07 09:51 | 648K | |
![[ ]](/icons/layout.gif) | Slatkin_B_Effective_Python_90_Specific_Ways_to_Write_Better_Python.pdf | 2023-06-07 09:46 | 4.1M | |
![[ ]](/icons/layout.gif) | Smart Girls Guide To Privacy [Violet_Aug 2015 ,176 pp].pdf | 2023-06-07 10:50 | 2.1M | |
![[ ]](/icons/layout.gif) | Sommerville-Software-Engineering-10ed.pdf | 2023-06-07 09:02 | 10M | |
![[ ]](/icons/layout.gif) | Statistical Mechanics of Neural Networks.pdf | 2023-03-31 07:27 | 13M | |
![[ ]](/icons/layout.gif) | Statistics Done Wrong [Alex_March 2015, 176 pp].pdf | 2023-06-07 10:50 | 7.3M | |
![[ ]](/icons/layout.gif) | Statistics For Data Science !.pdf | 2023-04-06 04:40 | 1.3M | |
![[ ]](/icons/layout.gif) | Statistics for Dummies.pdf | 2023-06-07 09:52 | 7.9M | |
![[ ]](/icons/layout.gif) | Storytelling with data.pdf | 2023-06-07 09:51 | 12M | |
![[ ]](/icons/layout.gif) | Stripes by Example.pdf | 2023-06-07 11:15 | 6.0M | |
![[ ]](/icons/layout.gif) | Swipe👉 SQL❤️ Cheatsheet📝.pdf | 2023-06-06 03:46 | 448K | |
![[ ]](/icons/layout.gif) | Task Automation scripts in Python.pdf | 2023-05-02 10:23 | 4.5M | |
![[ ]](/icons/layout.gif) | Teach Your Kids To Code [Bryson P_April 2015, 336 pp].pdf | 2023-06-07 10:50 | 15M | |
![[ ]](/icons/layout.gif) | The-Linux-Command-Line-A-Complete-Introduction.pdf | 2023-06-07 09:00 | 5.7M | |
![[ ]](/icons/layout.gif) | The Android Game Developer’s Handbook.pdf | 2023-06-07 10:48 | 4.2M | |
![[ ]](/icons/layout.gif) | The Art Of Deception Kevin D. Mitnick.pdf | 2023-06-07 10:53 | 1.5M | |
![[ ]](/icons/layout.gif) | The Art of Debugging [Norman & others Sept 2008, 280 pp].pdf | 2023-06-07 10:53 | 9.1M | |
![[ ]](/icons/layout.gif) | The Basics of Hacking and Penetration Testing.pdf | 2023-06-07 10:53 | 4.5M | |
![[ ]](/icons/layout.gif) | The Best Cheat Sheet Collection ever that.pdf | 2023-06-06 03:46 | 597K | |
![[ ]](/icons/layout.gif) | The Book of CSS3 2nd Edition.pdf | 2023-06-07 11:15 | 8.3M | |
![[ ]](/icons/layout.gif) | The C Programming Language.pdf | 2023-05-11 03:31 | 1.1M | |
![[ ]](/icons/layout.gif) | The Car Hacker's Handbook [C. Smith_March 2016, 304 pp].pdf | 2023-06-07 10:50 | 24M | |
![[ ]](/icons/layout.gif) | The Code Book.pdf | 2023-06-07 10:43 | 1.8M | |
![[ ]](/icons/layout.gif) | The Complete Cloud Computing Manual.pdf | 2023-06-07 03:33 | 70M | |
![[ ]](/icons/layout.gif) | The Complete Coding Manual #16th Edition 2023.pdf | 2023-04-06 05:10 | 116M | |
![[ ]](/icons/layout.gif) | The Complete Google User Manual.pdf | 2023-06-07 03:33 | 91M | |
![[ ]](/icons/layout.gif) | The Essential Guide to HTML5.pdf | 2023-06-07 10:47 | 9.9M | |
![[ ]](/icons/layout.gif) | The Essential Guide to HTML5_2nd edition.pdf | 2023-06-07 10:47 | 8.1M | |
![[ ]](/icons/layout.gif) | The GNU Make Book [John_April 2015, 256 pp].pdf | 2023-06-07 10:50 | 2.7M | |
![[ ]](/icons/layout.gif) | The Ghidra Book__the Definitive Guide.pdf | 2023-06-07 10:48 | 16M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 1.pdf | 2023-06-07 10:29 | 26M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 2.pdf | 2023-06-07 10:29 | 23M | |
![[ ]](/icons/layout.gif) | The Hacker Playbook 3.pdf | 2023-06-07 10:29 | 9.0M | |
![[ ]](/icons/layout.gif) | TheHackersHardwareToolkit.pdf | 2023-06-07 10:54 | 7.7M | |
![[ ]](/icons/layout.gif) | The Hardware Hacker [Andrew_August 2019, 424 pp].pdf | 2023-06-07 10:51 | 30M | |
![[ ]](/icons/layout.gif) | The IoT Hacker’s Handbook.pdf | 2023-06-07 10:42 | 19M | |
![[ ]](/icons/layout.gif) | The Pentester Blueprint.pdf | 2023-06-07 10:43 | 2.7M | |
![[ ]](/icons/layout.gif) | The Principles of Object-Oriented JavaScript.pdf | 2023-06-07 10:48 | 3.6M | |
![[ ]](/icons/layout.gif) | The Programmers Brain.pdf | 2023-03-31 07:27 | 9.6M | |
![[ ]](/icons/layout.gif) | The Python 3 Standard Library by Example.pdf | 2023-06-07 09:44 | 14M | |
![[ ]](/icons/layout.gif) | The Python Book_The ultimate guide to coding with Python.pdf | 2023-06-07 10:53 | 28M | |
![[ ]](/icons/layout.gif) | The Quick Python Book, 3rd Edition.pdf | 2023-06-07 09:45 | 9.9M | |
![[ ]](/icons/layout.gif) | The Tangled Web [Michal Zalewski_November 2011, 320 pp].pdf | 2023-06-07 10:51 | 4.0M | |
![[ ]](/icons/layout.gif) | The _C++ _Programming _Language _Bjarne Stroustrup.pdf | 2023-06-07 09:05 | 3.2M | |
![[ ]](/icons/layout.gif) | The_Complete_Guide_To_Linux_-_1st_Edition_2023.pdf | 2023-06-01 07:08 | 58M | |
![[ ]](/icons/layout.gif) | The_Elements_of_Statistical_Learning_Data_Mining,_Inference_and.pdf | 2023-06-07 09:53 | 12M | |
![[ ]](/icons/layout.gif) | The_Game_Believes_in_You_How_Digital.pdf | 2023-06-07 11:15 | 2.0M | |
![[ ]](/icons/layout.gif) | The_Morgan_Kaufmann_Series_in_Data_Management_Systems_Jiawei_Han.pdf | 2023-06-07 09:02 | 12M | |
![[ ]](/icons/layout.gif) | The_Ultimate_Beginners_Guide_to_Learn_kotlin_Programming_Step_by.pdf | 2023-06-07 10:27 | 519K | |
![[ ]](/icons/layout.gif) | The art of R programming.pdf | 2023-06-07 10:54 | 643K | |
![[ ]](/icons/layout.gif) | The art of invisibility_Kevin D. Mitnick.pdf | 2023-06-07 10:54 | 1.9M | |
![[ ]](/icons/layout.gif) | The morden web.pdf | 2023-06-07 10:54 | 7.2M | |
![[ ]](/icons/layout.gif) | The secret to cybersecurity.pdf | 2023-06-07 10:43 | 1.1M | |
![[ ]](/icons/layout.gif) | The web application hacker's handbook.pdf | 2023-06-07 10:49 | 15M | |
![[ ]](/icons/layout.gif) | Think Java - How to Think Like a Computer Scientist (2016).pdf | 2023-06-07 10:44 | 5.2M | |
![[ ]](/icons/layout.gif) | Think Like A Programmer [V. Anton_August 2012, 256 pp].pdf | 2023-06-07 10:53 | 7.0M | |
![[ ]](/icons/layout.gif) | Think Stats.pdf | 2023-06-07 09:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Tkinter Tutorial.pdf | 2023-06-07 09:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Top 50 python Interview Questions and answers .pdf | 2023-06-07 09:36 | 260K | |
![[ ]](/icons/layout.gif) | Ubuntu Made Easy.pdf | 2023-06-07 10:49 | 23M | |
![[ ]](/icons/layout.gif) | Unit-2_1.pdf | 2023-06-07 09:05 | 117K | |
![[ ]](/icons/layout.gif) | Unit-2_Array+P1.pdf | 2023-06-07 09:05 | 258K | |
![[ ]](/icons/layout.gif) | Unit-2_p2.pdf | 2023-06-07 09:05 | 84K | |
![[ ]](/icons/layout.gif) | Unit-2_p3.pdf | 2023-06-07 09:05 | 195K | |
![[ ]](/icons/layout.gif) | Unit-2_p4.pdf | 2023-06-07 09:05 | 342K | |
![[ ]](/icons/layout.gif) | Universal Meta Data Models - David Marco _ Michael Jennings.pdf | 2023-05-01 04:22 | 8.2M | |
![[ ]](/icons/layout.gif) | Using C&IT to Support Teaching - Paul Chin.pdf | 2023-05-01 04:22 | 9.6M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_1_Zero_To_SysAdmin_Getting.pdf | 2023-06-07 10:29 | 18M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_2_Zero_To_SysAdmin_Advanced.pdf | 2023-06-07 10:29 | 11M | |
![[ ]](/icons/layout.gif) | Using_And_Administering_Linux_Volume_3_Zero_To_SysAdmin_Network.pdf | 2023-06-07 10:29 | 7.9M | |
![[ ]](/icons/layout.gif) | Using_SPSS_for_Windows_and_Macintosh_Ana_Samuel_B_Green_Neil_J_Salkind.pdf | 2023-05-01 04:22 | 31M | |
![[ ]](/icons/layout.gif) | Valliappa_Lakshmanan,_Martin_Görner,_Ryan_Gillard_Practical_Machine.pdf | 2023-06-07 09:41 | 56M | |
![[ ]](/icons/layout.gif) | Viescas_J_SQL_Queries_for_Mere_Mortals,_4th_Edition_For_Mere_Mortals.pdf | 2023-06-07 09:42 | 18M | |
![[ ]](/icons/layout.gif) | Weaving the Dark Web Legitimacy on Freenet, Tor, and I2P.pdf | 2023-06-07 10:29 | 4.1M | |
![[ ]](/icons/layout.gif) | Webbots, Spiders, and Screen Scrapers.pdf | 2023-06-07 10:49 | 10M | |
![[ ]](/icons/layout.gif) | Web penetration testing with kali linux.pdf | 2023-06-07 10:54 | 20M | |
![[ ]](/icons/layout.gif) | Web security exposed.pdf | 2023-06-07 10:42 | 60M | |
![[ ]](/icons/layout.gif) | Web security for developers - malcolm mcdonald.pdf | 2023-06-07 08:59 | 3.3M | |
![[ ]](/icons/layout.gif) | Web security testing guide.pdf | 2023-06-07 10:43 | 9.7M | |
![[ ]](/icons/layout.gif) | What_Is_ChatGPT.pdf | 2023-03-31 10:09 | 6.1M | |
![[ ]](/icons/layout.gif) | Windows PowerShell Cookbook.pdf | 2023-06-07 10:51 | 15M | |
![[ ]](/icons/layout.gif) | XSS CheatSheet.pdf | 2023-06-07 10:29 | 1.1M | |
![[ ]](/icons/layout.gif) | Yolo-Object Detection Research Paper.pdf | 2023-06-07 09:49 | 5.1M | |
![[ ]](/icons/layout.gif) | Yolo 2 Object Detection .pdf | 2023-06-07 09:49 | 5.0M | |
![[ ]](/icons/layout.gif) | Yolo3 Research paper.pdf | 2023-06-07 09:49 | 2.3M | |
![[ ]](/icons/layout.gif) | You can revise entire Python in 19 minutes.pdf | 2023-05-06 03:06 | 1.9M | |
![[ ]](/icons/layout.gif) | Zach Codings 4 in 1.pdf | 2023-06-07 09:41 | 2.3M | |
![[ ]](/icons/layout.gif) | [Dane_Hillard]_Practices_of_the_Python_Pro.pdf | 2023-06-07 09:46 | 4.1M | |
![[ ]](/icons/layout.gif) | [David_J._Pine]_Introduction_to_Python_for_Science.pdf | 2023-06-07 09:42 | 5.2M | |
![[ ]](/icons/layout.gif) | [Jason_M._Kinser]_Image_Operators__Image_Processin.pdf | 2023-06-07 09:46 | 24M | |
![[ ]](/icons/layout.gif) | [Jojo_John_Moolayil]_Learn_Keras_for_Deep_Neural_N.pdf | 2023-06-07 09:42 | 2.7M | |
![[ ]](/icons/layout.gif) | [Paul_Deitel,_Dr._Harvey_Deitel]_Python_for_Progra.pdf | 2023-06-07 09:43 | 27M | |
![[ ]](/icons/layout.gif) | [Project_Syntax]_Python_and_Hacking_Made_Simple__F.pdf | 2023-06-07 09:44 | 2.2M | |
![[ ]](/icons/layout.gif) | [Thomas,-M.T.]-React-in-Action.pdf | 2023-04-06 05:49 | 15M | |
![[ ]](/icons/layout.gif) | adrian-rosebrock-deep-learning-for-computer-vision-2017.pdf | 2023-06-07 09:42 | 9.5M | |
![[ ]](/icons/layout.gif) | ahmed-fawzy-gad-practical-computer-vision-applications-2019.pdf | 2023-06-07 09:44 | 18M | |
![[ ]](/icons/layout.gif) | alex-thomas-natural-language-processing-w-2020.pdf | 2023-06-07 09:41 | 5.1M | |
![[ ]](/icons/layout.gif) | amazon-web-services-action-3rd.pdf | 2023-04-17 11:24 | 35M | |
![[ ]](/icons/layout.gif) | artificialintelligencewithpython.pdf | 2023-06-07 09:42 | 32M | |
![[ ]](/icons/layout.gif) | ashwin-pajankar-practical-python-data-visualization-a-2021.pdf | 2023-06-07 09:46 | 4.8M | |
![[ ]](/icons/layout.gif) | automate-the-boring-stuff-with-python-2015-.pdf | 2023-06-07 09:53 | 17M | |
![[ ]](/icons/layout.gif) | bash Cookbook 2nd edition.pdf | 2023-06-07 10:51 | 6.0M | |
![[ ]](/icons/layout.gif) | beginners_python_cheat_sheet_pcc_all.pdf | 2023-06-07 11:15 | 1.7M | |
![[ ]](/icons/compressed.gif) | books_on_python.zip | 2023-06-07 09:38 | 72M | |
![[ ]](/icons/layout.gif) | bug-bounty-field-manual.pdf | 2023-06-07 10:43 | 4.1M | |
![[ ]](/icons/layout.gif) | chih-cheng-hung-enmin-song-yihua-lan-image-texture-2019.pdf | 2023-06-07 09:46 | 11M | |
![[ ]](/icons/layout.gif) | chirag-shah-a-hands-on-introduction-to-data-science-2020.pdf | 2023-06-07 09:45 | 12M | |
![[ ]](/icons/layout.gif) | cole-nussbaumer-knaflic-storytelling-with-data-a-data-2015.pdf | 2023-06-07 09:45 | 12M | |
![[ ]](/icons/layout.gif) | cpp_operators.pdf | 2023-06-07 09:05 | 47K | |
![[ ]](/icons/layout.gif) | cpp_tutorial.pdf | 2023-06-07 09:05 | 1.0M | |
![[ ]](/icons/layout.gif) | cprogramming_tutorial.pdf | 2023-06-07 09:06 | 1.0M | |
![[ ]](/icons/layout.gif) | creatingagameusingpygame.pdf | 2023-05-08 10:58 | 1.9M | |
![[ ]](/icons/layout.gif) | cyberjutsu_cybersecurity_for_the_modern_ninja_1nbsped_9781718500549.pdf | 2023-06-07 10:26 | 7.1M | |
![[ ]](/icons/layout.gif) | d2l-en.pdf | 2023-06-07 09:53 | 26M | |
![[ ]](/icons/layout.gif) | daa book1.pdf | 2023-06-07 09:02 | 28M | |
![[ ]](/icons/layout.gif) | daa book2.pdf | 2023-06-07 09:02 | 5.6M | |
![[ ]](/icons/layout.gif) | danjou_julien_the_hacker_s_guide_to_scaling_python.pdf | 2023-06-07 09:45 | 3.0M | |
![[ ]](/icons/layout.gif) | data_mining-arun_k_pujari.pdf | 2023-06-07 09:02 | 3.5M | |
![[ ]](/icons/layout.gif) | datasciencebook.pdf | 2023-03-28 11:21 | 55M | |
![[ ]](/icons/layout.gif) | david-foster-generative-deep-learning-teaching-2019.pdf | 2023-06-07 09:43 | 29M | |
![[ ]](/icons/layout.gif) | deep_learning_for_computer_vision_mini_course.pdf | 2023-06-07 09:38 | 223K | |
![[ ]](/icons/layout.gif) | dr-brian-tuomanen-hands-on-gpu-programming-with-python-2018.pdf | 2023-06-07 09:43 | 9.9M | |
![[ ]](/icons/layout.gif) | ethem-alpaydın-introduction-to-machine-learning-2010.pdf | 2023-06-07 09:42 | 2.9M | |
![[ ]](/icons/layout.gif) | exploring-kotlin.pdf | 2023-04-06 05:48 | 1.8M | |
![[ ]](/icons/layout.gif) | feature enginnering for machine learning.pdf | 2023-06-07 09:50 | 3.9M | |
![[ ]](/icons/compressed.gif) | fireship.io - That Weird JavaScript Course.zip | 2023-04-24 09:57 | 283M | |
![[ ]](/icons/layout.gif) | full-stack-react-typescript-node.pdf | 2023-06-07 09:45 | 24M | |
![[ ]](/icons/layout.gif) | hacking_how_to_hack_like_a_pro.pdf | 2023-06-07 10:42 | 3.9M | |
![[ ]](/icons/layout.gif) | hacking the windows registry .pdf | 2023-06-07 10:55 | 222K | |
![[ ]](/icons/layout.gif) | harrison-kinsley-daniel-kukieła-neural-networks-from-2020.pdf | 2023-06-07 09:46 | 43M | |
![[ ]](/icons/layout.gif) | how-to-code-in-go.pdf | 2023-06-06 03:55 | 2.8M | |
![[ ]](/icons/layout.gif) | html.pdf | 2023-05-11 03:31 | 1.7M | |
![[ ]](/icons/layout.gif) | html_tutorial.pdf | 2023-05-11 03:30 | 1.0M | |
![[ ]](/icons/layout.gif) | htmlcheatsheet.pdf | 2023-04-16 06:17 | 244K | |
![[ ]](/icons/layout.gif) | iOS Application Security [David_February 2016, 296 pp].pdf | 2023-06-07 10:51 | 16M | |
![[ ]](/icons/layout.gif) | iOS Hackers Handbook.pdf | 2023-06-07 10:49 | 4.7M | |
![[ ]](/icons/layout.gif) | iOS_15_For_iPhone_&_iPad_Tricks_And_Tips_–_7th_Edition,_2023.pdf | 2023-05-27 07:34 | 67M | |
![[ ]](/icons/compressed.gif) | interview-question-data-science-.zip | 2023-06-07 09:53 | 27M | |
![[IMG]](/icons/image2.gif) | java roadmap 2021.png | 2023-06-07 08:59 | 621K | |
![[ ]](/icons/layout.gif) | jquery cheatsheet.pdf | 2023-06-07 10:53 | 33K | |
![[ ]](/icons/layout.gif) | js_interview_questions.pdf | 2023-06-07 09:36 | 4.4M | |
![[ ]](/icons/layout.gif) | julian-avila-scikit-learn-cookbook-over-80-recipes-for-2017.pdf | 2023-06-07 09:41 | 7.1M | |
![[ ]](/icons/layout.gif) | katharine-jarmul-richard-lawson-python-web-scraping-2017.pdf | 2023-06-07 09:41 | 7.1M | |
![[ ]](/icons/layout.gif) | learn-python-in-7-days.pdf | 2023-06-07 09:52 | 8.2M | |
![[ ]](/icons/layout.gif) | leonardo-de-marchi-laura-mitchell-hands-on-neural-2019.pdf | 2023-06-07 09:43 | 22M | |
![[ ]](/icons/layout.gif) | linux-cheat-sheet.pdf | 2023-06-07 10:53 | 91K | |
![[ ]](/icons/layout.gif) | machine-learning-cheat-sheet.pdf | 2023-06-07 09:38 | 1.9M | |
![[ ]](/icons/layout.gif) | machine-learning-interview-questions.pdf | 2023-04-24 10:29 | 211K | |
![[ ]](/icons/layout.gif) | mariano-anaya-clean-code-in-python-refactor-your-2018.pdf | 2023-06-07 09:43 | 2.8M | |
![[ ]](/icons/layout.gif) | michael-driscoll-python-101-second-edition-2020.pdf | 2023-06-07 09:40 | 9.0M | |
![[ ]](/icons/layout.gif) | michael-walker-python-data-cleaning-cookbook-modern-2021.pdf | 2023-06-07 09:45 | 4.5M | |
![[ ]](/icons/layout.gif) | mml-book.pdf | 2023-06-07 09:53 | 17M | |
![[ ]](/icons/layout.gif) | mml book - sir.pdf | 2023-06-07 09:03 | 7.4M | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-19-11.jpg | 2023-06-07 08:49 | 38K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-19-29.jpg | 2023-06-07 08:49 | 83K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-53-11.jpg | 2023-06-07 09:23 | 75K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-53-34.jpg | 2023-06-07 09:23 | 126K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-55-36.jpg | 2023-06-07 09:25 | 115K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-56-07.jpg | 2023-06-07 09:26 | 197K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_14-56-24.jpg | 2023-06-07 09:26 | 42K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_15-00-28.jpg | 2023-06-07 09:30 | 85K | |
![[IMG]](/icons/image2.gif) | photo_2023-06-07_15-00-43.jpg | 2023-06-07 09:30 | 74K | |
![[ ]](/icons/layout.gif) | php Cheatsheet.pdf | 2023-06-07 10:53 | 58K | |
![[ ]](/icons/layout.gif) | practical statistics for data scientist.pdf | 2023-06-07 09:37 | 14M | |
![[ ]](/icons/layout.gif) | pytest_tutorial.pdf | 2023-06-07 10:53 | 858K | |
![[ ]](/icons/layout.gif) | python-guide .pdf | 2023-06-07 09:29 | 4.7M | |
![[ ]](/icons/layout.gif) | real world bug hunting.pdf | 2023-06-07 10:54 | 4.0M | |
![[ ]](/icons/layout.gif) | sandeep-bhowmik-cloud-computing-2017.pdf | 2023-06-07 09:44 | 12M | |
![[ ]](/icons/layout.gif) | seyedali-mirjalili-evolutionary-machine-learning-2020.pdf | 2023-06-07 09:43 | 7.4M | |
![[ ]](/icons/layout.gif) | shruti-jadon-ankush-garg-hands-on-one-shot-learning-2020.pdf | 2023-06-07 09:43 | 14M | |
![[ ]](/icons/layout.gif) | sridhar-alla-suman-kalyan-adari-beginning-anomaly-2019.pdf | 2023-06-07 09:44 | 27M | |
![[ ]](/icons/layout.gif) | tale-steve-hacking-with-python-the-ultimate-beginners-2017.pdf | 2023-06-07 09:45 | 3.1M | |
![[ ]](/icons/layout.gif) | tariq-rashid-make-your-own-neural-network-2016.pdf | 2023-06-07 09:43 | 7.5M | |
![[ ]](/icons/layout.gif) | teachers_guide_to_google_classroom.pdf | 2023-05-01 03:46 | 7.6M | |
![[ ]](/icons/layout.gif) | tensorflow-2-pocket-primer@NetworkArtificial.pdf | 2023-06-07 09:49 | 5.5M | |
![[ ]](/icons/layout.gif) | the-beginners-guide-to-bug-bounty-programs.pdf | 2023-06-07 10:43 | 4.0M | |
![[ ]](/icons/layout.gif) | tutorial.pdf | 2023-06-07 09:05 | 1.2M | |
![[ ]](/icons/layout.gif) | ubuntu pocket guide-v1-1.pdf | 2023-06-07 10:54 | 2.1M | |
![[ ]](/icons/layout.gif) | using-asyncio-python-understanding-asynchronous.pdf | 2023-06-07 09:44 | 5.9M | |
![[ ]](/icons/layout.gif) | venkateshwaran-loganathan-pyside-gui-application-2013.pdf | 2023-06-07 09:41 | 2.1M | |
![[ ]](/icons/layout.gif) | wang_xiaofei_et_al_edge_ai_convergence_of_edge_computing_and.pdf | 2023-06-07 09:43 | 4.7M | |
![[ ]](/icons/layout.gif) | web-programming cheatsheet.pdf | 2023-06-07 10:53 | 51K | |
![[ ]](/icons/layout.gif) | web penetration testing with kali.pdf | 2023-06-07 09:00 | 28M | |
![[ ]](/icons/layout.gif) | xiaoyue-jiang-deep-learning-in-object-detection-and-2019.pdf | 2023-06-07 09:44 | 10M | |
|