![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Allopanishad.pdf | 2023-06-08 06:40 | 72K | |
![[ ]](/icons/layout.gif) | The Riddle of Rama and Krishna -BR Ambedkar.pdf | 2023-06-08 07:21 | 136K | |
![[ ]](/icons/layout.gif) | Self Enquiry Ramanamaharshi.pdf | 2023-06-08 09:41 | 144K | |
![[ ]](/icons/layout.gif) | Why Iam an Atheist -Bhagath Singh.pdf | 2023-06-08 07:24 | 144K | |
![[ ]](/icons/layout.gif) | Astronomical_References_in_Mahabharata.pdf | 2023-06-08 09:24 | 146K | |
![[ ]](/icons/layout.gif) | dattatreya-yoga-shastra_telugu_PDF_file11558.pdf | 2023-06-08 09:16 | 154K | |
![[ ]](/icons/layout.gif) | Myth of Aryan Invasion David Frawley.pdf | 2023-06-08 09:34 | 154K | |
![[ ]](/icons/layout.gif) | Ambedkar, B. R - Waiting for a Visa.pdf | 2023-07-04 04:23 | 163K | |
![[ ]](/icons/layout.gif) | Looking_past_for_future_Ayurveda.pdf | 2023-06-08 09:30 | 176K | |
![[ ]](/icons/layout.gif) | The Depth and Breadth Of RSS.pdf | 2023-06-08 06:40 | 216K | |
![[ ]](/icons/layout.gif) | garudapuran.pdf | 2023-06-08 09:45 | 233K | |
![[ ]](/icons/layout.gif) | Hercolubus or Red Planet.pdf | 2023-06-08 07:32 | 285K | |
![[ ]](/icons/layout.gif) | 7211422-The-Shiva-Samhita-ENG.pdf | 2023-06-08 09:25 | 302K | |
![[ ]](/icons/layout.gif) | 356462509-06-Aghora-ebook-draft-pdf.pdf | 2023-06-08 09:25 | 341K | |
![[ ]](/icons/layout.gif) | Yoga-Makaranda Part-2 .pdf | 2023-06-08 10:10 | 393K | |
![[ ]](/icons/layout.gif) | సూర్య_చికిత్సా_విజ్ఞానము_రోగ_రహిత_జీవనము.pdf | 2023-06-08 09:30 | 397K | |
![[ ]](/icons/layout.gif) | Who I Am Ramana-Maharshi.pdf | 2023-06-08 09:41 | 425K | |
![[ ]](/icons/layout.gif) | @eBookRoom. The Dip.pdf | 2023-06-08 08:00 | 445K | |
![[ ]](/icons/layout.gif) | indian-philosophy-english.pdf | 2023-06-08 09:36 | 445K | |
![[ ]](/icons/layout.gif) | arthuravalonkularnavatantraeng.pdf | 2023-06-08 09:48 | 452K | |
![[ ]](/icons/layout.gif) | Tirupati Balaji Was A Buddhisht Shrine -Jamanadas K.pdf | 2023-06-08 07:21 | 484K | |
![[ ]](/icons/layout.gif) | Communion, A True Story.pdf | 2023-06-08 07:33 | 547K | |
![[ ]](/icons/layout.gif) | learn-sanskrit-through-self-study_compress.pdf | 2023-06-08 09:24 | 554K | |
![[ ]](/icons/layout.gif) | Death of the Aryan Invasion Theory David Frawley.pdf | 2023-06-08 09:34 | 565K | |
![[ ]](/icons/layout.gif) | Che_Guevara_On_Socialism_and_Internationalism_EN.pdf | 2023-05-14 07:29 | 586K | |
![[ ]](/icons/layout.gif) | Dhanvantarigari Chikitsa (Kathalu) by Sakhamuru Ramagopal.pdf | 2023-06-08 09:32 | 615K | |
![[ ]](/icons/layout.gif) | Chaturvedi B.K. - Bhavishya purana .pdf | 2023-06-08 09:21 | 635K | |
![[ ]](/icons/layout.gif) | Woke A Guide to Social Justice (Titania McGrath).pdf | 2023-06-08 08:03 | 641K | |
![[ ]](/icons/layout.gif) | dronacharya.pdf | 2023-06-08 09:38 | 645K | |
![[ ]](/icons/layout.gif) | సమగ్ర_భారత_చరిత్ర_జాతీయోద్యమం_K_కృష్ణారెడ్డి.pdf | 2023-04-21 10:17 | 646K | |
![[ ]](/icons/layout.gif) | aditya-hridayam.pdf | 2023-06-08 10:08 | 673K | |
![[ ]](/icons/layout.gif) | Tripura-Rahasya.pdf | 2023-06-08 09:24 | 679K | |
![[ ]](/icons/layout.gif) | Introduction to Tantra Sastra.pdf | 2023-06-08 10:07 | 711K | |
![[ ]](/icons/layout.gif) | Life_Is_What_You_Make_It_by_Preeti_Shenoy.pdf | 2023-06-26 07:33 | 722K | |
![[ ]](/icons/layout.gif) | Yakshaprasna Sanskrit English.pdf | 2023-06-08 09:41 | 735K | |
![[ ]](/icons/layout.gif) | The Beast Tamer (Ruskin Bond).pdf | 2023-07-10 07:29 | 738K | |
![[ ]](/icons/layout.gif) | History_Hyd-hess-2020-213.pdf | 2023-06-08 09:27 | 749K | |
![[ ]](/icons/layout.gif) | The Science of Pranayama.pdf | 2023-06-08 09:16 | 766K | |
![[ ]](/icons/layout.gif) | Drive_The_Surprising_Truth_about_What_Motivates_Us_by_Daniel_H_Pink.pdf | 2023-06-08 07:59 | 791K | |
![[ ]](/icons/layout.gif) | Khattar Kaka -Hari Mohan Jha.pdf | 2023-06-08 07:21 | 791K | |
![[ ]](/icons/layout.gif) | Lalita Sahasra Namamu.pdf | 2023-06-08 09:24 | 796K | |
![[ ]](/icons/layout.gif) | mana_chuttu_perige_mokkala_oushadha_-_adyatmika_viluvalu.pdf | 2023-06-08 09:42 | 821K | |
![[ ]](/icons/layout.gif) | Dialogue_and_History_Constructing_South_India,_1795_1895_Eugene.pdf | 2023-06-08 07:57 | 854K | |
![[ ]](/icons/layout.gif) | శ్రీ శివ పురాణం(1).pdf | 2023-06-08 10:12 | 855K | |
![[ ]](/icons/layout.gif) | Tractatus Logico-Philosophicus -Ludwig Wittgenstein.pdf | 2023-07-07 06:43 | 867K | |
![[ ]](/icons/layout.gif) | Shilappadikaram_Ilango_Adigal.pdf | 2023-06-08 07:15 | 877K | |
![[ ]](/icons/layout.gif) | Buddha or Karl Marx by Dr. Ambedkar.pdf | 2023-06-08 07:23 | 886K | |
![[ ]](/icons/layout.gif) | Ambedkar,_B_R_The_Untouchables_Who_were_they_and_why_they_became.pdf | 2023-07-04 04:23 | 895K | |
![[ ]](/icons/layout.gif) | Marma-Points-of-Ayurveda-Vasant-Lad.09673.pdf | 2023-06-08 09:30 | 946K | |
![[ ]](/icons/layout.gif) | India’s_Most_Fearless_True_Stories_of_Modern_Military_Heroes_Shiv.pdf | 2023-06-10 04:56 | 967K | |
![[ ]](/icons/layout.gif) | mantreswara_s__phaladeeplka.pdf | 2023-06-08 09:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Advaita.pdf | 2023-06-08 09:17 | 1.0M | |
![[ ]](/icons/layout.gif) | vaidyanaikantika_padaparijathamu.pdf | 2023-06-08 09:26 | 1.0M | |
![[ ]](/icons/layout.gif) | @eBookRoom. The Art of Thinking Clearly.pdf | 2023-06-08 08:00 | 1.0M | |
![[ ]](/icons/layout.gif) | How_I_Became_a_Hindu_My_discovery_of_Vedic_Dharma_David_Frawley_.pdf | 2023-06-08 09:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Mūlamadhyamakakārikā -Nagarjuna.pdf | 2023-06-08 07:26 | 1.0M | |
![[ ]](/icons/layout.gif) | Meditation_and_Its_Methods_8freebooks_net_$_@meet_book_storage.pdf | 2023-06-08 09:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Civil Disobedience in Indian Tradition (Volume 2).pdf | 2023-06-08 09:49 | 1.0M | |
![[ ]](/icons/layout.gif) | Hinduism_and_Modern_World_Arise_Arjuna_David_Frawley.pdf | 2023-06-08 07:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Hinduism and Modern World Arise Arjuna David Frawley.pdf | 2023-06-08 09:34 | 1.0M | |
![[ ]](/icons/layout.gif) | Kautilya’s_Arthashastra_The_Way_of_Fianancial_Management_and_Economic.pdf | 2023-06-08 09:21 | 1.0M | |
![[ ]](/icons/layout.gif) | 8lectures of M planck.pdf | 2023-06-08 07:54 | 1.0M | |
![[ ]](/icons/layout.gif) | How_I_became_a_Hindu_David_Frawley.pdf | 2023-06-08 07:22 | 1.0M | |
![[ ]](/icons/layout.gif) | The_Ten_Principal_Upanishads.pdf | 2023-06-08 07:28 | 1.0M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 07.pdf | 2023-07-04 04:16 | 1.0M | |
![[ ]](/icons/layout.gif) | classification of plants in ancient science.pdf | 2023-06-08 09:30 | 1.1M | |
![[ ]](/icons/layout.gif) | Language of the Birds.pdf | 2023-06-08 07:32 | 1.1M | |
![[ ]](/icons/layout.gif) | Why Iam Not a Hindu -Kancha Ilaiah.pdf | 2023-06-08 07:22 | 1.1M | |
![[ ]](/icons/layout.gif) | The_Two_Traditions_of_Meditation_in_Ancient_India.pdf | 2023-06-08 07:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Joothan -Omprakash Valmiki.pdf | 2023-06-08 06:36 | 1.1M | |
![[ ]](/icons/layout.gif) | A_Flowering_Tree_and_Other_Oral_Tales_from_India_by_A_K_Ramanujan.pdf | 2023-06-08 07:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Blink_ The Power of Thinking Without Thinking ( PDFDrive ).pdf | 2023-06-08 08:00 | 1.1M | |
![[ ]](/icons/layout.gif) | Buddhacharita -Asvaghosa.pdf | 2023-06-08 07:24 | 1.1M | |
![[ ]](/icons/layout.gif) | Who Was Shivaji -Govind Pansare.pdf | 2023-06-08 07:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Great_Thinkers_on_Ramakrishna_Vivekananda_by Ramakrishna_Mission.pdf | 2023-06-08 09:26 | 1.2M | |
![[ ]](/icons/layout.gif) | Women_s_eyes.pdf | 2023-06-08 06:33 | 1.2M | |
![[ ]](/icons/layout.gif) | Miracles of the Gods.pdf | 2023-06-08 07:40 | 1.3M | |
![[ ]](/icons/layout.gif) | The-Yoga-of-Power -Tantra,-Shakti,-and-the-Secret-Way-.pdf | 2023-06-08 09:16 | 1.3M | |
![[ ]](/icons/layout.gif) | Hinduism and the Clash of Civilizations David Frawley.pdf | 2023-06-08 09:34 | 1.3M | |
![[ ]](/icons/layout.gif) | With_Respect_to_Sex_Negotiating_Hijra_Identity_in_South_India_by.pdf | 2023-06-08 07:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Buffalo_Nationalism_A_Critique_of_Spiritual_Fascism_PDFDrive_.pdf | 2023-06-08 06:36 | 1.4M | |
![[ ]](/icons/layout.gif) | India_s_Glorious_Scientific_Tradition_Suresh_Soni_1_.pdf | 2023-06-08 07:21 | 1.4M | |
![[ ]](/icons/layout.gif) | Somanatha The Shrine Eternal by K.M Munshi.pdf | 2023-06-08 08:03 | 1.4M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_5.pdf | 2023-06-08 08:38 | 1.4M | |
![[ ]](/icons/layout.gif) | Pakistan_or_Partition_of_India_Dr_B_R_Ambedkar_.pdf | 2023-06-08 07:57 | 1.4M | |
![[ ]](/icons/layout.gif) | We or Our Nationhood Defined -MS Golwalkar.pdf | 2023-06-08 07:21 | 1.4M | |
![[ ]](/icons/layout.gif) | 116_మహర్షుల_జీవిత_చరిత్రలు.pdf | 2023-06-08 09:17 | 1.5M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 03.pdf | 2023-07-04 04:16 | 1.5M | |
![[ ]](/icons/layout.gif) | The Positive Psychology of Buddhism and Yoga(Marvin Levine).pdf | 2023-07-04 04:09 | 1.5M | |
![[ ]](/icons/layout.gif) | The Incredible Life of a Himala - Shuddhaanandaa Brahmachari.pdf | 2023-06-08 09:15 | 1.5M | |
![[ ]](/icons/layout.gif) | Essays on Tradition, Recovery and Freedom (Volume 5).pdf | 2023-06-08 09:49 | 1.5M | |
![[ ]](/icons/layout.gif) | Indian_Buddhist_Philosophy_Amber_Carpenter_B._Routledge.pdf | 2023-06-08 06:35 | 1.5M | |
![[ ]](/icons/layout.gif) | Path Of Self Knowledge Ramana maharshi.pdf | 2023-06-08 09:41 | 1.6M | |
![[ ]](/icons/layout.gif) | Free Speech And Why It Matters (Andrew Doyle) A4.pdf | 2023-06-08 08:02 | 1.6M | |
![[ ]](/icons/layout.gif) | Insights into Vedanta-Tattvabodha.pdf | 2023-06-08 09:28 | 1.6M | |
![[ ]](/icons/layout.gif) | introduction_to_purvamimamsa_system.pdf | 2023-06-08 09:38 | 1.6M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_4.pdf | 2023-06-08 08:38 | 1.6M | |
![[ ]](/icons/layout.gif) | Jaimini Sutrartha Deepika(2).pdf | 2023-06-08 09:17 | 1.6M | |
![[ ]](/icons/layout.gif) | Tales_of_the_Sun_or_FolkLore_In_Southern_India.pdf | 2023-06-08 07:43 | 1.6M | |
![[ ]](/icons/layout.gif) | Manu-Smriti.pdf | 2023-06-08 09:15 | 1.6M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 04.pdf | 2023-07-04 04:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Riddles in Hinduism -Ambedkar BR.pdf | 2023-06-08 07:25 | 1.6M | |
![[ ]](/icons/layout.gif) | Angels Devil and Science -PM Bhargava.pdf | 2023-06-08 07:21 | 1.6M | |
![[ ]](/icons/layout.gif) | Total Freedom. The Essential Krishnamurti.pdf | 2023-06-08 06:40 | 1.6M | |
![[ ]](/icons/layout.gif) | Arise Arjuna--Hinduism Resurgent in a New Century.pdf | 2023-06-08 09:28 | 1.6M | |
![[ ]](/icons/layout.gif) | Politically_Incorrect_Guide_To_Islam_By_Robert_Spencer_Robert_Spencer.pdf | 2023-06-08 07:58 | 1.7M | |
![[ ]](/icons/layout.gif) | Begone Godmen -AT Kovoor.pdf | 2023-06-08 07:23 | 1.7M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_3 (2).pdf | 2023-06-08 09:59 | 1.7M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_3.pdf | 2023-06-08 08:38 | 1.7M | |
![[ ]](/icons/layout.gif) | An Interpretation Of Jain Ethics -Dr.Charlotte Krause.pdf | 2023-06-08 07:24 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Beautiful_Tree_Indigenous_Indian_Education_in_the_Eighteenth.pdf | 2023-06-08 09:49 | 1.7M | |
![[ ]](/icons/layout.gif) | The_Rise_of_the_New_Puritans_Noah_Rothman_Fighting_Back_Against.pdf | 2023-06-08 08:01 | 1.7M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Book_Part_4_The_Jewelled_Crown.pdf | 2023-06-08 07:23 | 1.7M | |
![[ ]](/icons/layout.gif) | Chandra-Chhaya-Ganitam.pdf | 2023-06-08 09:16 | 1.8M | |
![[ ]](/icons/layout.gif) | India’s_Most_Fearless_2_More_Military_Stories_of_Unimaginable_Courage.pdf | 2023-06-10 04:56 | 1.8M | |
![[ ]](/icons/layout.gif) | Samveda.pdf | 2023-06-08 09:53 | 1.8M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_1.pdf | 2023-06-08 08:38 | 1.8M | |
![[ ]](/icons/layout.gif) | potana_bhagavatam_vol_2.pdf | 2023-06-08 08:38 | 1.8M | |
![[ ]](/icons/layout.gif) | The Missionary Position -Christopher Hitchens.pdf | 2023-06-08 06:32 | 1.8M | |
![[ ]](/icons/layout.gif) | Practical_Ayurveda_Ayurvedic_Ayurveda_in_Depth_David_Frawley_Atreya.pdf | 2023-06-08 09:34 | 1.8M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 01.pdf | 2023-07-04 04:16 | 1.8M | |
![[ ]](/icons/layout.gif) | access resource.pdf | 2023-06-15 09:39 | 1.8M | |
![[ ]](/icons/layout.gif) | Ambedkar, B. R - Who were the Shudras.pdf | 2023-07-04 04:23 | 1.8M | |
![[ ]](/icons/layout.gif) | vedanta-sutras-with-the-commentary-by-sankaracharya.pdf | 2023-06-08 09:17 | 1.9M | |
![[ ]](/icons/layout.gif) | astanga-hridaya-sutrasthan-handbook.pdf | 2023-06-08 09:29 | 1.9M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_part_3_Sword_Of_Slaughter_Kalki_Krishnamurthy.pdf | 2023-06-08 07:23 | 1.9M | |
![[ ]](/icons/layout.gif) | Collected_Works_Periyar_E_V_Ramasamy_Collected_Works_of_Periyar_.pdf | 2023-06-08 07:21 | 1.9M | |
![[ ]](/icons/layout.gif) | Book. Bhrigu Samhita T.M.Rao.pdf | 2023-06-08 09:16 | 1.9M | |
![[ ]](/icons/layout.gif) | VastugunaDeepika by A.N. Jagannadhasharma.pdf | 2023-06-08 09:30 | 1.9M | |
![[ ]](/icons/layout.gif) | Panchayat Raj and India's Polity (Volume 4).pdf | 2023-06-08 09:49 | 1.9M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 05.pdf | 2023-07-04 04:16 | 2.0M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Part_1_Fresh_Floods_Kalki_Krishna_Murthy.pdf | 2023-06-08 07:23 | 2.0M | |
![[ ]](/icons/layout.gif) | The_Vimanika_Shastra_Ancient_Manuscript_on_the_Construction_and.pdf | 2023-06-08 08:04 | 2.0M | |
![[ ]](/icons/layout.gif) | The_New_Puritans_Andrew_Doyle_How_the_Religion_of_Social_Justice.pdf | 2023-06-08 08:02 | 2.0M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Whirlwinds_Part_2_Kalki_Krishnamurthy.pdf | 2023-06-08 07:23 | 2.0M | |
![[ ]](/icons/layout.gif) | Arthashastra of Chanakya.pdf | 2023-06-08 07:23 | 2.1M | |
![[ ]](/icons/layout.gif) | Kautilya arthasastra.pdf | 2023-06-08 09:21 | 2.1M | |
![[ ]](/icons/layout.gif) | The history of Sultan Mahmud of Ghazni_By Firishtah.pdf | 2023-06-08 06:33 | 2.1M | |
![[ ]](/icons/layout.gif) | bhagwat_gita_gita_press_english_translation_sadhak_sanjivani_web.pdf | 2023-06-08 08:35 | 2.1M | |
![[ ]](/icons/layout.gif) | Woke,_Inc_Vivek_Ramaswamy_Inside_Corporate_Americas_Social_Justice.pdf | 2023-06-08 08:01 | 2.1M | |
![[ ]](/icons/layout.gif) | Gita Shankara Bhashya English (Adwait).pdf | 2023-06-08 10:10 | 2.1M | |
![[ ]](/icons/layout.gif) | Human by Design.pdf | 2023-06-08 07:32 | 2.1M | |
![[ ]](/icons/layout.gif) | Paul-Brunton-A-Search-in-Secret-India.pdf | 2023-06-08 09:22 | 2.1M | |
![[ ]](/icons/layout.gif) | Mudras_for_Awakening_Chakras_19_Simple_Hand_Gestures_for_Awakening.pdf | 2023-06-08 09:20 | 2.1M | |
![[ ]](/icons/layout.gif) | Brahmanda Pu I.pdf | 2023-06-08 10:08 | 2.1M | |
![[ ]](/icons/layout.gif) | laghu-yoga-vasishta-english.pdf | 2023-06-08 09:49 | 2.2M | |
![[ ]](/icons/layout.gif) | Revealing_Facts_about_India's_Freedom_Stru_Rajnikant_Puranik.pdf | 2023-06-08 09:32 | 2.2M | |
![[ ]](/icons/layout.gif) | gandhi_hinduism.pdf | 2023-06-08 07:30 | 2.2M | |
![[ ]](/icons/layout.gif) | Gheranda samhita.pdf | 2023-06-08 09:15 | 2.2M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 02.pdf | 2023-07-04 04:16 | 2.2M | |
![[ ]](/icons/layout.gif) | madanapala-nighantu.pdf | 2023-06-08 07:54 | 2.2M | |
![[ ]](/icons/layout.gif) | చాణక్యుని_అర్థ_శాస్త్రం.pdf | 2023-06-08 10:07 | 2.2M | |
![[ ]](/icons/layout.gif) | Krishna-and-mediation.pdf | 2023-07-04 04:24 | 2.3M | |
![[ ]](/icons/layout.gif) | hindumedicine020132mbp.pdf | 2023-06-08 09:30 | 2.4M | |
![[ ]](/icons/layout.gif) | Bruhat Vaidya Ratnakaram(2).pdf | 2023-06-08 09:32 | 2.4M | |
![[ ]](/icons/layout.gif) | A_Second_Defence_of_the_Monotheistical_System_of_the_Veds__In_Reply.pdf | 2023-06-08 07:56 | 2.4M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 06.pdf | 2023-07-04 04:16 | 2.4M | |
![[ ]](/icons/layout.gif) | How_to_Debate_the_Left_on_Islam_by_Paul_Nielsen_1st_Ed_Freedom_of.pdf | 2023-06-08 08:03 | 2.4M | |
![[ ]](/icons/layout.gif) | akshara-kashayam-english.pdf | 2023-06-08 09:32 | 2.5M | |
![[ ]](/icons/layout.gif) | sri_chakra_vishesa_pujaha.pdf | 2023-06-08 09:26 | 2.5M | |
![[ ]](/icons/layout.gif) | Bahubali_Amar_Chitra_Katha.pdf | 2023-06-08 07:15 | 2.5M | |
![[ ]](/icons/layout.gif) | Oracle of the Illuminati.pdf | 2023-06-08 07:32 | 2.5M | |
![[ ]](/icons/layout.gif) | Why I am not a Muslim -Ibn Warraq.pdf | 2023-06-08 07:59 | 2.6M | |
![[ ]](/icons/layout.gif) | Francesco_Corea_An_Introduction_to_Data_Everythz_lib_org.pdf | 2023-07-07 06:33 | 2.6M | |
![[ ]](/icons/layout.gif) | The Enrichment of Life by K, S. CHANDRASEKHARA AIYAR..pdf | 2023-07-10 11:01 | 2.6M | |
![[ ]](/icons/layout.gif) | 549742194-122976799-Tibetian-Tantra.pdf | 2023-06-08 09:24 | 2.7M | |
![[ ]](/icons/layout.gif) | Indian_Science_and_Technology_in_the_Eighteenth_Century_Volume_1.pdf | 2023-06-08 09:49 | 2.7M | |
![[ ]](/icons/layout.gif) | POEMS -Subramania Bharati.pdf | 2023-06-08 07:20 | 2.7M | |
![[ ]](/icons/layout.gif) | Siddhānta-Darpaṇa of Nīlakaṇṭha.pdf | 2023-06-08 09:26 | 2.7M | |
![[ ]](/icons/layout.gif) | Saffron_Swords__Centuries_of_Indic_Resistance_to_Invaders_Book_by.pdf | 2023-06-08 07:58 | 2.7M | |
![[ ]](/icons/layout.gif) | you the super teacher.pdf | 2023-07-07 11:05 | 2.7M | |
![[ ]](/icons/layout.gif) | Dr_Bababsaheb_Ambedkar_Writings_and_Speeches_Vol_14_part_01.pdf | 2023-07-04 04:16 | 2.7M | |
![[ ]](/icons/layout.gif) | Hindu Dharma_ The Universal Way of Life.pdf | 2023-06-08 07:20 | 2.8M | |
![[ ]](/icons/layout.gif) | Flying Serpents and Dragons.pdf | 2023-06-08 07:33 | 2.8M | |
![[ ]](/icons/layout.gif) | bharateeya_samskriti.pdf | 2023-06-08 09:45 | 2.8M | |
![[ ]](/icons/layout.gif) | Yajurveda.pdf | 2023-06-08 09:53 | 2.8M | |
![[ ]](/icons/layout.gif) | Jitendra_Chouksey_LOSE_FAT,_GET_FITTR_THE_SIMPLE_SCIENCE_OF_STAYING.pdf | 2023-06-13 09:05 | 2.9M | |
![[ ]](/icons/layout.gif) | Ancient_India_in_Historical_Outline_by_D.N.Jha.pdf | 2023-06-08 06:40 | 2.9M | |
![[ ]](/icons/layout.gif) | The_Rigveda_and_the_Avesta_The_Final_Evidence.pdf | 2023-06-08 07:22 | 2.9M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_3_sabha_parvam.pdf | 2023-06-08 09:08 | 2.9M | |
![[ ]](/icons/layout.gif) | The Decline And Fall Of Buddhism -Jamanadas.pdf | 2023-06-08 07:16 | 2.9M | |
![[ ]](/icons/layout.gif) | The Idol Thief__Book by S. Vijay Kumar.pdf | 2023-06-08 08:04 | 2.9M | |
![[ ]](/icons/layout.gif) | Ramayana The Poisonous Tree -Ranganayakamma.pdf | 2023-06-15 06:15 | 3.0M | |
![[ ]](/icons/layout.gif) | Holy Geeta by Swami Chinmayana.pdf | 2023-06-08 09:58 | 3.0M | |
![[ ]](/icons/layout.gif) | BRAHUI_LANGUAGE_Past_Present_and_Future.pdf | 2023-06-08 06:33 | 3.0M | |
![[ ]](/icons/layout.gif) | hampikshetramu019998mbp.pdf | 2023-06-08 09:27 | 3.1M | |
![[ ]](/icons/layout.gif) | Gita Press and the making of Hindu India.pdf | 2023-06-08 10:10 | 3.1M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_2_adi_parvam_p-2.pdf | 2023-06-08 09:08 | 3.1M | |
![[ ]](/icons/layout.gif) | The_Heart_of_Tantric_Sex_A_Unique_Guide_to_Love_and_Sexual_Fulfillment.pdf | 2023-06-08 07:22 | 3.2M | |
![[ ]](/icons/layout.gif) | the-vimanika-shastra.pdf | 2023-06-08 09:18 | 3.2M | |
![[ ]](/icons/layout.gif) | 18-maha-puranas-in-english.pdf | 2023-06-08 09:22 | 3.2M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_10_karna_parvam.pdf | 2023-06-08 09:08 | 3.2M | |
![[ ]](/icons/layout.gif) | The Book Of Numbers.pdf | 2023-06-08 06:39 | 3.2M | |
![[ ]](/icons/layout.gif) | At The Feet Of The Master_By Jiddu Krishnamurti.pdf | 2023-06-08 07:25 | 3.3M | |
![[ ]](/icons/layout.gif) | Hindu Temples_ What Happened to Them vol 2.pdf | 2023-06-08 08:03 | 3.3M | |
![[ ]](/icons/layout.gif) | Slavery -Mahtma Jyotiba Phule.pdf | 2023-06-08 06:38 | 3.3M | |
![[ ]](/icons/layout.gif) | 108-Upanishads.pdf | 2023-06-08 09:51 | 3.3M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_8_bheshma_parvam.pdf | 2023-06-08 09:08 | 3.3M | |
![[ ]](/icons/layout.gif) | Ponniyin_Selvan_Part_5_The_Zenith_of_Sacrifice_Kalki_Krishnamurt.pdf | 2023-06-08 07:23 | 3.3M | |
![[ ]](/icons/layout.gif) | buddha-teachingsurw6.pdf | 2023-06-08 10:12 | 3.3M | |
![[ ]](/icons/layout.gif) | Annihilation Of Caste -BR Ambedkar.pdf | 2023-06-08 07:15 | 3.4M | |
![[ ]](/icons/layout.gif) | Ark of the Christos.pdf | 2023-06-08 07:32 | 3.4M | |
![[ ]](/icons/layout.gif) | Legends of Indias temples.pdf | 2023-06-08 07:13 | 3.5M | |
![[ ]](/icons/layout.gif) | Om_Swami_A_Million_Thoughts_Learn_All_About_Meditation_from_a_Himalayan.pdf | 2023-06-08 09:20 | 3.5M | |
![[ ]](/icons/layout.gif) | Yoga_Makaranda part 1 .pdf | 2023-06-08 10:10 | 3.5M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_12_santi_parvam_p-1.pdf | 2023-06-08 08:38 | 3.6M | |
![[ ]](/icons/layout.gif) | KundaliniYogarahasyam.pdf | 2023-06-08 09:17 | 3.6M | |
![[ ]](/icons/layout.gif) | Adventures of Feluda -Trouble in Gangtok by Satyajit Ray.pdf | 2023-06-08 06:31 | 3.6M | |
![[ ]](/icons/layout.gif) | The_Date_of_the_Maha_Bharata_War_and_the_Kali_Yugadhi_By_Professor.pdf | 2023-06-08 07:32 | 3.7M | |
![[ ]](/icons/layout.gif) | Candrakīrti .pdf | 2023-06-08 06:32 | 3.7M | |
![[ ]](/icons/layout.gif) | Folk-tales_of_Bengal.pdf | 2023-06-08 07:43 | 3.7M | |
![[ ]](/icons/layout.gif) | Kalagnanmu - Sri Sri Sri Veerabrahemdra Swami.pdf | 2023-06-08 09:17 | 3.8M | |
![[ ]](/icons/layout.gif) | Hindu_Temples_What_Happened_to_Them_2_Vol._Set_Sita_Ram_Goel.pdf | 2023-06-08 07:21 | 3.9M | |
![[ ]](/icons/layout.gif) | RigVeda.pdf | 2023-06-08 07:54 | 4.0M | |
![[ ]](/icons/layout.gif) | The_Markandeya_Purana.pdf | 2023-06-08 09:21 | 4.0M | |
![[ ]](/icons/layout.gif) | The Buddha And His Dhamma -BR Ambedkar.pdf | 2023-06-08 06:40 | 4.1M | |
![[ ]](/icons/layout.gif) | Sacred Plants of IndiaBook by Nanditha Krishna (2).pdf | 2023-06-08 09:28 | 4.1M | |
![[ ]](/icons/layout.gif) | B_R_Ambedkar_Pakistan_or_the_Partition_of_India_Dr_B_R_Ambedkar.pdf | 2023-06-08 07:57 | 4.1M | |
![[ ]](/icons/layout.gif) | Pakistan_or_the_Partition_of_India_B_R_Ambedkar.pdf | 2023-06-08 07:57 | 4.1M | |
![[ ]](/icons/layout.gif) | The Four Values In Indian Philosophy And Culture.pdf | 2023-07-10 11:01 | 4.1M | |
![[ ]](/icons/layout.gif) | The Moghul -Thomas Hoover.pdf | 2023-06-08 07:26 | 4.1M | |
![[ ]](/icons/layout.gif) | Jews In India And Far East -Henry Ford.pdf | 2023-06-08 07:15 | 4.2M | |
![[ ]](/icons/layout.gif) | Khajuraho details book.pdf | 2023-06-08 09:19 | 4.2M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_4_aranya_parvam_p-1.pdf | 2023-06-08 09:08 | 4.2M | |
![[ ]](/icons/layout.gif) | vrkshayurvedas.pdf | 2023-06-08 09:30 | 4.3M | |
![[ ]](/icons/layout.gif) | Katyayana_And_Patanjali_Their_Relation_To_Each_Other_And_To_Panini.pdf | 2023-06-08 07:25 | 4.3M | |
![[ ]](/icons/layout.gif) | PREHISTORIC CIVILIZATION OF THE_INDUS VALLEY.pdf | 2023-06-08 07:23 | 4.3M | |
![[ ]](/icons/layout.gif) | agastyavidyamu025678mbp.pdf | 2023-06-08 09:30 | 4.3M | |
![[ ]](/icons/layout.gif) | Basics of Vedanta Philosophy.pdf | 2023-06-08 09:44 | 4.3M | |
![[ ]](/icons/layout.gif) | 2015.142960.A-Short-History-Of-Kerala.pdf | 2023-06-08 09:26 | 4.4M | |
![[ ]](/icons/layout.gif) | The_Manual_for_Self_Realization_112_Meditations_of_the_Vijnana_Bhairava.pdf | 2023-06-08 07:20 | 4.4M | |
![[ ]](/icons/layout.gif) | Purusha Sukta.pdf | 2023-06-08 09:27 | 4.4M | |
![[ ]](/icons/layout.gif) | 2015.76372.Kalyana-Kalpataru-Vol-Iv-No-6-June-1937.pdf | 2023-06-08 09:54 | 4.5M | |
![[ ]](/icons/layout.gif) | Devi Bhagavata Swami Vijnananda.pdf | 2023-06-08 09:55 | 4.5M | |
![[ ]](/icons/layout.gif) | True Stories of The Real Men in Black.pdf | 2023-06-08 07:32 | 4.5M | |
![[ ]](/icons/layout.gif) | Amar_Chitra_Katha_Krishna.pdf | 2023-06-08 07:14 | 4.6M | |
![[ ]](/icons/layout.gif) | Leaving Islam .ibn Warraq .pdf | 2023-06-08 07:59 | 4.6M | |
![[ ]](/icons/layout.gif) | Brahmacharya-Vignanamu.pdf | 2023-06-08 09:28 | 4.6M | |
![[ ]](/icons/layout.gif) | AtharvaVeda.pdf | 2023-06-08 09:53 | 4.6M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_7_udyoga_parvam.pdf | 2023-06-08 09:08 | 4.6M | |
![[ ]](/icons/layout.gif) | Ayurvedic Medical Astro.pdf | 2023-06-10 04:53 | 4.7M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_11_shalya_sowptika_stri_parvam.pdf | 2023-06-08 08:38 | 4.7M | |
![[ ]](/icons/layout.gif) | Figuring the joy of numbers.pdf | 2023-06-08 06:33 | 4.7M | |
![[ ]](/icons/layout.gif) | agastya rasayanika tantram.pdf | 2023-06-08 10:00 | 4.7M | |
![[ ]](/icons/layout.gif) | Indian Histroy and Culture smartviewinc.com (1).pdf | 2023-06-20 03:42 | 4.8M | |
![[ ]](/icons/layout.gif) | Tajmahal_Is_an_Ancient_Siva_Temple.pdf | 2023-06-08 08:04 | 4.8M | |
![[ ]](/icons/layout.gif) | principles-of-silpashastra.pdf | 2023-06-08 09:58 | 4.8M | |
![[ ]](/icons/layout.gif) | Bradbury_Rod_,_Erikson_Thomas_,_Pender_Martin_,_Surrounded_by_idiots.pdf | 2023-06-08 08:00 | 4.8M | |
![[ ]](/icons/layout.gif) | Saundaryalaharī_of_Śaṅkarācārya_Sanskrit_text_in_Devangari.pdf | 2023-06-08 06:31 | 4.8M | |
![[ ]](/icons/layout.gif) | Agni Purana. Vol. 3.pdf | 2023-06-08 10:09 | 4.9M | |
![[ ]](/icons/layout.gif) | Sri-Ram-Charita-Manas-the-Ramayana-of-Goswami-Tulasidas.pdf | 2023-06-08 09:35 | 4.9M | |
![[ ]](/icons/layout.gif) | Svetasvatara Upanishad Tyagisananda RK Mutt.pdf | 2023-06-08 09:55 | 4.9M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_1_adi_parvam_p-1.pdf | 2023-06-08 09:08 | 4.9M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_13_santi_parvam_p-2.pdf | 2023-06-08 08:38 | 4.9M | |
![[ ]](/icons/layout.gif) | My_First_Little_Book_of_Intersectional_Activism_Titania_McGrath.pdf | 2023-06-08 08:03 | 5.0M | |
![[ ]](/icons/layout.gif) | Dr_Bababsaheb_Ambedkar_Writings_and_Speeches_Vol_17_part_02.pdf | 2023-07-04 04:16 | 5.1M | |
![[ ]](/icons/layout.gif) | ayurveda018331mbp.pdf | 2023-06-08 09:30 | 5.2M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_5_aranya_parvam_p-2.pdf | 2023-06-08 09:08 | 5.2M | |
![[ ]](/icons/layout.gif) | Ravana The Great.pdf | 2023-06-08 07:14 | 5.2M | |
![[ ]](/icons/layout.gif) | Tholi telugu sasanam.pdf | 2023-06-08 09:43 | 5.2M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_14_anushasanika_parvam.pdf | 2023-06-08 08:38 | 5.2M | |
![[ ]](/icons/layout.gif) | Scientific_Knowledge_in_Vedas.pdf | 2023-06-08 07:25 | 5.2M | |
![[ ]](/icons/layout.gif) | Ambedkar, B. R - Riddles in Hinduism.pdf | 2023-07-04 04:23 | 5.3M | |
![[ ]](/icons/layout.gif) | Riddles_in_Hinduism_Ambedkar_B.R..pdf | 2023-06-08 07:25 | 5.3M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_15_aswamedha_asramavasa_mousala_mahaprasthanika.pdf | 2023-06-08 08:38 | 5.3M | |
![[ ]](/icons/layout.gif) | infallible_vedic_remedies_mantras_for_common_problems_compress.pdf | 2023-06-08 09:24 | 5.4M | |
![[ ]](/icons/layout.gif) | ఋగ్వేదం.pdf | 2023-06-08 10:12 | 5.4M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 11.pdf | 2023-07-04 04:16 | 5.4M | |
![[ ]](/icons/layout.gif) | Hindu Rites and Rituals Origins and Meanings by K.V. Singh.pdf | 2023-06-08 10:11 | 5.5M | |
![[ ]](/icons/layout.gif) | Numerical_Methods_for_Solving_Partial_Differential_Equations_A_Comprehensive.pdf | 2023-07-04 06:11 | 5.5M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_6_virata_parvam.pdf | 2023-06-08 09:08 | 5.5M | |
![[ ]](/icons/layout.gif) | Ancient_India_archaeology_unlocks_the_secrets_of_Indias_past.pdf | 2023-06-08 06:33 | 5.6M | |
![[ ]](/icons/layout.gif) | Historic Role Of Islam -MN Roy.pdf | 2023-06-08 07:16 | 5.6M | |
![[ ]](/icons/layout.gif) | Gods Demons & Spirits -AT Kovoor.pdf | 2023-06-08 07:25 | 5.6M | |
![[ ]](/icons/layout.gif) | విష్ణుపురాణం.pdf | 2023-06-08 10:08 | 5.8M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 09.pdf | 2023-07-04 04:16 | 5.8M | |
![[ ]](/icons/layout.gif) | Original Valmiki Ramayana.pdf | 2023-06-08 09:52 | 5.9M | |
![[ ]](/icons/layout.gif) | The Surgical Instruments of the Hindus vol 2.pdf | 2023-06-08 09:29 | 5.9M | |
![[ ]](/icons/layout.gif) | Socrates, Buddha, Confucius, Jesus_Book by Karl Jaspers.pdf | 2023-06-08 06:32 | 5.9M | |
![[ ]](/icons/layout.gif) | Gods,_Sages_and_Kings_Vedic_Secrets.pdf | 2023-06-08 09:58 | 5.9M | |
![[ ]](/icons/layout.gif) | Civilization of india 1900.pdf | 2023-06-08 09:22 | 5.9M | |
![[ ]](/icons/layout.gif) | Pathanjali Yoga Sadhana Kundalinee Shakthi.pdf | 2023-06-08 10:07 | 5.9M | |
![[ ]](/icons/layout.gif) | _Sudras_in_Ancient_India__A_Social_History_of_the_Lower_Order_Down.pdf | 2023-06-08 06:35 | 6.0M | |
![[ ]](/icons/layout.gif) | Dr_Bababsaheb_Ambedkar_Writings_and_Speeches_Vol_14_part_02.pdf | 2023-07-04 04:16 | 6.0M | |
![[ ]](/icons/layout.gif) | Inscriptions Of Asoka.pdf | 2023-06-08 07:29 | 6.0M | |
![[ ]](/icons/layout.gif) | Garuda-Puranam-simple-telugu.pdf | 2023-06-08 09:21 | 6.0M | |
![[ ]](/icons/layout.gif) | Bharagava puranam tel.pdf | 2023-06-08 09:15 | 6.0M | |
![[ ]](/icons/layout.gif) | Propaganda -Edward Bernays.pdf | 2023-06-08 07:22 | 6.1M | |
![[ ]](/icons/layout.gif) | Yoga_of_Herbs_An_Ayurvedic_Guide_to_Herbal_Medicine_David_Frawley.pdf | 2023-06-08 09:16 | 6.2M | |
![[ ]](/icons/layout.gif) | Hindutva by Vinayak Damodar Savarkar.pdf | 2023-06-08 07:24 | 6.3M | |
![[ ]](/icons/layout.gif) | Agni Purana. Vol. 1.pdf | 2023-06-08 10:09 | 6.3M | |
![[ ]](/icons/layout.gif) | Muhammad -Karen Armstrong.pdf | 2023-06-08 07:23 | 6.3M | |
![[ ]](/icons/layout.gif) | Hinduism, Hindutva & Secularism.pdf | 2023-06-08 06:34 | 6.3M | |
![[ ]](/icons/layout.gif) | E05336_Modern_Culinary_Receipts.pdf | 2023-06-08 09:09 | 6.4M | |
![[ ]](/icons/layout.gif) | Shri-Vishnudharmottara.pdf | 2023-06-08 09:21 | 6.4M | |
![[ ]](/icons/layout.gif) | maha_bharatham_vol_9_drona_parva.pdf | 2023-06-08 09:08 | 6.4M | |
![[ ]](/icons/layout.gif) | Goa Inquisition Anant Kakba Priolkar.pdf | 2023-06-08 09:57 | 6.5M | |
![[ ]](/icons/layout.gif) | A_Peep_into_the_Early_History_of_India_From_the_foundation_of_the.pdf | 2023-06-08 07:33 | 6.5M | |
![[ ]](/icons/layout.gif) | The Healing Sun Code.pdf | 2023-06-08 07:32 | 6.5M | |
![[ ]](/icons/layout.gif) | Kakatiya_Rudreshwara_Temple.pdf | 2023-06-08 07:19 | 6.6M | |
![[ ]](/icons/layout.gif) | Kakatiya Temples.pdf | 2023-06-08 09:28 | 6.6M | |
![[ ]](/icons/layout.gif) | Select Kakatiya Temples_By Dr. M. Rama Rao.pdf | 2023-06-08 07:31 | 6.6M | |
![[ ]](/icons/layout.gif) | The Mission Of Philosophy M.Hiriyanna.pdf | 2023-07-10 11:01 | 6.6M | |
![[ ]](/icons/layout.gif) | యజుర్వేదం (1).pdf | 2023-06-08 10:12 | 6.6M | |
![[ ]](/icons/layout.gif) | Lallā_to_Nūruddīn_Rishī_Sufi_poetry_of_Kashmir_a_translati.pdf | 2023-06-08 06:31 | 6.6M | |
![[ ]](/icons/layout.gif) | Aryabhataya.pdf | 2023-06-08 09:31 | 6.6M | |
![[ ]](/icons/layout.gif) | Padma-Purana Vol-04 - Bhumi and Svarga Khanda - pages 1241-1.pdf | 2023-06-08 10:00 | 6.7M | |
![[ ]](/icons/layout.gif) | Charaka Samhita Sutrasthana.pdf | 2023-06-08 09:52 | 6.8M | |
![[ ]](/icons/layout.gif) | KING_GOVERNANCE_AND_LAW_IN_ANCIENT_INDIA_Kauṭilya's_Arthashastr.pdf | 2023-06-08 09:21 | 6.9M | |
![[ ]](/icons/layout.gif) | Top Secret Alien Abduction Files.pdf | 2023-06-08 07:32 | 7.0M | |
![[ ]](/icons/layout.gif) | Cloak of the Illuminati.pdf | 2023-06-08 07:32 | 7.0M | |
![[ ]](/icons/layout.gif) | సంస్కృత వ్యాకరణము.pdf | 2023-06-08 09:23 | 7.0M | |
![[ ]](/icons/layout.gif) | Temple India.pdf | 2023-06-09 06:55 | 7.1M | |
![[ ]](/icons/layout.gif) | Kashyapasamhita.pdf | 2023-06-08 09:32 | 7.2M | |
![[ ]](/icons/layout.gif) | Kumara Sambhava -Kalidasa.pdf | 2023-06-08 07:22 | 7.2M | |
![[ ]](/icons/layout.gif) | How to be a good atheist .pdf | 2023-06-08 06:32 | 7.2M | |
![[ ]](/icons/layout.gif) | Svelte Succinctly.pdf | 2023-06-09 06:57 | 7.2M | |
![[ ]](/icons/layout.gif) | Hello Bastar The Untold Story of India’s Maoist Movement.pdf | 2023-06-08 06:36 | 7.3M | |
![[ ]](/icons/layout.gif) | The Chamcha Age- Kanshi Ram.pdf | 2023-06-08 07:22 | 7.3M | |
![[ ]](/icons/layout.gif) | Studies in Ancient Hindu Polity By Narendranath Nath Law.pdf | 2023-06-08 07:29 | 7.3M | |
![[ ]](/icons/layout.gif) | A_Forgotten_Empire_Vijayanagar_A_contribution_to_the_history_of.pdf | 2023-07-04 04:24 | 7.4M | |
![[ ]](/icons/layout.gif) | A_Forgotten_Empire_Vijayanagar__A_contribution_to_the_history_of.pdf | 2023-06-08 07:29 | 7.4M | |
![[ ]](/icons/layout.gif) | Curfewed_Night__A_Frontline_Memoir_of_Life,_Love_and_War_in_Kashmir.pdf | 2023-06-08 06:36 | 7.5M | |
![[ ]](/icons/layout.gif) | Modern_Physics_and_Vedanta_Swami_Jitatamnanda_Bharatiya_Vidya_Bhavan.pdf | 2023-06-08 06:39 | 7.5M | |
![[ ]](/icons/layout.gif) | Inside-Vedas.pdf | 2023-06-08 09:58 | 7.6M | |
![[ ]](/icons/layout.gif) | Vyasasidhanta Marthandamu.pdf | 2023-06-08 09:45 | 7.6M | |
![[ ]](/icons/layout.gif) | మనుధర్మ శాస్త్రం.pdf | 2023-06-08 10:12 | 7.6M | |
![[ ]](/icons/layout.gif) | Nyaya philosophy.pdf | 2023-06-08 09:43 | 7.6M | |
![[ ]](/icons/layout.gif) | Andy_Pandharikar_Frederik_Bussler_AI_Powered_Commerce_Building_the.pdf | 2023-07-04 06:44 | 7.6M | |
![[ ]](/icons/layout.gif) | Playing_It_My_Way_My_Autobiogr_of_Sachin_Tendulkar.pdf | 2023-07-10 11:02 | 7.7M | |
![[ ]](/icons/layout.gif) | DOC-20230702-WA0039..pdf | 2023-07-05 10:55 | 7.7M | |
![[ ]](/icons/layout.gif) | The New Meditation Handbook.pdf | 2023-06-08 06:35 | 7.7M | |
![[ ]](/icons/layout.gif) | The_Trial_of_Bhagat_Singh.pdf | 2023-06-08 07:20 | 7.7M | |
![[ ]](/icons/layout.gif) | Kalidasa's -Sakuntala.pdf | 2023-06-08 07:29 | 7.7M | |
![[ ]](/icons/layout.gif) | Agni Purana. Vol. 2.pdf | 2023-06-08 10:09 | 7.8M | |
![[ ]](/icons/layout.gif) | Kunapajala.pdf | 2023-06-08 09:30 | 7.8M | |
![[ ]](/icons/layout.gif) | The Setu and Rameswaram By Vanamalai Pillai.pdf | 2023-06-08 07:24 | 7.9M | |
![[ ]](/icons/layout.gif) | The Bījak of Kabir.pdf | 2023-06-08 06:31 | 7.9M | |
![[ ]](/icons/layout.gif) | Tales_of_sex_and_violence_folklore,_sacrifice,_and_danger_in_th.pdf | 2023-06-08 06:40 | 8.0M | |
![[ ]](/icons/layout.gif) | Folk_Lore_of_North_India_Vol_2.pdf | 2023-06-08 07:43 | 8.1M | |
![[ ]](/icons/layout.gif) | Rani Ki Vav -Patan.pdf | 2023-06-08 07:15 | 8.1M | |
![[ ]](/icons/layout.gif) | Aryabhatta-Indian-work-on-mathematics-astronomy (2).pdf | 2023-06-08 09:31 | 8.1M | |
![[ ]](/icons/layout.gif) | Siddhanta siromani 2.pdf | 2023-06-08 09:31 | 8.2M | |
![[ ]](/icons/layout.gif) | సుభాష్ చంద్రబోస్.pdf | 2023-06-08 09:50 | 8.2M | |
![[ ]](/icons/layout.gif) | USMLE_Step_2_CS_Core_Cases_Brottman_3_ed_2014.pdf | 2023-07-10 07:26 | 8.2M | |
![[ ]](/icons/layout.gif) | Yoga Vasishta of Valmiki - Valmiki.pdf | 2023-06-08 09:49 | 8.2M | |
![[ ]](/icons/layout.gif) | Life & Letters Of St Francis Xavier V1.pdf | 2023-06-08 07:22 | 8.3M | |
![[ ]](/icons/layout.gif) | The Kama Sutra of Vatsyayana.pdf | 2023-06-08 07:24 | 8.3M | |
![[ ]](/icons/layout.gif) | The_Kama_Sutra_of_Vatsyayana.pdf | 2023-06-08 09:20 | 8.3M | |
![[ ]](/icons/layout.gif) | Understanding-Muhammad (English) Sixth edition by Ali Sina.pdf | 2023-06-08 07:58 | 8.4M | |
![[ ]](/icons/layout.gif) | Priests and Politicians the Mafia of the Soul.pdf | 2023-06-08 06:35 | 8.4M | |
![[ ]](/icons/layout.gif) | History of kerala in hindu astronomy.pdf | 2023-06-08 09:16 | 8.6M | |
![[ ]](/icons/layout.gif) | Ambedkarism.pdf | 2023-06-08 06:33 | 8.6M | |
![[ ]](/icons/layout.gif) | Vedayagabhumi.pdf | 2023-06-08 09:26 | 8.7M | |
![[ ]](/icons/layout.gif) | The Mind & It's Control.pdf | 2023-06-08 06:34 | 8.7M | |
![[ ]](/icons/layout.gif) | History of Aurangzib 02-Sir Jadunath Sarkar.pdf | 2023-06-08 07:32 | 8.7M | |
![[ ]](/icons/layout.gif) | Glimpses of Health and Medicine in Mauryan Empire.pdf | 2023-06-08 07:28 | 8.7M | |
![[ ]](/icons/layout.gif) | The Myth Of Holy Cow -DN Jha.pdf | 2023-06-08 07:22 | 8.8M | |
![[ ]](/icons/layout.gif) | What now, Adam the book of men.pdf | 2023-06-08 06:33 | 8.8M | |
![[ ]](/icons/layout.gif) | The History of Rashtrakutas ( Rathodes).pdf | 2023-06-08 09:28 | 8.8M | |
![[ ]](/icons/layout.gif) | The-Kashmiri-Ramayana.pdf | 2023-06-08 10:08 | 8.8M | |
![[ ]](/icons/layout.gif) | Rajatarangini_JogeshChunderDuttVol1.pdf | 2023-06-08 07:22 | 8.8M | |
![[ ]](/icons/layout.gif) | A Gift From The Stars.pdf | 2023-06-08 07:33 | 8.9M | |
![[ ]](/icons/layout.gif) | Encyclopedia of tantra.pdf | 2023-06-08 06:34 | 8.9M | |
![[ ]](/icons/layout.gif) | a_sanskrit_manual_for_high_schools_part_1_for_classes_vi_viii_r.pdf | 2023-06-08 09:24 | 9.0M | |
![[ ]](/icons/layout.gif) | Vasavadatta, a Sanskrit romance -Subandhu.pdf | 2023-06-08 07:31 | 9.0M | |
![[ ]](/icons/layout.gif) | A Text Book of Sharira-Kriya Vijnan Part II - Ranade (2009).pdf | 2023-06-08 09:30 | 9.1M | |
![[ ]](/icons/layout.gif) | A Text Book of Sharira-Kriya Vijnan Part I - Ranade (2009).pdf | 2023-06-08 09:30 | 9.1M | |
![[ ]](/icons/layout.gif) | Pramanavarttika -Dharmakirti.pdf | 2023-06-08 07:20 | 9.1M | |
![[ ]](/icons/layout.gif) | Rigveda (2).pdf | 2023-06-08 09:53 | 9.1M | |
![[ ]](/icons/layout.gif) | The-Tantric-Way-Art-Science-Ritual.pdf | 2023-06-08 10:10 | 9.1M | |
![[ ]](/icons/layout.gif) | Vedic Mathematics- Adi shankaracharya.pdf | 2023-06-08 09:31 | 9.2M | |
![[ ]](/icons/layout.gif) | The Sacred Cow -AL Basham.pdf | 2023-06-08 06:40 | 9.2M | |
![[ ]](/icons/layout.gif) | Ambedkar and Buddhism by Sangharakshita.pdf | 2023-06-08 06:31 | 9.3M | |
![[ ]](/icons/layout.gif) | Padma_Purana_Part_2_Srishti_Khanda_Motilal_Banarsidass_1989.pdf | 2023-06-08 10:00 | 9.3M | |
![[ ]](/icons/layout.gif) | ENG - Indian Contributions to Science.pdf | 2023-06-08 09:53 | 9.3M | |
![[ ]](/icons/layout.gif) | సంపూర్ణ రామాయణం.pdf | 2023-06-08 10:12 | 9.3M | |
![[ ]](/icons/layout.gif) | Early_History_of_the_Dekkan_down_to_the_Mahomedan_conquest_By_Ramakrishna.pdf | 2023-06-08 07:29 | 9.3M | |
![[ ]](/icons/layout.gif) | Popular Essays In Indian Philosophy.pdf | 2023-07-10 11:02 | 9.4M | |
![[ ]](/icons/layout.gif) | Nalanda -ASI.pdf | 2023-06-08 06:40 | 9.4M | |
![[ ]](/icons/layout.gif) | Modhera – Kirit Mankodi.pdf | 2023-06-08 08:04 | 9.4M | |
![[ ]](/icons/layout.gif) | Dalit liberation theology Ambedkarian perspective .pdf | 2023-06-08 06:34 | 9.6M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 08.pdf | 2023-07-04 04:16 | 9.7M | |
![[ ]](/icons/layout.gif) | Vidura_Niti_Sanskrit_Text_With_English_Translation_K_M_Ganguli.pdf | 2023-06-08 09:15 | 9.8M | |
![[ ]](/icons/layout.gif) | Kalki-Purana-english.pdf | 2023-06-08 09:21 | 10M | |
![[ ]](/icons/layout.gif) | David_Frawley_Wisdom_of_the_Ancient_Seers_Mantras_of_the_Rig_Vedas.pdf | 2023-06-08 09:09 | 10M | |
![[ ]](/icons/layout.gif) | Rajatarangini_JogeshChunderDuttVol2.pdf | 2023-06-08 07:22 | 10M | |
![[ ]](/icons/layout.gif) | The_little_book_of_Hindu_deities_from_the_Goddess_of_Wealth_to_.pdf | 2023-06-08 06:33 | 10M | |
![[ ]](/icons/layout.gif) | LalitaSahasaranama by bhaskaracharya.pdf | 2023-06-08 09:24 | 10M | |
![[ ]](/icons/layout.gif) | Can_Humanity_Change_J_Krishnamurti_in_Dialogue_with_Buddhists_Book.pdf | 2023-06-08 06:32 | 10M | |
![[ ]](/icons/layout.gif) | Kadapa Jilla Sasanaalu Samskruti Charitra.pdf | 2023-06-08 09:38 | 10M | |
![[ ]](/icons/layout.gif) | Vedanta for all.pdf | 2023-06-08 06:33 | 10M | |
![[ ]](/icons/layout.gif) | MAGADHA architecture and culture.pdf | 2023-06-08 09:16 | 10M | |
![[ ]](/icons/layout.gif) | Sanchi -ASI.pdf | 2023-06-08 06:34 | 10M | |
![[ ]](/icons/layout.gif) | Matsya puranam.pdf | 2023-06-08 09:21 | 10M | |
![[ ]](/icons/layout.gif) | Prostitution In India by Santosh Kumar Mukherji.pdf | 2023-06-08 06:38 | 10M | |
![[ ]](/icons/layout.gif) | Spanda karikas the divine creative pulsation.pdf | 2023-06-08 09:27 | 11M | |
![[ ]](/icons/layout.gif) | The Indian Calendar -Rober Sewell.pdf | 2023-06-08 07:26 | 11M | |
![[ ]](/icons/layout.gif) | The Surgical Instruments of the Hindus vol 1.pdf | 2023-06-08 09:29 | 11M | |
![[ ]](/icons/layout.gif) | Megasthenes_and_Arrian_A_translation_of_the_fragments_of_the_INDIKA.pdf | 2023-06-08 07:31 | 11M | |
![[ ]](/icons/layout.gif) | Same_sex_desire_in_Indian_culture_representations_in_literature.pdf | 2023-06-08 06:33 | 11M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 15.pdf | 2023-07-04 04:16 | 11M | |
![[ ]](/icons/layout.gif) | Veerappan The Untold Story.pdf | 2023-06-08 06:39 | 11M | |
![[ ]](/icons/layout.gif) | sayanas-commentary.pdf | 2023-06-08 09:31 | 11M | |
![[ ]](/icons/layout.gif) | The Rajneesh papers studies in a new religious movement.pdf | 2023-06-08 06:31 | 11M | |
![[ ]](/icons/layout.gif) | Agni Purana. Vol. 4.pdf | 2023-06-08 10:09 | 11M | |
![[ ]](/icons/layout.gif) | Indian architecture Manasara Silpasastra vol 2.pdf | 2023-06-08 09:17 | 11M | |
![[ ]](/icons/layout.gif) | Brihat Parasara Hora sastra part 1.pdf | 2023-06-08 08:04 | 11M | |
![[ ]](/icons/layout.gif) | Padma_Purana_Part_1_Srishti_Khanda_Motilal_Banarsidass_1988.pdf | 2023-06-08 10:00 | 11M | |
![[ ]](/icons/layout.gif) | Dr. Bababsaheb Ambedkar Writings and Speeches Vol. 13.pdf | 2023-07-04 04:16 | 11M | |
![[ ]](/icons/layout.gif) | The_social_message_of_the_Gita_symbolized_as_lokasaṁgraha_sel.pdf | 2023-06-08 06:33 | 11M | |
![[ ]](/icons/layout.gif) | Science_and_Society_in_Ancient_India_Debiprasad_Chattopadhyaya.pdf | 2023-06-08 07:20 | 11M | |
![[ ]](/icons/layout.gif) | Nagarjunakonda -Buddhist Site.pdf | 2023-06-08 07:16 | 11M | |
![[ ]](/icons/layout.gif) | Tantra of Sri Chakra - S.K.Ramachandra Rao.pdf | 2023-06-08 09:27 | 11M | |
![[ ]](/icons/layout.gif) | Ratnavali -Sri Harsha.pdf | 2023-06-08 07:26 | 11M | |
![[ ]](/icons/layout.gif) | The Emperor Uncrowned -The rise of Narendra Modi.pdf | 2023-06-08 06:32 | 11M | |
![[ ]](/icons/layout.gif) | Yogasūtra of Patañjali with the commentary of Vyāsa.pdf | 2023-06-08 06:31 | 11M | |
![[ ]](/icons/layout.gif) | 1977_Operation_Rescue_military_operations_in_Jammu_Kashmir_1947.pdf | 2023-06-08 06:35 | 11M | |
![[ ]](/icons/layout.gif) | Hampi -ASI.pdf | 2023-06-08 06:37 | 11M | |
![[ ]](/icons/layout.gif) | D-S-Sarma-A-Primer-of-Hinduism (1).pdf | 2023-06-12 05:57 | 11M | |
![[ ]](/icons/layout.gif) | Natures-Mysteries.pdf | 2023-06-08 09:55 | 11M | |
![[ ]](/icons/layout.gif) | Delhi, Agra & Fatehpur Sikri -Martin Hurlimann.pdf | 2023-06-08 07:31 | 11M | |
![[ ]](/icons/layout.gif) | Che Guevara_ Revolutionary & Icon.pdf | 2023-06-08 06:35 | 11M | |
![[ ]](/icons/layout.gif) | The Value Of Values Swami Dayananda.pdf | 2023-07-10 11:01 | 11M | |
![[ ]](/icons/layout.gif) | Brihat Parasara Hora Sastra part 2.pdf | 2023-06-08 08:04 | 11M | |
![[ ]](/icons/layout.gif) | arsha_vignana_sarvasvamu_trutiya_samputam_aranya_kandam.pdf | 2023-06-08 09:43 | 11M | |
![[ ]](/icons/layout.gif) | hathayoga00rama.pdf | 2023-06-08 10:00 | 12M | |
![[ ]](/icons/layout.gif) | Shiva stories and teachings from the Shiva Mahapurana.pdf | 2023-06-08 06:33 | 12M | |
![[ ]](/icons/layout.gif) | Vriksha Ayurveda of Surapala Nalini Sadhale 1996.pdf | 2023-06-08 09:25 | 12M | |
![[ ]](/icons/layout.gif) | Hindu astronomy.pdf | 2023-06-08 09:28 | 12M | |
![[ ]](/icons/layout.gif) | Historical view ofhindu astronomy.pdf | 2023-06-08 09:31 | 12M | |
![[ ]](/icons/layout.gif) | Geometry_in_Ancient_and_Medival_India_T.A.Sarasvati_Amma_.pdf | 2023-06-08 07:19 | 12M | |
![[ ]](/icons/layout.gif) | Brahmanda Purana - G.V.Tagare - Part 5.pdf | 2023-06-08 10:08 | 12M | |
![[ ]](/icons/layout.gif) | సాలగ్రామ శాస్త్రం.pdf | 2023-06-08 09:21 | 12M | |
![[ ]](/icons/layout.gif) | sundarakanda.pdf | 2023-06-08 09:26 | 12M | |
![[ ]](/icons/layout.gif) | British_Chess_Magazine_-_June_2023.pdf | 2023-06-15 09:29 | 12M | |
![[ ]](/icons/layout.gif) | Main Events Of Indian History By RN Sharma.pdf | 2023-06-06 03:54 | 12M | |
![[ ]](/icons/layout.gif) | Theft Of An Idol by Paul R Brass.pdf | 2023-06-08 06:39 | 12M | |
![[ ]](/icons/layout.gif) | 3.SiddhantakaumudiVol2Part1-KarakaSamasa-SRay1920.pdf | 2023-06-08 09:54 | 12M | |
![[ ]](/icons/layout.gif) | historyofeducati01grav.pdf | 2023-06-08 09:27 | 12M | |
![[ ]](/icons/layout.gif) | A Sanskrit Dictionary.pdf | 2023-06-08 09:35 | 12M | |
![[ ]](/icons/layout.gif) | Who Were the Sudhras BR Ambedkar.pdf | 2023-06-08 07:30 | 12M | |
![[ ]](/icons/layout.gif) | roots.pdf | 2023-06-08 09:58 | 12M | |
![[ ]](/icons/layout.gif) | మయ వాస్తు (2).pdf | 2023-06-08 10:12 | 12M | |
![[ ]](/icons/layout.gif) | The Hymns of the Rigved -Ralph TH Griffith.pdf | 2023-06-08 07:25 | 12M | |
![[ ]](/icons/layout.gif) | మాండూక్యోపనిషత్తు.pdf | 2023-06-08 09:34 | 12M | |
![[ ]](/icons/layout.gif) | The Kalinga Heritage.pdf | 2023-06-08 06:39 | 12M | |
![[ ]](/icons/layout.gif) | The Early History of India -Vincent Smith.pdf | 2023-06-08 07:24 | 12M | |
![[ ]](/icons/layout.gif) | Marxism On Vedanta.pdf | 2023-06-08 06:34 | 12M | |
![[ ]](/icons/layout.gif) | The_Dvaita_Philosophy_and_its_Place_in_Vedanta_H_N_Raghavendrachar.pdf | 2023-06-08 09:33 | 13M | |
![[ ]](/icons/layout.gif) | సామవేదసంహిత_దాశరథి_రంగాచార్య.pdf | 2023-06-08 09:22 | 13M | |
![[ ]](/icons/layout.gif) | Fifty Shades of Gray Aliens.pdf | 2023-06-08 07:40 | 13M | |
![[ ]](/icons/layout.gif) | Life & Letters Of St Francis Xavier V2.pdf | 2023-06-08 07:22 | 13M | |
![[ ]](/icons/layout.gif) | Nityasumaṅgalī devadasi tradition in South India.pdf | 2023-06-08 06:32 | 13M | |
![[ ]](/icons/layout.gif) | Khandakhadyaka,_an_Astronomical_Treatise,_Prabodha_Chandra_Sengupta.pdf | 2023-06-08 09:43 | 13M | |
![[ ]](/icons/layout.gif) | Kamandakya - Nitisara - M.M.Dutta-1896.pdf | 2023-06-08 09:15 | 13M | |
![[ ]](/icons/layout.gif) | Thirty_five_years_in_the_East_Adventures,_discoveries,_experiments.pdf | 2023-06-08 09:09 | 13M | |
![[ ]](/icons/layout.gif) | Consciousness_in_Advaita_Vedanta_William_M_Indich.pdf | 2023-06-08 06:35 | 13M | |
![[ ]](/icons/layout.gif) | HAYAGRTVA THE HORSE—HEADED DEITY IN INDIAN CULTURE.pdf | 2023-06-08 09:36 | 13M | |
![[ ]](/icons/layout.gif) | Dark Fleet - Len Kasten.pdf | 2023-06-08 07:33 | 13M | |
![[ ]](/icons/layout.gif) | Beyond_illusion_&_doubt_a_Vedic_view_of_western_philosophy.pdf | 2023-06-08 06:33 | 13M | |
![[ ]](/icons/layout.gif) | Viśvakarmā_;_examples_of_Indian_architecture,_sculpture,_painting.pdf | 2023-06-08 09:17 | 13M | |
![[ ]](/icons/layout.gif) | Shivaji_His_Life_and_Times_by_Gajanan_Bhaskar_Mehendale_z_lib_org.pdf | 2023-06-08 07:58 | 13M | |
![[ ]](/icons/layout.gif) | Sarva Darsana Samgraha -Madhava Acharya.pdf | 2023-06-08 07:24 | 13M | |
![[ ]](/icons/layout.gif) | Chand_Shastra.pdf | 2023-06-08 09:31 | 13M | |
![[ ]](/icons/layout.gif) | Bharya-Bharta-Santhoshamga-Vundadam-Yela.pdf | 2023-07-07 06:37 | 13M | |
![[ ]](/icons/layout.gif) | Under_the_Raj_Prostitution_in_Colonial_Bengal_by_Sumanta_Banerjee.pdf | 2023-06-08 06:34 | 13M | |
![[ ]](/icons/layout.gif) | Vanaspati.pdf | 2023-06-08 09:30 | 13M | |
![[ ]](/icons/layout.gif) | pdfcookie.com_electrical-machines-i-by-uabakshivubakshi.pdf | 2023-07-04 06:21 | 13M | |
![[ ]](/icons/layout.gif) | Dravidian Gods in MODERN HINDUISM.pdf | 2023-06-08 07:15 | 13M | |
![[ ]](/icons/layout.gif) | Swami_Satyananda_Saraswati_A_Systematic.pdf | 2023-06-08 09:55 | 13M | |
![[ ]](/icons/layout.gif) | ASOKA_By Radhakumud Mookerji.pdf | 2023-06-08 07:29 | 13M | |
![[ ]](/icons/layout.gif) | The Himàlaya -A Cultural Pilgrimage by Balkrishna Kalelkar.pdf | 2023-06-08 06:34 | 14M | |
![[ ]](/icons/layout.gif) | Indian Costumes -Biswas A.pdf | 2023-06-08 07:15 | 14M | |
![[ ]](/icons/layout.gif) | Rama The Hero Of India - Dhan Gopal Mukerji.pdf | 2023-06-08 07:25 | 14M | |
![[ ]](/icons/layout.gif) | David_Frawley_Ayurvedic_Astrology_Self_healing_Through_the_Stars.pdf | 2023-06-08 07:23 | 14M | |
![[ ]](/icons/layout.gif) | Narada-Purana-ENG-05.pdf | 2023-06-08 10:09 | 14M | |
![[ ]](/icons/layout.gif) | Sivaji A Historical Tale of Maratha Empire.pdf | 2023-06-08 09:28 | 14M | |
![[ ]](/icons/layout.gif) | Molecular_diffraction_of_light_By_Chandrashekara_Venkata_Raman.pdf | 2023-06-08 07:29 | 14M | |
![[ ]](/icons/layout.gif) | Yantra Mantra Tantra and Occult Science's.pdf | 2023-06-08 06:40 | 14M | |
![[ ]](/icons/layout.gif) | Indian Idealism - Surendranath Dasgupta.pdf | 2023-06-08 06:42 | 14M | |
![[ ]](/icons/layout.gif) | Priyadaranjian_Ray_History_of_Chemistry_in_Ancient_&_Medieval_India.pdf | 2023-06-08 09:53 | 14M | |
![[ ]](/icons/layout.gif) | Ancient india book.pdf | 2023-06-08 09:35 | 14M | |
![[ ]](/icons/layout.gif) | Illuminati_ The Cult that Hijacked the World.pdf | 2023-06-08 06:32 | 14M | |
![[ ]](/icons/layout.gif) | abhinavam-prasutitantram.pdf | 2023-06-08 09:29 | 14M | |
![[ ]](/icons/layout.gif) | Râma and Homer - Arthur Lillie.pdf | 2023-06-08 07:32 | 14M | |
![[ ]](/icons/layout.gif) | Omens and Superstitions of Southern India -Edgar Thurston.pdf | 2023-06-08 07:32 | 14M | |
![[ ]](/icons/layout.gif) | The_Ancient_and_Medieval_Architecture_of_India_A_Study_of_Indo_Aryan.pdf | 2023-06-08 07:32 | 14M | |
![[ ]](/icons/layout.gif) | The ancient and medieval architecture of India.pdf | 2023-06-08 09:17 | 14M | |
![[ ]](/icons/layout.gif) | CONTRIBUTIONS_OF_LALA_HAR_DAYAL_AS_AN_INTELLECTUAL_AND_REVOLUTIONARY.pdf | 2023-06-08 09:32 | 14M | |
![[ ]](/icons/layout.gif) | Education_and_Traditional_Values_by_Swami_Ranganathananda.pdf | 2023-07-10 11:02 | 14M | |
![[ ]](/icons/layout.gif) | Life in the ancient Indus River Valley.pdf | 2023-06-08 06:34 | 14M | |
![[ ]](/icons/layout.gif) | chanakya-neeti-telugu.pdf | 2023-06-08 09:21 | 14M | |
![[ ]](/icons/layout.gif) | The Wonder That Was India -AL Basham.pdf | 2023-06-08 07:14 | 14M | |
![[ ]](/icons/layout.gif) | Mahabharata By C.Rajagopalachari.pdf | 2023-06-08 07:28 | 14M | |
![[ ]](/icons/layout.gif) | Histroy_of_Hindu_Imperialism.pdf | 2023-06-08 07:21 | 14M | |
![[ ]](/icons/layout.gif) | Andhra Yogulu -3.pdf | 2023-06-08 09:17 | 14M | |
![[ ]](/icons/layout.gif) | Vivekachudamani of Sri Sankaracharya By Swami Madhavananda.pdf | 2023-06-08 07:26 | 14M | |
![[ ]](/icons/layout.gif) | matsya-puranam-2.pdf | 2023-06-08 09:47 | 14M | |
![[ ]](/icons/layout.gif) | Brahmanda Purana - G.V.Tagare - Part 3.pdf | 2023-06-08 10:08 | 14M | |
![[ ]](/icons/layout.gif) | Builders of Modern India -KB Hedgewar.pdf | 2023-06-08 07:22 | 14M | |
![[ ]](/icons/layout.gif) | Education in ancient india.pdf | 2023-06-08 10:12 | 14M | |
![[ ]](/icons/layout.gif) | Nagarjuniana_studies_in_the_writings_and_philosophy_of_Nāgārj.pdf | 2023-06-08 06:31 | 14M | |
![[ ]](/icons/layout.gif) | History of Aurangzib 01-Sir Jadunath Sarkar.pdf | 2023-07-04 04:14 | 14M | |
![[ ]](/icons/layout.gif) | Ayurvedic Nature Remedies David Frawley Subhash Ranade MLBD.pdf | 2023-06-08 09:30 | 14M | |
![[ ]](/icons/layout.gif) | History and Doctrines of the Ajivikas -AL Basham.pdf | 2023-06-08 07:25 | 14M | |
![[ ]](/icons/layout.gif) | Aghora_II.pdf | 2023-06-08 06:41 | 14M | |
![[ ]](/icons/layout.gif) | Mohenjora and indus valley civilization.pdf | 2023-06-08 09:27 | 14M | |
![[ ]](/icons/layout.gif) | The Hymns of the Rigveda-by Ralph Thomas Hotchkin Griffith.pdf | 2023-06-08 07:25 | 15M | |
![[ ]](/icons/layout.gif) | The Religions of the Ancient World -George Rawlinson.pdf | 2023-06-08 07:24 | 15M | |
![[ ]](/icons/layout.gif) | Din I Ilahi -Akbar.pdf | 2023-06-08 06:38 | 15M | |
![[ ]](/icons/layout.gif) | 196174216674_10152693130586675.pdf | 2023-06-08 09:26 | 15M | |
![[ ]](/icons/layout.gif) | Sanatan dharma advance.pdf | 2023-06-08 07:54 | 15M | |
![[ ]](/icons/layout.gif) | Ashtavakra-Samhita.pdf | 2023-06-08 09:33 | 15M | |
![[ ]](/icons/layout.gif) | kancheepuram_and_its_temples.pdf | 2023-06-08 09:38 | 15M | |
![[ ]](/icons/layout.gif) | natya_shastra_translation_volume_2_-_bharat_muni.pdf | 2023-06-08 09:42 | 15M | |
![[ ]](/icons/layout.gif) | Veerabrahmendra-the-Precursor-of-Kalki (1).pdf | 2023-06-08 09:54 | 15M | |
![[ ]](/icons/layout.gif) | ayurveda.pdf | 2023-06-08 09:30 | 15M | |
![[ ]](/icons/layout.gif) | South_India_and_Her_Muhammadan_Invaders_By_Sakkottai_Krishnaswami.pdf | 2023-06-08 08:04 | 15M | |
![[ ]](/icons/layout.gif) | Bharadwaja Samhita [Tel].pdf | 2023-06-08 09:15 | 15M | |
![[ ]](/icons/layout.gif) | The Heart of Jainism_By Mrs. Sinclair Stevenson.pdf | 2023-06-08 07:29 | 15M | |
![[ ]](/icons/layout.gif) | practicals-of-mantras-and-tantras_compress.pdf | 2023-06-08 09:24 | 15M | |
![[ ]](/icons/layout.gif) | GREAT TEMPLES OF INDIA, BURMA, CEYLON.pdf | 2023-06-08 08:11 | 15M | |
![[ ]](/icons/layout.gif) | The_life_of_the_Buddha,_and_the_early_history_of_his_Order_Derived.pdf | 2023-06-08 07:31 | 15M | |
![[ ]](/icons/layout.gif) | Some_Missing_Chapter_of_World_History.pdf | 2023-06-08 09:20 | 16M | |
![[ ]](/icons/layout.gif) | Baburnamah - Memoirs of Babur.pdf | 2023-06-08 07:22 | 16M | |
![[ ]](/icons/layout.gif) | Classical_Sāṃkhya_an_interpretation_of_its_history_and_meanin.pdf | 2023-06-08 06:31 | 16M | |
![[ ]](/icons/layout.gif) | Hypnotism_and_Mysticism_of_India_by_Ormond_McGill_1979.pdf | 2023-06-08 07:15 | 16M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. III (2).pdf | 2023-06-08 09:57 | 16M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. III.pdf | 2023-06-08 09:20 | 16M | |
![[ ]](/icons/layout.gif) | Charaka-Samhita-kalpana.pdf | 2023-06-08 10:10 | 16M | |
![[ ]](/icons/layout.gif) | Rajatarangini_JogeshChunderDuttVol3.pdf | 2023-06-08 07:22 | 16M | |
![[ ]](/icons/layout.gif) | vikramnkadevacharita.pdf | 2023-06-08 09:32 | 16M | |
![[ ]](/icons/layout.gif) | A_Study_of_the_Siva_Sutras_Finding_The_Hidden_Self_Roger_Worthington.pdf | 2023-06-08 07:15 | 16M | |
![[ ]](/icons/layout.gif) | Yaksha_Prasnalu tel.pdf | 2023-06-08 09:41 | 16M | |
![[ ]](/icons/layout.gif) | matsya-puranam-1.pdf | 2023-06-08 09:47 | 16M | |
![[ ]](/icons/layout.gif) | The Essentials Of Indian Philosophy M.Hiriyanna.pdf | 2023-07-10 11:04 | 16M | |
![[ ]](/icons/layout.gif) | suryasiddhanta.pdf | 2023-06-08 09:31 | 16M | |
![[ ]](/icons/layout.gif) | indian_antiquary_vol_61_032553_std.pdf | 2023-06-08 07:43 | 16M | |
![[ ]](/icons/layout.gif) | Tantra The Supreme Understanding Osho.pdf | 2023-06-08 06:41 | 16M | |
![[ ]](/icons/layout.gif) | indian_antiquary_vol_60_032552_std.pdf | 2023-06-08 07:43 | 17M | |
![[ ]](/icons/layout.gif) | pli.kerala.rare.12055.pdf | 2023-06-08 09:26 | 17M | |
![[ ]](/icons/layout.gif) | surya_siddhanta_english_text.pdf | 2023-06-08 09:31 | 17M | |
![[ ]](/icons/layout.gif) | Siddhantabindu.of.Madhusudana.Sarasvati.by.P.M.Modi.pdf | 2023-06-08 09:33 | 17M | |
![[ ]](/icons/layout.gif) | The Hindu View Of Life - Radhakrishnan.pdf | 2023-06-24 06:19 | 17M | |
![[ ]](/icons/layout.gif) | THE PEOPLE OF INDIA-By Sir Herbert Hope Risley.pdf | 2023-06-08 07:29 | 17M | |
![[ ]](/icons/layout.gif) | Chaitanya's_Life_and_Teachings_From_his_contemporary_Bengali_biography.pdf | 2023-07-04 04:17 | 17M | |
![[ ]](/icons/layout.gif) | Chaitanya's_Life_and_Teachings___From_his_contemporary_Bengali_biography.pdf | 2023-06-08 07:29 | 17M | |
![[ ]](/icons/layout.gif) | Arthasastra_Of_Kautilya_with_Tika_Part_1-_TG_Sastri.pdf | 2023-06-08 09:37 | 17M | |
![[ ]](/icons/layout.gif) | Getting Started with... by Ekaterina Kochmar (z-lib.org).pdf | 2023-07-04 06:36 | 17M | |
![[ ]](/icons/layout.gif) | indian_antiquary_vol_62_032554_std.pdf | 2023-06-08 07:43 | 17M | |
![[ ]](/icons/layout.gif) | Radical Humanism -MN Roy.pdf | 2023-06-08 07:22 | 17M | |
![[ ]](/icons/layout.gif) | The story of the Buddha -Edith Holland.pdf | 2023-06-08 07:32 | 17M | |
![[ ]](/icons/layout.gif) | Ajanta_&_Ellora_Cave_Temples_of_Ancient_India_by_Pushpesh_Pant.pdf | 2023-07-04 04:23 | 17M | |
![[ ]](/icons/layout.gif) | _Ajanta_&_Ellora___Cave_Temples_of_Ancient_India_by_Pushpesh_Pant.pdf | 2023-06-08 06:33 | 17M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_VisistAdvaita_Vedanta_based_on_Tattva_Mukta_Kalapa.pdf | 2023-06-08 06:34 | 17M | |
![[ ]](/icons/layout.gif) | God's Got a Thing About You by Bhagwan Shree Rajneesh.pdf | 2023-06-08 06:32 | 17M | |
![[ ]](/icons/layout.gif) | The Jungle Book -Rudyard Kipling.pdf | 2023-06-08 07:23 | 17M | |
![[ ]](/icons/layout.gif) | కేనోపనిషత్తు.pdf | 2023-06-08 09:34 | 17M | |
![[ ]](/icons/layout.gif) | Bhoja Raja_By P.T. Srinivasa Ayyangar.pdf | 2023-06-08 07:28 | 18M | |
![[ ]](/icons/layout.gif) | The Arthashastra ( PDFDrive ).pdf | 2023-06-08 09:21 | 18M | |
![[ ]](/icons/layout.gif) | బృహజ-జాతకము-1914.pdf | 2023-06-08 09:55 | 18M | |
![[ ]](/icons/layout.gif) | Bhagavata-Purana-ENG-01-1950-OCR-Motilal-Banasirdass.pdf | 2023-06-08 10:08 | 18M | |
![[ ]](/icons/layout.gif) | ఈశావిస్యోపనిషత్తు.pdf | 2023-06-08 09:34 | 18M | |
![[ ]](/icons/layout.gif) | The art of india traditons of indian sculpture painting (2).pdf | 2023-06-08 09:19 | 18M | |
![[ ]](/icons/layout.gif) | The art of india traditons of indian sculpture painting.pdf | 2023-06-08 09:17 | 18M | |
![[ ]](/icons/layout.gif) | Volga To Ganga - Rahul Sankrityayan.pdf | 2023-06-08 07:36 | 18M | |
![[ ]](/icons/layout.gif) | The Art of War - Sun Tzu.pdf | 2023-06-08 07:33 | 18M | |
![[ ]](/icons/layout.gif) | On Alexander Track To The Indus_by Aurel Stein.pdf | 2023-06-08 06:35 | 18M | |
![[ ]](/icons/layout.gif) | The_Taj_Mahal_Is_A_Temple_Place.pdf | 2023-06-08 08:04 | 18M | |
![[ ]](/icons/layout.gif) | Some_Blunders_of_Indian_Historical_Research.pdf | 2023-06-08 09:20 | 18M | |
![[ ]](/icons/layout.gif) | The Questions Of King Milinda By Thomas William Rhys Davids.pdf | 2023-06-08 07:28 | 18M | |
![[ ]](/icons/layout.gif) | Saint Kabir_ Life and Philosophy.pdf | 2023-06-08 06:32 | 18M | |
![[ ]](/icons/layout.gif) | On the Edge of the World_By Edmund Candler.pdf | 2023-06-08 07:25 | 18M | |
![[ ]](/icons/layout.gif) | The_Rape_of_India_A_Biography_of_Robert_Clive_and_a_Sexual_Histo.pdf | 2023-06-08 06:32 | 18M | |
![[ ]](/icons/layout.gif) | HistoryOfTheRiseOfTheMahomedanPowerInIndia_Volume_2.pdf | 2023-06-08 06:35 | 18M | |
![[ ]](/icons/layout.gif) | Holy_Himalaya_The_religion,_traditions,_and_scenery_of_Himalayan.pdf | 2023-06-08 07:29 | 18M | |
![[ ]](/icons/layout.gif) | Ananga Ranga -Kalyana Malla.pdf | 2023-06-08 07:16 | 18M | |
![[ ]](/icons/layout.gif) | The Naga story first armed struggle in India .pdf | 2023-06-08 06:33 | 18M | |
![[ ]](/icons/layout.gif) | The-Vishnu-Purana--Vol-3.pdf | 2023-06-08 09:56 | 19M | |
![[ ]](/icons/layout.gif) | Masti Sahitya Samagra Darshana.pdf | 2023-07-10 11:03 | 19M | |
![[ ]](/icons/layout.gif) | Autobiography of Subhas Chandra Bose -1.pdf | 2023-06-08 07:24 | 19M | |
![[ ]](/icons/layout.gif) | Thug the true story of Indias murderous religion .pdf | 2023-06-08 06:33 | 19M | |
![[ ]](/icons/layout.gif) | The_Mahabharata_Romesh_C._Dutt.pdf | 2023-06-08 06:35 | 19M | |
![[ ]](/icons/layout.gif) | Prevention_USA_.pdf | 2023-07-05 09:44 | 19M | |
![[ ]](/icons/layout.gif) | The Upanishads_By Friedrich Max Muller.pdf | 2023-06-08 07:29 | 19M | |
![[ ]](/icons/layout.gif) | Yogirajadhiraj_Swami_VISHUDDHANAND_PARAMAHANSADEVA_Life_&_Philosophy.pdf | 2023-06-08 09:15 | 19M | |
![[ ]](/icons/layout.gif) | ఐతరేయోపనిషత్తు.pdf | 2023-06-08 09:34 | 19M | |
![[ ]](/icons/layout.gif) | Vishnu puranam vol 5.pdf | 2023-06-08 09:56 | 19M | |
![[ ]](/icons/layout.gif) | అధర్వవేదసంహిత_దాశరథి_రంగాచార్య_Volume_2.pdf | 2023-06-08 10:08 | 19M | |
![[ ]](/icons/layout.gif) | A Text Book of Dravyaguna Vijnana - Hegde (2010).pdf | 2023-06-08 09:30 | 19M | |
![[ ]](/icons/layout.gif) | History of Pallavas of Kanchi Gopalan MUS.pdf | 2023-06-08 08:11 | 19M | |
![[ ]](/icons/layout.gif) | Sanatana_Dharma_An_Elementary_Text_Book_of_Hindu_Religion_And_Ethics.pdf | 2023-06-12 05:57 | 19M | |
![[ ]](/icons/layout.gif) | Panca_Siddhantika_Varahamihira,T_S_Kuppanna_Sastry,_K_V_Sarma (2).pdf | 2023-06-08 09:31 | 19M | |
![[ ]](/icons/layout.gif) | Panca_Siddhantika_Varahamihira,T_S_Kuppanna_Sastry,_K_V_Sarma.pdf | 2023-06-08 09:16 | 19M | |
![[ ]](/icons/layout.gif) | Glimpses Of Philosophy and Mysticism.pdf | 2023-07-10 11:03 | 19M | |
![[ ]](/icons/layout.gif) | DelhiAndItsNeighourhood.pdf | 2023-06-08 07:13 | 19M | |
![[ ]](/icons/layout.gif) | Vishnu-Purana--Vol-1.pdf | 2023-06-08 09:56 | 19M | |
![[ ]](/icons/layout.gif) | Sri-Gopal tapani upanishad.pdf | 2023-06-08 09:45 | 19M | |
![[ ]](/icons/layout.gif) | Indus_Civilization_Irfan_Habib.pdf | 2023-06-08 07:13 | 19M | |
![[ ]](/icons/layout.gif) | Vishnu-Purana--Vol-2.pdf | 2023-06-08 09:56 | 19M | |
![[ ]](/icons/layout.gif) | ssk-swachanda-tantram-vol-1.pdf | 2023-06-08 09:27 | 19M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-12.pdf | 2023-06-08 09:45 | 19M | |
![[ ]](/icons/layout.gif) | Book_Sanatan_Dharma_elementry.pdf | 2023-06-08 10:10 | 19M | |
![[ ]](/icons/layout.gif) | Organiser on Ambedkar BR.pdf | 2023-07-04 04:10 | 20M | |
![[ ]](/icons/layout.gif) | First_Indian_War_Independence_Marx_Engels.pdf | 2023-06-08 07:14 | 20M | |
![[ ]](/icons/layout.gif) | Introduction to the Devanagari Script.pdf | 2023-06-08 09:09 | 20M | |
![[ ]](/icons/layout.gif) | The Principles Of Moral Judgement By W.D.Lamont.pdf | 2023-07-10 11:04 | 20M | |
![[ ]](/icons/layout.gif) | YajNa valkya smriti.pdf | 2023-06-08 09:15 | 20M | |
![[ ]](/icons/layout.gif) | 196174216674_10152996551871675.pdf | 2023-06-08 09:21 | 20M | |
![[ ]](/icons/layout.gif) | Cosmos -Carl Sagan.pdf | 2023-06-08 07:14 | 20M | |
![[ ]](/icons/layout.gif) | Narada-Purana-ENG-01.pdf | 2023-06-08 10:09 | 20M | |
![[ ]](/icons/layout.gif) | A History of Pre-Buddhistic Indian Philosophy.pdf | 2023-06-08 07:14 | 20M | |
![[ ]](/icons/layout.gif) | అధర్వవేద_సంహిత_దాశరథి_రంగాచార్య_Volume_1.pdf | 2023-06-08 10:08 | 20M | |
![[ ]](/icons/layout.gif) | The-Gita_Chidbhavananda.pdf | 2023-06-08 09:16 | 20M | |
![[ ]](/icons/layout.gif) | Personality_Development_Swami_Vivekananda.pdf | 2023-06-08 07:21 | 20M | |
![[ ]](/icons/layout.gif) | Goraksha vacyana Eng.pdf | 2023-06-08 09:36 | 20M | |
![[ ]](/icons/layout.gif) | manusmiriti.pdf | 2023-06-08 07:55 | 20M | |
![[ ]](/icons/layout.gif) | ప్రశ్నోపనిషత్తు.pdf | 2023-06-08 09:33 | 21M | |
![[ ]](/icons/layout.gif) | Vikramaditya Of Ujjayini .pdf | 2023-06-08 09:43 | 21M | |
![[ ]](/icons/layout.gif) | Brahmanda Purana - G.V.Tagare - Part 2.pdf | 2023-06-08 10:08 | 21M | |
![[ ]](/icons/layout.gif) | rekhaganitavol_i.pdf | 2023-06-08 09:48 | 21M | |
![[ ]](/icons/layout.gif) | Linga Purana - J.L.Shastri - Part 2.pdf | 2023-06-08 10:09 | 21M | |
![[ ]](/icons/layout.gif) | Arctic Home in the Vedas -BG Tilak.pdf | 2023-06-08 07:25 | 21M | |
![[ ]](/icons/layout.gif) | AGHORA, At the Left Hand of God -Robert Svoboda.pdf | 2023-06-08 07:25 | 21M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. I (2).pdf | 2023-06-08 09:57 | 21M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. I.pdf | 2023-06-08 09:20 | 21M | |
![[ ]](/icons/layout.gif) | naradiyadharmasa021669mbp.pdf | 2023-06-08 09:15 | 21M | |
![[ ]](/icons/layout.gif) | A_History_of_the_Holy_Shrine_of_Sri_Venkatesa_in_Tirupati_Sakkottai.pdf | 2023-07-04 04:24 | 21M | |
![[ ]](/icons/layout.gif) | Eight-Upanisads-Vol-1.pdf | 2023-06-08 10:11 | 22M | |
![[ ]](/icons/layout.gif) | Basav_Vachan_Amritam_Of_Basaveshvar_Kannada_to_Sanskrit_Translated.pdf | 2023-07-10 11:02 | 22M | |
![[ ]](/icons/layout.gif) | India as known to Panini.pdf | 2023-06-08 09:28 | 22M | |
![[ ]](/icons/layout.gif) | Siddhānta-śiromaṇi-Gaṇitādhyāya.pdf | 2023-06-08 09:31 | 22M | |
![[ ]](/icons/layout.gif) | Siddhanta siromani of bhaskaracharya.pdf | 2023-06-08 09:32 | 22M | |
![[ ]](/icons/layout.gif) | The Mārkaṇḍeya Purāṇa.pdf | 2023-06-08 07:30 | 22M | |
![[ ]](/icons/layout.gif) | Ashoka -India's Lost Emperor.pdf | 2023-06-08 06:34 | 22M | |
![[ ]](/icons/layout.gif) | తైత్తిరీయోపనిషత్తు.pdf | 2023-06-08 09:38 | 22M | |
![[ ]](/icons/layout.gif) | Wild India the wildlife and scenery of India and Nepal.pdf | 2023-06-08 06:34 | 22M | |
![[ ]](/icons/layout.gif) | Indian temples and sculptures.pdf | 2023-06-08 09:27 | 22M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. II (2).pdf | 2023-06-08 09:57 | 22M | |
![[ ]](/icons/layout.gif) | Ayurvedic Text The Sushruta Samhita Vol. II.pdf | 2023-06-08 09:20 | 22M | |
![[ ]](/icons/layout.gif) | Manifestations Of Shiva -Stella Kramrisch.pdf | 2023-06-08 07:26 | 22M | |
![[ ]](/icons/layout.gif) | AN INDIAN PILIGRIM - SUBHAS CHANDRA BOSE.pdf | 2023-06-08 09:59 | 22M | |
![[ ]](/icons/layout.gif) | Mahabharata of Vyaasa.pdf | 2023-06-08 09:53 | 22M | |
![[ ]](/icons/layout.gif) | The Psychology Book by DK.pdf | 2023-06-21 06:12 | 22M | |
![[ ]](/icons/layout.gif) | Women In Rgveda_By Bhagwat Saran Upadhya.pdf | 2023-06-08 07:28 | 23M | |
![[ ]](/icons/layout.gif) | Myths of the Hindus & Buddhists_By Sister Nivedita.pdf | 2023-06-08 07:25 | 23M | |
![[ ]](/icons/layout.gif) | ముండకోపనిషత్.pdf | 2023-06-08 09:34 | 23M | |
![[ ]](/icons/layout.gif) | 5000 Inspiring Quotations.pdf | 2023-06-15 06:16 | 23M | |
![[ ]](/icons/layout.gif) | The_Upanishads_Swami_Prabhavananda_&_Frederick_Manchester.pdf | 2023-06-06 04:01 | 23M | |
![[ ]](/icons/layout.gif) | Alberuni's India -02.pdf | 2023-06-08 07:24 | 23M | |
![[ ]](/icons/layout.gif) | Vivekananda-A.pdf | 2023-06-08 09:32 | 23M | |
![[ ]](/icons/layout.gif) | Bodhidharma_commentaries_on_the_teachings_of_the_messenger_of_Z.pdf | 2023-06-08 06:33 | 23M | |
![[ ]](/icons/layout.gif) | Buddhadharma -Spring 2023.pdf | 2023-06-06 04:01 | 23M | |
![[ ]](/icons/layout.gif) | The Military System of Marathas.pdf | 2023-06-08 09:50 | 23M | |
![[ ]](/icons/layout.gif) | Indian_culture_and_society_in_the_Vedas.pdf | 2023-06-08 07:19 | 23M | |
![[ ]](/icons/layout.gif) | Simply Fly -GR Gopinath.pdf | 2023-06-08 06:37 | 23M | |
![[ ]](/icons/layout.gif) | Carvaka_Lokayata_An_Anthology_of_Source_Materials_and_Some_Recent.pdf | 2023-06-08 07:19 | 23M | |
![[ ]](/icons/layout.gif) | Right_wing_women_from_conservatives_to_extremists_around_the_wo.pdf | 2023-06-08 06:33 | 23M | |
![[ ]](/icons/layout.gif) | The_Great_Book_of_Magical_Art,_Hindu_Magic_and_East_Indian_Occultism.pdf | 2023-06-08 07:54 | 24M | |
![[ ]](/icons/layout.gif) | Samarangana Sutradhara sanskrit.pdf | 2023-06-08 10:09 | 24M | |
![[ ]](/icons/layout.gif) | 301153447-Gandharva-Tantra.pdf | 2023-06-08 09:39 | 24M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-8.pdf | 2023-06-08 09:46 | 24M | |
![[ ]](/icons/layout.gif) | VisnuSahasraNama_Bhasya_Samkaracarya_AnanthaKrishna_Sastry_1980.pdf | 2023-06-08 09:33 | 24M | |
![[ ]](/icons/layout.gif) | The temple architecture of India .pdf | 2023-06-08 06:35 | 24M | |
![[ ]](/icons/layout.gif) | Photos_of_the_Gods_the_printed_image_and_political_struggle_in_.pdf | 2023-06-08 06:32 | 24M | |
![[ ]](/icons/layout.gif) | Divide_and_Quit_An_eye_witness_account_of_the_Partition_of_India.pdf | 2023-07-04 04:16 | 24M | |
![[ ]](/icons/layout.gif) | Divide_and_Quit___An_eye_witness_account_of_the_Partition_of_India.pdf | 2023-06-08 07:30 | 24M | |
![[ ]](/icons/layout.gif) | Soma_ Divine Mushroom of Immortality, by R. Gordon Wasson.pdf | 2023-06-08 06:36 | 24M | |
![[ ]](/icons/layout.gif) | The_Strength_of_Our_Wrists__Three_Plays_Book_by_Premānanda_Gajvī.pdf | 2023-07-08 07:38 | 24M | |
![[ ]](/icons/layout.gif) | Ayurveda Encyclopedia - Swami Sadashiva Tirtha, R.C. Uniyal.pdf | 2023-06-08 07:19 | 24M | |
![[ ]](/icons/layout.gif) | Mystical_Verses_of_Lalla_Jaishree_Kak.pdf | 2023-06-08 07:19 | 24M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-4.pdf | 2023-06-08 09:46 | 24M | |
![[ ]](/icons/layout.gif) | Sivanandalahari_Of_Sri_Sankaracharya_Swami_Tapsyananda.pdf | 2023-06-08 06:43 | 24M | |
![[ ]](/icons/layout.gif) | Hindu astronomy by bernard.pdf | 2023-06-08 09:31 | 24M | |
![[ ]](/icons/layout.gif) | Pakistan_or_partition_of_india_Ambedkar_B.R..pdf | 2023-06-08 06:32 | 25M | |
![[ ]](/icons/layout.gif) | 5.SiddhantakaumudiVol3Part1TaddhitaApatyadhikara-KrRay1938.pdf | 2023-06-08 09:55 | 25M | |
![[ ]](/icons/layout.gif) | Architecture of Manansara vol 5.pdf | 2023-06-08 09:18 | 25M | |
![[ ]](/icons/layout.gif) | rekhaganitavol_ii_dli.pdf | 2023-06-08 09:48 | 25M | |
![[ ]](/icons/layout.gif) | The_Quest_for_the_Historical_Muhammad_by_Ibn_Warraq_z_lib_org.pdf | 2023-06-08 07:59 | 25M | |
![[ ]](/icons/layout.gif) | The Hymns of the Rigved -Ralph TH Griffith (2).pdf | 2023-06-08 07:25 | 25M | |
![[ ]](/icons/layout.gif) | The Yoga System of Patañjali.pdf | 2023-06-08 07:24 | 25M | |
![[ ]](/icons/layout.gif) | Bija Ganita by bhaskara 2.pdf | 2023-06-08 09:49 | 25M | |
![[ ]](/icons/layout.gif) | What Aliens Told Us About God.pdf | 2023-06-08 07:41 | 25M | |
![[ ]](/icons/layout.gif) | Bhagavata-Purana-ENG-04-1955-OCR-Motilal-Banasirdass.pdf | 2023-06-08 10:07 | 25M | |
![[ ]](/icons/layout.gif) | Ancient indian Medicine kutumbiah P..pdf | 2023-06-08 09:30 | 25M | |
![[ ]](/icons/layout.gif) | Yoga,_Ayurveda,_Self_Healing_and_Self_Realization_David_Frawley.pdf | 2023-06-08 09:59 | 25M | |
![[ ]](/icons/layout.gif) | Narada-Purana-ENG-04.pdf | 2023-06-08 10:09 | 25M | |
![[ ]](/icons/layout.gif) | Ayurveda and the Mind -David Frawley.pdf | 2023-06-08 07:19 | 25M | |
![[ ]](/icons/layout.gif) | Indian-original-constitution-interpretation.pdf | 2023-06-08 07:55 | 25M | |
![[ ]](/icons/layout.gif) | Taranatha_s_History_of_Buddhism_in_India.pdf | 2023-06-08 07:21 | 25M | |
![[ ]](/icons/layout.gif) | SrimadBhagavadGitaRahasya_BgTilak_Vol1.pdf | 2023-06-08 07:23 | 26M | |
![[ ]](/icons/layout.gif) | Algebra,_with_Arithmetic_and_Mensuration,_from_the_Sanscrit_of_Brahmegupta.pdf | 2023-06-08 07:33 | 26M | |
![[ ]](/icons/layout.gif) | The-Vishnu-Purana--Vol-4.pdf | 2023-06-08 09:56 | 26M | |
![[ ]](/icons/layout.gif) | Buddhist India-By Thomas William Rhys Davids.pdf | 2023-06-08 07:30 | 26M | |
![[ ]](/icons/layout.gif) | Oppenheimer & the bomb -Paul Strathern.pdf | 2023-07-03 07:57 | 26M | |
![[ ]](/icons/layout.gif) | _Bhagavad_Gita_The_Scripture_Of_Mankind_By_Swami_Tapasyananda.pdf | 2023-07-04 04:24 | 26M | |
![[ ]](/icons/layout.gif) | _Bhagavad_Gita__The_Scripture_Of_Mankind_By_Swami_Tapasyananda.pdf | 2023-06-06 04:01 | 26M | |
![[ ]](/icons/layout.gif) | Sarnath -ASI.pdf | 2023-06-08 07:14 | 26M | |
![[ ]](/icons/layout.gif) | Panchi_Karanam_Of_Sri_Shankaracharya_By_Sri_Sureshwaracharya_With.pdf | 2023-06-08 06:42 | 26M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-9.pdf | 2023-06-08 09:46 | 26M | |
![[ ]](/icons/layout.gif) | Arthasastra_Of_Kautilya_with_Tika_Part_3_-_TG_Sastri.pdf | 2023-06-08 09:36 | 26M | |
![[ ]](/icons/layout.gif) | The_Great_Epic_of_India;_Its_Character_and_Origin_by_Hopkins_Edward.pdf | 2023-06-08 07:25 | 26M | |
![[ ]](/icons/layout.gif) | Alberuni's India -01.pdf | 2023-06-08 07:24 | 27M | |
![[ ]](/icons/layout.gif) | India_Illustrated_with_Pen_and_Pencil_By_William_Urwick_and_Edward.pdf | 2023-06-08 07:29 | 27M | |
![[ ]](/icons/layout.gif) | Castes_and_tribes_of_Southern_India_01_Edgar_Thurston_Assisted_by.pdf | 2023-06-08 07:33 | 27M | |
![[ ]](/icons/layout.gif) | Konark Sun Temple.pdf | 2023-06-08 07:16 | 27M | |
![[ ]](/icons/layout.gif) | damara-tantra-ram-kumar-rai_compress.pdf | 2023-06-08 09:39 | 27M | |
![[ ]](/icons/layout.gif) | Castes_and_tribes_of_Southern_India_02_Edgar_Thurston_Assisted_by.pdf | 2023-06-08 07:33 | 27M | |
![[ ]](/icons/layout.gif) | 2015.22683.The-Ashtadhyayi-Of-Panini.pdf | 2023-06-08 08:04 | 27M | |
![[ ]](/icons/layout.gif) | Conception_of_Matter_According_to_Nyaya_Vaisesika_by_Umesha_Mishra.pdf | 2023-06-08 10:12 | 27M | |
![[ ]](/icons/layout.gif) | The Charm of Bombay - R.P. Karkaria.pdf | 2023-06-08 07:32 | 28M | |
![[ ]](/icons/layout.gif) | Studies In Indian Temple Architecture _By Pramod Chandra.pdf | 2023-06-08 07:22 | 28M | |
![[ ]](/icons/layout.gif) | Sri Ramanuja Gita Bhasya.pdf | 2023-06-08 07:15 | 28M | |
![[ ]](/icons/layout.gif) | Indian_Epigraphy_A_Guide_to_the_Study_of_Inscriptions_in_Sanskrit.pdf | 2023-06-08 10:08 | 28M | |
![[ ]](/icons/layout.gif) | Khajuraho Group of Monuments.pdf | 2023-06-08 07:16 | 28M | |
![[ ]](/icons/layout.gif) | Personal_and_geographical_names_in_the_Gupta_inscriptions_By_Tej.pdf | 2023-06-08 07:29 | 28M | |
![[ ]](/icons/layout.gif) | Mahabharatam.pdf | 2023-06-08 09:43 | 28M | |
![[ ]](/icons/layout.gif) | Jataka_Tales_Selected_and_edited_by_H_T_Francis_and_E_J_Thomas_.pdf | 2023-06-08 07:29 | 28M | |
![[ ]](/icons/layout.gif) | ATHARVA VEDA VOL - II.pdf | 2023-06-08 09:59 | 28M | |
![[ ]](/icons/layout.gif) | arsha_vignana_sarvasvamu_modati_samputamu_veda_samhitamu.pdf | 2023-06-08 09:43 | 28M | |
![[ ]](/icons/layout.gif) | Sampurna Gandhi Vagmay.pdf | 2023-06-08 09:36 | 29M | |
![[ ]](/icons/layout.gif) | Siva Purana - J.L.Shastri - Part 3.pdf | 2023-06-08 10:09 | 29M | |
![[ ]](/icons/layout.gif) | Narada-Purana-ENG-02.pdf | 2023-06-08 10:09 | 29M | |
![[ ]](/icons/layout.gif) | Sree Lalitopakhyanam.pdf | 2023-06-08 09:43 | 29M | |
![[ ]](/icons/layout.gif) | 2500 Years Of Buddhism -PV Bapat.pdf | 2023-06-08 06:33 | 29M | |
![[ ]](/icons/layout.gif) | Vayu puranam part 1.pdf | 2023-06-08 10:00 | 29M | |
![[ ]](/icons/layout.gif) | Outlines of Indian Philosophy M.Hiriyanna.pdf | 2023-07-10 11:03 | 30M | |
![[ ]](/icons/layout.gif) | Paippalada_Samhita_of_The_Atharva_Veda_Vol_1_Dipak_Bhattacharya.pdf | 2023-06-08 09:50 | 30M | |
![[ ]](/icons/layout.gif) | కఠోపనిషత్తు.pdf | 2023-06-08 09:34 | 30M | |
![[ ]](/icons/layout.gif) | The_Vinashikha_Tantra_Teun_Goudriaan.pdf | 2023-06-08 07:19 | 30M | |
![[ ]](/icons/layout.gif) | Kalyana-Kalpataru-Gita-Tattva-No-i.pdf | 2023-06-08 09:55 | 30M | |
![[ ]](/icons/layout.gif) | Signs of the Gods.pdf | 2023-06-08 07:40 | 30M | |
![[ ]](/icons/layout.gif) | Eight-Upanisads-vol2.pdf | 2023-06-08 10:11 | 30M | |
![[ ]](/icons/layout.gif) | J_Duncan_J_Duncan_Glover_Glover,_Mulukutla_S_Sarma,_Thomas_Overbye.pdf | 2023-07-10 10:52 | 30M | |
![[ ]](/icons/layout.gif) | Jaina Philosophy and Religion by Munîsrí Nyäyavijayaji.pdf | 2023-06-08 06:31 | 31M | |
![[ ]](/icons/layout.gif) | What_the_Koran_Really_Says_Language,_Text,_and_Commentary_by_Ibn.pdf | 2023-06-08 07:58 | 31M | |
![[ ]](/icons/layout.gif) | Arthur_Avalon_The_Serpent_Power_1_.pdf | 2023-06-08 07:20 | 31M | |
![[ ]](/icons/layout.gif) | The Exercise of Freedom_ An Introduction to Dalit Writing.pdf | 2023-06-23 07:29 | 31M | |
![[ ]](/icons/layout.gif) | Arthasastra_Of_Kautilya_with_Tika_Part_2 TG_Sastri.pdf | 2023-06-08 09:36 | 31M | |
![[ ]](/icons/layout.gif) | illustrations of himalayan plants.pdf | 2023-06-08 09:31 | 31M | |
![[ ]](/icons/layout.gif) | Damara-Tantra-Ram-Kumar-Rai.pdf | 2023-06-08 09:42 | 31M | |
![[ ]](/icons/layout.gif) | An Introduction to the Study of Indian History.pdf | 2023-06-08 07:15 | 32M | |
![[ ]](/icons/layout.gif) | Erotic_literature_of_ancient_India_Kama_sutra,_Koka_shastra,_Gi.pdf | 2023-06-08 06:35 | 32M | |
![[ ]](/icons/layout.gif) | 2015.511989.The-Groundwork.pdf | 2023-06-08 10:10 | 32M | |
![[ ]](/icons/layout.gif) | Vegetarian_Indian_food_&_cooking_explore_the_very_best_of_India.pdf | 2023-06-08 06:32 | 32M | |
![[ ]](/icons/layout.gif) | A Dictnary of Hindu Architecture vol 1.pdf | 2023-06-08 09:19 | 32M | |
![[ ]](/icons/layout.gif) | HistoryOfTheRiseOfTheMahomedanPowerInIndia-Volume-4.pdf | 2023-06-08 06:35 | 32M | |
![[ ]](/icons/layout.gif) | 53746-Introduction To Kayachikitsa (1959).pdf | 2023-06-08 09:29 | 32M | |
![[ ]](/icons/layout.gif) | V.N.S. Murthy - Geotechnical Engineering_ Principles and Practices of Soil Mechanics and Foundation Engineering (Civil and Environmental Engineering)-CRC Press (2002).pdf | 2023-07-10 07:50 | 32M | |
![[ ]](/icons/layout.gif) | Narada-Purana-ENG-03.pdf | 2023-06-08 10:09 | 32M | |
![[ ]](/icons/layout.gif) | Siva Purana - J.L.Shastri - Part 4.pdf | 2023-06-08 10:09 | 32M | |
![[ ]](/icons/layout.gif) | The_Hindu_Nationalist_Movement_in_India_Christophe_Jaffrelot.pdf | 2023-06-08 06:38 | 32M | |
![[ ]](/icons/layout.gif) | All About History - History of Communism, 5th Edition, 2022.pdf | 2023-07-05 09:43 | 32M | |
![[ ]](/icons/layout.gif) | Forgotten Empire Vijayanagar - Robert Sewell.pdf | 2023-06-08 08:11 | 33M | |
![[ ]](/icons/layout.gif) | The Awakening Of Intelligence.pdf | 2023-06-08 06:36 | 33M | |
![[ ]](/icons/layout.gif) | Breaking India - Rajiv Malhotra & Aravindan Neelakandan.pdf | 2023-07-04 04:19 | 33M | |
![[ ]](/icons/layout.gif) | Female_Buddhas_women_of_enlightenment_in_Tibetan_mystical_art.pdf | 2023-06-08 06:34 | 33M | |
![[ ]](/icons/layout.gif) | 1.SiddhantakaumudiVol1Part1-Sandhi-SrRay1926.pdf | 2023-06-08 09:54 | 33M | |
![[ ]](/icons/layout.gif) | RIGVEDA - 3.pdf | 2023-06-08 09:59 | 33M | |
![[ ]](/icons/layout.gif) | Philosophy_of_Sankar_s_Advaita_Vedanta_The_Chattopadhyaya_S_K.pdf | 2023-06-08 07:22 | 33M | |
![[ ]](/icons/layout.gif) | ATHARVA VEDA VOL - I.pdf | 2023-06-08 09:59 | 33M | |
![[ ]](/icons/layout.gif) | Jewels Of Nizam.pdf | 2023-06-08 07:14 | 33M | |
![[ ]](/icons/layout.gif) | The-Hindu-yogi Science of breath.pdf | 2023-06-08 09:09 | 33M | |
![[ ]](/icons/layout.gif) | History of puri jaganath temple.pdf | 2023-06-08 09:27 | 34M | |
![[ ]](/icons/layout.gif) | Zodiac and Swastika -Wilhelm Wulff.pdf | 2023-06-19 09:35 | 34M | |
![[ ]](/icons/layout.gif) | bharateeya_samskaramulu.pdf | 2023-06-08 09:45 | 34M | |
![[ ]](/icons/layout.gif) | natya_shastra_translation_volume_1_-_bharat_muni.pdf | 2023-06-08 09:42 | 34M | |
![[ ]](/icons/layout.gif) | yogasarvaswamu.pdf | 2023-06-08 10:07 | 34M | |
![[ ]](/icons/layout.gif) | Bhagavata-Purana-ENG-02-1950-OCR-Motilal-Banasirdass.pdf | 2023-06-08 10:08 | 34M | |
![[ ]](/icons/layout.gif) | The_saiva_upanisads_with_the_commentary_of_sri_upanishad_brahma.pdf | 2023-06-08 08:04 | 35M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-3.pdf | 2023-06-08 09:46 | 35M | |
![[ ]](/icons/layout.gif) | 2015.102744.Netaji-Subhash-Chandra-Bose-His-Life-And-Work.pdf | 2023-06-08 09:59 | 35M | |
![[ ]](/icons/layout.gif) | The Life of Shivaji Maharaj - Nilakant Sadashiv Takakhav.pdf | 2023-06-08 07:31 | 35M | |
![[ ]](/icons/layout.gif) | History_of_Ancient_and_Early_Medieval_India_From_the_Stone_Age_to.pdf | 2023-06-08 08:11 | 35M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-1.pdf | 2023-06-08 09:46 | 35M | |
![[ ]](/icons/layout.gif) | Gods Guardians and Lovers Temple Sculptors From North India.pdf | 2023-06-08 06:40 | 35M | |
![[ ]](/icons/layout.gif) | Linga Purana - J.L.Shastri - Part 1.pdf | 2023-06-08 10:09 | 35M | |
![[ ]](/icons/layout.gif) | A_philosophy_of_devotion_a_comparative_study_of_bhakti_and_prap.pdf | 2023-06-08 06:33 | 35M | |
![[ ]](/icons/layout.gif) | CanadianGeographic.pdf | 2023-06-15 06:21 | 35M | |
![[ ]](/icons/layout.gif) | The_Asvamedha_The_Rite_and_its_Logic_Subhash_Kak.pdf | 2023-06-08 07:21 | 35M | |
![[ ]](/icons/layout.gif) | The Great Chola Temples.pdf | 2023-06-08 07:21 | 35M | |
![[ ]](/icons/layout.gif) | Kalidasa-And-Vikramaditya.pdf | 2023-06-08 09:32 | 36M | |
![[ ]](/icons/layout.gif) | Sexual Life In Ancient India by Johann Jakob Meyer.pdf | 2023-06-08 07:24 | 36M | |
![[ ]](/icons/layout.gif) | Same_Sex_Love_in_India_Readings_from_Literature_and_History_PDFDrive.pdf | 2023-06-08 07:14 | 36M | |
![[ ]](/icons/layout.gif) | RIGVEDA - 4.pdf | 2023-06-08 09:59 | 37M | |
![[ ]](/icons/layout.gif) | For the solution of the ‘Caste’ question -Ranganayakamma (2).pdf | 2023-07-04 04:15 | 37M | |
![[ ]](/icons/layout.gif) | For the solution of the ‘Caste’ question -Ranganayakamma.pdf | 2023-06-12 05:56 | 37M | |
![[ ]](/icons/layout.gif) | ఆర్య చాణక్యుడు.pdf | 2023-06-08 10:08 | 37M | |
![[ ]](/icons/layout.gif) | Encyclopedia of Hindu Architecture.pdf | 2023-06-08 10:11 | 37M | |
![[ ]](/icons/layout.gif) | Yuganta -Irawati Karve.pdf | 2023-07-05 10:31 | 37M | |
![[ ]](/icons/layout.gif) | Legacy of Vagbhata Valiathan M.S..pdf | 2023-06-08 09:30 | 38M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-7.pdf | 2023-06-08 09:46 | 38M | |
![[ ]](/icons/layout.gif) | Our Films Their Films -Satyajit Ray.pdf | 2023-07-08 07:34 | 38M | |
![[ ]](/icons/layout.gif) | Evolution -The Human Story by DK.pdf | 2023-06-20 03:48 | 39M | |
![[ ]](/icons/layout.gif) | ashtadasarahasyamgal_part-i.pdf | 2023-06-08 09:45 | 39M | |
![[ ]](/icons/layout.gif) | The Raghu Vamsa -Kalidasa.pdf | 2023-06-08 07:15 | 39M | |
![[ ]](/icons/layout.gif) | Economy & Soceity in Early India -DN Jha.pdf | 2023-07-03 07:58 | 39M | |
![[ ]](/icons/layout.gif) | Agama_Encyclopadia_Part_I_Prof._S._K._Ramachandra_Rao.pdf | 2023-06-08 09:38 | 39M | |
![[ ]](/icons/layout.gif) | The_Story_of_Mira_Bhai_by_Bankey_Behari_Gita_Press.pdf | 2023-06-08 06:35 | 39M | |
![[ ]](/icons/layout.gif) | Odyssey of the Gods.pdf | 2023-06-08 07:41 | 39M | |
![[ ]](/icons/layout.gif) | alberunis INDIA.pdf | 2023-06-08 09:38 | 39M | |
![[ ]](/icons/layout.gif) | Best of Jataka Tales.pdf | 2023-06-19 09:35 | 39M | |
![[ ]](/icons/layout.gif) | RIGVEDA - 2.pdf | 2023-06-08 09:59 | 39M | |
![[ ]](/icons/layout.gif) | After Dinner Conversation Philosophy - June 2023.pdf | 2023-06-12 11:23 | 39M | |
![[ ]](/icons/layout.gif) | Vaishnavism_Shaivism_and_Other_Minor_Religious_Systems_R_G_Bhandarkar.pdf | 2023-06-08 07:25 | 40M | |
![[ ]](/icons/layout.gif) | Bhavishya puranam telugu.pdf | 2023-06-08 09:22 | 40M | |
![[ ]](/icons/layout.gif) | RIGVEDA - 1.pdf | 2023-06-08 09:59 | 40M | |
![[ ]](/icons/layout.gif) | Chanakya_Acharya_Kautilya_Chanakya_Neeti_Translated_0,_Rajat_Prakashan (2).pdf | 2023-06-08 10:11 | 40M | |
![[ ]](/icons/layout.gif) | Two_Plays_of_Ancient_India__The_Little_Clay_Cart_and_the_Minister’s.pdf | 2023-07-08 07:34 | 40M | |
![[ ]](/icons/layout.gif) | Bhagavata-Purana-ENG-05-1955-OCR-Motilal-Banasirdass.pdf | 2023-06-08 10:07 | 40M | |
![[ ]](/icons/layout.gif) | krishna_yajurvediya_taitiriya_samhita_vedartha_dipika_sahitamu.pdf | 2023-06-08 09:45 | 40M | |
![[ ]](/icons/layout.gif) | Brahma Sputha Siddhanta VOL_IV.pdf | 2023-06-08 09:49 | 40M | |
![[ ]](/icons/layout.gif) | Bhagavata-Purana-ENG-03-1955-OCR-Motilal-Banasirdass.pdf | 2023-06-08 10:08 | 41M | |
![[ ]](/icons/layout.gif) | Agama_Encyclopadia_Part_II_Prof._S._K._Ramachandra_Rao.pdf | 2023-06-08 09:37 | 41M | |
![[ ]](/icons/layout.gif) | Himalayan botony.pdf | 2023-06-08 09:31 | 41M | |
![[ ]](/icons/layout.gif) | Vedic Mathematics -Jagadguru Swami Sri.pdf | 2023-06-08 06:33 | 42M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_కిష్కింధ.pdf | 2023-06-08 09:29 | 42M | |
![[ ]](/icons/layout.gif) | Hampi Ruins by A.H. Longhurst.pdf | 2023-06-08 07:26 | 43M | |
![[ ]](/icons/layout.gif) | Brihadaranyaka_Upanishad_Shankara_Bhashya_by_Swami_Madhavananda.pdf | 2023-06-08 07:14 | 43M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_అరణ్యకాండము.pdf | 2023-06-08 09:29 | 43M | |
![[ ]](/icons/layout.gif) | The_Origins_of_the_Koran_Classic_Essays_on_Islam’s_Holy_Book_by.pdf | 2023-06-08 07:59 | 43M | |
![[ ]](/icons/layout.gif) | The TODAS.pdf | 2023-06-08 06:37 | 44M | |
![[ ]](/icons/layout.gif) | varahamihira_pancha.pdf | 2023-06-08 09:18 | 44M | |
![[ ]](/icons/layout.gif) | Brahma Sputha Siddhanta VOL_III.pdf | 2023-06-08 09:50 | 44M | |
![[ ]](/icons/layout.gif) | Apasthamba-Sulba Sutras sanskrit.pdf | 2023-06-08 09:38 | 44M | |
![[ ]](/icons/layout.gif) | Panini- His Work and its Traditions by George Cardona.pdf | 2023-06-08 09:28 | 45M | |
![[ ]](/icons/layout.gif) | The life of Shivaji Maharaj, founder of the Maratha empire.pdf | 2023-06-08 09:28 | 46M | |
![[ ]](/icons/layout.gif) | Gods of Angkor -Arthur M Sackler.pdf | 2023-07-03 07:58 | 46M | |
![[ ]](/icons/layout.gif) | What_is_Living_and_What_is_Dead_in_Indian_Philosophy_Debiprasad.pdf | 2023-06-08 07:24 | 46M | |
![[ ]](/icons/layout.gif) | manusmrxti telugu.pdf | 2023-06-08 09:57 | 46M | |
![[ ]](/icons/layout.gif) | Dakshinamurthy Stotra and Upanishad.pdf | 2023-06-08 09:52 | 46M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-11.pdf | 2023-06-08 09:45 | 47M | |
![[ ]](/icons/layout.gif) | Padma purana part 3.pdf | 2023-06-08 10:00 | 47M | |
![[ ]](/icons/layout.gif) | Muhammad Ali Mazidi, Sarmad Naimi and Sepehr Naimi,”The AVR Microcontroller and Embedded Systems”, Using Assembly and C, Pearson Education, 1st Edition, 2012.pdf | 2023-07-10 10:41 | 47M | |
![[ ]](/icons/layout.gif) | Brahma Sputha Siddhanta VOL_II.pdf | 2023-06-08 09:50 | 47M | |
![[ ]](/icons/layout.gif) | The_illustrated_encyclopedia_of_Buddhism_a_comprehensive_guide_.pdf | 2023-06-08 06:35 | 47M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_యుద్ద.pdf | 2023-06-08 09:29 | 47M | |
![[ ]](/icons/layout.gif) | Nationalism -Rabindranath Tagore.pdf | 2023-06-19 06:04 | 48M | |
![[ ]](/icons/layout.gif) | An Atheist Reports from India - Margaret R. Bhatty (2).pdf | 2023-07-10 11:02 | 48M | |
![[ ]](/icons/layout.gif) | An Atheist Reports from India - Margaret R. Bhatty.pdf | 2023-07-08 07:38 | 48M | |
![[ ]](/icons/layout.gif) | Shandilya_Samhita_Bhakti_Khanda_Part_2_No_60_1936_Saraswati_Bhawan.pdf | 2023-06-08 07:54 | 48M | |
![[ ]](/icons/layout.gif) | Studies_in_the_origins_of_Buddhism_Govind_Chandra_Pande_1957.pdf | 2023-06-08 08:00 | 48M | |
![[ ]](/icons/layout.gif) | Zieglers English Kannada Dictionary.pdf | 2023-07-10 11:04 | 48M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_బాల_కాండము.pdf | 2023-06-08 09:29 | 49M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_అయోధ్యా.pdf | 2023-06-08 09:29 | 49M | |
![[ ]](/icons/layout.gif) | 7.SiddhantakaumudiVol4Bhvadi-KrRay1936.pdf | 2023-06-08 09:55 | 49M | |
![[ ]](/icons/layout.gif) | Vriksha_Ayurveda_A_Treatise_on_Plant_Science_Sircar_N_N_Roma_Sarkar.pdf | 2023-06-08 09:24 | 49M | |
![[ ]](/icons/layout.gif) | Oka-Yogi atma katha.pdf | 2023-06-08 09:58 | 50M | |
![[ ]](/icons/layout.gif) | Sanskrit English Dictionary.pdf | 2023-07-10 11:01 | 50M | |
![[ ]](/icons/layout.gif) | Jaideva Singh Paratrishika Vivarana (Trident of Wisdom).pdf | 2023-06-08 09:20 | 50M | |
![[ ]](/icons/layout.gif) | Kumaresh_Purana_Translation_By_Hirvedrayar_English_Mada_Vira_Shaiva.pdf | 2023-07-10 11:02 | 50M | |
![[ ]](/icons/layout.gif) | Ashtanga-HridayamSutra tel.pdf | 2023-06-08 09:32 | 50M | |
![[ ]](/icons/layout.gif) | Lalita Archana Chandrika Ramachandra Rao S.K. Kalpatharu.pdf | 2023-06-08 09:28 | 50M | |
![[ ]](/icons/layout.gif) | Society at the time of the Buddha by Narendra Wagle.pdf | 2023-06-15 06:16 | 50M | |
![[ ]](/icons/layout.gif) | History_of_the_Dvaita_School_of_Vedanta_and_its_Literature_B_N_K.pdf | 2023-06-08 07:14 | 50M | |
![[ ]](/icons/layout.gif) | The-Supreme-Yoga-Swami-Venkatesananda.pdf | 2023-06-08 09:16 | 50M | |
![[ ]](/icons/layout.gif) | Brahma Sputha Siddhanta VOL_I.pdf | 2023-06-08 09:50 | 51M | |
![[ ]](/icons/layout.gif) | Srimad Bhagavad Gita (Sanskrit, Hindi and English).pdf | 2023-07-10 11:03 | 51M | |
![[ ]](/icons/layout.gif) | Brahmanda Purana - G.V.Tagare - Part 4.pdf | 2023-06-08 10:08 | 51M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-5.pdf | 2023-06-08 09:46 | 51M | |
![[ ]](/icons/layout.gif) | Taitreya upanishad manuscript.pdf | 2023-06-08 09:47 | 51M | |
![[ ]](/icons/layout.gif) | The Life-history of a Brahui.pdf | 2023-06-08 06:40 | 51M | |
![[ ]](/icons/layout.gif) | Tantrik_Yoga_Hindu_and_Tibetan_J_Marques_Riviere.pdf | 2023-06-08 06:34 | 51M | |
![[ ]](/icons/layout.gif) | VemanaPadyamulu.pdf | 2023-06-08 09:25 | 51M | |
![[ ]](/icons/layout.gif) | శ్రీ_మద్రామాయణ_కల్పవృక్షము_సుందరకాండము.pdf | 2023-06-08 09:29 | 52M | |
![[ ]](/icons/layout.gif) | Schopenhauer and Indian Philosophy.pdf | 2023-06-27 06:02 | 52M | |
![[ ]](/icons/layout.gif) | 378924539-Dasa-Mahavidya-and-Tantra-Sastra-S-Satpathy-pdf.pdf | 2023-06-08 09:32 | 52M | |
![[ ]](/icons/layout.gif) | Bharathiya samskaramullu.pdf | 2023-06-08 10:11 | 53M | |
![[ ]](/icons/layout.gif) | Manusmriti original.pdf | 2023-06-08 09:20 | 53M | |
![[ ]](/icons/layout.gif) | Avyaya Kosa -Srivatsankacharya.pdf | 2023-06-08 09:28 | 53M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-6.pdf | 2023-06-08 09:46 | 53M | |
![[ ]](/icons/layout.gif) | Astral_Travel_Your_Guide_to_The_Secrets_of_Out_of_Body_Experience.pdf | 2023-06-08 07:23 | 53M | |
![[ ]](/icons/layout.gif) | The Character of the Self in Ancient India -Brian Black.pdf | 2023-06-23 07:30 | 53M | |
![[ ]](/icons/layout.gif) | హిమాలయ_యోగులతో_క్రియాయోగి_అనుభవాలు.pdf | 2023-06-08 09:21 | 54M | |
![[ ]](/icons/layout.gif) | João_Manuel_R_S_Tavares_editor_Christoph_Bourauel_editor_Liesbet.pdf | 2023-07-04 06:42 | 54M | |
![[ ]](/icons/layout.gif) | Enugula Veeraswamys Journal Kasiyatra Charitra.pdf | 2023-06-08 07:30 | 54M | |
![[ ]](/icons/layout.gif) | BrahadaranyakaUpanishad-Madhavaananda.pdf | 2023-06-08 09:46 | 54M | |
![[ ]](/icons/layout.gif) | Bhagavad_Gita_for_Peace_of_Mind_by_R_J_Venkateshwar_Bharatiya_Vidya.pdf | 2023-06-08 06:38 | 54M | |
![[ ]](/icons/layout.gif) | An_Outline_Of_History_Of_Saiva_Philosophy_K.C._Pandey.pdf | 2023-06-08 06:36 | 55M | |
![[ ]](/icons/layout.gif) | Myths and symbols of Vedic astrology -Bepin Behari.pdf | 2023-07-04 04:11 | 55M | |
![[ ]](/icons/layout.gif) | History_of_Medieval_India Satish Chandra.pdf | 2023-06-06 06:28 | 55M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-10.pdf | 2023-06-08 09:46 | 56M | |
![[ ]](/icons/layout.gif) | 2015.76712.History-Of-Kerala-Vol-I.pdf | 2023-06-08 09:27 | 56M | |
![[ ]](/icons/layout.gif) | Indian_Thought_K_Damodaran.pdf | 2023-06-08 06:41 | 57M | |
![[ ]](/icons/layout.gif) | HistoryOfTheRiseOfTheMahomedanPowerInIndia-Volume-3.pdf | 2023-06-08 06:35 | 57M | |
![[ ]](/icons/layout.gif) | RSS’s_Tryst_with_Politics_From_Hedgewar_to_Sudarshan_by_Pralay_Kanugo.pdf | 2023-06-10 04:55 | 57M | |
![[SND]](/icons/sound2.gif) | The truth about the Gita.mp3 | 2023-06-08 07:16 | 58M | |
![[ ]](/icons/layout.gif) | Pattadakal_A.Sundara.pdf | 2023-06-08 07:15 | 58M | |
![[ ]](/icons/layout.gif) | Marma_Lost_Secrets_of_Ayurveda_Avainash_Lele,_Subhash_Ranade,_David.pdf | 2023-06-08 07:25 | 58M | |
![[ ]](/icons/layout.gif) | Autobiography of Subhas Chandra Bose -2.pdf | 2023-06-08 07:24 | 58M | |
![[ ]](/icons/layout.gif) | Religious_Nationalism_Hindus_and_Muslims_in_India_by_Peter_Van_der.pdf | 2023-06-06 04:01 | 59M | |
![[ ]](/icons/layout.gif) | 5000 years of the art of India .pdf | 2023-06-08 06:32 | 60M | |
![[ ]](/icons/layout.gif) | 4.SiddhantakaumudiVol2Part2-Samasa-SRay1910.pdf | 2023-06-08 09:54 | 61M | |
![[ ]](/icons/layout.gif) | Masterpieces_Of_Traditional_Indian_Architecture_Satish_Grover.pdf | 2023-06-19 06:04 | 61M | |
![[ ]](/icons/layout.gif) | Siva Purana - J.L.Shastri - Part 1.pdf | 2023-06-08 10:09 | 61M | |
![[ ]](/icons/layout.gif) | HistoryOfTheRiseOfTheMahomedanPowerInIndia_Volume_1.pdf | 2023-06-08 06:36 | 61M | |
![[ ]](/icons/layout.gif) | Materia_Medica_of_Ayurveda_Bhagawan_Dash_Lalitesh_Kashyap.pdf | 2023-06-08 07:24 | 61M | |
![[ ]](/icons/layout.gif) | _We_Were_Making_History_Life_Stories_of_Women_in_the_Telengana.pdf | 2023-07-04 04:30 | 62M | |
![[ ]](/icons/layout.gif) | _We_Were_Making_History___Life_Stories_of_Women_in_the_Telengana.pdf | 2023-06-19 06:04 | 62M | |
![[ ]](/icons/layout.gif) | Christian_Identity_and_Dalit_Religion_in_Hindu_India,_1868_1947.pdf | 2023-06-19 09:35 | 62M | |
![[ ]](/icons/layout.gif) | Vaiṣṇavī _ women and the worship of Krishna.pdf | 2023-06-10 04:55 | 62M | |
![[ ]](/icons/layout.gif) | Tamil Tigress -Niromi de Soyza.pdf | 2023-06-08 07:14 | 62M | |
![[ ]](/icons/layout.gif) | North India .pdf | 2023-06-08 06:32 | 63M | |
![[ ]](/icons/layout.gif) | Satyarth Prakash -Swami Dayanand Saraswati.pdf | 2023-06-08 07:26 | 63M | |
![[ ]](/icons/layout.gif) | The-Skanda-Purana-Part-2.pdf | 2023-06-08 09:46 | 63M | |
![[ ]](/icons/layout.gif) | 6.SiddhantakaumudiVol3Part2Taddhita-KrRay1934.pdf | 2023-06-08 09:55 | 64M | |
![[ ]](/icons/layout.gif) | AIDS Sutra_ Untold Stories From India.pdf | 2023-06-10 04:55 | 64M | |
![[ ]](/icons/layout.gif) | Cuba by Korda.pdf | 2023-07-04 04:18 | 64M | |
![[ ]](/icons/layout.gif) | Art and Architecture of Ancient Kashmir.pdf | 2023-06-06 04:01 | 64M | |
![[ ]](/icons/layout.gif) | Spanda Karika With Hand Written Notes - KSTS.pdf | 2023-06-08 09:27 | 65M | |
![[ ]](/icons/layout.gif) | We Become Atheists -Gora.pdf | 2023-06-08 07:27 | 65M | |
![[ ]](/icons/layout.gif) | Puranic_Encyclopaedia_A_comprehensive_dictionary_with_special_reference.pdf | 2023-06-08 07:32 | 65M | |
![[ ]](/icons/layout.gif) | Immortal Speeches -Harshvardhan Dutta.pdf | 2023-06-06 04:01 | 66M | |
![[ ]](/icons/layout.gif) | Shri Guruji -CP Bhishikar.pdf | 2023-06-19 06:04 | 66M | |
![[ ]](/icons/layout.gif) | The_story_of_Ramakrishna_Mission_Swami_Vivekanandas_vision_and_.pdf | 2023-06-08 06:32 | 67M | |
![[ ]](/icons/layout.gif) | National Geographic History June - July 2023.pdf | 2023-06-23 07:27 | 67M | |
![[ ]](/icons/layout.gif) | The Impossible Question -Jiddu Krishnamurti.pdf | 2023-07-08 07:34 | 68M | |
![[ ]](/icons/layout.gif) | Critiquing Brahmanism by K Murali.pdf | 2023-06-08 06:39 | 68M | |
![[ ]](/icons/layout.gif) | National Geographic History_June July 2023.pdf | 2023-06-10 04:16 | 68M | |
![[ ]](/icons/layout.gif) | Oppenheimer - The Years Of Risk - James W. Kunetka.pdf | 2023-07-03 07:58 | 68M | |
![[ ]](/icons/layout.gif) | The Alien Book - Nick Redfern.pdf | 2023-06-08 07:41 | 69M | |
![[ ]](/icons/layout.gif) | The_Brahui_Language_part_2.pdf | 2023-06-08 06:40 | 69M | |
![[ ]](/icons/layout.gif) | Essays in Humanism -Albert Einstein.pdf | 2023-06-15 06:16 | 69M | |
![[ ]](/icons/layout.gif) | chakradatta-telugu.pdf | 2023-06-08 09:32 | 70M | |
![[ ]](/icons/layout.gif) | The Philosophy Of Upanishads_by Paul Deussen.pdf | 2023-07-08 07:38 | 70M | |
![[ ]](/icons/layout.gif) | ENCY_CLOP_lED_lA_of_MEDICAL_AsTROLOGY.pdf | 2023-06-13 09:12 | 70M | |
![[ ]](/icons/layout.gif) | The Vibrating Universe - N C Panda.pdf | 2023-06-08 07:19 | 70M | |
![[ ]](/icons/layout.gif) | The Indian mother goddess -Narendra Nath Bhattacharyya.pdf | 2023-07-03 07:58 | 70M | |
![[ ]](/icons/layout.gif) | Meditation and other spiritual disciplines.pdf | 2023-06-15 06:16 | 70M | |
![[ ]](/icons/layout.gif) | A Few Thoughts On The Science Of The Self Or Atma Vidya.pdf | 2023-06-08 10:12 | 71M | |
![[ ]](/icons/layout.gif) | Philosophy_Of_The_Shunya_Sampadane_Vol_1_By_V_S_Kambi_English_Kumaresh.pdf | 2023-07-10 11:03 | 71M | |
![[ ]](/icons/layout.gif) | System_of_Five_Chakras_in_Kubjikamata_Tantra_Dory_Heilijgers_Seelen.pdf | 2023-06-08 09:55 | 71M | |
![[ ]](/icons/layout.gif) | 8.SiddhantakaumudiVol5AdadiToLakara-KrRay19136.pdf | 2023-06-08 09:55 | 71M | |
![[ ]](/icons/layout.gif) | Hindu festivals in a north Indian village.pdf | 2023-06-08 08:04 | 72M | |
![[ ]](/icons/layout.gif) | Ancient_India_a_History_of_its_Culture_and_Civilisation_D_D_Kosambi.pdf | 2023-06-19 06:04 | 72M | |
![[ ]](/icons/layout.gif) | THE PHILOSOPHY OF SRI NARAYANA GURU.pdf | 2023-07-10 11:04 | 72M | |
![[ ]](/icons/compressed.gif) | Books by B. R. Ambedkar.zip | 2023-06-08 06:42 | 73M | |
![[ ]](/icons/layout.gif) | Varahamihiras-Brihat-Samhitavoli-ii.pdf | 2023-06-08 09:31 | 74M | |
![[ ]](/icons/layout.gif) | Purohit-Darpana bengali-.pdf | 2023-06-08 09:37 | 74M | |
![[ ]](/icons/layout.gif) | A Handbook of Virashaivism S C Nandimath English 1942.pdf | 2023-07-10 11:02 | 75M | |
![[ ]](/icons/layout.gif) | SrimadBhagavadGitaRahasya_BgTilak_Vol2.pdf | 2023-06-08 07:23 | 75M | |
![[ ]](/icons/layout.gif) | Vayu puranam part 2.pdf | 2023-06-08 10:00 | 75M | |
![[ ]](/icons/layout.gif) | Sri_Krsna_temple_at_Udupi.pdf | 2023-06-08 07:16 | 76M | |
![[ ]](/icons/layout.gif) | National_Geographic_History_-_MayJune_2023.pdf | 2023-06-15 06:35 | 77M | |
![[ ]](/icons/layout.gif) | చాందోగ్యోపనిషత్.pdf | 2023-06-08 09:38 | 77M | |
![[ ]](/icons/layout.gif) | The_Theories_of_Error_in_Indian_Philosophy_Bijayananda_Kar.pdf | 2023-06-08 06:36 | 77M | |
![[ ]](/icons/layout.gif) | Jainism_A_Pictorial_Guide_to_the_Religion_of_Non_Violence_by_Kurt.pdf | 2023-07-04 04:31 | 77M | |
![[ ]](/icons/layout.gif) | Jainism__A_Pictorial_Guide_to_the_Religion_of_Non_Violence_by_Kurt.pdf | 2023-06-06 04:01 | 77M | |
![[ ]](/icons/layout.gif) | Seven_Works_of_Vasubandhu_Transl_Stefan_Anacker_First_Edition_1984.pdf | 2023-07-05 07:48 | 78M | |
![[ ]](/icons/layout.gif) | Seven_Works_of_Vasubandhu_Transl_Stefan_Anacker_First_Edition__1984.pdf | 2023-06-06 04:02 | 78M | |
![[ ]](/icons/layout.gif) | Studies_in_South_Indian_Architecture_Kerela_andTamil_Nadu_Srinivas.pdf | 2023-06-08 09:17 | 78M | |
![[ ]](/icons/layout.gif) | Śiva The Erotic Ascetic -Wendy Doniger.pdf | 2023-06-19 06:04 | 78M | |
![[ ]](/icons/layout.gif) | Dark Tourism -#The Traveller's Guide.pdf | 2023-06-15 06:36 | 79M | |
![[ ]](/icons/layout.gif) | Encyclopaedia_of_Indian_cinema_Book_by_Ashish_Rajadhyaksha_Published.pdf | 2023-06-08 06:36 | 83M | |
![[ ]](/icons/layout.gif) | Ramayana.pdf | 2023-06-08 09:46 | 83M | |
![[ ]](/icons/layout.gif) | Indian Alchemy Or Rasayana By S. Mahdihassan.pdf | 2023-06-08 06:38 | 84M | |
![[ ]](/icons/layout.gif) | God Is Not For Sale -Bhagwan Shree Rajneesh.pdf | 2023-06-23 07:30 | 85M | |
![[ ]](/icons/layout.gif) | Retelling_the_Ramayana__Voices_from_Kerala_by_C_N_Sreekantan_Nair.pdf | 2023-06-15 06:42 | 85M | |
![[ ]](/icons/layout.gif) | Chains_of_Servitude_Bondage_&_Slavery_in_India_by_Utsa_Patnaik.pdf | 2023-07-04 04:18 | 85M | |
![[ ]](/icons/layout.gif) | Chains_of_Servitude__Bondage_&_Slavery_in_India_by_Utsa_Patnaik.pdf | 2023-06-10 04:55 | 85M | |
![[ ]](/icons/layout.gif) | భగవద్గీత - ఆర్యసమాజ్.pdf | 2023-06-08 09:28 | 86M | |
![[ ]](/icons/layout.gif) | MN Roy -A Political Biography.pdf | 2023-06-08 06:32 | 86M | |
![[ ]](/icons/layout.gif) | Siva Purana - J.L.Shastri - Part 2.pdf | 2023-06-08 10:09 | 86M | |
![[ ]](/icons/layout.gif) | lakshmi-tantra_compress.pdf | 2023-06-08 09:39 | 87M | |
![[ ]](/icons/layout.gif) | Santarasa_and_Abhinavagupta_s_Philosophy_Of_Aestheics_Masson_and.pdf | 2023-06-08 06:36 | 89M | |
![[ ]](/icons/layout.gif) | The Colas by K.A. Nilakanta Sastri.pdf | 2023-06-08 07:25 | 91M | |
![[ ]](/icons/layout.gif) | Malini_Vijayottara_Tantra_Eng_Translation_1956_Vishnu_Datt_Shastri.pdf | 2023-06-08 09:28 | 93M | |
![[ ]](/icons/layout.gif) | Hindu_Shrines_of_Kashmir_by_R_L_Bhat_Pandit_Prem_Nath_Bhat_Memorial.pdf | 2023-06-08 06:35 | 94M | |
![[ ]](/icons/layout.gif) | 9.SiddhantakaumudiVol6KridantaVaidika-KrRay1936.pdf | 2023-06-08 09:54 | 94M | |
![[ ]](/icons/layout.gif) | Early Cola Architecture & Sculpture -Douglas Barrett.pdf | 2023-06-19 06:04 | 95M | |
![[ ]](/icons/layout.gif) | Tantric_Texts_Series_01_Tantrabhidhana_Panchanana_Bhattacharya_1937Hr.pdf | 2023-06-08 10:09 | 95M | |
![[ ]](/icons/layout.gif) | Raj_Yoga_Sutras_of_Maharishi_Patanjali_Explained_by_Swami_Jyotir.pdf | 2023-06-08 08:01 | 99M | |
![[ ]](/icons/layout.gif) | A Grammar of the Prakrit Language by D.C. Sircar.pdf | 2023-07-04 04:24 | 100M | |
![[ ]](/icons/layout.gif) | Science & Philosophy - MN Roy.pdf | 2023-06-15 06:16 | 101M | |
![[ ]](/icons/layout.gif) | India.pdf | 2023-07-04 04:23 | 102M | |
![[ ]](/icons/layout.gif) | India123.pdf | 2023-06-08 06:31 | 102M | |
![[ ]](/icons/layout.gif) | The Complete Illustrated Kama Sutra.pdf | 2023-07-08 07:38 | 102M | |
![[ ]](/icons/compressed.gif) | Aryabhatiya-with-English-commentary.zip | 2023-06-08 07:55 | 103M | |
![[ ]](/icons/layout.gif) | Self_Knowledge_Adi_Shankaracharya_Treatise_on_Non_Dualism_By_Yogananda.pdf | 2023-06-08 07:15 | 107M | |
![[ ]](/icons/layout.gif) | The Life Of Krishna In Indian Art by P. Banerjee.pdf | 2023-06-08 06:37 | 107M | |
![[ ]](/icons/layout.gif) | TheBhamatiCatussutriBySSSuryanarayanaSastriAndCKunhanRaja.pdf | 2023-06-08 09:38 | 110M | |
![[ ]](/icons/layout.gif) | Who_is_the_Supreme_God_Visnu_or_Siva.pdf | 2023-06-08 07:27 | 110M | |
![[ ]](/icons/layout.gif) | A Search in Secret India _ Paul Brunton.pdf | 2023-07-04 04:24 | 111M | |
![[ ]](/icons/layout.gif) | Basavarajeeyam.pdf | 2023-06-08 09:30 | 111M | |
![[ ]](/icons/layout.gif) | Critical Essays On Purva Mimamsa.pdf | 2023-06-08 07:16 | 114M | |
![[ ]](/icons/layout.gif) | God -The Brief History by John Bowker.pdf | 2023-06-10 04:55 | 121M | |
![[ ]](/icons/layout.gif) | Uchalya -Laxman Gaikwad.pdf | 2023-06-24 06:19 | 122M | |
![[ ]](/icons/layout.gif) | The_Art_Of_India_Through_the_Ages_Stella_Kramrisch.pdf | 2023-06-08 06:42 | 123M | |
![[ ]](/icons/layout.gif) | The_Secret_Of_Karma_Yoga_Jayadayal_Goyandka.pdf | 2023-06-08 06:41 | 123M | |
![[ ]](/icons/layout.gif) | Kumbha_India_s_Ageless_Festival_By_Dilip_Kumar_Roy_And_Indira_Devi.pdf | 2023-06-08 06:40 | 123M | |
![[ ]](/icons/layout.gif) | Rigveda_The_Rise_of_Aryan_Power_Brij_B._Nigam.pdf | 2023-06-08 06:36 | 123M | |
![[ ]](/icons/layout.gif) | Power,_Memory,_Architecture_Contested_Sites_on_India's_Deccan_Plateau.pdf | 2023-07-04 04:10 | 124M | |
![[ ]](/icons/layout.gif) | Power,_Memory,_Architecture__Contested_Sites_on_India's_Deccan_Plateau.pdf | 2023-06-19 06:04 | 124M | |
![[ ]](/icons/layout.gif) | The_Yoga_of_Kashmir_Shaivism_Swami_Shankarananda.pdf | 2023-06-08 07:27 | 125M | |
![[ ]](/icons/layout.gif) | Indian_Philosophical_Sysytems_by_S_M_S_Chari_Munshiram_Manoharlal.pdf | 2023-06-08 06:36 | 125M | |
![[ ]](/icons/layout.gif) | Advaita_And_Visistadvaita_S.M._Srinivasachari.pdf | 2023-06-08 07:15 | 127M | |
![[ ]](/icons/layout.gif) | The Discovery of India -Jawaharlal Nehru.pdf | 2023-07-08 07:39 | 131M | |
![[ ]](/icons/layout.gif) | _Hanumān_in_the_Rāmāyaṇa_of_Vālmīki_and_the_Rāmacaritamānasa.pdf | 2023-06-06 04:02 | 133M | |
![[ ]](/icons/layout.gif) | World_Vedic_Heritage_A_History_of_Histories_By_P.N._Oak.pdf | 2023-06-08 07:22 | 136M | |
![[ ]](/icons/layout.gif) | Sangiti Sabda Kosa -Bimal Roy.pdf | 2023-06-08 07:20 | 136M | |
![[ ]](/icons/layout.gif) | Bhagavad_Gita_with_Hindi_and_English_Translation_Gita_Press.pdf | 2023-07-04 04:19 | 147M | |
![[ ]](/icons/layout.gif) | Krishna_The_Man_and_His_Philosophy_by_Bhagawan_Shree_Rajneesh.pdf | 2023-07-04 04:31 | 147M | |
![[ ]](/icons/layout.gif) | Krishna__The_Man_and_His_Philosophy_by_Bhagawan_Shree_Rajneesh.pdf | 2023-06-19 06:04 | 147M | |
![[ ]](/icons/layout.gif) | 108-upanishads-with-upanishad-brahmam-commentary.pdf | 2023-06-08 09:53 | 148M | |
![[ ]](/icons/layout.gif) | All About History - Roman Republic, 3rd Edition, 2023.pdf | 2023-06-06 04:00 | 153M | |
![[ ]](/icons/layout.gif) | Life and Thought of Shankaracharya - Govind Chandra Pande.pdf | 2023-06-08 06:40 | 153M | |
![[ ]](/icons/layout.gif) | History's Weirdest Mysteries #1st Edition 2023.pdf | 2023-06-23 07:26 | 155M | |
![[ ]](/icons/layout.gif) | Garuda Puranam Sanskrit-English.pdf | 2023-06-08 09:22 | 155M | |
![[ ]](/icons/layout.gif) | A_History_Of_Early_Vedanta_Philosophy_Hajime_Nakamura.pdf | 2023-06-08 07:22 | 161M | |
![[ ]](/icons/layout.gif) | _The_Hindu_Temple_An_Introduction_to_Its_Meaning_and_Forms_George.pdf | 2023-06-16 04:57 | 162M | |
![[ ]](/icons/layout.gif) | BBC Science Focus – July 2023.pdf | 2023-07-05 09:44 | 166M | |
![[ ]](/icons/layout.gif) | India Mortgaged -Nagireddy Tarimela.pdf | 2023-06-08 06:35 | 167M | |
![[ ]](/icons/layout.gif) | History of indian and eastern architecture very rare book.pdf | 2023-06-08 09:18 | 168M | |
![[ ]](/icons/layout.gif) | Burning For Freedom -VD Savarkar.pdf | 2023-06-08 06:32 | 168M | |
![[ ]](/icons/layout.gif) | Astanga-hrdayam. Eng.pdf | 2023-06-08 09:32 | 170M | |
![[ ]](/icons/layout.gif) | Astanga Hrdayam -Dr Vidyanath.pdf | 2023-06-08 07:22 | 170M | |
![[ ]](/icons/layout.gif) | Encyclopedia_Of_Indian_Erotics_By_Ram_Kumar_Rai_Prachya_Prakashan.pdf | 2023-06-08 06:42 | 172M | |
![[ ]](/icons/layout.gif) | Rasavaisheshik Sutra with Narasimha Bhashya.pdf | 2023-06-08 09:50 | 184M | |
![[ ]](/icons/layout.gif) | Shotokan’s_Secret_The_Hidden_Truth_Behind_Karate’s_Fighting_Origins.pdf | 2023-06-08 07:55 | 186M | |
![[ ]](/icons/layout.gif) | The BIBLE -Ebrew and Greeke.pdf | 2023-06-08 07:30 | 190M | |
![[ ]](/icons/layout.gif) | CaveTemples.pdf | 2023-06-08 07:31 | 192M | |
![[ ]](/icons/layout.gif) | HongKongTatler_.pdf | 2023-07-05 09:45 | 197M | |
![[ ]](/icons/layout.gif) | Ramayana - The Poisonous Tree - Ranganayakamma.pdf | 2023-06-06 04:01 | 219M | |
![[ ]](/icons/layout.gif) | Vedic_Mathematics_for_All_Ages_Vandana_Singhal.pdf | 2023-06-08 07:27 | 220M | |
![[ ]](/icons/layout.gif) | Tara_The_Supreme_Goddess_By_Prof_Pushpendra_Kumar_And_Dr_R_K_Sharma.pdf | 2023-06-08 06:41 | 225M | |
![[ ]](/icons/layout.gif) | AboutHistoryBookazine.pdf | 2023-06-02 07:59 | 228M | |
![[ ]](/icons/layout.gif) | History of Paganism – 5th Edition 2023.pdf | 2023-06-20 03:48 | 229M | |
![[ ]](/icons/layout.gif) | The Art of India - Calambur Sivaramamurti.pdf | 2023-06-08 06:35 | 232M | |
![[ ]](/icons/layout.gif) | 2023-06-01 101 Tempat Kena Melawat Sebelum Mati.pdf | 2023-06-06 03:58 | 235M | |
![[ ]](/icons/layout.gif) | Encyclopedia_Of_Yoga_By_Ram_Kumar_Rai_Indological_Reference_Series.pdf | 2023-06-08 06:41 | 237M | |
![[ ]](/icons/layout.gif) | Autobiography of A Yogi by Paramahansa Yogananda.pdf | 2023-07-10 11:03 | 260M | |
![[ ]](/icons/layout.gif) | A_History_Of_Sufism_In_India_Vol_One_Saiyid_Athar_Abbas_Rizvi.pdf | 2023-06-08 07:28 | 261M | |
![[ ]](/icons/layout.gif) | 437676594_Mahakala_Samhita_Guhya_Kali_Khanda_Part_I_Dr_Kishor_Nath.pdf | 2023-06-08 09:38 | 266M | |
![[ ]](/icons/layout.gif) | Techlife News July 1st 2023.pdf | 2023-07-05 09:44 | 270M | |
![[ ]](/icons/layout.gif) | Folk_Lore_of_North_India_Vol_1.pdf | 2023-06-08 07:43 | 277M | |
![[ ]](/icons/layout.gif) | The_Art_Of_Khajuraho_By_R_Nath_1980_New_Delhi_Abhinav_Publications.pdf | 2023-06-08 06:42 | 291M | |
![[ ]](/icons/layout.gif) | Yogavasistha Telugu Translation book 1 of 8.pdf | 2023-06-08 09:37 | 292M | |
![[ ]](/icons/layout.gif) | Lokayata_A_Study_in_Ancient_Indian_Materialism_Debiprasad_Chattopadhyaya.pdf | 2023-06-08 07:30 | 381M | |
![[ ]](/icons/layout.gif) | The_Revival_of_Buddhist_Piligrimage_at_Bodh_Gaya_1811_1949_Alan.pdf | 2023-06-08 07:28 | 406M | |
![[ ]](/icons/layout.gif) | Science & Soceity -Jawaharlal Nehru.pdf | 2023-06-08 07:16 | 407M | |
![[ ]](/icons/layout.gif) | Early_Buddhism_and_the_Bhagavad_Gita_Kashi_Nath_Upadhyaya.pdf | 2023-06-08 06:43 | 436M | |
![[ ]](/icons/layout.gif) | Vedic Mathematics -Bharati Krsna.pdf | 2023-06-08 06:41 | 620M | |
![[ ]](/icons/layout.gif) | The Indian War of Independence of 1857_By VEER SAVARKAR.pdf | 2023-06-08 07:36 | 637M | |
![[ ]](/icons/layout.gif) | The Essential Vedanta - Eliot Deutsch and Rohit Dalvi.pdf | 2023-06-08 07:24 | 770M | |
![[ ]](/icons/layout.gif) | Encyclopaedia of Indian Temple Architecture, II (pt. 1).pdf | 2023-06-08 07:26 | 869M | |
|