![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 📚 GATE For Electrical Engineering.pdf | 2023-11-02 09:18 | 27M | |
| 1. Types of Structures & Loads.pdf | 2023-11-03 09:28 | 1.0M | |
| 2. Analysis of Statically Determinate Structures.pdf | 2023-11-03 09:28 | 3.5M | |
| 3. Analysis of Statically Determinate Trusses.pdf | 2023-11-03 09:28 | 3.8M | |
| AGGREGATES✔__.pdf | 2023-11-06 07:26 | 1.3M | |
| ARCH BRIDGE ANALYSIS__.pdf | 2023-11-06 07:22 | 1.7M | |
| All About Beams __.pdf | 2023-11-06 07:21 | 1.7M | |
| All About Stones __.pdf | 2023-11-06 07:21 | 2.1M | |
| Axially Loaded Columns__.pdf | 2023-11-03 09:29 | 1.7M | |
| CABLE BOWSTRING BRIDGE__.pdf | 2023-11-03 09:29 | 1.5M | |
| CANTILEVER BRIDGE PIER & FLYOVER__.pdf | 2023-11-03 09:29 | 767K | |
| CIV_QP.pdf | 2023-11-03 06:26 | 3.9M | |
| COMPOSITION OF SOIL TERMINOLOGY AND DEFINITIONS__ (1).pdf | 2023-11-06 07:22 | 6.5M | |
| CURVE ROOF WITH DIAGONAL TIE ROD__ (1).pdf | 2023-11-03 09:29 | 1.5M | |
| Calculate Volume of Trapezoidal Footing__.pdf | 2023-11-03 09:29 | 919K | |
| California Bearing Ratio Test (CBR) ✔__.pdf | 2023-11-06 07:26 | 834K | |
| Civil Engineering.pdf | 2023-11-03 06:26 | 4.3M | |
| Civil Engineering 3rd Aug 2021 Shift2_800894114.pdf | 2023-11-03 06:26 | 5.0M | |
| Civil Engineering 9th May 2018 Shift 1.pdf | 2023-11-03 06:26 | 11M | |
| Civil Engineering 31st Aug 2020 Shift 2.pdf | 2023-11-03 06:26 | 11M | |
| Civil R-2017 Notes Link Collection.pdf | 2023-11-02 09:17 | 376K | |
| Civil objective by rs khurmi.pdf | 2023-11-02 09:17 | 267M | |
| Compaction of Soil__.pdf | 2023-11-06 07:22 | 1.6M | |
| Composite Construction.pdf | 2023-11-06 07:26 | 828K | |
| Confined masonry ✔✔__.pdf | 2023-11-06 07:22 | 565K | |
| Curing of concrete__.pdf | 2023-11-06 07:22 | 644K | |
| Cutting Length of Stirrups__.pdf | 2023-11-06 07:26 | 881K | |
| DESIGN OF PILED JETTIES.pdf | 2023-11-06 07:26 | 1.5M | |
| DURABILITY OF CONCRETE__.pdf | 2023-11-03 09:29 | 2.0M | |
| Design of Raft Foundations ✔✔__.pdf | 2023-11-06 07:26 | 644K | |
| Different Types Of Brick Cut__.pdf | 2023-11-06 07:22 | 1.2M | |
| Estimation & Costing__.pdf | 2023-11-06 07:26 | 5.0M | |
| GRAVITY ANCHOR BLOCK- SLAB__.pdf | 2023-11-03 09:29 | 1.8M | |
| Geo Technology__ (1).pdf | 2023-11-06 07:26 | 5.3M | |
| GoodHousekeepingUSANovemberDecember2023.pdf | 2023-11-05 05:45 | 160M | |
| HELICAL & TWISTED RAMPS__.pdf | 2023-11-06 07:21 | 1.1M | |
| Highway Engineering Vertical Curves__.pdf | 2023-11-06 07:22 | 1.7M | |
| How the orientation of column is decided__ .pdf | 2023-11-03 09:29 | 804K | |
| INCLINED_CABLE_🌐Civil_Engg_Free_Tutorials👇_🌐Linktr_ee_TsOnlineAcademy.pdf | 2023-11-03 09:29 | 918K | |
| Installation of footing reinforcement__.pdf | 2023-11-06 07:21 | 487K | |
| LAND SURVEYING__.pdf | 2023-11-03 09:29 | 1.3M | |
| Mcgraw_Hill_Series_in_Civil_Engineering.pdf | 2023-11-02 09:16 | 47M | |
| Origin of soil___.pdf | 2023-11-06 07:22 | 1.1M | |
| Plinth Beam__.pdf | 2023-11-06 07:26 | 1.3M | |
| Plum Concrete✓✓__.pdf | 2023-11-03 09:29 | 757K | |
| Quantity of Cement, Sand & Aggregate.pdf | 2023-11-06 07:26 | 1.0M | |
| RAKER PILE GROUP __.pdf | 2023-11-03 09:29 | 910K | |
| RCC STAIR DESIGN__.pdf | 2023-11-06 07:22 | 1.6M | |
| REACTION AT PIER LEG & FOOTING__.pdf | 2023-11-03 09:29 | 1.1M | |
| RIGIT STRUCTURAL FRAME__.pdf | 2023-11-03 09:29 | 1.8M | |
| Reinforcement Learning (en).pdf | 2023-11-03 03:43 | 11M | |
| Reinforcement_Learning_An_Introduction,_2nd_Edition_by_Richard_S.pdf | 2023-11-03 03:41 | 7.5M | |
| Retaining Wall Design__.pdf | 2023-11-06 07:22 | 1.5M | |
| S.S. Bhavikatti Basic Civil Engineering.pdf | 2023-11-11 07:19 | 3.4M | |
| STRUCTURE THEORY FOR PARABOLA ARCH__.pdf | 2023-11-06 07:21 | 689K | |
| STRUCTURE_MECHANIC_FOR_FREE_STANDING_STAIRS_🌐Civil_Engg_Free_Tutorials👇.pdf | 2023-11-06 07:26 | 1.2M | |
| SUSPENSION PEDESTRIAN ARCH BRIDGE.pdf | 2023-11-06 07:26 | 1.0M | |
| Screw Water Irrigation Method.__.pdf | 2023-11-06 07:22 | 1.4M | |
| Septic Tank Design and Build__.pdf | 2023-11-06 07:22 | 1.3M | |
| Swimming Pool Design information , __.pdf | 2023-11-06 07:21 | 1.8M | |
| TES - Note.pdf | 2023-11-02 09:22 | 54M | |
| TESTS ON SOIL__.pdf | 2023-11-06 07:21 | 1.9M | |
| TRUSS OR BRACE COLUMN__.pdf | 2023-11-03 09:29 | 1.7M | |
| TYPES OF FOOTING✔✔__.pdf | 2023-11-03 09:29 | 686K | |
| Types of Concrete and Concrete Blocks.__.pdf | 2023-11-06 07:22 | 2.0M | |
| Types of Soil Lab Tests ✔ ✔__.pdf | 2023-11-06 07:22 | 1.2M | |
| WATER & ADMIXTURE__.pdf | 2023-11-03 09:29 | 1.7M | |
| Water - Cement Ratio__.pdf | 2023-11-03 09:29 | 737K | |
| concise-hydrology.pdf | 2023-11-02 09:23 | 5.8M | |
| filling.pdf | 2023-11-06 06:45 | 173K | |
|
|---|