![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | zseano's methodology.pdf | 2023-11-02 05:03 | 3.3M | |
![[ ]](/icons/layout.gif) | wxPython in Action (2006).pdf | 2023-11-02 05:11 | 13M | |
![[ ]](/icons/layout.gif) | will-ballard-hands-on-deep-learning-for-images-with-2018.pdf | 2023-11-02 11:15 | 5.7M | |
![[ ]](/icons/layout.gif) | web-design-with-html-and-css-digital-classroom.pdf | 2023-10-31 06:52 | 24M | |
![[ ]](/icons/layout.gif) | wang_xiaofei_et_al_edge_ai_convergence_of_edge_computing_and.pdf | 2023-11-02 10:47 | 4.7M | |
![[ ]](/icons/layout.gif) | wang_xiaofei_et_al_edge_ai_convergence_of_edge_computing_and (2).pdf | 2023-11-02 10:47 | 4.7M | |
![[ ]](/icons/layout.gif) | vm-paging.pdf | 2023-11-02 05:26 | 118K | |
![[ ]](/icons/layout.gif) | vadim-dabravolski-accelerate-deep-learning-workloads.pdf | 2023-11-20 04:04 | 7.5M | |
![[ ]](/icons/layout.gif) | umer-saiyed-person-identification-using-fusion-of-iris-2019.pdf | 2023-11-02 10:53 | 5.4M | |
![[ ]](/icons/layout.gif) | thinkjava.pdf | 2023-11-02 05:30 | 1.3M | |
![[ ]](/icons/compressed.gif) | thinkcspy3.zip | 2023-11-02 05:30 | 7.9M | |
![[ ]](/icons/layout.gif) | the_c_programming_language_2.pdf | 2023-11-02 05:30 | 23M | |
![[ ]](/icons/layout.gif) | sunila-gollapudi-learn-computer-vision-using-opencv-2019.pdf | 2023-11-02 11:15 | 6.2M | |
![[ ]](/icons/layout.gif) | sun-xudong-face-detection-using-deep-learning-an-2018.pdf | 2023-11-02 10:53 | 5.8M | |
![[ ]](/icons/layout.gif) | structured-programming-with-c-plus-plus.pdf | 2023-11-02 05:01 | 2.5M | |
![[ ]](/icons/compressed.gif) | stl.zip | 2023-11-02 05:16 | 217K | |
![[ ]](/icons/tar.gif) | stl.tar | 2023-11-02 05:16 | 1.2M | |
![[ ]](/icons/layout.gif) | sridhar-alla-suman-kalyan-adari-beginning-anomaly-2019.pdf | 2023-11-02 11:14 | 27M | |
![[ ]](/icons/layout.gif) | spring4shell.pdf | 2023-11-02 05:01 | 2.0M | |
![[ ]](/icons/layout.gif) | spring-framework-reference.pdf | 2023-11-02 05:13 | 5.3M | |
![[ ]](/icons/layout.gif) | servlet-4_0_EDR_draft.pdf | 2023-11-02 05:32 | 1.5M | |
![[ ]](/icons/layout.gif) | servlet-3_1-final.pdf | 2023-11-02 05:32 | 1.5M | |
![[ ]](/icons/layout.gif) | securebasebook.pdf | 2023-10-31 06:56 | 3.8M | |
![[ ]](/icons/unknown.gif) | sams-teach-yourself-java-21-days-8th.rar | 2023-10-31 06:55 | 96M | |
![[ ]](/icons/unknown.gif) | sams-samsteachyourselfphpmysqlandapachein24hours.chm | 2023-11-02 05:21 | 3.3M | |
![[ ]](/icons/layout.gif) | sagheer-alaa-unsupervised-pre-training-of-a-deep-lstm-2019.pdf | 2023-11-02 10:53 | 2.1M | |
![[ ]](/icons/layout.gif) | real-nextjs-scalable-performance.pdf | 2023-10-31 06:53 | 8.9M | |
![[ ]](/icons/layout.gif) | pygtk2-tut.pdf | 2023-11-02 05:25 | 3.5M | |
![[ ]](/icons/layout.gif) | py.pdf | 2023-11-02 04:59 | 776K | |
![[ ]](/icons/unknown.gif) | prenticehallptr-corephpprogrammingthirdedition.chm | 2023-11-02 04:32 | 1.5M | |
![[ ]](/icons/unknown.gif) | premierpress-php.mysqlprogrammingfortheabsolutebeginner.chm | 2023-11-02 04:33 | 7.0M | |
![[ ]](/icons/layout.gif) | practicalmachinelearningwithh2o_1ed.pdf | 2023-11-02 05:14 | 9.3M | |
![[ ]](/icons/layout.gif) | practical-binary-analysis.pdf | 2023-11-02 05:03 | 16M | |
![[ ]](/icons/layout.gif) | pointers.pdf | 2023-11-02 04:34 | 184K | |
![[ ]](/icons/layout.gif) | phparchitects_Guide_To_PHP_Design.pdf | 2023-11-02 04:34 | 3.3M | |
![[ ]](/icons/layout.gif) | php_tutorial.pdf | 2023-11-02 05:36 | 1.6M | |
![[ ]](/icons/layout.gif) | php_architect_s_Guide_to_Programming_with_Zend_Framework.pdf | 2023-11-02 05:20 | 5.4M | |
![[ ]](/icons/layout.gif) | php-mysql-javascript-html5-all-in-one-for-dummies.pdf | 2023-10-31 06:52 | 14M | |
![[ ]](/icons/layout.gif) | php-and-mysql-web-development-5th-edition (2).pdf | 2023-11-02 05:14 | 8.0M | |
![[IMG]](/icons/image2.gif) | photo_2023-11-02_10-40-00.jpg | 2023-11-02 05:10 | 70K | |
![[IMG]](/icons/image2.gif) | photo_2023-11-02_10-20-28.jpg | 2023-11-02 04:50 | 118K | |
![[IMG]](/icons/image2.gif) | photo_2023-10-30_23-47-07.jpg | 2023-11-02 03:44 | 124K | |
![[IMG]](/icons/image2.gif) | photo_2023-09-08_11-36-47.jpg | 2023-11-02 03:46 | 96K | |
![[IMG]](/icons/image2.gif) | photo_2023-09-08_11-36-39.jpg | 2023-11-02 03:46 | 102K | |
![[IMG]](/icons/image2.gif) | photo_2023-08-09_20-18-27.jpg | 2023-11-02 03:47 | 132K | |
![[IMG]](/icons/image2.gif) | photo_2020-09-28_10-43-13.jpg | 2023-11-22 03:40 | 163K | |
![[ ]](/icons/layout.gif) | palash-goyal-sumit-pandey-deep-learning-for-natural-2018.pdf | 2023-11-02 11:14 | 7.3M | |
![[ ]](/icons/unknown.gif) | oreilly-webdatabaseapplicationswithphpmysqlsecondedition.chm | 2023-11-02 04:35 | 2.6M | |
![[ ]](/icons/layout.gif) | ocp.pdf | 2023-11-02 04:35 | 69K | |
![[ ]](/icons/layout.gif) | naturallanguageannotationformachinelearning.pdf | 2023-11-02 05:12 | 9.5M | |
![[ ]](/icons/layout.gif) | moon-gwiyeong-deep-learning-approach-for-enhanced-2019.pdf | 2023-11-02 11:14 | 3.4M | |
![[ ]](/icons/layout.gif) | matlab_prog.pdf | 2023-11-03 06:29 | 10M | |
![[ ]](/icons/layout.gif) | machinelearningischangingtherules_1ed.pdf | 2023-11-02 05:13 | 14M | |
![[ ]](/icons/layout.gif) | machinelearningforhackers.pdf | 2023-11-02 05:13 | 23M | |
![[ ]](/icons/layout.gif) | machinelearningandsecurity.pdf | 2023-11-02 05:13 | 13M | |
![[ ]](/icons/layout.gif) | letusc-yashwantkanetkar.pdf | 2023-11-03 06:45 | 7.2M | |
![[ ]](/icons/layout.gif) | lect40-engin112.pdf | 2023-11-02 05:04 | 687K | |
![[ ]](/icons/layout.gif) | learningtensorflow_1ed.pdf | 2023-11-02 05:13 | 13M | |
![[ ]](/icons/layout.gif) | learningopencv.pdf | 2023-11-02 05:13 | 42M | |
![[ ]](/icons/layout.gif) | learneverythingai .pdf | 2023-10-26 08:21 | 3.4M | |
![[ ]](/icons/layout.gif) | learneverythingai -1.pdf | 2023-11-03 04:36 | 738K | |
![[ ]](/icons/layout.gif) | learn-web-development-python-hands.pdf | 2023-11-03 03:33 | 15M | |
![[ ]](/icons/layout.gif) | kang-min-joo-intrusion-detection-system-using-deep-2016.pdf | 2023-11-02 10:53 | 4.0M | |
![[ ]](/icons/layout.gif) | joyseeree-ranveer-fusing-learned-representations-from-2019.pdf | 2023-11-02 10:53 | 6.1M | |
![[ ]](/icons/layout.gif) | johnwileysons-mysql_phpdatabaseapplicationssecondedition (2).pdf | 2023-11-02 05:20 | 5.5M | |
![[ ]](/icons/layout.gif) | jdbc4.2-fr-spec.pdf | 2023-11-02 04:38 | 960K | |
![[ ]](/icons/layout.gif) | javascript_tutorial.pdf | 2023-11-02 05:03 | 1.0M | |
![[ ]](/icons/layout.gif) | java_tutorial.pdf | 2023-11-02 05:03 | 1.0M | |
![[ ]](/icons/layout.gif) | java_tutorial (2).pdf | 2023-11-02 05:36 | 4.3M | |
![[ ]](/icons/layout.gif) | java_basic_operators.pdf | 2023-11-02 05:03 | 71K | |
![[ ]](/icons/compressed.gif) | java-puzzlers example source code.zip | 2023-11-02 04:39 | 60K | |
![[ ]](/icons/unknown.gif) | java-precisely-3rd.rar | 2023-10-31 06:54 | 10M | |
![[ ]](/icons/layout.gif) | java-operators-and-controls.pdf | 2023-11-02 05:03 | 141K | |
![[ ]](/icons/layout.gif) | ivan-vasilev-python-deep-learning-exploring-deep-2019.pdf | 2023-11-02 11:15 | 24M | |
![[ ]](/icons/layout.gif) | introductiontomachinelearningwithr.pdf | 2023-11-02 05:12 | 5.1M | |
![[ ]](/icons/layout.gif) | introductiontomachinelearningwithpython.pdf | 2023-11-02 05:13 | 30M | |
![[ ]](/icons/layout.gif) | introduction_to_computer_note.pdf | 2023-11-02 05:03 | 891K | |
![[ ]](/icons/layout.gif) | introduction-to-automata-theory--languages--and-computation.pdf | 2023-11-02 04:41 | 57M | |
![[ ]](/icons/unknown.gif) | introduction-java-programming-structures-12th.rar | 2023-10-31 06:55 | 30M | |
![[ ]](/icons/layout.gif) | introducing-data-science-machine-learning-python.pdf | 2023-11-01 10:51 | 15M | |
![[ ]](/icons/layout.gif) | hibernate_search_reference (2).pdf | 2023-11-02 05:14 | 1.6M | |
![[ ]](/icons/layout.gif) | hibernate_reference 3.6.10 (2).pdf | 2023-11-02 05:14 | 2.1M | |
![[ ]](/icons/layout.gif) | hack_from_linux.pdf | 2023-11-02 04:42 | 41K | |
![[ ]](/icons/layout.gif) | guo-wei-deep-learning-scene-recognition-method-based-2018.pdf | 2023-11-02 10:53 | 8.6M | |
![[ ]](/icons/layout.gif) | guide.pdf | 2023-11-02 05:00 | 126K | |
![[ ]](/icons/layout.gif) | functional-programming-python.pdf | 2023-11-02 04:43 | 1.6M | |
![[ ]](/icons/layout.gif) | featureengineeringformachinelearning_1ed.pdf | 2023-11-02 05:14 | 17M | |
![[ ]](/icons/layout.gif) | eyal-wirsansky-hands-on-genetic-algorithms-with-python-2020.pdf | 2023-11-02 11:14 | 9.0M | |
![[ ]](/icons/layout.gif) | elements-of-programming-interviews-adnan-aziz in java.pdf | 2023-11-02 05:12 | 10M | |
![[ ]](/icons/layout.gif) | efficient_proceeding_of_dnn.pdf | 2023-11-02 10:51 | 20M | |
![[ ]](/icons/unknown.gif) | effective-kafka-examples-java.rar | 2023-10-31 06:55 | 14M | |
![[ ]](/icons/layout.gif) | doc_2023-11-02_10-30-22.net.pdf | 2023-11-02 05:00 | 751K | |
![[ ]](/icons/layout.gif) | diveintopython.pdf | 2023-11-02 04:44 | 1.2M | |
![[ ]](/icons/layout.gif) | develop-companys-first-security-baseline-standard_170.pdf | 2023-10-31 06:56 | 153K | |
![[ ]](/icons/layout.gif) | deeplearning.pdf | 2023-11-02 05:14 | 20M | |
![[ ]](/icons/layout.gif) | dax_functions_tutorial.pdf | 2023-10-31 06:56 | 944K | |
![[ ]](/icons/layout.gif) | data communications and networking - behrouz a forouzan.pdf | 2023-11-02 04:47 | 11M | |
![[ ]](/icons/unknown.gif) | data-structures-program-design-using-java.rar | 2023-10-31 06:55 | 160M | |
![[ ]](/icons/layout.gif) | cracking-coding-interview-6th-programming.pdf | 2023-11-02 04:48 | 54M | |
![[ ]](/icons/layout.gif) | cpp_tutorial.pdf | 2023-11-02 05:36 | 1.8M | |
![[ ]](/icons/unknown.gif) | computer-graphics-programming-opengl-java-2nd.rar | 2023-10-31 06:55 | 80M | |
![[ ]](/icons/layout.gif) | cloudservicesguidelines.pdf | 2023-10-31 06:56 | 198K | |
![[ ]](/icons/layout.gif) | chris-albon-machine-learning-with-python-cookbook-2018.pdf | 2023-11-02 11:15 | 4.6M | |
![[ ]](/icons/layout.gif) | cheat3.pdf | 2023-11-02 05:32 | 242K | |
![[ ]](/icons/layout.gif) | camel_in_action.pdf | 2023-11-05 05:44 | 2.2M | |
![[ ]](/icons/layout.gif) | c# in 7 days.pdf | 2023-11-02 05:00 | 16M | |
![[ ]](/icons/layout.gif) | c# cheat sheet.pdf | 2023-11-02 05:00 | 567K | |
![[ ]](/icons/layout.gif) | c# 4.0 in a nutshell 4th edition (2).pdf | 2023-11-02 05:15 | 6.7M | |
![[ ]](/icons/layout.gif) | c#.pdf | 2023-11-02 05:00 | 111K | |
![[ ]](/icons/layout.gif) | bigdata.pdf | 2023-11-02 05:00 | 4.2M | |
![[ ]](/icons/layout.gif) | bb-Data Structures and Algorithms with Python.pdf | 2023-11-02 04:50 | 13M | |
![[ ]](/icons/layout.gif) | basics_of_compiler_design.pdf | 2023-11-02 04:50 | 1.6M | |
![[ ]](/icons/layout.gif) | bash_Idioms_Write_Powerful__Flexible__Readable_Shell_Scripts.pdf | 2023-11-02 05:02 | 1.8M | |
![[ ]](/icons/layout.gif) | backendhandbook.pdf | 2023-11-10 06:27 | 212K | |
![[ ]](/icons/layout.gif) | atij-core-servlets-2x1.pdf | 2023-11-02 04:50 | 412K | |
![[ ]](/icons/layout.gif) | antonio-gulli-sujit-pal-deep-learning-with-keras-2017.pdf | 2023-11-02 11:15 | 18M | |
![[ ]](/icons/layout.gif) | anirudh-koul-practical-deep-learning-for-cloud-mobile-2019.pdf | 2023-11-02 11:14 | 26M | |
![[ ]](/icons/unknown.gif) | algs4.jar | 2023-11-02 04:52 | 1.8M | |
![[ ]](/icons/layout.gif) | _storage_emulated_0_Android_data_com.cv.docscanner_cache_tenth-sa1-socialmp1E-ap.pdf | 2023-11-07 06:45 | 4.1M | |
![[ ]](/icons/layout.gif) | [YAn_YErik_Solem]_Programmirovanie_kompyuternogo-.pdf | 2023-11-03 03:37 | 41M | |
![[ ]](/icons/layout.gif) | [Will_Ballard]_Hands-On_Deep_Learning_for_Images_w.pdf | 2023-11-02 10:51 | 5.7M | |
![[ ]](/icons/layout.gif) | [Wei-Meng_Lee]_Python_Machine_Learning.pdf | 2023-11-02 10:51 | 8.7M | |
![[ ]](/icons/layout.gif) | [Delip_Rao,_Brian_McMahan]_Natural_Language_Proces.pdf | 2023-11-02 10:49 | 16M | |
![[ ]](/icons/layout.gif) | [Burkhard_A._Meier]_Python_GUI_Programming_Cookboo.pdf | 2023-11-02 10:48 | 7.6M | |
![[ ]](/icons/layout.gif) | Zend_Framework_in_Action.pdf | 2023-11-02 05:19 | 3.7M | |
![[ ]](/icons/layout.gif) | Z User Workshop, Oxford 1990 - Nicholls.pdf | 2023-11-02 05:04 | 13M | |
![[ ]](/icons/layout.gif) | ZI Hackademy - Newbie 3.pdf | 2023-11-02 05:17 | 31M | |
![[ ]](/icons/layout.gif) | ZI Hackademy - Newbie 2.pdf | 2023-11-02 05:17 | 41M | |
![[ ]](/icons/layout.gif) | ZI Hackademy - Newbie 1.pdf | 2023-11-02 05:17 | 25M | |
![[ ]](/icons/layout.gif) | Your_brain_on_porn_internet_pornography_and_the_emerging_science.pdf | 2023-10-31 07:28 | 1.4M | |
![[ ]](/icons/layout.gif) | Yoon Harry - Python Mini Reference - 2022.pdf | 2023-11-03 03:33 | 4.2M | |
![[ ]](/icons/layout.gif) | Yong Cui - Python How-To - 2023.pdf | 2023-11-03 03:33 | 13M | |
![[ ]](/icons/layout.gif) | XML for Dummies 4th Ed@englishbooks.pdf | 2023-11-02 05:26 | 7.0M | |
![[ ]](/icons/layout.gif) | XML Processing with Perl, Python, and PHP (2002).pdf | 2023-11-02 05:24 | 2.1M | |
![[ ]](/icons/layout.gif) | X86_Assembly_Language_and_C_Fundamentals.pdf | 2023-11-02 05:29 | 3.7M | |
![[ ]](/icons/unknown.gif) | Wrox_Professional_Web_APIs_with.chm | 2023-11-02 05:21 | 3.6M | |
![[ ]](/icons/layout.gif) | Wrox_Professional_Search_Engine.pdf | 2023-11-02 05:19 | 8.0M | |
![[ ]](/icons/layout.gif) | Wrox_Press_Professional_PHP_Programming.pdf | 2023-11-02 05:19 | 18M | |
![[ ]](/icons/layout.gif) | Wrox_Press_Beginning_Android_4_Application.pdf | 2023-11-02 05:22 | 60M | |
![[ ]](/icons/unknown.gif) | Wrox.Puzzles.for.Programmers.and.Pros.May.2007.chm | 2023-11-02 05:16 | 5.8M | |
![[ ]](/icons/layout.gif) | Writing_Solid_Code_Microsofts_Techniques.pdf | 2023-11-02 05:31 | 11M | |
![[ ]](/icons/layout.gif) | Writing Excel Macros - Roman.pdf | 2023-11-02 05:04 | 11M | |
![[ ]](/icons/layout.gif) | Write_Great_Code_Volume_02_Thinking.pdf | 2023-11-02 05:30 | 4.3M | |
![[ ]](/icons/layout.gif) | Write_Great_Code_Volume_01_Understanding.pdf | 2023-11-02 05:30 | 5.3M | |
![[ ]](/icons/layout.gif) | WordPress_For_Beginners_7th_Edition@englishbooks.pdf | 2023-11-02 05:29 | 51M | |
![[ ]](/icons/layout.gif) | Wired_Python-Data-Science.pdf | 2023-11-03 03:33 | 5.5M | |
![[ ]](/icons/layout.gif) | Windows_Communication_Foundation_4_Step_by_Step.pdf | 2023-11-02 05:15 | 12M | |
![[ ]](/icons/layout.gif) | Windows Server automation with PowerShell cookbook.pdf | 2023-11-02 05:02 | 30M | |
![[ ]](/icons/layout.gif) | Windows Communication Foundation Unleashed.pdf | 2023-11-02 05:15 | 11M | |
![[ ]](/icons/layout.gif) | Wiley_Wrox_Expert_PHP_and_MySQL.pdf | 2023-11-02 05:19 | 22M | |
![[ ]](/icons/layout.gif) | Wiley - Amazing Android Apps For Dummies.pdf | 2023-11-02 05:22 | 70M | |
![[ ]](/icons/layout.gif) | Wei_Meng_Lee_Beginning_Android_Tablet.pdf | 2023-11-02 05:22 | 52M | |
![[ ]](/icons/layout.gif) | Web_Dragons_Inside_the_Myths_of_Search_Engine_Technology_Witten.pdf | 2023-11-02 05:04 | 9.0M | |
![[ ]](/icons/layout.gif) | Web Design For Dummies 2nd Ed 2006@englishbooks.pdf | 2023-11-02 05:26 | 45M | |
![[ ]](/icons/layout.gif) | Web-Based Projects that Rock the Class.pdf | 2023-11-02 05:10 | 14M | |
![[ ]](/icons/layout.gif) | Warren_s_Abstract_Machine_A_Tutorial_Reconstruction_Ait_Kaci.pdf | 2023-11-02 05:04 | 18M | |
![[ ]](/icons/layout.gif) | W__Jason_Gilmore_Beginning_PHP_and_MySQL.pdf | 2023-11-02 05:14 | 17M | |
![[ ]](/icons/layout.gif) | WPF 4 Unleashed.pdf | 2023-11-02 05:15 | 30M | |
![[ ]](/icons/layout.gif) | Volume_04B_Pre_Fascicle_05A_Mathematical.pdf | 2023-11-02 05:30 | 635K | |
![[ ]](/icons/layout.gif) | Volume 04B - Pre-Fascicle 06A - Satisfiability.pdf | 2023-11-02 05:30 | 2.1M | |
![[ ]](/icons/layout.gif) | Volume 01 - Fascicle 01 - MMIX.pdf | 2023-11-02 05:30 | 1.3M | |
![[ ]](/icons/unknown.gif) | Visual_Studio_2005_AIO_Desk_Reference.chm | 2023-11-02 05:26 | 63M | |
![[ ]](/icons/layout.gif) | Visual Structures and Integrated Functions - Arbib and Ewert.pdf | 2023-11-02 05:04 | 22M | |
![[ ]](/icons/layout.gif) | Visual Basic 2005 For Dummies 2006@englishbooks.pdf | 2023-11-02 05:26 | 9.3M | |
![[ ]](/icons/compressed.gif) | Violent_Python_A_Cookbook_for_Ha.zip | 2023-11-02 05:25 | 3.9M | |
![[ ]](/icons/layout.gif) | Veronique_Brossier_Developing_Android.pdf | 2023-11-02 05:22 | 7.5M | |
![[ ]](/icons/layout.gif) | Verification_Theory_and_Practice_Essays_Dedicated_to_Zohar_Manna.pdf | 2023-11-02 05:04 | 2.2M | |
![[ ]](/icons/layout.gif) | Veracity of Big Data.pdf | 2023-10-31 06:57 | 4.7M | |
![[ ]](/icons/layout.gif) | VBA For Dummies 5th Ed Jan 2007@englishbooks.pdf | 2023-11-02 05:26 | 8.8M | |
![[ ]](/icons/layout.gif) | Using The GNU Compiler Collection.pdf | 2023-11-02 05:31 | 3.3M | |
![[ ]](/icons/layout.gif) | Unlocking Blockchain on Azure.pdf | 2023-10-31 06:56 | 8.0M | |
![[ ]](/icons/unknown.gif) | Unix 5th Ed For Dummies@englishbooks.chm | 2023-11-02 05:26 | 3.0M | |
![[ ]](/icons/layout.gif) | Universal_Subgoaling_and_Chunking_The_Automatic_Generation_and_Learning.pdf | 2023-11-02 05:04 | 16M | |
![[ ]](/icons/layout.gif) | Unconventional_Models_of_Computation,_UMC’2K_Antoniou,_Calude,_and.pdf | 2023-11-02 05:04 | 12M | |
![[ ]](/icons/layout.gif) | Unconventional Computation - Akl.pdf | 2023-11-02 05:04 | 3.4M | |
![[ ]](/icons/layout.gif) | Uncertainty_Modeling_Dedicated_to_Professor_Boris_Kovalerchuk_on.pdf | 2023-11-02 05:04 | 6.7M | |
![[ ]](/icons/layout.gif) | Ubuntu Unleashed 2015 Edition, 10th Edition.pdf | 2023-11-02 05:29 | 12M | |
![[ ]](/icons/unknown.gif) | Ubuntu Linux For Dummies Apr 2007@englishbooks.chm | 2023-11-02 05:26 | 3.8M | |
![[ ]](/icons/layout.gif) | UNIX and Linux System Administration Handbook.pdf | 2023-11-02 05:17 | 16M | |
![[ ]](/icons/layout.gif) | UNIX and Linux System Administration Handbook, 4th Edition.pdf | 2023-11-02 05:29 | 16M | |
![[ ]](/icons/layout.gif) | Types for Proofs and Programs - Altenkirch and McBride.pdf | 2023-11-02 05:04 | 3.0M | |
![[ ]](/icons/layout.gif) | Types and Programming Languages - Pierce.pdf | 2023-11-02 05:04 | 2.2M | |
![[ ]](/icons/layout.gif) | Types_for_Proofs_and_Programs_Altenkirch,_Reus,_and_Naraschewski.pdf | 2023-11-02 05:04 | 2.6M | |
![[ ]](/icons/layout.gif) | Typed Lambda Calculi and Applications - Urzyczyn.pdf | 2023-11-02 05:04 | 2.8M | |
![[ ]](/icons/layout.gif) | TypeScript in 50 Lessons (Stefan Baumgartner).pdf | 2023-11-03 03:33 | 8.7M | |
![[ ]](/icons/unknown.gif) | Twisted_Network_Programming_Essentials.chm | 2023-11-02 05:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Twisted Python Projects.pdf | 2023-11-03 03:35 | 7.5M | |
![[ ]](/icons/layout.gif) | Troubleshooting CentOS.pdf | 2023-11-02 05:29 | 5.7M | |
![[ ]](/icons/layout.gif) | Trade Chart Patterns Like the Pros - Suri Duddella.pdf | 2023-10-31 06:55 | 7.2M | |
![[ ]](/icons/layout.gif) | Top 100 Deep Learning Interview Questions.pdf | 2023-10-28 05:51 | 2.1M | |
![[ ]](/icons/layout.gif) | Top 50 Machine Learning Interview Q&A.pdf | 2023-11-02 10:50 | 261K | |
![[ ]](/icons/layout.gif) | Tkinter 8.4 reference - a GUI for Python (2010).pdf | 2023-11-02 05:24 | 1.4M | |
![[ ]](/icons/layout.gif) | Think like a programmer.pdf | 2023-11-02 05:12 | 7.0M | |
![[ ]](/icons/layout.gif) | Thinking in Tkinter (2005).pdf | 2023-11-02 05:24 | 282K | |
![[ ]](/icons/layout.gif) | Think Java - How to Think Like a Computer Scientist (2016).pdf | 2023-11-02 05:21 | 5.2M | |
![[ ]](/icons/layout.gif) | The_international_dictionary_of_.pdf | 2023-11-02 05:24 | 769K | |
![[ ]](/icons/layout.gif) | The_Ultimate_Guide_to_Job_Interview_Answers_2008.pdf | 2023-11-02 05:32 | 323K | |
![[ ]](/icons/layout.gif) | The_Ultimate_Guide_to_Job_Interview_Answers_2008 (2).pdf | 2023-11-02 05:34 | 323K | |
![[ ]](/icons/layout.gif) | The_Tomes_of_Delphi_Algorithms_and.pdf | 2023-11-02 05:33 | 5.2M | |
![[ ]](/icons/layout.gif) | The_Rootkit_Arsenal_Escape_and_Evasion_in_the_Dark_Corners_of_the.pdf | 2023-11-02 05:01 | 94M | |
![[ ]](/icons/layout.gif) | The_Mythical_Man_Month_Essays_On.pdf | 2023-11-02 05:30 | 19M | |
![[ ]](/icons/layout.gif) | The_Leadership_Code_Using_Life's.pdf | 2023-11-02 05:10 | 2.6M | |
![[IMG]](/icons/image2.gif) | The_Leadership_Code_Using_Life's.jpg | 2023-11-02 05:10 | 24K | |
![[ ]](/icons/layout.gif) | The_Design_And_Analysis_Of_Spatial.pdf | 2023-11-02 05:33 | 27M | |
![[ ]](/icons/layout.gif) | The_Definitive_Guide_to_Jython_Python.pdf | 2023-11-02 05:11 | 7.7M | |
![[ ]](/icons/layout.gif) | The_C_Programming_Language_19882ndBrian.pdf | 2023-11-02 05:31 | 20M | |
![[ ]](/icons/compressed.gif) | The_C_Programming_Language_2nd_E.zip | 2023-11-02 05:25 | 685K | |
![[ ]](/icons/layout.gif) | The_C_Answer_Book_19892ndClovis.pdf | 2023-11-02 05:31 | 2.6M | |
![[ ]](/icons/layout.gif) | The_C++_Programming_Language_4th.pdf | 2023-11-02 05:28 | 19M | |
![[ ]](/icons/layout.gif) | The_Book_of_Why_The_New_Science_of_Cause_and_Effect_by_Judea_Pearl.pdf | 2023-11-02 10:53 | 7.3M | |
![[ ]](/icons/layout.gif) | The Quick Python Book, Second Edition (2010).pdf | 2023-11-02 05:11 | 4.4M | |
![[ ]](/icons/layout.gif) | TheObjectiveCProgrammingLanguage.pdf | 2023-11-02 05:32 | 2.6M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Securite wifi.pdf | 2023-11-02 05:17 | 1.3M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Newbie - part 4.pdf | 2023-11-02 05:17 | 9.2M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Newbie - part 3.pdf | 2023-11-02 05:17 | 11M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Newbie - part 2.pdf | 2023-11-02 05:17 | 9.9M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Newbie - part 1.pdf | 2023-11-02 05:17 | 10M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Mini Guide Anonymat.pdf | 2023-11-02 05:17 | 2.3M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Linux.pdf | 2023-11-02 05:17 | 19M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Hack Security Pro.pdf | 2023-11-02 05:17 | 6.4M | |
![[ ]](/icons/layout.gif) | The Hackademy School - Hack Newbie.pdf | 2023-11-02 05:17 | 3.5M | |
![[ ]](/icons/layout.gif) | The Hackademy Prog - Apprendre à Programmer en PHP.pdf | 2023-11-02 05:17 | 34M | |
![[ ]](/icons/layout.gif) | The Hackademy Prog - Apprendre à Programmer en C.pdf | 2023-11-02 05:17 | 14M | |
![[ ]](/icons/layout.gif) | The Hackademy - Hors Serie 3.pdf | 2023-11-02 05:17 | 14M | |
![[ ]](/icons/layout.gif) | The Hackademy - Hors Serie 2.pdf | 2023-11-02 05:18 | 36M | |
![[ ]](/icons/layout.gif) | The Hackademy - Hors Serie 1.pdf | 2023-11-02 05:17 | 12M | |
![[ ]](/icons/layout.gif) | The Guide Of HTML5 AND JAVA SCRIPT Programming For Beginners.pdf | 2023-11-02 05:10 | 8.8M | |
![[ ]](/icons/layout.gif) | The GNU C Reference Manual.pdf | 2023-11-02 05:31 | 547K | |
![[ ]](/icons/layout.gif) | The GNU C Library Reference Manual.pdf | 2023-11-02 05:31 | 5.6M | |
![[ ]](/icons/layout.gif) | TheDefinitiveGuidetoSymfony.pdf | 2023-11-02 05:19 | 8.7M | |
![[ ]](/icons/layout.gif) | The Complete Guide to Google Android - 2010.pdf | 2023-11-02 05:22 | 43M | |
![[ ]](/icons/layout.gif) | The Art of Memory Forensic(@Ebooksec).pdf | 2023-11-02 05:03 | 14M | |
![[ ]](/icons/layout.gif) | The Algorithm Design Manual 2nd Ed - Steven S. Skiena (2008).pdf | 2023-11-02 05:34 | 11M | |
![[ ]](/icons/layout.gif) | The.Android.Developers.Cookbook.pdf | 2023-11-02 05:22 | 4.5M | |
![[ ]](/icons/unknown.gif) | Text Processing in Python (2003).chm | 2023-11-02 05:03 | 855K | |
![[ ]](/icons/layout.gif) | Test Driven.pdf | 2023-11-02 05:35 | 6.0M | |
![[ ]](/icons/unknown.gif) | Teach_Yourself_PHP_In_10_Minutes.chm | 2023-11-02 05:21 | 364K | |
![[ ]](/icons/layout.gif) | Teach_Yourself_Data_Structures_And.pdf | 2023-11-02 05:33 | 5.6M | |
![[ ]](/icons/unknown.gif) | Teach Yourself Python in 24 Hours (2000).chm | 2023-11-02 05:03 | 2.4M | |
![[ ]](/icons/layout.gif) | Tarek_Amr_Hands_On_Machine_Learning_with_scikit_learn_and_Scientific.pdf | 2023-11-02 10:51 | 12M | |
![[ ]](/icons/layout.gif) | Tapestry in Action.pdf | 2023-11-02 05:35 | 7.6M | |
![[ ]](/icons/layout.gif) | Syngress_Wireshark_and_Ethereal.pdf | 2023-11-02 05:17 | 13M | |
![[ ]](/icons/layout.gif) | Syngress_Systems_Security_Certification.pdf | 2023-11-02 05:17 | 6.3M | |
![[ ]](/icons/layout.gif) | Syngress_Special_Ops_Host_and_Network.pdf | 2023-11-02 05:17 | 17M | |
![[ ]](/icons/layout.gif) | Syngress_Sockets,_Shellcode,_Porting.pdf | 2023-11-02 05:18 | 112M | |
![[ ]](/icons/layout.gif) | Syngress_Security_Sage's_Guide.pdf | 2023-11-02 05:18 | 11M | |
![[ ]](/icons/layout.gif) | Syngress_Security_Log_Management.pdf | 2023-11-02 05:18 | 6.6M | |
![[ ]](/icons/layout.gif) | Syngress_Securing_the_Cloud_Cloud.pdf | 2023-11-02 05:18 | 3.3M | |
![[ ]](/icons/layout.gif) | Syngress_Scene_of_the_Cybercrime.pdf | 2023-11-02 05:18 | 5.0M | |
![[ ]](/icons/layout.gif) | Syngress_Penetration_Tester's.pdf | 2023-11-02 05:18 | 27M | |
![[ ]](/icons/layout.gif) | Syngress_Nmap_in_the_Enterprise.pdf | 2023-11-02 05:18 | 6.1M | |
![[ ]](/icons/layout.gif) | Syngress_Ninja_Hacking_Unconventional.pdf | 2023-11-02 05:18 | 9.9M | |
![[ ]](/icons/layout.gif) | Syngress_Metasploit_Toolkit_for.pdf | 2023-11-02 05:18 | 4.9M | |
![[ ]](/icons/layout.gif) | Syngress_InfoSec_Career_Hacking.pdf | 2023-11-02 05:18 | 84M | |
![[ ]](/icons/layout.gif) | Syngress_Hack_Proofing_your_Identity.pdf | 2023-11-02 05:18 | 8.9M | |
![[ ]](/icons/layout.gif) | Syngress_Cyber_Spying_Tracking_your.pdf | 2023-11-02 05:19 | 106M | |
![[ ]](/icons/layout.gif) | Syngress_Cyber_Adversary_Characterization.pdf | 2023-11-02 05:19 | 4.1M | |
![[ ]](/icons/layout.gif) | Syngress_Creating_Security_Policies.pdf | 2023-11-02 05:18 | 2.8M | |
![[ ]](/icons/layout.gif) | Syngress_Cisco_Security_Specialist's.pdf | 2023-11-02 05:19 | 11M | |
![[ ]](/icons/layout.gif) | Syngress_Cisco_Security_Professional's.pdf | 2023-11-02 05:19 | 15M | |
![[ ]](/icons/layout.gif) | Syngress_Check_Point_NG_VPN_1_FireWall.pdf | 2023-11-02 05:19 | 12M | |
![[ ]](/icons/layout.gif) | Syngress_Building_a_VoIP_Network.pdf | 2023-11-02 05:19 | 17M | |
![[ ]](/icons/layout.gif) | Syngress - Zero Day Exploit - Countdown to Darkness.pdf | 2023-11-02 05:17 | 3.7M | |
![[ ]](/icons/layout.gif) | Syngress - Zen and the Art of Information Security.pdf | 2023-11-02 05:17 | 5.2M | |
![[ ]](/icons/layout.gif) | Syngress - XSS Attacks.pdf | 2023-11-02 05:17 | 7.3M | |
![[ ]](/icons/layout.gif) | Syngress - Writing Security Tools and Exploits.pdf | 2023-11-02 05:17 | 11M | |
![[ ]](/icons/layout.gif) | Syngress - Wireless Hacking - Projects for Wi-Fi Enthusiasts.pdf | 2023-11-02 05:17 | 18M | |
![[ ]](/icons/layout.gif) | Syngress - WarDriving and Wireless Penetration Testing.pdf | 2023-11-02 05:17 | 21M | |
![[ ]](/icons/layout.gif) | Syngress - VB.NET Developer's Guide.pdf | 2023-11-02 05:17 | 6.4M | |
![[ ]](/icons/layout.gif) | Syngress - The Mezonic Agenda - Hacking the Presidency.pdf | 2023-11-02 05:17 | 16M | |
![[ ]](/icons/layout.gif) | Syngress - Techno Security’s Guide to Managing Risks.pdf | 2023-11-02 05:17 | 16M | |
![[ ]](/icons/layout.gif) | Syngress - Stealing the Network - How to Own the Box.pdf | 2023-11-02 05:17 | 4.6M | |
![[ ]](/icons/layout.gif) | Syngress - Stealing the Network - How to Own a Shadow.pdf | 2023-11-02 05:17 | 9.1M | |
![[ ]](/icons/layout.gif) | Syngress - Snort IDS and IPS Toolkit.pdf | 2023-11-02 05:18 | 8.4M | |
![[ ]](/icons/layout.gif) | Syngress - Snort 2.1 Intrusion Detection - 2nd Edition.pdf | 2023-11-02 05:18 | 12M | |
![[ ]](/icons/layout.gif) | Syngress - Snort 2.0 Intrusion Detection.pdf | 2023-11-02 05:18 | 7.1M | |
![[ ]](/icons/layout.gif) | Syngress - Security+ Study Guide.pdf | 2023-11-02 05:18 | 11M | |
![[ ]](/icons/layout.gif) | Syngress - Scripting VMware Power Tools.pdf | 2023-11-02 05:18 | 5.0M | |
![[ ]](/icons/layout.gif) | Syngress - SQL Injection Attacks and Defense.pdf | 2023-11-02 05:17 | 6.5M | |
![[ ]](/icons/layout.gif) | Syngress - RFID Security.pdf | 2023-11-02 05:18 | 5.9M | |
![[ ]](/icons/layout.gif) | Syngress - Programmer's Ultimate Security Deskref.pdf | 2023-11-02 05:18 | 4.5M | |
![[ ]](/icons/layout.gif) | Syngress - Phishing Exposed.pdf | 2023-11-02 05:18 | 8.3M | |
![[ ]](/icons/layout.gif) | Syngress - OS X for Hackers at Heart.pdf | 2023-11-02 05:18 | 15M | |
![[ ]](/icons/layout.gif) | Syngress - Nessus Network Auditing.pdf | 2023-11-02 05:18 | 4.6M | |
![[ ]](/icons/layout.gif) | Syngress - Microsoft Vista for IT Security Professionals.pdf | 2023-11-02 05:18 | 19M | |
![[ ]](/icons/layout.gif) | Syngress - Linksys WRT54G Ultimate Hacking.pdf | 2023-11-02 05:18 | 16M | |
![[ ]](/icons/layout.gif) | Syngress - LEGO Software Power Tools.pdf | 2023-11-02 05:18 | 15M | |
![[ ]](/icons/layout.gif) | Syngress - Intrusion, Prevention and Active Response.pdf | 2023-11-02 05:19 | 85M | |
![[ ]](/icons/layout.gif) | Syngress - How to Cheat at Securing a Wireless Network.pdf | 2023-11-02 05:18 | 12M | |
![[ ]](/icons/layout.gif) | Syngress - Hack the Stack.pdf | 2023-11-02 05:18 | 7.2M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing your Wireless Network.pdf | 2023-11-02 05:18 | 6.6M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing your Web Applications.pdf | 2023-11-02 05:18 | 8.6M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing your Network - 2nd Edition.pdf | 2023-11-02 05:18 | 8.8M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing XML.pdf | 2023-11-02 05:18 | 7.1M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing Windows 2000 Server.pdf | 2023-11-02 05:18 | 12M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing Sun Solaris.pdf | 2023-11-02 05:18 | 6.8M | |
![[ ]](/icons/layout.gif) | Syngress - Hack Proofing Linux.pdf | 2023-11-02 05:18 | 12M | |
![[ ]](/icons/layout.gif) | Syngress - Google Talking.pdf | 2023-11-02 05:18 | 8.3M | |
![[ ]](/icons/layout.gif) | Syngress - Google Hacking for Penetration Tester - Vol.2.pdf | 2023-11-02 05:18 | 15M | |
![[ ]](/icons/layout.gif) | Syngress - Google Hacking for Penetration Tester - Vol.1.pdf | 2023-11-02 05:18 | 13M | |
![[ ]](/icons/layout.gif) | Syngress - Essential Computer Security.pdf | 2023-11-02 05:18 | 7.8M | |
![[ ]](/icons/layout.gif) | Syngress - Enemy at the Water Cooler.pdf | 2023-11-02 05:18 | 6.3M | |
![[ ]](/icons/layout.gif) | Syngress - Email Virus Protection Handbook.pdf | 2023-11-02 05:18 | 5.8M | |
![[ ]](/icons/layout.gif) | Syngress - Developer's Guide to Web Application Security.pdf | 2023-11-02 05:18 | 11M | |
![[ ]](/icons/layout.gif) | Syngress - Cyber Crime Investigations.pdf | 2023-11-02 05:18 | 9.2M | |
![[ ]](/icons/layout.gif) | Syngress - Combating Spyware in the Enterprise.pdf | 2023-11-02 05:18 | 8.0M | |
![[ ]](/icons/layout.gif) | Syngress - C#.NET Web Developer's Guide.pdf | 2023-11-02 05:19 | 6.8M | |
![[ ]](/icons/layout.gif) | Syngress - Building SANs with Brocade Fabric Switches.pdf | 2023-11-02 05:19 | 3.8M | |
![[ ]](/icons/layout.gif) | Syngress - Building DMZs for Enterprise Networks.pdf | 2023-11-02 05:19 | 12M | |
![[ ]](/icons/layout.gif) | Syngress - Buffer Overflow Attacks.pdf | 2023-11-02 05:19 | 5.4M | |
![[ ]](/icons/layout.gif) | Syngress - Botnets - The Killer Web App.pdf | 2023-11-02 05:19 | 7.0M | |
![[ ]](/icons/layout.gif) | Syngress - Best Damn Windows Server 2003 Book Period.pdf | 2023-11-02 05:19 | 21M | |
![[ ]](/icons/layout.gif) | Syngress - Aggressive Network Self-Defense.pdf | 2023-11-02 05:19 | 83M | |
![[ ]](/icons/layout.gif) | Sweigart_Al_Python_Programming_Exercises,_Gently_Explained_2022_.pdf | 2023-11-03 03:33 | 1.6M | |
![[ ]](/icons/layout.gif) | Supervised Learning.pdf | 2023-11-02 11:17 | 2.0M | |
![[ ]](/icons/layout.gif) | Sufyan_bin_Uzayr_Optimizing_Visual_Studio_Code_for_Python_Development.pdf | 2023-11-03 03:33 | 2.2M | |
![[ ]](/icons/layout.gif) | Struts_Interview_Questions.pdf | 2023-11-02 05:34 | 44K | |
![[ ]](/icons/layout.gif) | Structure_And_Interpretation_Of.pdf | 2023-11-02 05:30 | 4.4M | |
![[ ]](/icons/layout.gif) | Stroustrup_B_Programming_Principles.pdf | 2023-11-02 05:19 | 73M | |
![[ ]](/icons/layout.gif) | Stripes by Example.pdf | 2023-11-02 05:35 | 6.0M | |
![[ ]](/icons/layout.gif) | Starting Out with Python (2009).pdf | 2023-11-02 05:11 | 34M | |
![[ ]](/icons/layout.gif) | Starting Out with Java, 6th Edition.pdf | 2023-11-02 05:13 | 17M | |
![[ ]](/icons/layout.gif) | Standard C Library, The (1992)(1st)(P. J. Plaucer).pdf | 2023-11-02 05:31 | 50M | |
![[ ]](/icons/layout.gif) | Spring in Practice.pdf | 2023-11-02 05:35 | 16M | |
![[ ]](/icons/layout.gif) | Spring_Interview_Questions.pdf | 2023-11-02 05:34 | 116K | |
![[ ]](/icons/layout.gif) | Spring Security 3.1.pdf | 2023-11-02 05:13 | 6.3M | |
![[ ]](/icons/layout.gif) | Spring Roo in Action.pdf | 2023-11-02 05:13 | 6.2M | |
![[ ]](/icons/layout.gif) | Spring Recipes, 3rd Edition.pdf | 2023-11-02 05:35 | 10M | |
![[ ]](/icons/layout.gif) | Spring REST.pdf | 2023-11-02 05:13 | 5.0M | |
![[ ]](/icons/layout.gif) | Spring Persistence with Hibernate.pdf | 2023-11-02 05:35 | 3.3M | |
![[ ]](/icons/layout.gif) | Spring Dynamic Modules in Action.pdf | 2023-11-02 05:13 | 4.8M | |
![[ ]](/icons/layout.gif) | Spring Cookbook.pdf | 2023-11-02 05:13 | 3.1M | |
![[ ]](/icons/layout.gif) | Spring Boot Cookbook.pdf | 2023-11-02 05:13 | 2.8M | |
![[ ]](/icons/layout.gif) | Spark for Data Science.pdf | 2023-11-02 09:57 | 13M | |
![[ ]](/icons/layout.gif) | Software_Project_Management_For.pdf | 2023-11-02 05:26 | 5.9M | |
![[ ]](/icons/layout.gif) | Social_Engineering_How_Crowdmasters_Phreaks_Hackers_and_Trolls.pdf | 2023-11-02 05:02 | 2.5M | |
![[ ]](/icons/layout.gif) | Snake_Wrangling_for_Kids_Learning.pdf | 2023-11-02 05:11 | 1.2M | |
![[ ]](/icons/layout.gif) | Snake_Wrangling_for_Kids_Learning (6).pdf | 2023-11-02 05:24 | 1.3M | |
![[ ]](/icons/layout.gif) | Snake_Wrangling_for_Kids_Learning (5).pdf | 2023-11-02 05:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Snake_Wrangling_for_Kids_Learning (3).pdf | 2023-11-02 05:24 | 1.3M | |
![[ ]](/icons/layout.gif) | Snake_Wrangling_for_Kids_Learning (2).pdf | 2023-11-02 05:24 | 1.3M | |
![[ ]](/icons/layout.gif) | Smith_Dave_Android_Recipes_A_Problem.pdf | 2023-11-02 05:22 | 11M | |
![[ ]](/icons/layout.gif) | Smarty.PHP.Template.Programming.and.Applications_Packt_2006.pdf | 2023-11-02 05:19 | 6.5M | |
![[ ]](/icons/layout.gif) | Skiena.-.TheAlgorithmDesignManual.pdf | 2023-11-02 05:12 | 3.9M | |
![[ ]](/icons/layout.gif) | Sitepoint___Build_Your_Own_Datab.pdf | 2023-11-02 05:19 | 7.2M | |
![[ ]](/icons/layout.gif) | SitePoint.The.PHP.Anthology.2007.2Ed.BBL.0975841998.pdf | 2023-11-02 05:19 | 5.0M | |
![[ ]](/icons/layout.gif) | SitePoint-ThePHPAnthology-VolumeII-Aplications2.pdf | 2023-11-02 05:19 | 3.8M | |
![[ ]](/icons/layout.gif) | SitePoint-ThePHPAnthology-VolumeI-Foundations.pdf | 2023-11-02 05:19 | 4.4M | |
![[ ]](/icons/layout.gif) | Singh P., Manure A. - Learn TensorFlow 2.0 - 2020.pdf | 2023-11-03 03:39 | 6.2M | |
![[ ]](/icons/layout.gif) | Service-Oriented Design with Ruby and Rails.pdf | 2023-11-02 05:15 | 2.1M | |
![[ ]](/icons/layout.gif) | Serlvets & JSP - Falkner Jones.pdf | 2023-11-02 05:12 | 4.9M | |
![[ ]](/icons/layout.gif) | Security.from.Zero.Revision.pdf | 2023-11-02 05:01 | 2.9M | |
![[ ]](/icons/layout.gif) | Security.Practice.Tests.pdf | 2023-11-02 05:01 | 5.2M | |
![[ ]](/icons/layout.gif) | Scheduling_Theory,_Algorithms,_and.pdf | 2023-11-02 05:34 | 5.3M | |
![[ ]](/icons/layout.gif) | Scheduling Algorithms 5th Ed - Peter Brucker (2007).pdf | 2023-11-02 05:34 | 12M | |
![[ ]](/icons/layout.gif) | Scaling.Python.with.Dask.pdf | 2023-11-09 13:01 | 8.9M | |
![[ ]](/icons/layout.gif) | Scala for Data Science.pdf | 2023-11-02 09:57 | 2.7M | |
![[ ]](/icons/layout.gif) | Satya Komatineni and Dave MacLean - Pro Android 4 - 2012.pdf | 2023-11-02 05:22 | 31M | |
![[ ]](/icons/unknown.gif) | Sams_Teach_Yourself_PHP_MySQL_and.chm | 2023-11-02 05:21 | 8.1M | |
![[ ]](/icons/layout.gif) | Sams_PHP_And_MySQL_Web_Development.pdf | 2023-11-02 05:19 | 11M | |
![[ ]](/icons/layout.gif) | Sams.Web.Publishing.with.PHP.and.FileMaker.9.Sep.2007.pdf | 2023-11-02 05:19 | 5.8M | |
![[ ]](/icons/layout.gif) | SUSE Linux 10 for Dummies@englishbooks.pdf | 2023-11-02 05:26 | 13M | |
![[ ]](/icons/layout.gif) | SUSE Linux 9 3 for Dummies@englishbooks.pdf | 2023-11-02 05:26 | 11M | |
![[ ]](/icons/tar.gif) | STL_doc.tar | 2023-11-02 05:16 | 3.5M | |
![[ ]](/icons/layout.gif) | STL Reference.pdf | 2023-11-02 05:16 | 495K | |
![[ ]](/icons/unknown.gif) | SQL_Server_2012_Query_Performance.epub | 2023-11-02 05:28 | 15M | |
![[ ]](/icons/layout.gif) | SQL The Complete Reference, 3rd Edition - James, Andy, Paul.pdf | 2023-11-02 05:29 | 7.2M | |
![[ ]](/icons/layout.gif) | SQL Handwritten Notes .pdf | 2023-11-10 08:55 | 4.4M | |
![[ ]](/icons/layout.gif) | SQL For Dummies 2003@englishbooks.pdf | 2023-11-02 05:28 | 5.9M | |
![[ ]](/icons/layout.gif) | SQL For Dummies, 6th Ed 2006@englishbooks.pdf | 2023-11-02 05:28 | 7.6M | |
![[ ]](/icons/layout.gif) | SQL-1.pdf | 2023-10-25 06:22 | 87K | |
![[ ]](/icons/layout.gif) | SCWCD Exam Study Kit, 2nd Edition.pdf | 2023-11-02 05:35 | 4.4M | |
![[ ]](/icons/layout.gif) | Ruby on Rails For Dummies Jan 2007@englishbooks.pdf | 2023-11-02 05:26 | 9.8M | |
![[ ]](/icons/layout.gif) | Rootkits for Dummies Jan 2007@englishbooks.pdf | 2023-11-02 05:26 | 6.9M | |
![[ ]](/icons/layout.gif) | Rootkits_and_Bootkits_Reversing.pdf | 2023-11-02 05:02 | 15M | |
![[ ]](/icons/layout.gif) | Rootkits_Bootkits.pdf | 2023-11-02 05:01 | 15M | |
![[ ]](/icons/layout.gif) | R for Data Science.pdf | 2023-11-02 09:57 | 3.5M | |
![[ ]](/icons/layout.gif) | Reverse_Engineering_for_Beginners-en-A5.pdf | 2023-11-02 05:25 | 8.1M | |
![[ ]](/icons/layout.gif) | Restlet in Action.pdf | 2023-11-02 05:35 | 14M | |
![[ ]](/icons/layout.gif) | Restful_dotnet.pdf | 2023-11-02 05:15 | 9.7M | |
![[ ]](/icons/layout.gif) | Reinforcement_Learning_with_Python_Master_Reinforcemearning_in_Python.pdf | 2023-10-25 06:39 | 463K | |
![[ ]](/icons/layout.gif) | Reinforcement_Learning_An_Introduction,_2nd_Edition_by_Richard_S.pdf | 2023-11-02 10:53 | 7.5M | |
![[ ]](/icons/layout.gif) | Red_Hat_Fedora_Linux_2_AIO_Desk.pdf | 2023-11-02 05:26 | 17M | |
![[ ]](/icons/layout.gif) | Red Hat System 3.pdf | 2023-11-02 05:00 | 11M | |
![[ ]](/icons/layout.gif) | Red Hat System 2.pdf | 2023-11-02 05:00 | 7.5M | |
![[ ]](/icons/layout.gif) | Red Hat System 1.pdf | 2023-11-02 05:00 | 11M | |
![[ ]](/icons/unknown.gif) | Red Hat Linux Fedora For Dummies 2004@englishbooks.chm | 2023-11-02 05:26 | 5.0M | |
![[ ]](/icons/layout.gif) | Raspberry_Pi_Computer_Vision_Programming_Design_and_implement_computer.pdf | 2023-11-02 10:47 | 12M | |
![[ ]](/icons/layout.gif) | Raspberry Pi for complete beginners - Antun Peicevic.pdf | 2023-11-02 05:30 | 8.3M | |
![[ ]](/icons/unknown.gif) | Raspberry Pi for complete beginners - Antun Peicevic.epub | 2023-11-02 05:30 | 3.3M | |
![[ ]](/icons/unknown.gif) | Rapid_Web_Applications_with_TurboGears.chm | 2023-11-02 05:11 | 6.2M | |
![[ ]](/icons/layout.gif) | Rapid_GUI_Programming_with_Python.pdf | 2023-11-02 05:11 | 7.0M | |
![[ ]](/icons/layout.gif) | R_for_Data_Science_Import,_Tidy.pdf | 2023-11-02 09:57 | 33M | |
![[ ]](/icons/layout.gif) | R_Programming_for_Data_Science_by_Roger_D_Peng.pdf | 2023-11-17 10:55 | 10M | |
![[ ]](/icons/layout.gif) | R Projects For Dummies.pdf | 2023-11-02 10:45 | 7.8M | |
![[ ]](/icons/layout.gif) | REWORK (UZB @audiokitobuz).pdf | 2023-11-02 10:49 | 869K | |
![[ ]](/icons/layout.gif) | RESTful Java with JAX-RS 2.0, 2nd Edition.pdf | 2023-11-02 05:35 | 6.9M | |
![[ ]](/icons/layout.gif) | REALWORLDPYTHON- Hackers Guide2020.pdf | 2023-11-02 05:03 | 16M | |
![[ ]](/icons/layout.gif) | Quick Reference Sheet - ML , DL , AI.pdf | 2023-11-02 11:17 | 7.0M | |
![[ ]](/icons/layout.gif) | QUICK_REVISION_SOCIAL_SCIENCE_CBSE.pdf | 2023-11-02 10:39 | 14M | |
![[ ]](/icons/layout.gif) | Python term work.pdf | 2023-11-06 06:45 | 238K | |
![[ ]](/icons/unknown.gif) | Python in a Nutshell, 2nd Edition (2006).chm | 2023-11-02 05:11 | 1.1M | |
![[ ]](/icons/layout.gif) | Python for Unix and Linux System Administration (2008).pdf | 2023-11-02 05:11 | 3.4M | |
![[ ]](/icons/layout.gif) | Python for Scientists (en).pdf | 2023-11-03 03:42 | 9.6M | |
![[ ]](/icons/layout.gif) | Python for Probability, Statistics and Machine Learning (en).pdf | 2023-11-03 03:42 | 7.1M | |
![[ ]](/icons/layout.gif) | Python for OSINT. 21 day course for beginners.pdf | 2023-11-03 03:33 | 19M | |
![[ ]](/icons/compressed.gif) | Python for JavaScript Developers.zip | 2023-10-25 07:03 | 234M | |
![[ ]](/icons/layout.gif) | Python for Dummies (2006).pdf | 2023-11-02 05:11 | 1.7M | |
![[ ]](/icons/layout.gif) | Python for Data Science For Dummies.pdf | 2023-11-02 09:57 | 9.8M | |
![[ ]](/icons/layout.gif) | Python for Data Science(tricks).pdf | 2023-11-02 05:00 | 2.2M | |
![[ ]](/icons/layout.gif) | Python for Data Analysts - Quick Summary (1).pdf | 2023-10-25 06:46 | 64K | |
![[ ]](/icons/layout.gif) | Python for Data Analysis.pdf | 2023-11-02 11:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Python for Absolute Beginners ☑️.pdf | 2023-10-29 12:08 | 7.8M | |
![[ ]](/icons/layout.gif) | Python complete notes🥇 (1).pdf | 2023-11-03 03:33 | 918K | |
![[ ]](/icons/layout.gif) | Python code for Artificial Intelligence (en).pdf | 2023-11-03 03:42 | 1.0M | |
![[ ]](/icons/layout.gif) | Python_for_Software_Design_How_to.pdf | 2023-11-02 05:11 | 784K | |
![[ ]](/icons/compressed.gif) | Python_for_Kids_A_Playful_Introd.zip | 2023-11-02 05:25 | 11M | |
![[ ]](/icons/layout.gif) | Python_Seaborn_Cheat_Sheet.pdf | 2023-10-25 06:22 | 624K | |
![[ ]](/icons/layout.gif) | Python_Scripting_for_Computational.pdf | 2023-11-02 05:11 | 5.0M | |
![[ ]](/icons/unknown.gif) | Python_Programming_with_the_Java.chm | 2023-11-02 05:11 | 1.8M | |
![[ ]](/icons/compressed.gif) | Python_Programming_for_the_Absol.zip | 2023-11-02 05:25 | 9.8M | |
![[ ]](/icons/layout.gif) | Python_Programming_An_Introduction.pdf | 2023-11-02 05:11 | 1.2M | |
![[ ]](/icons/layout.gif) | Python_Machine_Learning_Machine_Learning_and_Deep_Learning_with.pdf | 2023-11-02 10:52 | 26M | |
![[ ]](/icons/layout.gif) | Python_Artificial_Intelligence_Projects_for_Beginners_Get_up_and.pdf | 2023-11-02 10:51 | 16M | |
![[ ]](/icons/layout.gif) | Python_All_In_One_For_Dummies.pdf | 2023-11-03 03:33 | 42M | |
![[ ]](/icons/layout.gif) | Python_&_XML_XML_Processing.pdf | 2023-11-02 05:11 | 3.5M | |
![[ ]](/icons/layout.gif) | Python Testing - Beginner's Guide (2010).pdf | 2023-11-02 05:11 | 4.6M | |
![[ ]](/icons/layout.gif) | Python Science Projects.pdf_20231120_013618_0000.pdf | 2023-11-20 04:04 | 2.1M | |
![[ ]](/icons/unknown.gif) | Python Programming on Win32, First Edition (2000).chm | 2023-11-02 05:11 | 2.1M | |
![[ ]](/icons/layout.gif) | Python Programming for the Absolute Beginner - 3rd Edition.pdf | 2023-11-02 05:15 | 13M | |
![[ ]](/icons/unknown.gif) | Python Programming for the Absolute Beginner (2003).chm | 2023-11-02 05:11 | 5.5M | |
![[ ]](/icons/layout.gif) | Python Programming for Beginners (2023).pdf | 2023-11-03 03:33 | 2.2M | |
![[ ]](/icons/layout.gif) | Python Programming for Beginner.pdf | 2023-11-02 05:29 | 451K | |
![[ ]](/icons/layout.gif) | Python Power - The Comprehensive Guide (2008).pdf | 2023-11-02 05:11 | 6.1M | |
![[ ]](/icons/layout.gif) | Python Pocket Reference, 4th Edition (2009).pdf | 2023-11-02 05:11 | 2.3M | |
![[ ]](/icons/unknown.gif) | Python Phrasebook - Essential Code and Commands (2006).chm | 2023-11-02 05:11 | 767K | |
![[ ]](/icons/layout.gif) | Python Machine Learning Case Studies (en).pdf | 2023-11-03 03:42 | 8.0M | |
![[ ]](/icons/layout.gif) | Python Machine Learning (en).pdf | 2023-11-03 03:42 | 11M | |
![[ ]](/icons/layout.gif) | Python For Dummies.pdf | 2023-11-02 05:15 | 1.5M | |
![[ ]](/icons/layout.gif) | Python Essential Reference, Fourth Edition (2009).pdf | 2023-11-02 05:11 | 2.4M | |
![[ ]](/icons/layout.gif) | Python Developer's Handbook, First Edition (2000).pdf | 2023-11-02 05:11 | 15M | |
![[ ]](/icons/layout.gif) | Python Data Visualization Cookbook (en).pdf | 2023-11-03 03:42 | 7.7M | |
![[ ]](/icons/layout.gif) | Python Data Science Handbook.pdf | 2023-11-02 09:57 | 21M | |
![[ ]](/icons/layout.gif) | Python Data Science Essentials.pdf | 2023-11-02 09:57 | 12M | |
![[ ]](/icons/layout.gif) | Python Data Science Cookbook.pdf | 2023-11-02 09:57 | 7.3M | |
![[ ]](/icons/layout.gif) | Python Data Science. The Bible.pdf | 2023-11-02 10:46 | 4.0M | |
![[ ]](/icons/layout.gif) | Python Data Cleaning Cookbook.pdf | 2023-11-14 10:33 | 3.4M | |
![[ ]](/icons/layout.gif) | Python Cookbook, 2nd Edition (2005).pdf | 2023-11-02 05:11 | 3.2M | |
![[ ]](/icons/unknown.gif) | Python Cookbook, 2nd Edition (2005).chm | 2023-11-02 05:24 | 1.5M | |
![[ ]](/icons/layout.gif) | Python Cheat Sheet (2009).pdf | 2023-11-02 05:15 | 393K | |
![[ ]](/icons/layout.gif) | Python 3 for Absolute Beginners (2009).pdf | 2023-11-02 05:11 | 7.6M | |
![[ ]](/icons/layout.gif) | Python 3 Text Processing with NLTK 3 Cookbook.pdf | 2023-11-02 05:16 | 1.9M | |
![[ ]](/icons/layout.gif) | Python 2.6 Quick Reference (Letter) (2009) (2).pdf | 2023-11-02 05:15 | 894K | |
![[ ]](/icons/layout.gif) | Python 2.6 Cheatsheet (2008).pdf | 2023-11-02 05:15 | 97K | |
![[ ]](/icons/layout.gif) | Python 2.5 Reference Card (2009).pdf | 2023-11-02 05:15 | 169K | |
![[ ]](/icons/layout.gif) | Python 2.4 Quick Reference Card (Letter) (2007).pdf | 2023-11-02 05:15 | 608K | |
![[ ]](/icons/layout.gif) | Python 2.1 Bible (2001).pdf | 2023-11-02 05:11 | 6.5M | |
![[ ]](/icons/layout.gif) | Python-data-access_RuLit_Me_619099.pdf | 2023-11-03 03:33 | 1.9M | |
![[ ]](/icons/unknown.gif) | Python - Visual QuickStart Guide (2001).chm | 2023-11-02 05:11 | 11M | |
![[ ]](/icons/layout.gif) | Python - How to Program, 1e (2002).pdf | 2023-11-02 05:11 | 25M | |
![[ ]](/icons/layout.gif) | Python - Create-Modify-Reuse (2008).pdf | 2023-11-02 05:11 | 6.3M | |
![[ ]](/icons/layout.gif) | Python---C---for-Beginners-Oct-2023.pdf | 2023-10-25 11:21 | 34M | |
![[ ]](/icons/layout.gif) | Programming with 64-Bit ARM Assembly Language.pdf | 2023-10-31 06:56 | 4.7M | |
![[ ]](/icons/layout.gif) | Programming in C Reema Thareja.pdf | 2023-11-03 06:28 | 166M | |
![[ ]](/icons/layout.gif) | Programming_in_Python_3_A_Complete.pdf | 2023-11-02 05:11 | 2.5M | |
![[ ]](/icons/layout.gif) | Programming_Your_Home_Automate_with.pdf | 2023-11-02 05:24 | 8.8M | |
![[ ]](/icons/layout.gif) | Programming_PyTorch_for_Deep_Learning_Creating_and_Deploying_Deep.pdf | 2023-11-02 10:49 | 6.2M | |
![[ ]](/icons/layout.gif) | Programming_PHP_OReilly.pdf | 2023-11-02 05:19 | 6.8M | |
![[ ]](/icons/layout.gif) | Programming_In_C_A_Complete_Introduction.pdf | 2023-11-02 05:29 | 1.7M | |
![[ ]](/icons/layout.gif) | Programming Python 4e - O'Reilly (2010).pdf | 2023-11-02 05:15 | 29M | |
![[ ]](/icons/unknown.gif) | Programming Python, 3rd Edition (2006).chm | 2023-11-02 05:11 | 9.7M | |
![[ ]](/icons/unknown.gif) | ProgrammingPHP2ndEd_R_LerdorfP_MacIntyreK.chm | 2023-11-02 05:21 | 1.7M | |
![[ ]](/icons/layout.gif) | Programming PHP.pdf | 2023-11-02 05:19 | 3.3M | |
![[ ]](/icons/layout.gif) | Programming Language.pdf | 2023-11-03 03:34 | 3.1M | |
![[ ]](/icons/layout.gif) | Programming Interviews Exposed 3rd Edition V413HAV.pdf | 2023-11-02 05:24 | 6.7M | |
![[ ]](/icons/layout.gif) | Programming Concurrency on the JVM.pdf | 2023-11-02 05:35 | 3.1M | |
![[ ]](/icons/layout.gif) | Programming Computer Vision with Python.pdf | 2023-11-02 05:11 | 69M | |
![[ ]](/icons/layout.gif) | Professional_WCF_4_Windows_Commu.pdf | 2023-11-02 05:15 | 28M | |
![[ ]](/icons/layout.gif) | Professional_Python_Frameworks_Web (2).pdf | 2023-11-02 05:11 | 10M | |
![[ ]](/icons/layout.gif) | Professional_Android_2_Application.pdf | 2023-11-02 04:32 | 20M | |
![[ ]](/icons/layout.gif) | Professional Java for Web Applications.pdf | 2023-11-02 04:32 | 11M | |
![[ ]](/icons/layout.gif) | Professional Java EE Design Patterns.pdf | 2023-11-02 04:32 | 11M | |
![[ ]](/icons/layout.gif) | Professional ASP.NET MVC 3.pdf | 2023-11-02 04:32 | 14M | |
![[ ]](/icons/layout.gif) | Production-Ready Applied Deep Learning.pdf | 2023-11-05 05:41 | 8.3M | |
![[ ]](/icons/layout.gif) | Problem Solving with Algorithms and Data Structures (en).pdf | 2023-11-03 03:43 | 4.2M | |
![[ ]](/icons/layout.gif) | Pro_WPF_CSharp_2010_dotNET_4.pdf | 2023-11-02 05:15 | 17M | |
![[ ]](/icons/layout.gif) | Pro_ASP_NET_MVC_3_Framework.pdf | 2023-11-02 04:33 | 11M | |
![[ ]](/icons/layout.gif) | Pro WPF and Silverlight MVVM.pdf | 2023-11-02 05:15 | 3.9M | |
![[ ]](/icons/layout.gif) | Pro WCF 4 Practical Microsoft SOA Implementation.pdf | 2023-11-02 05:15 | 10M | |
![[ ]](/icons/layout.gif) | Pro Spring Security.pdf | 2023-11-02 05:35 | 5.7M | |
![[ ]](/icons/layout.gif) | Pro Spring MVC with Web Flow.pdf | 2023-11-02 05:35 | 15M | |
![[ ]](/icons/layout.gif) | Pro Spring Integration.pdf | 2023-11-02 05:35 | 16M | |
![[ ]](/icons/layout.gif) | Pro Silverlight 4 in C#.pdf | 2023-11-02 05:15 | 19M | |
![[ ]](/icons/layout.gif) | Pro React 16.pdf | 2023-11-02 05:03 | 17M | |
![[ ]](/icons/layout.gif) | Pro LINQ 2010.pdf | 2023-11-02 05:15 | 7.0M | |
![[ ]](/icons/layout.gif) | Pro Java 8 Programming, 3rd Edition.pdf | 2023-11-02 05:35 | 8.9M | |
![[ ]](/icons/layout.gif) | Pro Java 8 Programming (3rd edition) (2015) (2).pdf | 2023-11-02 05:34 | 9.1M | |
![[ ]](/icons/layout.gif) | Pro JPA 2, 2nd Edition.pdf | 2023-11-02 05:35 | 3.4M | |
![[ ]](/icons/layout.gif) | Pro IronPython (2009).pdf | 2023-11-02 05:11 | 3.0M | |
![[ ]](/icons/layout.gif) | Pro Apache Struts with Ajax.pdf | 2023-11-02 04:33 | 7.9M | |
![[ ]](/icons/layout.gif) | Pro Apache Ant (Expert-s Voice in Java).pdf | 2023-11-02 04:33 | 7.6M | |
![[ ]](/icons/layout.gif) | Pro Android-3 (2).pdf | 2023-11-02 05:22 | 27M | |
![[ ]](/icons/layout.gif) | Pro ASP. NET MVC 5 [@ebookz].pdf | 2023-11-02 04:33 | 19M | |
![[ ]](/icons/layout.gif) | Pro ASP. NET MVC 3 Framework.pdf | 2023-11-02 04:33 | 12M | |
![[ ]](/icons/layout.gif) | Pro ASP.NET 4 in CSharp 2010 4th Edition.pdf | 2023-11-02 04:33 | 37M | |
![[ ]](/icons/layout.gif) | Pro.PHP.XML.and.Web.Services_Robert.Richards_Apress_2006 (2).pdf | 2023-11-02 05:19 | 3.8M | |
![[ ]](/icons/layout.gif) | Pro .NET 4 Parallel Programming in C#.pdf | 2023-11-02 04:33 | 3.8M | |
![[ ]](/icons/layout.gif) | Pro.C.2010.and.the..NET.4.Platform.Fifth.Edition.pdf | 2023-11-02 04:33 | 23M | |
![[ ]](/icons/layout.gif) | Pro.Android.Web.Apps.pdf | 2023-11-02 04:33 | 13M | |
![[ ]](/icons/layout.gif) | Prikladnoe_glubokoe_obuchenie_2020_Umberto_Mikeluchchi.pdf | 2023-11-02 10:46 | 39M | |
![[ ]](/icons/layout.gif) | Price-Intelligently-SaaS-Pricing-Strategy.pdf | 2023-10-31 06:53 | 2.5M | |
![[ ]](/icons/unknown.gif) | Prentice_Hall_Core_Web_Applicati.chm | 2023-11-02 04:33 | 4.3M | |
![[ ]](/icons/layout.gif) | Prentice_Hall_Core_Java_Volume_II.pdf | 2023-11-02 04:33 | 70M | |
![[ ]](/icons/layout.gif) | Prentice_Hall_Core_Java_Volume_I (2).pdf | 2023-11-02 05:32 | 37M | |
![[ ]](/icons/layout.gif) | Prentice.Hall.Android.for.Programmers.pdf | 2023-11-02 04:33 | 15M | |
![[ ]](/icons/unknown.gif) | Premier_Press_PHP_Fast_And_Easy.chm | 2023-11-02 04:33 | 3.3M | |
![[ ]](/icons/unknown.gif) | PremierPress-PHPProfessionalProjects.chm | 2023-11-02 04:33 | 16M | |
![[ ]](/icons/layout.gif) | Pragmatic_Programmer,_The_From_Journeyman.pdf | 2023-11-02 04:33 | 1.6M | |
![[ ]](/icons/layout.gif) | Practice_Of_Programming,_The_19991stBrian.pdf | 2023-11-02 04:33 | 4.8M | |
![[ ]](/icons/layout.gif) | Practical_Vulnerability_Management_A_Strategic_Approach_to_Managing.pdf | 2023-11-02 05:01 | 2.4M | |
![[ ]](/icons/compressed.gif) | Practical_Programming_Paul_Gries.zip | 2023-11-02 04:34 | 10M | |
![[ ]](/icons/layout.gif) | Practical_Programming_An_Introduction (2).pdf | 2023-11-02 05:11 | 9.2M | |
![[ ]](/icons/layout.gif) | Practical_Malware_Analysis.pdf | 2023-11-02 05:02 | 9.4M | |
![[ ]](/icons/layout.gif) | Practical_IoT_Hacking_The_Definitive_Guide_to_Attacking_the_Internet.pdf | 2023-11-02 05:02 | 38M | |
![[ ]](/icons/layout.gif) | Practical_Deep_Learning_for_Cloud,_Mobile,_and_Edge_2020_Koul,_Ganju.pdf | 2023-11-02 10:46 | 19M | |
![[ ]](/icons/layout.gif) | Practical_Computer_Vision_Applications_Using_Deep_Learning_with.pdf | 2023-11-02 11:14 | 9.6M | |
![[ ]](/icons/layout.gif) | Practical Social Engineering A Primer for the Ethical Hacker.pdf | 2023-11-02 05:02 | 6.7M | |
![[ ]](/icons/layout.gif) | Practical RichFaces, 2nd Edition.pdf | 2023-11-02 04:34 | 11M | |
![[ ]](/icons/layout.gif) | Practical RichFaces, 2nd Edition (2).pdf | 2023-11-02 05:35 | 11M | |
![[ ]](/icons/layout.gif) | Practical Object-Oriented Design in Ruby (2).pdf | 2023-11-02 05:19 | 1.3M | |
![[ ]](/icons/layout.gif) | Practical Machine Learning with Python (en).pdf | 2023-11-03 03:43 | 19M | |
![[ ]](/icons/layout.gif) | Practical LPIC-1 Linux Certification Study Guide.pdf | 2023-10-31 06:55 | 5.2M | |
![[ ]](/icons/layout.gif) | Practical Enterprise Data Lake Insights ( PDFDrive.com ).pdf | 2023-10-31 06:57 | 5.1M | |
![[ ]](/icons/layout.gif) | Practical Data Science Cookbook.pdf | 2023-11-02 09:57 | 5.1M | |
![[ ]](/icons/layout.gif) | Practical Data Science.pdf | 2023-10-31 06:56 | 7.6M | |
![[ ]](/icons/layout.gif) | Practical C Programming (1997)(3rd)(Steve Oualline) (2).pdf | 2023-11-02 05:29 | 10M | |
![[ ]](/icons/layout.gif) | Practical Artificial Intelligence.pdf | 2023-11-02 10:47 | 10M | |
![[ ]](/icons/layout.gif) | Practical.Android.Projects.pdf | 2023-11-02 04:34 | 17M | |
![[ ]](/icons/layout.gif) | PowerShell for Sysadmins Workflow Automation Made Easy.pdf | 2023-11-02 05:02 | 3.4M | |
![[ ]](/icons/layout.gif) | PowerShell Fast Track Hacks for Non-Coders.pdf | 2023-11-02 05:02 | 6.1M | |
![[ ]](/icons/layout.gif) | PostgreSQL High Availability Cookbook, 2nd Edition.pdf | 2023-10-31 06:56 | 6.2M | |
![[ ]](/icons/layout.gif) | PostgreSQL Development Essentials.pdf | 2023-10-31 06:56 | 4.2M | |
![[ ]](/icons/layout.gif) | PostgreSQL Developer s Guide.pdf | 2023-10-31 06:56 | 1.2M | |
![[ ]](/icons/layout.gif) | PostgreSQL Cookbook.pdf | 2023-10-31 06:56 | 2.8M | |
![[ ]](/icons/layout.gif) | Portlets in Action (2).pdf | 2023-11-02 05:34 | 17M | |
![[ ]](/icons/layout.gif) | Portlet Spec 3.0-JSR-362 (2).pdf | 2023-11-02 05:24 | 4.1M | |
![[ ]](/icons/layout.gif) | Polity Free Model Papers Telugu .pdf | 2023-11-02 10:39 | 492K | |
![[ ]](/icons/unknown.gif) | PhpDevelopersCookbookSecondEditionSams.chm | 2023-11-02 04:34 | 606K | |
![[ ]](/icons/layout.gif) | Photoshop-for-Beginners-Oct-2023.pdf | 2023-10-25 11:21 | 52M | |
![[ ]](/icons/layout.gif) | Peter_Elger,_Eoin_Shanaghy_AI_as_a_Service_Manning_Publications.pdf | 2023-11-02 10:46 | 28M | |
![[ ]](/icons/unknown.gif) | Perl To Python Migration (2001).chm | 2023-11-02 04:34 | 426K | |
![[ ]](/icons/layout.gif) | Peachpit.Press.PHP.5.Advanced.Mar.2007.pdf | 2023-11-02 04:34 | 11M | |
![[ ]](/icons/layout.gif) | Paolo_Perrotta_Programming_Machine_Learning_From_Coding_to_Deep.pdf | 2023-11-02 10:50 | 52M | |
![[ ]](/icons/layout.gif) | Packtpub.Android.Database.Programming.Jun.2012.pdf | 2023-11-02 04:34 | 3.0M | |
![[ ]](/icons/layout.gif) | Packt_Xamarin_Mobile_Application (4).pdf | 2023-11-02 05:17 | 4.0M | |
![[ ]](/icons/layout.gif) | Packt_Xamarin_Mobile_Application (3).pdf | 2023-11-02 05:16 | 3.5M | |
![[ ]](/icons/layout.gif) | Packt_IOS_Development_with_Xamarin.pdf | 2023-11-02 04:34 | 4.5M | |
![[ ]](/icons/layout.gif) | Packt.Xamarin.Dec.2014.ISBN.178355083X.pdf | 2023-11-02 04:34 | 3.1M | |
![[ ]](/icons/layout.gif) | PYTHON.pdf | 2023-10-25 06:22 | 829K | |
![[ ]](/icons/unknown.gif) | PHPfortheWorldWideWebVisualQuickStartGuide.chm | 2023-11-02 04:58 | 8.9M | |
![[ ]](/icons/compressed.gif) | PHP and PostgreSQL Programming By Example.tgz | 2023-11-02 04:34 | 6.4M | |
![[ ]](/icons/layout.gif) | PHP and MySQL The Missing Manual Second Edition (2).pdf | 2023-11-02 05:20 | 25M | |
![[ ]](/icons/layout.gif) | PHP and MySQL - 24-Hour Trainer.pdf | 2023-11-02 04:34 | 58M | |
![[ ]](/icons/layout.gif) | PHP_by_Example.pdf | 2023-11-02 04:34 | 2.5M | |
![[ ]](/icons/layout.gif) | PHP_and_MySQL_Web_Development_AIO.pdf | 2023-11-02 04:58 | 11M | |
![[ ]](/icons/layout.gif) | PHP_Solutions_Dynamic_Web_Design_Made_Easy_-_Friends_of_Ed (2).pdf | 2023-11-02 05:20 | 8.9M | |
![[ ]](/icons/layout.gif) | PHP Solutions 2nd Edition[A4].pdf | 2023-11-02 04:34 | 31M | |
![[ ]](/icons/layout.gif) | PHPProgrammingWithPEAR.pdf | 2023-11-02 04:34 | 5.3M | |
![[ ]](/icons/layout.gif) | PHPObjectOrientedSolutions (2).pdf | 2023-11-02 05:19 | 6.8M | |
![[ ]](/icons/layout.gif) | PHPGameProgramming (2).pdf | 2023-11-02 05:19 | 5.3M | |
![[ ]](/icons/layout.gif) | PHP 6 and MySQL 5.pdf | 2023-11-02 04:34 | 13M | |
![[ ]](/icons/layout.gif) | PHP6_MySQL_Programming_for_the_Absolute_Beginner (2).pdf | 2023-11-02 05:20 | 4.7M | |
![[ ]](/icons/layout.gif) | PHP 6MySQL Programming for the Absolute Beginner.pdf | 2023-11-02 04:34 | 8.5M | |
![[ ]](/icons/layout.gif) | PHP 6 FAST & EASY WEB DEVELOPMENT.pdf | 2023-11-02 05:20 | 7.6M | |
![[ ]](/icons/layout.gif) | PHP6, Apache,MySQL Web Development.pdf | 2023-11-02 04:34 | 12M | |
![[ ]](/icons/layout.gif) | PHP5PowerPrograming (2).pdf | 2023-11-02 05:20 | 9.4M | |
![[ ]](/icons/unknown.gif) | PHP.Hacks_Jack.Herrington_O.Reilly_2005.chm | 2023-11-02 04:58 | 3.8M | |
![[ ]](/icons/layout.gif) | PHP & MySQL for Dummies,Second Ed@englishbooks (2).pdf | 2023-11-02 05:28 | 9.5M | |
![[ ]](/icons/layout.gif) | PHP & MySQL For Dummies 3rd Ed Nov 2006@englishbooks (2).pdf | 2023-11-02 05:28 | 7.0M | |
![[ ]](/icons/layout.gif) | PHP & MySQL Everyday Apps for Dummies@englishbooks (2).pdf | 2023-11-02 05:28 | 6.6M | |
![[ ]](/icons/layout.gif) | PEP-8 Cheatsheet (2009) (2).pdf | 2023-11-02 05:15 | 12K | |
![[ ]](/icons/layout.gif) | Ostrander_J_Android_UI_Fundamentals.pdf | 2023-11-02 04:34 | 3.6M | |
![[ ]](/icons/layout.gif) | Oreilly_Developing_Android_Applications.pdf | 2023-11-02 04:35 | 8.6M | |
![[ ]](/icons/layout.gif) | Oreilly.Learning.Android.Mar.2011 (2).pdf | 2023-11-02 05:22 | 9.5M | |
![[ ]](/icons/layout.gif) | Oracle_PLslashSQL_Language_Pocket_Reference_Fifth_Edition.pdf | 2023-11-02 04:35 | 1.8M | |
![[ ]](/icons/layout.gif) | Oracle_Certified_Professional_Java.pdf | 2023-11-02 04:35 | 3.7M | |
![[ ]](/icons/layout.gif) | Oracle SOA Suite 11g Handbook.pdf | 2023-11-02 04:35 | 25M | |
![[ ]](/icons/layout.gif) | Oracle PLSQL Programming, 6th Edition.pdf | 2023-11-02 04:35 | 15M | |
![[ ]](/icons/layout.gif) | Oracle PLSQL For Dummies@englishbooks.pdf | 2023-11-02 04:35 | 7.1M | |
![[ ]](/icons/layout.gif) | Oracle Database Transactions and Locking Revealed.pdf | 2023-11-02 04:58 | 1.7M | |
![[ ]](/icons/layout.gif) | Oracle Certified Associate, Java SE 7 Programmer Study Guide.pdf | 2023-11-02 04:35 | 2.4M | |
![[ ]](/icons/layout.gif) | Oracle 11G- SQL.pdf | 2023-11-02 04:35 | 15M | |
![[ ]](/icons/layout.gif) | Operating Systems Design & Implementation 3rd Edition(1).pdf | 2023-11-02 04:35 | 8.5M | |
![[ ]](/icons/layout.gif) | Operating Systems Design & Implementation 3rd Edition(1) (2).pdf | 2023-11-02 05:19 | 8.5M | |
![[ ]](/icons/layout.gif) | OpenLDAP-Admin-Guide.pdf | 2023-11-02 04:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Official_Google_Cloud_Certified_Associate_Cloud_Engineer_Study_Guide.pdf | 2023-11-01 06:55 | 63M | |
![[ ]](/icons/layout.gif) | Objects First with Java, 5th Edition (2).pdf | 2023-11-02 05:13 | 7.4M | |
![[ ]](/icons/compressed.gif) | Objective_C_Programming_The_Big_.zip | 2023-11-02 04:35 | 6.8M | |
![[ ]](/icons/layout.gif) | Object_Oriented_Programming_With (2).pdf | 2023-11-02 05:31 | 1.2M | |
![[ ]](/icons/layout.gif) | ObjectOrientedProgrammingWithObjectiveC.pdf | 2023-11-02 04:58 | 486K | |
![[ ]](/icons/layout.gif) | Object-Oriented Data Structures Using Java - Nell Dale.pdf | 2023-11-02 04:35 | 15M | |
![[ ]](/icons/layout.gif) | OSGi-Specification-From-OSGi Community.pdf | 2023-11-02 04:35 | 12M | |
![[ ]](/icons/layout.gif) | OReilly_RESTful_Java_With_JAXRS.pdf | 2023-11-02 04:35 | 7.1M | |
![[ ]](/icons/layout.gif) | OReilly Programming Android (2011).pdf | 2023-11-02 04:35 | 10M | |
![[ ]](/icons/layout.gif) | OReilly Programming Android (2011) (2).pdf | 2023-11-02 05:22 | 10M | |
![[ ]](/icons/layout.gif) | OReilly Learning Android (2011).pdf | 2023-11-02 04:35 | 9.5M | |
![[ ]](/icons/unknown.gif) | OReilly.Programming.PHP.2nd.Edition.Apr.20062.chm | 2023-11-02 04:35 | 1.7M | |
![[ ]](/icons/unknown.gif) | OReilly.PHP.Cookbook.2nd.Edition.Aug.2006.chm | 2023-11-02 04:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | OReilly.Learning.PHP.and.MySQL.Jun.2006.chm | 2023-11-02 04:35 | 4.2M | |
![[ ]](/icons/layout.gif) | OReilly.Learning.PHP.and.MySQL.2nd.Edition.Aug.20072.pdf | 2023-11-02 04:35 | 6.2M | |
![[ ]](/icons/unknown.gif) | OReilly.Learning.PHP.5 (2).chm | 2023-11-02 05:21 | 1.2M | |
![[ ]](/icons/unknown.gif) | OReilly-PHPPocketReference-2ndEdition.chm | 2023-11-02 04:35 | 97K | |
![[ ]](/icons/unknown.gif) | OReilly-PHPPocketReference-2ndEdition (2).chm | 2023-11-02 05:21 | 97K | |
![[ ]](/icons/layout.gif) | OOP - Learn Object Oriented Thinking and Programming.pdf | 2023-11-02 04:35 | 6.4M | |
![[ ]](/icons/layout.gif) | OCP_Java_SE_7_Programmer_II_Certification.pdf | 2023-11-02 04:35 | 11M | |
![[ ]](/icons/layout.gif) | OCP-CERTIFIED-PROFESSIONAL-PROGRAMMER-1Z0-809.pdf | 2023-11-02 04:35 | 13M | |
![[ ]](/icons/layout.gif) | OCA_ORACLE_CERTIFIED_ASSOCIATE_JAVA.pdf | 2023-11-02 04:35 | 3.0M | |
![[ ]](/icons/layout.gif) | OCAOCP_Java_SE_7_Programmer_I_II.pdf | 2023-11-02 04:35 | 7.7M | |
![[ ]](/icons/layout.gif) | OCA Java SE 7 Programmer I Certification Guide (2).pdf | 2023-11-02 05:13 | 6.6M | |
![[ ]](/icons/layout.gif) | Numerical_Recipes_in_C_The_Art_of.pdf | 2023-11-02 04:36 | 19M | |
![[ ]](/icons/layout.gif) | Numerical Methods in Engineering with Python (2005).pdf | 2023-11-02 04:36 | 7.1M | |
![[ ]](/icons/layout.gif) | Numerical Methods in Engineering with Python (2005) (2).pdf | 2023-11-02 05:11 | 7.1M | |
![[ ]](/icons/layout.gif) | Noor-Bookcom c plus plus خطوة بخطوة_230404_094553.pdf | 2023-11-02 04:31 | 4.1M | |
![[ ]](/icons/layout.gif) | Node_js_Design_Patterns,_3rd_Edition_by_Mario_Casciaro,_Luciano.pdf | 2023-10-31 06:53 | 8.1M | |
![[ ]](/icons/layout.gif) | No_Starch_Press_Object_Oriented.pdf | 2023-11-02 04:36 | 4.2M | |
![[ ]](/icons/unknown.gif) | Next-Generation Web Frameworks in Python (2007) (2).chm | 2023-11-02 05:11 | 478K | |
![[ ]](/icons/layout.gif) | Neural_Networks_and_Deep_Learning_A_Textbook_by_Charu_C_Aggarwal.pdf | 2023-11-02 10:51 | 5.1M | |
![[ ]](/icons/layout.gif) | Neural_Networks_and_Deep_Learning_A_Textbook_by_Charu_C_Aggarwal (2).pdf | 2023-11-02 10:52 | 5.1M | |
![[ ]](/icons/layout.gif) | Networking_AIO_Desk_Reference_for (2).pdf | 2023-11-02 05:26 | 20M | |
![[ ]](/icons/layout.gif) | Networking 7th Ed For Dummies@englishbooks (2).pdf | 2023-11-02 05:26 | 9.2M | |
![[ ]](/icons/layout.gif) | Natural Language Processing with Python (2009).pdf | 2023-11-02 04:36 | 3.1M | |
![[ ]](/icons/layout.gif) | Natural Language Processing Recipes (en).pdf | 2023-11-02 10:49 | 3.8M | |
![[ ]](/icons/layout.gif) | Natural-Language-Processing-Python.pdf | 2023-11-02 10:49 | 9.7M | |
![[ ]](/icons/layout.gif) | NOTES_SUBJECT_DATA_STRUCTURES-converted.pdf | 2023-11-02 09:16 | 3.5M | |
![[ ]](/icons/layout.gif) | MySQLandPHPDatabaseApplications.pdf | 2023-11-02 04:36 | 3.5M | |
![[ ]](/icons/layout.gif) | MySQLandPHPDatabaseApplications (2).pdf | 2023-11-02 05:20 | 3.5M | |
![[ ]](/icons/unknown.gif) | Murach's Android Programming@englishbooks.part2.rar | 2023-11-02 04:37 | 50M | |
![[ ]](/icons/unknown.gif) | Murach's Android Programming@englishbooks.part1.rar | 2023-11-02 04:37 | 101M | |
![[ ]](/icons/unknown.gif) | Murach’s Beginning Java with NetBeans.part2.rar | 2023-11-02 04:36 | 51M | |
![[ ]](/icons/layout.gif) | MongoDB for Java Developers.pdf | 2023-11-02 04:36 | 2.0M | |
![[ ]](/icons/layout.gif) | Modern_PHP_new_features_and_good_practices_by_Josh_Lockhart_z_lib.pdf | 2023-11-03 03:40 | 8.1M | |
![[ ]](/icons/layout.gif) | Modern_API_Design_with_ASP_NET_Core_2_Building_Cross_Platform_Back.pdf | 2023-10-31 06:56 | 4.8M | |
![[ ]](/icons/layout.gif) | Modern Windows Exploit Development.pdf | 2023-11-02 04:58 | 19M | |
![[ ]](/icons/layout.gif) | Modern Compiler Design 2nd Edition V413HAV.pdf | 2023-11-02 04:36 | 4.2M | |
![[ ]](/icons/layout.gif) | Mockito for Spring.pdf | 2023-11-02 04:36 | 1.6M | |
![[ ]](/icons/layout.gif) | Mobile_Python_Rapid_Prototyping.pdf | 2023-11-02 04:36 | 3.0M | |
![[ ]](/icons/layout.gif) | Mobile-app in react native (2).pdf | 2023-11-02 05:14 | 348K | |
![[ ]](/icons/layout.gif) | Milette_G_,_Stroud_A_Professional.pdf | 2023-11-02 04:36 | 15M | |
![[ ]](/icons/layout.gif) | Milano_Diego_Torres___Android_Ap.pdf | 2023-11-02 04:36 | 7.0M | |
![[ ]](/icons/layout.gif) | Milano_Diego_Torres___Android_Ap (2).pdf | 2023-11-02 05:22 | 7.0M | |
![[ ]](/icons/layout.gif) | Microsoft_SQL_Server_2008_R2_Administration (2).pdf | 2023-11-02 05:29 | 14M | |
![[ ]](/icons/layout.gif) | Microsoft_SQL_Server_2005_Reporting.pdf | 2023-11-02 04:36 | 11M | |
![[ ]](/icons/layout.gif) | Microsoft_SQL_Server_2005_Programming.pdf | 2023-11-02 04:36 | 5.3M | |
![[ ]](/icons/layout.gif) | Microsoft_SQL_Server_2005_Express.pdf | 2023-11-02 04:36 | 8.9M | |
![[ ]](/icons/layout.gif) | Microsoft_Press_Microsoft_Visual (2).pdf | 2023-11-02 05:15 | 16M | |
![[ ]](/icons/layout.gif) | Microsoft_Access_2013_Complete,.pdf | 2023-11-02 04:36 | 87M | |
![[ ]](/icons/unknown.gif) | Microsoft SQL Server 2008 R2 Administration Cookbook_Code (2).rar | 2023-11-02 05:29 | 31K | |
![[ ]](/icons/layout.gif) | Microsoft SQL Server 2005 for Dummies@englishbooks.pdf | 2023-11-02 04:36 | 11M | |
![[ ]](/icons/layout.gif) | Microsoft Excel Advanced Functions And Formulas.pdf | 2023-11-01 06:56 | 3.8M | |
![[ ]](/icons/layout.gif) | Metasploit_The_Penetration_Teste (2).pdf | 2023-11-02 05:24 | 6.9M | |
![[ ]](/icons/layout.gif) | Merrifield_Mew_K_Android_3_0_Application.pdf | 2023-11-02 04:36 | 9.6M | |
![[ ]](/icons/layout.gif) | Mednieks Zigurd - Programming Android - 2011.pdf | 2023-11-02 04:36 | 12M | |
![[ ]](/icons/layout.gif) | Mednieks Z. - Programming Android 2nd Edition - 2012.pdf | 2023-11-02 04:36 | 8.2M | |
![[ ]](/icons/layout.gif) | Mednieks Z. - Programming Android 2nd Edition - 2012 (2).pdf | 2023-11-02 05:22 | 8.2M | |
![[ ]](/icons/layout.gif) | Matplotlib for Python Developers (2009).pdf | 2023-11-02 04:36 | 11M | |
![[ ]](/icons/layout.gif) | Mastering_pandas_for_Finance_Master_pandas,_an_open_source_Python.pdf | 2023-11-02 11:17 | 7.0M | |
![[ ]](/icons/layout.gif) | Mastering_Kali_Linux_for_Advanced.pdf | 2023-11-02 04:58 | 9.0M | |
![[ ]](/icons/layout.gif) | Mastering_Algorithms_With_C_Useful.pdf | 2023-11-02 04:37 | 5.0M | |
![[ ]](/icons/layout.gif) | Mastering_Algorithms_With_C_Useful (2).pdf | 2023-11-02 05:31 | 5.0M | |
![[ ]](/icons/layout.gif) | Mastering Python for Data Science.pdf | 2023-11-02 09:57 | 5.9M | |
![[ ]](/icons/layout.gif) | Mastering Python Networking - Fourth Edition.pdf | 2023-11-02 05:01 | 35M | |
![[ ]](/icons/layout.gif) | Mastering NetBeans.pdf | 2023-11-02 04:36 | 12M | |
![[ ]](/icons/layout.gif) | Mastering Apache Spark (2).pdf | 2023-11-02 05:13 | 17M | |
![[ ]](/icons/layout.gif) | Mark_L_Murphy_Android_Programming.pdf | 2023-11-02 04:37 | 11M | |
![[ ]](/icons/layout.gif) | Mark_Allen_Weiss_Data_Structures.pdf | 2023-11-02 04:37 | 3.5M | |
![[ ]](/icons/layout.gif) | Mark Allen Weiss Solution Manual.pdf | 2023-11-02 04:37 | 233K | |
![[ ]](/icons/layout.gif) | Mario Zechner - Beginning Android Games - 2011 (2).pdf | 2023-11-02 05:23 | 47M | |
![[ ]](/icons/layout.gif) | Many Free resources to learn and Apply AI.pdf | 2023-11-02 11:17 | 12M | |
![[ ]](/icons/layout.gif) | Manning.PHP.in.Action.Jun.2007.pdf | 2023-11-02 04:37 | 9.0M | |
![[ ]](/icons/layout.gif) | Malware_Analysis_Using_Artificial_Intelligence_and_Deep_Learning.pdf | 2023-11-02 05:01 | 48M | |
![[ ]](/icons/layout.gif) | Making Use of Python (2002).pdf | 2023-11-02 04:37 | 6.9M | |
![[ ]](/icons/layout.gif) | Making Embedded Systems.pdf | 2023-11-17 04:06 | 33M | |
![[ ]](/icons/layout.gif) | Make_Money_On_The_Internet_How_To_Turn_Your_Website_Into_A_Cash.pdf | 2023-11-02 05:04 | 3.8M | |
![[ ]](/icons/layout.gif) | Make Your Own Neural Network by Tariq Rashid.pdf | 2023-11-02 10:53 | 7.5M | |
![[ ]](/icons/layout.gif) | Machine_Learning_in_Finance_From_Theory_to_Practice_by_Matthew_F.pdf | 2023-11-02 11:16 | 9.5M | |
![[ ]](/icons/layout.gif) | Machine_Learning_for_Beginners_A_Complete_and_Phased_Beginner’s.pdf | 2023-11-02 11:16 | 1.7M | |
![[ ]](/icons/layout.gif) | Machine_Learning_and_Big_Data_Analytics_Paradigms_Analysis,1.pdf | 2023-11-13 10:17 | 24M | |
![[ ]](/icons/layout.gif) | Machine_Learning_With_Python_For_Everyone_Addison_Wesley_Professional.pdf | 2023-10-25 07:21 | 9.0M | |
![[ ]](/icons/layout.gif) | Machine Learning with Python Cookbook (en).pdf | 2023-11-03 03:43 | 3.4M | |
![[ ]](/icons/layout.gif) | Machine Learning for Cloud Management.pdf | 2023-10-31 04:44 | 8.5M | |
![[ ]](/icons/layout.gif) | Machine Learning With Python - Copy.pdf | 2023-11-02 05:03 | 18M | |
![[ ]](/icons/layout.gif) | Machine Learning For Dummies.pdf | 2023-11-20 04:06 | 1.8M | |
![[ ]](/icons/layout.gif) | Machine Learning For Absolute Beginners (1).pdf | 2023-10-29 12:08 | 2.6M | |
![[ ]](/icons/layout.gif) | Machine Learning Concepts Simplified .pdf | 2023-11-02 11:17 | 9.6M | |
![[ ]](/icons/layout.gif) | Mac Studio For Beginners October 2023.pdf | 2023-11-05 05:41 | 56M | |
![[ ]](/icons/layout.gif) | MP Programming Microsoft ASP. NET MVC 3rd Edition.pdf | 2023-11-02 04:36 | 11M | |
![[ ]](/icons/layout.gif) | MLOps+Masterclass+November+2023.pdf | 2023-10-25 06:23 | 6.1M | |
![[ ]](/icons/layout.gif) | MLOps+Masterclass+November+2023 (1).pdf | 2023-11-09 13:06 | 6.1M | |
![[ ]](/icons/layout.gif) | ML Algorithms.pdf | 2023-11-02 05:00 | 151K | |
![[ ]](/icons/unknown.gif) | MICROSOFT_PRESS_EBOOK_CREATINGMOBILEAPPSWITHXAMARINFORMS_PDF.PDF | 2023-11-02 04:36 | 56M | |
![[ ]](/icons/layout.gif) | Longstaff2014.pdf | 2023-11-02 09:54 | 5.6M | |
![[ ]](/icons/compressed.gif) | Lock_Picking_for_Beginners_A_Complete_Step_by_Step_Visual_Guide.zip | 2023-11-02 05:01 | 835K | |
![[ ]](/icons/layout.gif) | Linux Timesaving Techniques For Dummies@englishbooks.pdf | 2023-11-02 04:37 | 15M | |
![[ ]](/icons/layout.gif) | Linux Smart Homes For Dummies@englishbooks.pdf | 2023-11-02 04:37 | 9.5M | |
![[ ]](/icons/layout.gif) | Linux For Dummies 8th Ed@englishbooks (2).pdf | 2023-11-02 05:26 | 9.3M | |
![[ ]](/icons/layout.gif) | Linux For Dummies 7th Ed@englishbooks.pdf | 2023-11-02 04:37 | 9.8M | |
![[ ]](/icons/layout.gif) | Linux For Dummies 6th Ed@englishbooks.pdf | 2023-11-02 04:37 | 11M | |
![[ ]](/icons/layout.gif) | Linux Basics for Hackers.pdf | 2023-11-02 05:01 | 8.7M | |
![[ ]](/icons/layout.gif) | Linux AIO Desk Reference For Dummies@englishbooks.pdf | 2023-11-02 04:37 | 19M | |
![[ ]](/icons/layout.gif) | Liferay in Action (2).pdf | 2023-11-02 05:34 | 21M | |
![[ ]](/icons/layout.gif) | Liferay Portal Performance Best Practices (2).pdf | 2023-11-02 05:34 | 2.1M | |
![[ ]](/icons/layout.gif) | Liferay Portal 6 Enterprise Intranets.pdf | 2023-11-02 04:37 | 7.1M | |
![[ ]](/icons/layout.gif) | LiferayCookBook.pdf | 2023-11-02 04:37 | 6.1M | |
![[ ]](/icons/layout.gif) | Liferay 6.2 Developer Guide-portal.pdf | 2023-11-02 04:37 | 14M | |
![[ ]](/icons/layout.gif) | Liferay.User.Interface.Development.pdf | 2023-11-02 04:37 | 8.3M | |
![[ ]](/icons/layout.gif) | Liferay.Beginners.Guide.Quick.And.Easy.Techniques.pdf | 2023-11-02 04:37 | 12M | |
![[ ]](/icons/layout.gif) | Liferay-Portlet-Development.pdf | 2023-11-02 04:37 | 610K | |
![[ ]](/icons/layout.gif) | Let Us Python Python Is Future, Embrace It Fast (Second).pdf | 2023-11-03 06:28 | 34M | |
![[ ]](/icons/layout.gif) | Let Us C++, Yashwant Kanetkar.pdf | 2023-11-03 06:50 | 4.3M | |
![[ ]](/icons/layout.gif) | Let's Build a Compiler (Jack Crenshaw).pdf | 2023-11-02 04:37 | 568K | |
![[ ]](/icons/layout.gif) | Lecture9.pdf | 2023-11-02 05:04 | 307K | |
![[ ]](/icons/layout.gif) | Learn kotlin.pdf | 2023-11-02 04:38 | 1.4M | |
![[ ]](/icons/layout.gif) | Learning to Program - Python (2006).pdf | 2023-11-02 04:38 | 1.1M | |
![[ ]](/icons/layout.gif) | Learning to Love Data Science.pdf | 2023-11-02 09:57 | 2.2M | |
![[ ]](/icons/layout.gif) | Learning scikit-learn_ Machine Learning in Python (en).pdf | 2023-11-03 03:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Learning_Python_5th_Edition_Mark_Lutz(www.ebook-dl.com) (2).zip | 2023-11-02 05:25 | 18M | |
![[ ]](/icons/layout.gif) | Learning_PHP,_MySQL,_and_JavaScript (2).pdf | 2023-11-02 05:20 | 9.6M | |
![[ ]](/icons/compressed.gif) | Learning_Java_Patrick_Niemeyer_Daniel_Leuckwww.zip | 2023-11-02 04:38 | 20M | |
![[ ]](/icons/layout.gif) | Learning Vaadin 7, Second Edition.pdf | 2023-11-02 04:38 | 6.7M | |
![[ ]](/icons/layout.gif) | Learning Python, Fourth Edition (2009).pdf | 2023-11-02 04:38 | 16M | |
![[ ]](/icons/layout.gif) | Learning Pandas.pdf | 2023-11-02 05:00 | 1.8M | |
![[ ]](/icons/layout.gif) | LearningPHPMySQL2nded.OReilly2007.pdf | 2023-11-02 04:38 | 5.9M | |
![[ ]](/icons/unknown.gif) | LearningPHP5.chm | 2023-11-02 04:38 | 1.2M | |
![[ ]](/icons/layout.gif) | Learning JavaScript Design Patterns.pdf | 2023-11-02 04:38 | 2.5M | |
![[ ]](/icons/layout.gif) | Learning HBase.pdf | 2023-11-02 04:38 | 20M | |
![[ ]](/icons/layout.gif) | Learning Go Programming by Vladimir Vivien (z-lib.org).pdf | 2023-11-03 03:40 | 4.6M | |
![[ ]](/icons/layout.gif) | Learning AngularJS.pdf | 2023-11-02 04:38 | 3.4M | |
![[ ]](/icons/layout.gif) | Learn_SQL_in_One_Day_and_Learn_It_Well_SQL_for_Beginners_with_Hands.pdf | 2023-11-02 11:16 | 2.2M | |
![[ ]](/icons/layout.gif) | Learn_PHP_7_Object_Oriented_Modular_Programming_using_HTML5,_CSS3.pdf | 2023-11-02 05:04 | 5.3M | |
![[ ]](/icons/layout.gif) | Learn Python The Hard Way 3rd Edition V413HAV.pdf | 2023-11-02 04:38 | 2.6M | |
![[ ]](/icons/layout.gif) | Learn PySpark.pdf | 2023-11-02 10:48 | 10M | |
![[ ]](/icons/layout.gif) | Learn Php MySql and Css(2012)[A4] (2).pdf | 2023-11-02 05:20 | 15M | |
![[ ]](/icons/layout.gif) | Learn Numpy.pdf | 2023-11-03 07:48 | 1.6M | |
![[ ]](/icons/layout.gif) | Learn Linux Shell Scripting Fundamentals of Bash 4.4.pdf | 2023-11-02 05:02 | 5.8M | |
![[ ]](/icons/layout.gif) | Learn Keras for Deep Neural Networks (en).pdf | 2023-11-02 10:53 | 2.7M | |
![[ ]](/icons/layout.gif) | Learn JavaFX 8.pdf | 2023-11-02 04:38 | 14M | |
![[ ]](/icons/layout.gif) | LearnJava.pdf | 2023-11-02 05:04 | 5.8M | |
![[ ]](/icons/layout.gif) | Learn C++ In A DAY.pdf | 2023-11-02 04:38 | 379K | |
![[ ]](/icons/layout.gif) | Large Scale Machine Learning with Python (en).pdf | 2023-11-03 03:42 | 4.3M | |
![[ ]](/icons/layout.gif) | Lafore_R_Object_oriented_programming_in_Turbo_C++,_Galgotia_publications.pdf | 2023-11-03 07:08 | 13M | |
![[ ]](/icons/layout.gif) | LRS(1).pdf | 2023-11-02 10:50 | 3.2M | |
![[ ]](/icons/layout.gif) | L1_MSDOS_Primer.pdf | 2023-11-02 05:03 | 185K | |
![[ ]](/icons/layout.gif) | KomatineniSatyaProAndroid3-2011.pdf | 2023-11-02 04:38 | 24M | |
![[ ]](/icons/layout.gif) | Khalid Mughal 3rd Edition (2).pdf | 2023-11-02 05:13 | 6.9M | |
![[ ]](/icons/layout.gif) | Kali Linux Wireless Penetration Testing Beginner-s Guide.pdf | 2023-11-03 03:36 | 16M | |
![[ ]](/icons/unknown.gif) | Jython For Java Programmers, First Edition (2001) (2).chm | 2023-11-02 05:11 | 713K | |
![[ ]](/icons/layout.gif) | Just Spring Data Access (2).pdf | 2023-11-02 05:13 | 2.3M | |
![[ ]](/icons/layout.gif) | John_Wiley___Sons_-_MySQL_PHP_Database_Applications__Second_ (2).pdf | 2023-11-02 05:20 | 5.5M | |
![[ ]](/icons/layout.gif) | JohnWileySons-PHPandMySQLforDummiesSecondEdition.pdf | 2023-11-02 04:38 | 9.5M | |
![[ ]](/icons/layout.gif) | JohnWileySons-PHP5ForDummies.pdf | 2023-11-02 04:38 | 6.0M | |
![[ ]](/icons/layout.gif) | Joe_Papa_PyTorch_Pocket_Reference_Building_and_Deploying_Deep_Learning.pdf | 2023-11-02 10:45 | 6.7M | |
![[ ]](/icons/layout.gif) | Jenkins The Definitive Guide (2).pdf | 2023-11-02 05:13 | 28M | |
![[ ]](/icons/layout.gif) | Javascript Tutorial.pdf | 2023-11-02 04:39 | 2.1M | |
![[ ]](/icons/layout.gif) | Java data structures.pdf | 2023-11-02 04:59 | 2.9M | |
![[ ]](/icons/layout.gif) | Java_preview.pdf | 2023-11-02 05:03 | 577K | |
![[ ]](/icons/compressed.gif) | Java_Programming_Seventh_Edition.zip | 2023-11-02 04:39 | 21M | |
![[ ]](/icons/layout.gif) | Java_Logical_Operators.pdf | 2023-11-02 05:03 | 163K | |
![[ ]](/icons/compressed.gif) | Java_How_to_Program_9th_Edition_.zip | 2023-11-02 04:57 | 19M | |
![[ ]](/icons/layout.gif) | Java_Graphical_User_Interfaces_0.pdf | 2023-11-02 05:03 | 3.4M | |
![[ ]](/icons/layout.gif) | Java_Arithmetic_Operators.pdf | 2023-11-02 05:03 | 157K | |
![[ ]](/icons/compressed.gif) | Java_A_Beginner_Guide_Sixth_Edit.zip | 2023-11-02 04:40 | 10M | |
![[ ]](/icons/layout.gif) | Java Web Services Up and Running, 2nd Edition (2).pdf | 2023-11-02 05:13 | 9.3M | |
![[ ]](/icons/compressed.gif) | JavaWebServiceTutorialPack 2.0 (Complete).zip | 2023-11-02 04:38 | 2.3M | |
![[ ]](/icons/layout.gif) | JavaWebServiceTutorial.pdf | 2023-11-02 04:38 | 1.7M | |
![[ ]](/icons/layout.gif) | Java Virtual Machine Specs 8 (2).pdf | 2023-11-02 05:32 | 2.1M | |
![[ ]](/icons/layout.gif) | Java Virtual Machine.pdf | 2023-11-02 04:39 | 3.0M | |
![[ ]](/icons/layout.gif) | Java Servlet Programming.pdf | 2023-11-02 04:39 | 4.7M | |
![[ ]](/icons/layout.gif) | Java Servlet Programming (2).pdf | 2023-11-02 05:13 | 4.7M | |
![[ ]](/icons/layout.gif) | JavaServer Faces_ Introduction By Example ( PDFDrive.com ).pdf | 2023-11-02 05:04 | 4.2M | |
![[ ]](/icons/layout.gif) | JavaScript Quick Syntax Reference (2).pdf | 2023-11-02 05:13 | 1.0M | |
![[ ]](/icons/layout.gif) | JavaScript Quick Reference For Dummies@englishbooks.pdf | 2023-11-02 05:26 | 30M | |
![[ ]](/icons/layout.gif) | JavaScript 4th Ed For Dummies@englishbooks (2).pdf | 2023-11-02 05:26 | 43M | |
![[ ]](/icons/layout.gif) | JavaScript & AJAX.pdf | 2023-11-02 04:39 | 23M | |
![[ ]](/icons/layout.gif) | Java SE 8 for the Really Impatient (2).pdf | 2023-11-02 05:14 | 7.4M | |
![[ ]](/icons/layout.gif) | Java Puzzlers-Joshua Bloch, Neal Gafter (2).pdf | 2023-11-02 05:30 | 4.8M | |
![[ ]](/icons/layout.gif) | Java Programming Interviews Exposed (2).pdf | 2023-11-02 05:14 | 4.8M | |
![[ ]](/icons/layout.gif) | Java Phrasebook.pdf | 2023-11-02 04:39 | 1.0M | |
![[ ]](/icons/layout.gif) | Java Performance The Definitive Guide.pdf | 2023-11-02 04:39 | 12M | |
![[ ]](/icons/layout.gif) | Java Network Programming, 4th Edition.pdf | 2023-11-02 04:39 | 8.1M | |
![[ ]](/icons/layout.gif) | Java NIO.pdf | 2023-11-02 04:39 | 3.0M | |
![[ ]](/icons/layout.gif) | Java Message Service, 2nd Edition.pdf | 2023-11-02 04:39 | 5.5M | |
![[ ]](/icons/layout.gif) | JavaMail API.pdf | 2023-11-02 04:39 | 2.5M | |
![[ ]](/icons/layout.gif) | Java Magazine JanuaryFebruary 2016 (2).pdf | 2023-11-02 05:35 | 40M | |
![[ ]](/icons/layout.gif) | Java Language Specifications 8.pdf | 2023-11-02 04:39 | 3.8M | |
![[ ]](/icons/layout.gif) | Java J2EE Job Interview Companion, Second Edition.pdf | 2023-11-02 04:39 | 3.9M | |
![[ ]](/icons/layout.gif) | Java Interview Questions and Answers (2).pdf | 2023-11-02 05:26 | 874K | |
![[ ]](/icons/layout.gif) | Java How to Program, 10th Edition.pdf | 2023-11-02 04:40 | 15M | |
![[ ]](/icons/layout.gif) | Java Hibernate Cookbook (2).pdf | 2023-11-02 05:14 | 2.0M | |
![[ ]](/icons/layout.gif) | Java Generics and Collections.pdf | 2023-11-02 04:40 | 3.9M | |
![[ ]](/icons/layout.gif) | Java Game Programming For Dummies@englishbooks.pdf | 2023-11-02 04:40 | 4.7M | |
![[ ]](/icons/layout.gif) | Java For Testers.pdf | 2023-11-02 04:40 | 1.7M | |
![[ ]](/icons/layout.gif) | Java For Dummies 4th Ed Dec 2006@englishbooks.pdf | 2023-11-02 04:40 | 8.1M | |
![[ ]](/icons/layout.gif) | Java EE 7 The Big Picture.pdf | 2023-11-02 04:40 | 19M | |
![[ ]](/icons/layout.gif) | Java EE 7 Performance Tuning and Optimization (2).pdf | 2023-11-02 05:14 | 14M | |
![[ ]](/icons/layout.gif) | Java Concurrency in Practice.pdf | 2023-11-02 04:40 | 3.6M | |
![[ ]](/icons/layout.gif) | Java Collection Matrix (2).pdf | 2023-11-02 04:40 | 209K | |
![[ ]](/icons/layout.gif) | Java Closures and Lambda (2).pdf | 2023-11-02 05:14 | 1.6M | |
![[ ]](/icons/layout.gif) | JavaCheatSheet.pdf | 2023-11-02 04:40 | 160K | |
![[ ]](/icons/unknown.gif) | Java AIO Desk Reference 2nd Ed For Dummies@englishbooks.chm | 2023-11-02 04:40 | 12M | |
![[ ]](/icons/layout.gif) | Java 8 Pocket Guide.pdf | 2023-11-02 04:40 | 8.0M | |
![[ ]](/icons/layout.gif) | Java 8 Lambdas.pdf | 2023-11-02 04:40 | 6.6M | |
![[ ]](/icons/layout.gif) | Java 7 Concurrency Cookbook.pdf | 2023-11-02 04:40 | 2.6M | |
![[ ]](/icons/layout.gif) | Java.Programming.Interviews.Exposed.pdf | 2023-11-02 04:40 | 5.4M | |
![[ ]](/icons/layout.gif) | Java -The Complete Reference-1.pdf | 2023-11-02 04:15 | 6.4M | |
![[ ]](/icons/layout.gif) | Java-J2EE JOB Interview Companion.pdf | 2023-11-02 04:39 | 3.9M | |
![[IMG]](/icons/image2.gif) | Java-8-Streams-cheat-sheet-v3.png | 2023-11-02 05:32 | 448K | |
![[ ]](/icons/layout.gif) | JasperReports 3.6 Development Cookbook.pdf | 2023-11-02 04:40 | 25M | |
![[ ]](/icons/layout.gif) | JSTL in Action.pdf | 2023-11-02 04:57 | 1.8M | |
![[ ]](/icons/layout.gif) | JSP2.3MR.pdf | 2023-11-02 04:38 | 3.8M | |
![[ ]](/icons/layout.gif) | JSF_2_3_EDR Specification.pdf | 2023-11-02 04:38 | 3.6M | |
![[ ]](/icons/layout.gif) | JSF_2_2 Specs 20130320.pdf | 2023-11-02 04:38 | 3.1M | |
![[ ]](/icons/layout.gif) | JMX in Action.pdf | 2023-11-02 04:38 | 3.6M | |
![[ ]](/icons/layout.gif) | JLS-JavaSE7-Full.pdf | 2023-11-02 04:38 | 2.4M | |
![[ ]](/icons/layout.gif) | JAVA for Beginners.pdf | 2023-11-02 04:40 | 1.4M | |
![[ ]](/icons/layout.gif) | JAVA_Easy_Java_Programming_for_Beginners,_Your_Step_By_Step_Guide (2).pdf | 2023-11-02 05:03 | 2.3M | |
![[ ]](/icons/layout.gif) | IronPython in Action (2009).pdf | 2023-11-02 04:40 | 14M | |
![[ ]](/icons/layout.gif) | Invent Your Own Computer Games with Python (2008).pdf | 2023-11-02 04:40 | 2.7M | |
![[ ]](/icons/layout.gif) | Introduction to Linux - Machtelt Garrels.pdf | 2023-11-02 04:40 | 1.5M | |
![[ ]](/icons/layout.gif) | Introduction to Deep Learning-2019.pdf | 2023-11-02 10:52 | 16M | |
![[ ]](/icons/layout.gif) | Introduction to Deep Learning (en).pdf | 2023-11-03 03:40 | 3.7M | |
![[ ]](/icons/layout.gif) | Introduction to Datascience [R20DS501].pdf | 2023-11-09 13:01 | 5.3M | |
![[ ]](/icons/layout.gif) | Introduction to Algorithms, 2nd Ed - Thomas H. Cormen (2).pdf | 2023-11-02 05:33 | 13M | |
![[ ]](/icons/layout.gif) | Introduction_to_latex2.pdf | 2023-11-02 04:40 | 1.7M | |
![[ ]](/icons/compressed.gif) | Introduction_to_Java_Programming.zip | 2023-11-02 04:40 | 16M | |
![[ ]](/icons/layout.gif) | Introduction_to_Deep_Learning_From_Logical_Calculus_to_Artificial.pdf | 2023-11-02 10:53 | 3.7M | |
![[ ]](/icons/layout.gif) | Introduction_to_Computation_and.pdf | 2023-11-02 04:41 | 13M | |
![[ ]](/icons/layout.gif) | Introduction_To_Computational_Modeling.pdf | 2023-11-02 04:41 | 8.1M | |
![[ ]](/icons/layout.gif) | Introduction_To_Algorithms_20093rdThomas.pdf | 2023-11-02 04:41 | 4.8M | |
![[ ]](/icons/layout.gif) | Introduction_To_64_Bit_Intel_Assembly.pdf | 2023-11-02 04:41 | 4.9M | |
![[ ]](/icons/layout.gif) | Introduction To Coding.pdf | 2023-11-03 03:34 | 13M | |
![[ ]](/icons/layout.gif) | Introduction-to-Algorithms-CLRS-3rd-Edition (2).pdf | 2023-11-02 05:34 | 5.4M | |
![[ ]](/icons/layout.gif) | Introducing the HTML5 Web Speech API.pdf | 2023-10-31 06:56 | 5.3M | |
![[ ]](/icons/layout.gif) | Introducing Spring Framework.pdf | 2023-11-02 04:41 | 9.9M | |
![[ ]](/icons/layout.gif) | Introducing-the-STL.pdf | 2023-11-02 04:41 | 104K | |
![[ ]](/icons/compressed.gif) | Introducing-Python-Bill-Lubanovic(www.ebook-dl.com).zip | 2023-11-02 04:41 | 11M | |
![[ ]](/icons/layout.gif) | Intro_to_autonomous_robots.pdf | 2023-11-02 04:40 | 15M | |
![[ ]](/icons/layout.gif) | IntelSGX_explained.pdf | 2023-11-02 04:41 | 2.2M | |
![[ ]](/icons/layout.gif) | Instant Ubuntu.pdf | 2023-11-02 04:41 | 2.2M | |
![[ ]](/icons/layout.gif) | Information_Retrieval_Data_Structures (2).pdf | 2023-11-02 05:33 | 1.2M | |
![[ ]](/icons/layout.gif) | Indian_History_previous_year_bits_2016_2023_DO_YOU_SUCCESS_TELEGRAM.pdf | 2023-11-02 10:39 | 34M | |
![[ ]](/icons/layout.gif) | Impractical Python Projects.pdf | 2023-10-31 06:56 | 10M | |
![[ ]](/icons/layout.gif) | ITSS_14.pdf | 2023-10-31 06:56 | 109K | |
![[ ]](/icons/layout.gif) | ITSS_05.pdf | 2023-10-31 06:56 | 133K | |
![[ ]](/icons/layout.gif) | IT 2201 Data Structures and Algorithms _21507_may 2013.pdf | 2023-11-02 09:17 | 1.1M | |
![[ ]](/icons/layout.gif) | IT2201 Data Structures and Algorithms.pdf | 2023-11-02 09:17 | 151K | |
![[ ]](/icons/layout.gif) | IT 2201 — DATA STRUCTURES AND ALGORITHMS 2010.pdf | 2023-11-02 09:17 | 188K | |
![[ ]](/icons/layout.gif) | IAPP-CIPM-Certified-Information-Privacy-Manager-Study-Guide.pdf | 2023-11-02 05:01 | 8.7M | |
![[ ]](/icons/layout.gif) | Hunt_John_Advanced_Guide_to_Python_3_Programming,_2nd_Edition_2023.pdf | 2023-11-15 06:31 | 16M | |
![[ ]](/icons/layout.gif) | How-to-Become-a-Business-Analyst-2011.pdf | 2023-11-02 05:12 | 4.0M | |
![[ ]](/icons/layout.gif) | Hollemans_M_,_LaPollo_C_,_Tam_A_Machine_Learning_by_Tutorials_2nd.pdf | 2023-11-02 10:48 | 89M | |
![[ ]](/icons/layout.gif) | Hibernate in Action.pdf | 2023-11-02 04:41 | 3.5M | |
![[ ]](/icons/layout.gif) | Hibernate in Action (2).pdf | 2023-11-02 05:14 | 3.5M | |
![[ ]](/icons/layout.gif) | Hibernate_Interview_Questions (2).pdf | 2023-11-02 05:35 | 86K | |
![[ ]](/icons/layout.gif) | Hello_World_Computer_Programming (2).pdf | 2023-11-02 05:12 | 30M | |
![[ ]](/icons/compressed.gif) | Head_First_Python_Paul_Barry(www.ebook-dl.com) (2).zip | 2023-11-02 05:25 | 31M | |
![[ ]](/icons/layout.gif) | Head_First_Python (2).pdf | 2023-11-02 05:15 | 28M | |
![[ ]](/icons/compressed.gif) | Head_First_Java_Kathy_Sierra_Bert_Bates(www.ebook-dl.com).zip | 2023-11-02 04:42 | 36M | |
![[ ]](/icons/compressed.gif) | Head_First_C_David_Griffiths_Dawn_Griffithswww.zip | 2023-11-02 04:41 | 31M | |
![[ ]](/icons/layout.gif) | Head_First_C_A_Brain_Friendly_Guide.pdf | 2023-11-02 04:41 | 53M | |
![[ ]](/icons/layout.gif) | Head First JavaScript.pdf | 2023-11-02 04:42 | 51M | |
![[ ]](/icons/layout.gif) | Head First Java, 2nd Edition (2).pdf | 2023-11-02 05:32 | 35M | |
![[ ]](/icons/layout.gif) | Head First! PHP and MySQL.pdf | 2023-11-02 04:41 | 32M | |
![[ ]](/icons/layout.gif) | Hands-on.TinyML.pdf | 2023-11-09 13:01 | 32M | |
![[ ]](/icons/layout.gif) | Handcrafted_CSS_More_Bulletproof_Web_Design_Dan_Cederholm,_Ethan.pdf | 2023-10-31 06:53 | 9.5M | |
![[ ]](/icons/layout.gif) | Handbook of Big Data and IoT Security ( PDFDrive.com ).pdf | 2023-10-31 06:57 | 12M | |
![[ ]](/icons/layout.gif) | Handbook_of_Exact_String_Matching.pdf | 2023-11-02 04:41 | 713K | |
![[ ]](/icons/layout.gif) | Hacking for Dummies@englishbooks (2).pdf | 2023-11-02 05:27 | 9.3M | |
![[ ]](/icons/layout.gif) | Hacking_the_ultimate_hacking_for_beginners_how_to_hack_hacking_intelligence.pdf | 2023-10-31 06:52 | 4.2M | |
![[ ]](/icons/layout.gif) | Hacking_the_Hacker_Learn_from_the_Experts_Who_Take_Down_Hackers.pdf | 2023-11-02 05:01 | 1.3M | |
![[ ]](/icons/layout.gif) | Hacking_a_Google_Interview_Practice_Questions_Person_B (2).pdf | 2023-11-02 05:32 | 66K | |
![[ ]](/icons/layout.gif) | Hacking_a_Google_Interview_Practice_Questions_Person_A (2).pdf | 2023-11-02 05:32 | 57K | |
![[ ]](/icons/layout.gif) | Hacking_a_Google_Interview_Handout_3 (2).pdf | 2023-11-02 05:32 | 82K | |
![[ ]](/icons/layout.gif) | Hacking_a_Google_Interview_Handout_2.pdf | 2023-11-02 04:42 | 71K | |
![[ ]](/icons/layout.gif) | Hacking Wireless Networks For Dummies@englishbooks.pdf | 2023-11-02 04:41 | 11M | |
![[ ]](/icons/layout.gif) | HackingTheXbox_Free.pdf | 2023-11-02 04:41 | 18M | |
![[ ]](/icons/layout.gif) | Hacking The Xbox 360 For Dummies@englishbooks (2).pdf | 2023-11-02 05:27 | 6.6M | |
![[ ]](/icons/layout.gif) | Hacking AI (@Ebooksec).pdf | 2023-11-02 05:03 | 1.3M | |
![[ ]](/icons/layout.gif) | Hacking.With.Python.B09C2NBLLT.pdf | 2023-11-02 05:02 | 3.0M | |
![[ ]](/icons/layout.gif) | Hacking-the-art-of-exploitation.pdf | 2023-11-02 04:41 | 4.0M | |
![[ ]](/icons/layout.gif) | Hacking-the-art-of-exploitation (2).pdf | 2023-11-02 05:24 | 4.0M | |
![[ ]](/icons/layout.gif) | Hacking-For-Dummies-3rd-Edition.pdf | 2023-10-31 06:52 | 8.6M | |
![[ ]](/icons/layout.gif) | HTML and CSS Design and Build Websites Jon Duckett.pdf | 2023-11-02 04:41 | 19M | |
![[ ]](/icons/layout.gif) | HTML and CSS (2).pdf | 2023-11-02 05:24 | 26M | |
![[ ]](/icons/layout.gif) | HTML5 Security Cheat Sheet.pdf | 2023-11-02 04:41 | 350K | |
![[ ]](/icons/unknown.gif) | HTML5CookbookExcerpt1 [@ebookz].PDF | 2023-11-02 04:41 | 9.6M | |
![[ ]](/icons/layout.gif) | HTML 4 for Dummies 5th Ed@englishbooks (2).pdf | 2023-11-02 05:26 | 11M | |
![[ ]](/icons/layout.gif) | Guide to NumPy (for Python) (2006) (2).pdf | 2023-11-02 05:12 | 2.0M | |
![[ ]](/icons/layout.gif) | Groovy in Action.pdf | 2023-11-02 04:42 | 19M | |
![[ ]](/icons/layout.gif) | Grokking Deep Learning by Andrew W. Trask.pdf | 2023-11-02 10:53 | 14M | |
![[ ]](/icons/layout.gif) | Gray_Hat_Python_Python_Programming (2).pdf | 2023-11-02 05:12 | 3.0M | |
![[ ]](/icons/layout.gif) | GrayHat-CSharp(@EbookSec).pdf | 2023-11-02 05:03 | 13M | |
![[ ]](/icons/layout.gif) | Graph Algorithms in the Language of Linear Algebra.pdf | 2023-11-02 04:57 | 4.7M | |
![[ ]](/icons/layout.gif) | Google Resume.pdf | 2023-11-02 04:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Go H_ck Yourself @hacker_vision .pdf | 2023-11-02 05:02 | 5.8M | |
![[ ]](/icons/layout.gif) | GitHub For Dummies.pdf | 2023-11-07 09:52 | 46M | |
![[IMG]](/icons/image2.gif) | Git-Cheat-Sheet.png | 2023-11-02 05:32 | 373K | |
![[ ]](/icons/layout.gif) | Getting started with IntelliJ IDEA (2).pdf | 2023-11-02 05:14 | 1.9M | |
![[ ]](/icons/layout.gif) | Getting_Started_with_Oracle_WebLogic.pdf | 2023-11-02 04:42 | 9.6M | |
![[ ]](/icons/layout.gif) | Getting Started with TensorFlow.pdf | 2023-11-02 05:12 | 4.7M | |
![[ ]](/icons/layout.gif) | Getting Started with Pyparsing (2007) (2).pdf | 2023-11-02 05:12 | 624K | |
![[ ]](/icons/layout.gif) | Getting Real WebDevelopment.pdf | 2023-11-02 04:42 | 488K | |
![[ ]](/icons/layout.gif) | Getting.Started.With_.Laravel.4 (2).pdf | 2023-11-02 05:14 | 1.4M | |
![[ ]](/icons/layout.gif) | GeoServer Cookbook.pdf | 2023-11-02 04:42 | 6.2M | |
![[ ]](/icons/layout.gif) | Generative_Deep_Learning_Teaching_Machines_to_Paint,_Write,_Compose.pdf | 2023-11-02 10:50 | 29M | |
![[ ]](/icons/layout.gif) | Generative_Adversarial_Networks_with_Python_by_Jason_Brownlee.pdf | 2023-11-02 10:51 | 11M | |
![[ ]](/icons/layout.gif) | General Knowledge For CSAT Paper 1 (www.sarkaripost.in).pdf | 2023-11-02 10:39 | 64M | |
![[ ]](/icons/layout.gif) | Garbage_Collection_Algorithms_For (2).pdf | 2023-11-02 05:33 | 14M | |
![[ ]](/icons/layout.gif) | Garbage Collection.pdf | 2023-11-02 04:42 | 4.7M | |
![[ ]](/icons/layout.gif) | Game Programming with Python, Lua, and Ruby (2003).pdf | 2023-11-02 04:42 | 2.7M | |
![[ ]](/icons/unknown.gif) | Game Programming with Python, Lua, and Ruby (2003) (2).chm | 2023-11-02 05:12 | 2.3M | |
![[ ]](/icons/unknown.gif) | GUI Programming with Python - QT Edition (2002).chm | 2023-11-02 04:42 | 16M | |
![[ ]](/icons/layout.gif) | GNU C Tutorials.pdf | 2023-11-02 04:42 | 1.4M | |
![[ ]](/icons/layout.gif) | GNU C Lib Reference.pdf | 2023-11-02 04:42 | 3.5M | |
![[ ]](/icons/layout.gif) | GDL.pdf | 2023-11-02 10:53 | 31M | |
![[ ]](/icons/layout.gif) | GATE _Computer Science _and Information Technology2020.pdf | 2023-11-03 06:45 | 60M | |
![[ ]](/icons/layout.gif) | Fundamentals of Database Systems 7ed [2015].pdf | 2023-11-02 04:43 | 4.3M | |
![[ ]](/icons/unknown.gif) | Fundamentals of Data Structures - Ellis Horowitz.chm | 2023-11-02 04:43 | 2.4M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_OOP_and_Data_Structures (2).pdf | 2023-11-02 05:33 | 11M | |
![[ ]](/icons/layout.gif) | Fundamentals_of_Data_Structures_by_Horowitz_and_Sahani,_Galgotia.pdf | 2023-11-03 06:50 | 20M | |
![[ ]](/icons/layout.gif) | Functional Programming in Java.pdf | 2023-11-02 04:43 | 2.4M | |
![[ ]](/icons/layout.gif) | Functional JavaScript (2).pdf | 2023-11-02 05:28 | 9.6M | |
![[ ]](/icons/layout.gif) | FriendSoft.Foundation.PHP.5.for.Flash.Mar.2005.pdf | 2023-11-02 04:43 | 16M | |
![[ ]](/icons/layout.gif) | Frank_Ableson,_Robi_Sen,_Chris_King.pdf | 2023-11-02 04:43 | 16M | |
![[ ]](/icons/layout.gif) | Foundations of Python Network Programming Second Edition (2).pdf | 2023-11-02 05:16 | 4.8M | |
![[ ]](/icons/layout.gif) | Foundations of Agile Python Development (2008).pdf | 2023-11-02 04:43 | 6.9M | |
![[ ]](/icons/layout.gif) | Foundations_of_Deep_Reinforcement_Learning_Theory_and_Practice_in (2).pdf | 2023-11-02 10:52 | 13M | |
![[ ]](/icons/layout.gif) | Foundations_of_Computer_Science.pdf | 2023-11-02 04:43 | 5.2M | |
![[ ]](/icons/layout.gif) | Forrest_Brazeal_The_Cloud_Resume_Challenge_Cookbook_AWS_Edition.pdf | 2023-11-05 05:44 | 5.7M | |
![[ ]](/icons/layout.gif) | For_Dummies_PHP_and_MySQL_Web_Development.pdf | 2023-11-02 04:43 | 10M | |
![[ ]](/icons/layout.gif) | Fabio Nelli - Python Data Analytics, 3rd Edition - 2023.pdf | 2023-11-09 13:01 | 19M | |
![[ ]](/icons/layout.gif) | FUNDAMENTALS OF DATA STRUCTURES - Shrivastava - IBRG.pdf | 2023-11-02 04:43 | 3.2M | |
![[ ]](/icons/layout.gif) | Expression.Blend.4.pdf | 2023-11-02 04:43 | 9.9M | |
![[ ]](/icons/layout.gif) | Expert_T_SQL_Window_Functions_in_SQL_Server_2019,_2nd_Edition.pdf | 2023-10-31 06:56 | 10M | |
![[ ]](/icons/layout.gif) | Expert_C_programming_Deep_C_secrets.pdf | 2023-11-02 04:43 | 2.1M | |
![[ ]](/icons/layout.gif) | Expert Python Programming (2008).pdf | 2023-11-02 04:43 | 10M | |
![[ ]](/icons/layout.gif) | Expert Oracle SQL.pdf | 2023-11-02 04:43 | 4.6M | |
![[ ]](/icons/layout.gif) | Excel VBA 24-Hour Trainer (2015) [@ebookz].pdf | 2023-11-02 04:43 | 23M | |
![[ ]](/icons/layout.gif) | Ethical Hacking A Hands-on Introduction to Breaking In.pdf | 2023-11-02 05:02 | 16M | |
![[ ]](/icons/layout.gif) | Essential_Javascript_--_A_Javascript_Tutorial.pdf | 2023-11-02 04:43 | 234K | |
![[ ]](/icons/layout.gif) | Essential Math for Data Science.pdf | 2023-10-28 04:13 | 22M | |
![[ ]](/icons/layout.gif) | Essential JavaFX.pdf | 2023-11-02 04:43 | 3.8M | |
![[ ]](/icons/layout.gif) | Enterprise Cybersecurity.pdf | 2023-10-31 06:56 | 21M | |
![[ ]](/icons/layout.gif) | Encyclopedia of History of Technology.pdf | 2023-11-01 06:55 | 10M | |
![[ ]](/icons/layout.gif) | Embedded Android - Yaghmour - O'Reilly (2011).pdf | 2023-11-02 04:43 | 2.2M | |
![[ ]](/icons/layout.gif) | Eloquent_JavaScript.pdf | 2023-11-02 04:43 | 2.7M | |
![[ ]](/icons/layout.gif) | Elements of Statistical Learning (2).pdf | 2023-11-02 05:25 | 12M | |
![[ ]](/icons/layout.gif) | Elements_Of_Programming_Style,_The.pdf | 2023-11-02 04:43 | 10M | |
![[ ]](/icons/layout.gif) | Elements_Of_Programming_Style,_The (2).pdf | 2023-11-02 05:30 | 10M | |
![[ ]](/icons/layout.gif) | Effective_Project_Management_7e (2).pdf | 2023-11-02 05:19 | 10M | |
![[ ]](/icons/layout.gif) | Effective Java (2nd Edition).pdf | 2023-11-02 04:44 | 2.0M | |
![[ ]](/icons/layout.gif) | EJB 3 in Action, 2nd Edition.pdf | 2023-11-02 04:57 | 14M | |
![[ ]](/icons/layout.gif) | EJB 3 in Action, 2nd Edition (2).pdf | 2023-11-02 05:14 | 14M | |
![[ ]](/icons/layout.gif) | EJB 3.1 Cookbook.pdf | 2023-11-02 04:44 | 4.3M | |
![[ ]](/icons/layout.gif) | EDA With Pandas.pdf | 2023-11-22 03:49 | 94K | |
![[ ]](/icons/layout.gif) | EASSY.pdf | 2023-10-29 12:10 | 12M | |
![[ ]](/icons/layout.gif) | EA - Windows Security Internals with PowerShell @codbooks.pdf | 2023-11-02 05:01 | 6.1M | |
![[ ]](/icons/layout.gif) | Drupal 8 Guide.pdf | 2023-11-02 04:44 | 6.8M | |
![[ ]](/icons/layout.gif) | Drools JBoss Rules 5.X Developer-s Guide (2).pdf | 2023-11-02 05:14 | 4.0M | |
![[ ]](/icons/layout.gif) | Doing Data Science.pdf | 2023-11-02 09:57 | 15M | |
![[ ]](/icons/layout.gif) | Dive Into Python 3, r870 (2010).pdf | 2023-11-02 04:44 | 2.5M | |
![[ ]](/icons/layout.gif) | Dive Into Data Science (SafefilekU.com).pdf | 2023-11-03 03:33 | 5.0M | |
![[ ]](/icons/unknown.gif) | Dictionaryof Algorithms and Data Structures.chm | 2023-11-02 04:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Developing_on_AWS_with_C_A_Comprehensive_Guide_on_Using_C#_to_Build.pdf | 2023-10-31 06:57 | 13M | |
![[ ]](/icons/layout.gif) | Developing_RESTful_Services_with.pdf | 2023-11-02 04:44 | 3.3M | |
![[ ]](/icons/layout.gif) | Developing_Language_and_Literacy.pdf | 2023-11-17 10:55 | 2.6M | |
![[ ]](/icons/layout.gif) | Developing RESTful Web Services with Jersey 2.0.pdf | 2023-11-02 04:44 | 1.5M | |
![[ ]](/icons/layout.gif) | Developing Inclusive Mobile Apps.pdf | 2023-10-31 06:56 | 7.0M | |
![[ ]](/icons/layout.gif) | Designing Machine Learning Systems with Python (en).pdf | 2023-11-03 03:42 | 2.1M | |
![[ ]](/icons/layout.gif) | Design_Patterns_Interview_Questions.pdf | 2023-11-02 04:44 | 105K | |
![[ ]](/icons/layout.gif) | Design_Patterns_Elements_Of_Reusable.pdf | 2023-11-02 04:44 | 4.1M | |
![[ ]](/icons/layout.gif) | Deploy_Machine_Learning_Models_to_Production_With_Flask,_Streamlit.pdf | 2023-11-02 10:46 | 5.2M | |
![[ ]](/icons/layout.gif) | Dependency.Injection.in.NET.pdf | 2023-11-02 04:44 | 12M | |
![[ ]](/icons/layout.gif) | Deitel_P_,_Deitel_H_Intro_to_Python_for_Computer_Science_and_Data.pdf | 2023-11-03 03:38 | 24M | |
![[ ]](/icons/layout.gif) | Deep_Reinforcement_Learning_Hands_On_by_Maxim_Lapan_z_lib_org.pdf | 2023-11-02 10:52 | 17M | |
![[ ]](/icons/layout.gif) | Deep_Learning_with_PyTorch_by_Eli_Stevens,_Luca_Antiga,_Thomas_Viehmann.pdf | 2023-11-02 10:47 | 44M | |
![[ ]](/icons/layout.gif) | Deep_Learning_with_Applications_Using_Python_Chatbots_and_Face,.pdf | 2023-11-02 10:47 | 11M | |
![[ ]](/icons/layout.gif) | Deep_Learning_for_Vision_Systems_by_Mohamed_Elgendy_z_lib_org.pdf | 2023-11-02 10:47 | 17M | |
![[ ]](/icons/layout.gif) | Deep_Learning_for_Natural_Language_Proce_v4_MEAP.pdf | 2023-11-02 10:46 | 4.9M | |
![[ ]](/icons/layout.gif) | Deep_Learning_for_Computer_Vision_with_Python_by_Adrian_Rosebrock.pdf | 2023-11-02 10:53 | 9.5M | |
![[ ]](/icons/layout.gif) | Deep_Learning_Illustrated_A_Visual,_Interactive_Guide_to_Artificial.pdf | 2023-11-02 10:52 | 20M | |
![[ ]](/icons/layout.gif) | Deep_Learning_Cookbook_Practical_Recipes_to_Get_Started_Quickly.pdf | 2023-11-02 10:51 | 12M | |
![[ ]](/icons/layout.gif) | Deep_Learning_Adaptive_Computation_and_Machine_Learning_by_Ian_Goodfellow.pdf | 2023-11-02 10:53 | 16M | |
![[ ]](/icons/layout.gif) | Deep Learning with Python by Francois Chollet (1).pdf | 2023-11-02 10:53 | 11M | |
![[ ]](/icons/layout.gif) | Deep Learning with Keras.pdf | 2023-11-02 10:52 | 20M | |
![[ ]](/icons/layout.gif) | Deep Learning for Search.pdf | 2023-11-02 10:52 | 8.2M | |
![[ ]](/icons/layout.gif) | Deep Learning by John D. Kelleher (z-lib.org).pdf | 2023-11-02 10:51 | 3.1M | |
![[ ]](/icons/layout.gif) | Deep Learning by John D. Kelleher (z-lib.org) (2).pdf | 2023-11-02 10:52 | 3.1M | |
![[ ]](/icons/layout.gif) | Deep Learning by Ian Goodfellow.pdf | 2023-11-03 03:40 | 22M | |
![[ ]](/icons/layout.gif) | Deep Learning Methods and Applications by Li Deng, Dong Yu.pdf | 2023-11-02 10:53 | 8.6M | |
![[ ]](/icons/layout.gif) | Deep Learning Foundations and Concepts.pdf | 2023-11-16 06:51 | 47M | |
![[ ]](/icons/layout.gif) | Deep Learning Architectures.pdf | 2023-11-02 10:51 | 15M | |
![[ ]](/icons/layout.gif) | Deep-Learning-with-PyTorch.pdf | 2023-11-02 10:51 | 17M | |
![[ ]](/icons/layout.gif) | Decompiling.Android (2).pdf | 2023-11-02 05:23 | 4.5M | |
![[ ]](/icons/layout.gif) | Debugging.Machine.Learning.Models.pdf | 2023-11-09 13:01 | 28M | |
![[ ]](/icons/layout.gif) | David_Amos,_Dan_Bader,_Joanna_Jablonski,_Fletcher_Heisler_Python.pdf | 2023-11-03 03:34 | 6.5M | |
![[ ]](/icons/layout.gif) | Database.Security.Problems.and.Solutions.pdf | 2023-11-02 05:00 | 15M | |
![[ ]](/icons/unknown.gif) | Data_Structures_and_Algorithms_with.chm | 2023-11-02 04:45 | 11M | |
![[ ]](/icons/unknown.gif) | Data_Structures_and_Algorithms_with (9).chm | 2023-11-02 05:33 | 4.0M | |
![[ ]](/icons/unknown.gif) | Data_Structures_and_Algorithms_with (8).chm | 2023-11-02 05:33 | 3.0M | |
![[ ]](/icons/unknown.gif) | Data_Structures_and_Algorithms_with (5).chm | 2023-11-02 04:45 | 3.3M | |
![[ ]](/icons/unknown.gif) | Data_Structures_and_Algorithm_Analysis.chm | 2023-11-02 04:47 | 2.3M | |
![[ ]](/icons/layout.gif) | Data_Structures_Seymour_Lipschutz_&_GA_Vijyalaksmi_Pai,_Schaum’s.pdf | 2023-11-03 06:50 | 15M | |
![[ ]](/icons/layout.gif) | Data_Structures_And_Problem_Solving.pdf | 2023-11-02 04:45 | 63M | |
![[ ]](/icons/unknown.gif) | Data_Structures,_Algorithms_and.chm | 2023-11-02 04:45 | 2.7M | |
![[ ]](/icons/layout.gif) | Data_Structure_using_C_and_C++_Langsam,_Augenstein_&_Tananbaum,.pdf | 2023-11-03 06:52 | 193M | |
![[ ]](/icons/layout.gif) | Data_Science_in_the_Cloud_with_Microsoft.pdf | 2023-11-02 09:57 | 1.8M | |
![[ ]](/icons/layout.gif) | Data_Science_for_Marketing_Analytics_A_practical_guide_to_forming.pdf | 2023-11-01 04:36 | 27M | |
![[ ]](/icons/layout.gif) | Data_Lake_Architecture_Designing_the_Data_Lake_and_Avoiding_the.pdf | 2023-10-31 06:57 | 17M | |
![[ ]](/icons/layout.gif) | Data_20Science_20Crash_20Course_20for_20Beginners.pdf | 2023-11-03 03:34 | 6.2M | |
![[ ]](/icons/layout.gif) | Data Visualization with Python.pdf | 2023-11-17 04:12 | 7.7M | |
![[ ]](/icons/layout.gif) | Data Structures and Program Design in C by Kruse.pdf | 2023-11-03 06:29 | 61M | |
![[ ]](/icons/layout.gif) | Data Structures and Program Design in C++ - Robert L. Kruse (2).pdf | 2023-11-02 05:33 | 5.8M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms with Python (en).pdf | 2023-11-03 03:43 | 13M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms in Python (en).pdf | 2023-11-03 03:43 | 6.6M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms in Java - Robert Lafore.pdf | 2023-11-02 04:45 | 2.8M | |
![[ ]](/icons/unknown.gif) | Data Structures and Algorithms in Java - Peter Drake.chm | 2023-11-02 04:45 | 4.2M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms in Java, 6th Edition.pdf | 2023-11-02 04:45 | 10M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms - Alfred V. Aho.pdf | 2023-11-02 04:45 | 6.6M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms(Video).pdf | 2023-11-02 04:45 | 173K | |
![[ ]](/icons/layout.gif) | Data Structures With C - by schaum series (2).pdf | 2023-11-02 05:32 | 38M | |
![[ ]](/icons/layout.gif) | Data Structures Using C Deat]-[e@teR..pdf | 2023-11-02 05:32 | 172K | |
![[ ]](/icons/layout.gif) | Data Structures Revathy Poonguzhali part 1.pdf | 2023-11-02 04:45 | 5.9M | |
![[ ]](/icons/unknown.gif) | Data Structures Demystified - Jim Keogh.chm | 2023-11-02 04:45 | 2.8M | |
![[ ]](/icons/layout.gif) | Data Structures Aptitude.pdf | 2023-11-02 04:45 | 530K | |
![[ ]](/icons/layout.gif) | DataStructuresAndAlgorithmAnalysisInCpp_2014 (2).pdf | 2023-11-02 05:32 | 4.2M | |
![[ ]](/icons/layout.gif) | Data Structures Algorithms in Python.pdf | 2023-11-15 06:31 | 41M | |
![[ ]](/icons/layout.gif) | Data Structures & Algorithms in Java - Robert Lafore.pdf | 2023-11-02 04:45 | 3.0M | |
![[ ]](/icons/layout.gif) | Data Structure For Game Programers - Ron Penton.pdf | 2023-11-02 04:47 | 20M | |
![[ ]](/icons/layout.gif) | Data Structure For Game Programers - Ron Penton (2).pdf | 2023-11-02 05:34 | 20M | |
![[ ]](/icons/layout.gif) | Data Structure And Algorithms In Java - Mitchel Waite.pdf | 2023-11-02 04:47 | 6.1M | |
![[ ]](/icons/layout.gif) | Data Structure-Sartaj Sahni by D .pdf | 2023-11-02 04:45 | 11M | |
![[ ]](/icons/layout.gif) | Data Structure & Program Design - Robert L Kruse, PHI.pdf | 2023-11-03 06:50 | 5.8M | |
![[ ]](/icons/layout.gif) | Data Scientist RoadMap.pdf_20231108_142938_0000.pdf | 2023-11-09 13:01 | 463K | |
![[ ]](/icons/layout.gif) | Data Science from Scratch.pdf | 2023-11-02 09:55 | 7.1M | |
![[ ]](/icons/layout.gif) | Data Science from Scratch (en).pdf | 2023-11-03 03:43 | 5.6M | |
![[ ]](/icons/layout.gif) | Data Science for Business.pdf | 2023-11-02 09:55 | 12M | |
![[ ]](/icons/layout.gif) | Data Science at the Command Line [@ebookz].pdf | 2023-11-02 04:47 | 7.6M | |
![[ ]](/icons/layout.gif) | Data Science at the Command Line [@ebookz] (2).pdf | 2023-11-02 05:13 | 7.6M | |
![[ ]](/icons/layout.gif) | Data Science at the Command Line.pdf | 2023-11-02 09:57 | 7.6M | |
![[ ]](/icons/layout.gif) | Data Science Using Oracle Data Miner and Oracle R Enterprise.pdf | 2023-11-02 09:57 | 13M | |
![[ ]](/icons/layout.gif) | DataScience Roadmap .pdf | 2023-10-31 05:35 | 1.0M | |
![[ ]](/icons/layout.gif) | Data Science For Dummies.pdf | 2023-11-02 09:55 | 16M | |
![[ ]](/icons/layout.gif) | Data Science For Dummies, 2nd Edition.pdf | 2023-11-02 09:57 | 8.9M | |
![[ ]](/icons/layout.gif) | Data Science Essentials in Python (en).pdf | 2023-11-03 03:43 | 10M | |
![[ ]](/icons/layout.gif) | Data Engineers to follow.pdf | 2023-11-02 09:54 | 50M | |
![[ ]](/icons/layout.gif) | Data Analytics Practical Guide. .pdf | 2023-10-26 07:36 | 1.1M | |
![[ ]](/icons/layout.gif) | DS.pdf | 2023-11-02 04:44 | 4.0M | |
![[ ]](/icons/layout.gif) | DDS MLI [Casestudy I].pdf | 2023-11-02 10:49 | 2.1M | |
![[ ]](/icons/layout.gif) | DATA_STRUCTURES_IN_JAVA_A_Laboratory (2).pdf | 2023-11-02 05:33 | 2.9M | |
![[ ]](/icons/layout.gif) | DATA_STRUCTURES_AND_ALGORITHMS_USING.pdf | 2023-11-02 04:45 | 3.6M | |
![[ ]](/icons/layout.gif) | Cybersecurity for Executives.pdf | 2023-10-31 06:56 | 2.2M | |
![[ ]](/icons/layout.gif) | Cybersecurity_First_Principles_A_Reboot_of_Strategy_and_Tactics.pdf | 2023-11-15 06:30 | 8.6M | |
![[ ]](/icons/layout.gif) | Cybersecurity Incident Response.pdf | 2023-10-31 06:56 | 4.3M | |
![[ ]](/icons/layout.gif) | Cybersecurity A Practical Engineering Approach.pdf | 2023-11-02 05:01 | 11M | |
![[ ]](/icons/layout.gif) | Cyberjutsu Cybersecurity for the Modern Ninja.pdf | 2023-11-02 05:03 | 7.1M | |
![[ ]](/icons/layout.gif) | Cyber-Physical Attack Recovery Procedures.pdf | 2023-10-31 06:56 | 7.7M | |
![[ ]](/icons/layout.gif) | Cryptography_An_End_to_End_Systems.pdf | 2023-11-02 04:47 | 187K | |
![[ ]](/icons/unknown.gif) | Cryptography For Dummies@englishbooks (2).chm | 2023-11-02 05:26 | 4.0M | |
![[ ]](/icons/layout.gif) | Cryptography - Body of Secrets (2).pdf | 2023-11-02 05:24 | 4.3M | |
![[ ]](/icons/layout.gif) | Cryptography - Block Ciphers And Cryptanalysis.pdf | 2023-11-02 04:47 | 241K | |
![[ ]](/icons/layout.gif) | Cryptography - An Introduction To Cryptography.pdf | 2023-11-02 04:47 | 823K | |
![[ ]](/icons/layout.gif) | Crypto101.pdf | 2023-11-02 04:48 | 15M | |
![[ ]](/icons/layout.gif) | Creating_Web_Pages_AIO_Desk_Reference.pdf | 2023-11-02 04:48 | 18M | |
![[ ]](/icons/layout.gif) | Creating_Web_Pages_AIO_Desk_Reference (2).pdf | 2023-11-02 05:27 | 20M | |
![[ ]](/icons/layout.gif) | Creating Web Pages For Dummies 8th Ed Oct 2006@englishbooks.pdf | 2023-11-02 04:48 | 10M | |
![[ ]](/icons/layout.gif) | Creating Web Pages For Dummies 7ed@englishbooks.pdf | 2023-11-02 04:48 | 9.6M | |
![[ ]](/icons/layout.gif) | Cracking the Coding Interview.pdf | 2023-11-02 04:48 | 29M | |
![[ ]](/icons/layout.gif) | Cpp_STL_ReferenceManual.pdf | 2023-11-02 04:48 | 512K | |
![[ ]](/icons/layout.gif) | Course_Technology_Java_Programming.pdf | 2023-11-02 04:48 | 7.5M | |
![[ ]](/icons/layout.gif) | CorelDRAW-X7.pdf | 2023-11-02 05:03 | 12M | |
![[ ]](/icons/layout.gif) | Core_PHP_Programming_Using_PHP_to.pdf | 2023-11-02 04:48 | 6.0M | |
![[ ]](/icons/layout.gif) | Core_Java_Interview_Questions.pdf | 2023-11-02 04:48 | 127K | |
![[ ]](/icons/unknown.gif) | Core Python Programming, Second Edition (2006).chm | 2023-11-02 04:48 | 3.5M | |
![[ ]](/icons/layout.gif) | Core PHP Programming Third Edition Leon Atkinson[A4].pdf | 2023-11-02 04:48 | 3.6M | |
![[ ]](/icons/layout.gif) | Core.Python.Applications.Programming.3rd.Edition (2).pdf | 2023-11-02 05:16 | 9.3M | |
![[ ]](/icons/layout.gif) | Core-Servlets-and-JSP.pdf | 2023-11-02 04:48 | 9.6M | |
![[ ]](/icons/layout.gif) | Contact with Deep Learning .pdf | 2023-11-02 10:51 | 6.9M | |
![[ ]](/icons/layout.gif) | Conquering_JavaScript..pdf | 2023-11-10 06:27 | 12M | |
![[ ]](/icons/layout.gif) | Concrete_Mathematics_19942ndRonald (2).pdf | 2023-11-02 05:30 | 5.4M | |
![[ ]](/icons/layout.gif) | Computer_Networking_A_Top-Down_Approach.pdf | 2023-11-02 09:54 | 8.3M | |
![[ ]](/icons/layout.gif) | Computer_Graphics_C_Version_19972ndDonald.pdf | 2023-11-02 04:49 | 20M | |
![[ ]](/icons/layout.gif) | Computer_&_Internet_Security_A_Hands_on_Approach,_2nd_Edition_by.pdf | 2023-11-02 05:00 | 231M | |
![[ ]](/icons/layout.gif) | Computer Networks 4th Edition by Andrew S.Tanenbaum.pdf | 2023-11-02 04:49 | 14M | |
![[ ]](/icons/layout.gif) | Computer Networks (5th Edition) by Andrew s. Tanenbaum (2).pdf | 2023-11-02 05:29 | 8.1M | |
![[ ]](/icons/layout.gif) | Computational and Constructive Design Theory - Wallis.pdf | 2023-11-02 05:09 | 6.2M | |
![[ ]](/icons/layout.gif) | Computational_Optimization,_Methods_and_Algorithms_Koziel_and_Yang.pdf | 2023-11-02 05:09 | 3.4M | |
![[ ]](/icons/layout.gif) | Computational_Intelligence_in_Engineering_Rudas,_Fodor,_and_Kacprzky.pdf | 2023-11-02 05:09 | 9.4M | |
![[ ]](/icons/layout.gif) | Computational_Intelligence_in_Automotive_Applications_Prokhorov.pdf | 2023-11-02 05:09 | 6.1M | |
![[ ]](/icons/layout.gif) | Computational_Intelligence_The_Experts_Speak_Fogel_and_Robinson.pdf | 2023-11-02 05:09 | 30M | |
![[ ]](/icons/layout.gif) | Computational_Intelligence_Paradigms_in_Advanced_Pattern_Classification.pdf | 2023-11-02 05:09 | 7.8M | |
![[ ]](/icons/layout.gif) | Computational_Geometry_An_Introduction_Through_Randomized_Algorithms.pdf | 2023-11-02 05:09 | 24M | |
![[ ]](/icons/layout.gif) | Computational_Geometry_An_Introduction_Preparata_and_Shamos.pdf | 2023-11-02 05:09 | 18M | |
![[ ]](/icons/layout.gif) | Computational_Complexity_and_Feasibility_of_Data_Processing_and.pdf | 2023-11-02 05:09 | 35M | |
![[ ]](/icons/layout.gif) | Computational_Complexity_A_Conceptual_Perspective_Goldreich.pdf | 2023-11-02 05:09 | 3.3M | |
![[ ]](/icons/layout.gif) | Computational_Aspects_of_VLSI_Very_Large_Scale_Integration_Ullman.pdf | 2023-11-02 05:09 | 24M | |
![[ ]](/icons/layout.gif) | Computational Logistics - Bose.pdf | 2023-11-02 05:09 | 6.3M | |
![[ ]](/icons/layout.gif) | Computational Logic - Berger and Schwichtenberg.pdf | 2023-11-02 05:09 | 13M | |
![[ ]](/icons/layout.gif) | Computational Geometry and Computer Graphics in C++ - Laszlo.pdf | 2023-11-02 05:09 | 11M | |
![[ ]](/icons/layout.gif) | Computational Geometry In C (1998)(2nd)(Joseph O'Rourke) (2).pdf | 2023-11-02 05:31 | 3.9M | |
![[ ]](/icons/layout.gif) | Computational Geometry Algorithms and Applications 3e - Berg.pdf | 2023-11-02 05:09 | 3.3M | |
![[ ]](/icons/layout.gif) | Computational Complexity A Modern Approach - Arora and Barak.pdf | 2023-11-02 05:09 | 4.6M | |
![[ ]](/icons/layout.gif) | Computational Complexity - Papadimitriou.pdf | 2023-11-02 05:09 | 27M | |
![[ ]](/icons/layout.gif) | Computational Complexity - Arora and Barak.pdf | 2023-11-02 05:09 | 3.1M | |
![[ ]](/icons/layout.gif) | Computation_Engineering_Applied_Automata_Theory_and_Logic_Gopalakrishnan.pdf | 2023-11-02 05:09 | 3.7M | |
![[ ]](/icons/layout.gif) | Computation Theory and Logic - Borger.pdf | 2023-11-02 05:09 | 21M | |
![[ ]](/icons/layout.gif) | Computation Structures - Ward and Halstead.pdf | 2023-11-02 05:09 | 109M | |
![[ ]](/icons/layout.gif) | Computation,_Physics_and_Beyond_Dinneen,_Khoussainov,_and_Nies.pdf | 2023-11-02 05:09 | 4.9M | |
![[ ]](/icons/layout.gif) | Computation,_Logic,_Games,_and_Quantum_Foundations_Coecke,_Ong,.pdf | 2023-11-02 05:09 | 14M | |
![[ ]](/icons/layout.gif) | Computable Models - Turner.pdf | 2023-11-02 05:08 | 1.0M | |
![[ ]](/icons/layout.gif) | Computability and Unsolvability - Davis.pdf | 2023-11-02 05:08 | 13M | |
![[ ]](/icons/layout.gif) | Computability and Logic 5e - Boolos, Burgess, and Jeffrey.pdf | 2023-11-02 05:08 | 2.2M | |
![[ ]](/icons/layout.gif) | Computability and Complexity Theory - Homer and Selman.pdf | 2023-11-02 05:08 | 9.2M | |
![[ ]](/icons/layout.gif) | Computability_and_Complexity_From_a_Programming_Perspective_Jones.pdf | 2023-11-02 05:08 | 1.7M | |
![[ ]](/icons/layout.gif) | Computability_Theory_An_Introduction_to_Recursion_Theory_Enderton.pdf | 2023-11-02 05:08 | 1.9M | |
![[ ]](/icons/layout.gif) | Computability,_Complexity,_and_Languages_Fundamentals_of_Theoretical.pdf | 2023-11-02 05:08 | 16M | |
![[ ]](/icons/layout.gif) | Computability,_Complexity,_and_Languages_Fundamentals_of_Theoretical (2).pdf | 2023-11-02 05:08 | 9.9M | |
![[ ]](/icons/layout.gif) | Compositionality,_Concurrency_and_Partial_Correctness_Proof_Theories.pdf | 2023-11-02 05:08 | 5.2M | |
![[ ]](/icons/layout.gif) | Complexity of Computer Computations - Miller and Thatcher.pdf | 2023-11-02 05:08 | 4.1M | |
![[ ]](/icons/layout.gif) | Complexity and Real Computation - Blum.pdf | 2023-11-02 05:08 | 54M | |
![[ ]](/icons/layout.gif) | Complexity_of_Lattice_Problems_A_Cryptographic_Perspective_Micciancio.pdf | 2023-11-02 05:08 | 7.0M | |
![[ ]](/icons/layout.gif) | Complexity_Theory_and_Cryptology_An_Introduction_to_Cryptocomplexity.pdf | 2023-11-02 05:08 | 3.6M | |
![[ ]](/icons/layout.gif) | Complex_Valued_Nonlinear_Adaptive_Filters_Noncircularity,_Widely.pdf | 2023-11-02 05:08 | 14M | |
![[ ]](/icons/layout.gif) | Complex Systems and Dependability - Zamojski.pdf | 2023-11-02 05:08 | 16M | |
![[ ]](/icons/layout.gif) | Complete Guide For Python Programming (2015).pdf | 2023-11-02 04:49 | 812K | |
![[ ]](/icons/layout.gif) | Compilers_Principles,_Techniques.pdf | 2023-11-02 04:49 | 48M | |
![[ ]](/icons/layout.gif) | Compilers Principles, Techniques, and Tools 2e - Aho.pdf | 2023-11-02 05:08 | 5.8M | |
![[ ]](/icons/layout.gif) | Compiler_Design_Theory_Tools_Examples_C_C++ (2).pdf | 2023-11-02 05:25 | 883K | |
![[ ]](/icons/layout.gif) | Compiler Construction Using Java, JavaCC, and Yacc - Reis.pdf | 2023-11-02 05:08 | 44M | |
![[ ]](/icons/layout.gif) | Compiler Construction An Advanced Course - Bauer and Eickel.pdf | 2023-11-02 05:08 | 9.1M | |
![[ ]](/icons/layout.gif) | Compiler Construction - de Moor and Schwartzbach.pdf | 2023-11-02 05:08 | 6.5M | |
![[ ]](/icons/layout.gif) | Compiler Construction (Rajiv Gupta, ed.).pdf | 2023-11-02 04:49 | 3.8M | |
![[ ]](/icons/layout.gif) | Compiler Construction (Niklaus Wirth).pdf | 2023-11-02 04:49 | 597K | |
![[ ]](/icons/layout.gif) | Competitive Programming 3 (2).pdf | 2023-11-02 05:12 | 18M | |
![[ ]](/icons/layout.gif) | CommonsWare_The_Busy_Coders_Guide.pdf | 2023-11-02 04:49 | 16M | |
![[ ]](/icons/layout.gif) | Combinatorial_Optimization_and_Theoretical_Computer_Science_Interfaces.pdf | 2023-11-02 05:08 | 3.6M | |
![[ ]](/icons/layout.gif) | Combinatorial_Algorithms_For_Computers_and_Calculators_2e_Nijenhuis.pdf | 2023-11-02 05:08 | 11M | |
![[ ]](/icons/layout.gif) | Coffee-BreakPython Paperback_21684073_2023_09_03_23_00.pdf | 2023-11-07 07:01 | 4.8M | |
![[ ]](/icons/layout.gif) | Coding and Programming Tricks and Tips – 16th Edition 2023.pdf | 2023-11-07 09:52 | 45M | |
![[ ]](/icons/layout.gif) | Coding and Complexity - Longo.pdf | 2023-11-02 05:08 | 24M | |
![[ ]](/icons/layout.gif) | Coding Theory and Cryptology - Niederreiter.pdf | 2023-11-02 05:08 | 2.9M | |
![[ ]](/icons/layout.gif) | Coding,_Cryptography_and_Combinatorics_Fend,_Niederreiter,_and_Xing.pdf | 2023-11-02 05:08 | 7.8M | |
![[ ]](/icons/layout.gif) | Code__The_Hidden_Language_of_Computer.pdf | 2023-11-02 04:49 | 2.8M | |
![[ ]](/icons/layout.gif) | Code_Complete_A_Practical_Handbook.pdf | 2023-11-02 04:49 | 8.5M | |
![[ ]](/icons/layout.gif) | Cloud Networking for Big Data.pdf | 2023-10-31 06:57 | 3.8M | |
![[ ]](/icons/layout.gif) | Clojure for Data Science.pdf | 2023-11-02 09:57 | 10M | |
![[ ]](/icons/layout.gif) | Clean_Code_A_Handbook_of_Agile_Software_Craftmanship_Martin.pdf | 2023-11-02 05:08 | 3.6M | |
![[ ]](/icons/layout.gif) | Classical_and_New_Paradigms_of_Computation_and_their_Complexity.pdf | 2023-11-02 05:08 | 1.5M | |
![[ ]](/icons/layout.gif) | Classic Data Structures - D Samanata, PHI.pdf | 2023-11-03 06:50 | 17M | |
![[DIR]](/icons/folder.gif) | C language/ | 2023-11-23 09:58 | - | |
![[ ]](/icons/layout.gif) | Cisco_Networks_Engineers'_Handbook_of_Routing,_Switching,_and_Security.pdf | 2023-11-15 06:30 | 35M | |
![[ ]](/icons/layout.gif) | CherryPy_Essentials_Rapid_Python (2).pdf | 2023-11-02 05:12 | 5.5M | |
![[ ]](/icons/layout.gif) | Cheet_Sheet_for_Algorithms_for_Supervised (2).pdf | 2023-11-02 05:26 | 242K | |
![[ ]](/icons/layout.gif) | Cheat Sheet ML.pdf | 2023-11-02 05:00 | 1.3M | |
![[ ]](/icons/layout.gif) | Chaos_based_Cryptography_Theory,_Algorithms_and_Applications_Kocarev.pdf | 2023-11-02 05:08 | 6.5M | |
![[ ]](/icons/layout.gif) | Challenges_for_Computational_Intelligence_Duch_and_Mandziuk.pdf | 2023-11-02 05:08 | 5.3M | |
![[ ]](/icons/layout.gif) | C for Dummies@englishbooks.pdf | 2023-11-02 04:49 | 7.9M | |
![[ ]](/icons/layout.gif) | C for Dummies@englishbooks (2).pdf | 2023-11-02 05:27 | 7.9M | |
![[ ]](/icons/layout.gif) | Certified Programs and Proofs - Gonthier and Norrish.pdf | 2023-11-02 05:08 | 3.5M | |
![[ ]](/icons/layout.gif) | Cellular Automata A Discrete View of the World - Schiff.pdf | 2023-11-02 05:08 | 19M | |
![[ ]](/icons/layout.gif) | Cellular Automata A Discrete Universe - Hachinski.pdf | 2023-11-02 05:08 | 57M | |
![[ ]](/icons/layout.gif) | Causation,_Prediction,_and_Search_2e_Spirtes,_Glymour,_and_Scheines.pdf | 2023-11-02 05:08 | 3.1M | |
![[ ]](/icons/layout.gif) | Categories and Computer Science - Walters.pdf | 2023-11-02 05:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Categories,_Types,_and_Structures_Introduction_to_Category_Theory.pdf | 2023-11-02 05:08 | 2.4M | |
![[ ]](/icons/layout.gif) | Categorical_Combinators,_Sequential_Algorithms,_and_Functional_Programming.pdf | 2023-11-02 05:08 | 33M | |
![[ ]](/icons/layout.gif) | Candlesticks,_Fibonacci,_and_Chart_Pattern_Trading_Forex_Factory.pdf | 2023-10-31 06:56 | 2.2M | |
![[ ]](/icons/layout.gif) | C and Data Structures By Practice - Vasappanavara.pdf | 2023-11-02 05:07 | 4.7M | |
![[ ]](/icons/unknown.gif) | C and Data Structures - P.S. Deshpande.chm | 2023-11-02 04:49 | 7.5M | |
![[ ]](/icons/layout.gif) | C and Data Structures - Deshpande and Kakde.pdf | 2023-11-02 05:07 | 4.6M | |
![[ ]](/icons/compressed.gif) | C_in_a_Nutshell_Peter_Prinz_Tony_Crawford(www.ebook-dl.com).zip | 2023-11-02 04:49 | 9.7M | |
![[ ]](/icons/layout.gif) | C_Programming.pdf | 2023-11-02 04:48 | 2.1M | |
![[ ]](/icons/layout.gif) | C_Pocket_Reference_C_Syntax_And.pdf | 2023-11-02 04:48 | 285K | |
![[ ]](/icons/compressed.gif) | C_Plus_Plus_All_in_one_Desk_Refe.zip | 2023-11-02 04:48 | 3.9M | |
![[ ]](/icons/layout.gif) | C_Interfaces_And_Implementations (2).pdf | 2023-11-02 05:31 | 3.0M | |
![[ ]](/icons/layout.gif) | C_Book,_The_19912ndMike_Banahan (2).pdf | 2023-11-02 05:29 | 1.1M | |
![[ ]](/icons/layout.gif) | C_A_Reference_Manual_20025thSamuel.pdf | 2023-11-02 04:49 | 3.0M | |
![[ ]](/icons/layout.gif) | C Traps And Pitfalls (1989)(1st)(Andrew Koenig) (2).pdf | 2023-11-02 05:31 | 5.4M | |
![[ ]](/icons/layout.gif) | C Sharp 2005 For Dummies Oct 2005 eBook-LinG@englishbooks.pdf | 2023-11-02 04:47 | 8.5M | |
![[ ]](/icons/layout.gif) | CSUnplugged_OS_2015_v3.1.pdf | 2023-11-02 04:47 | 9.9M | |
![[ ]](/icons/layout.gif) | CSS Web Design for Dummies@englishbooks.pdf | 2023-11-02 04:47 | 12M | |
![[ ]](/icons/layout.gif) | CSS3 Quick Syntax Reference, 2nd Edition.pdf | 2023-11-02 05:03 | 2.1M | |
![[ ]](/icons/layout.gif) | C Puzzle Book, The (1982)(1st)(Alan R. Feuer).pdf | 2023-11-02 04:48 | 2.8M | |
![[ ]](/icons/layout.gif) | C Programming Just the Faqs - Chisholm.pdf | 2023-11-02 05:07 | 3.6M | |
![[ ]](/icons/layout.gif) | C Programming A Modern Approach, 2 Edition (2).pdf | 2023-11-02 05:30 | 102M | |
![[ ]](/icons/layout.gif) | C Primer Plus 6e - Prata.pdf | 2023-11-02 05:07 | 6.9M | |
![[ ]](/icons/unknown.gif) | CPlusPlus Plus Data Structures, 3rd Ed - Nell Dale.chm | 2023-11-02 04:48 | 32M | |
![[ ]](/icons/layout.gif) | COLOG-88 - Martin-Löf and Mints.pdf | 2023-11-02 05:08 | 13M | |
![[ ]](/icons/layout.gif) | CODE CRAFT by Pete Goodliffe.pdf | 2023-11-02 05:11 | 2.5M | |
![[ ]](/icons/layout.gif) | CISSP® Study Guide, 4th Edition.pdf | 2023-11-02 05:01 | 24M | |
![[ ]](/icons/layout.gif) | CEH_–_Certified_Ethical_Hacker_v11_+1200_Exam_Practice_Questions.pdf | 2023-11-02 05:01 | 3.4M | |
![[ ]](/icons/layout.gif) | C Algorithms For Real Time DsP - Paul Embree.pdf | 2023-11-02 04:49 | 9.9M | |
![[ ]](/icons/layout.gif) | C - How to Program (2013)(7th)(Paul Deitel, Harvey Deitel).pdf | 2023-11-02 04:49 | 7.4M | |
![[ ]](/icons/layout.gif) | C++ for Dummies 5th Ed@englishbooks (2).pdf | 2023-11-02 05:27 | 7.7M | |
![[ ]](/icons/layout.gif) | C++_Template_Metaprogramming_Concepts,_Tools_and_Techniques_from.pdf | 2023-11-02 05:08 | 2.9M | |
![[ ]](/icons/layout.gif) | C++ Timesaving Techniques For Dummies@englishbooks (2).pdf | 2023-11-02 05:27 | 8.0M | |
![[ ]](/icons/layout.gif) | C++ Plus Data Structures 3e - Dale.pdf | 2023-11-02 05:08 | 10M | |
![[ ]](/icons/layout.gif) | C++ Lecture Notes (Francois Fleuret).pdf | 2023-11-02 09:16 | 1.0M | |
![[ ]](/icons/layout.gif) | C++ How to Program 8e - Deitel.pdf | 2023-11-02 05:08 | 56M | |
![[ ]](/icons/layout.gif) | C++ Data Structures 3rd ed - Nell Dale.pdf | 2023-11-02 04:49 | 18M | |
![[ ]](/icons/layout.gif) | C# Bible - Ferguson, Patterson, and Boutquin.pdf | 2023-11-02 05:08 | 4.1M | |
![[ ]](/icons/layout.gif) | C# (2).pdf | 2023-11-02 05:00 | 4.6M | |
![[ ]](/icons/layout.gif) | Building an Optimizing Compiler.pdf | 2023-11-02 04:50 | 9.6M | |
![[ ]](/icons/layout.gif) | Building a Data Integration Team.pdf | 2023-10-31 06:56 | 7.7M | |
![[ ]](/icons/layout.gif) | Building_Web_Sites_AIO_Desk_Reference.pdf | 2023-11-02 04:50 | 26M | |
![[ ]](/icons/layout.gif) | Building Real-Time Analytics Systems (2023).pdf | 2023-10-27 09:16 | 13M | |
![[ ]](/icons/layout.gif) | Building Python Microservices with FastAPI.pdf | 2023-11-09 13:07 | 6.6M | |
![[ ]](/icons/layout.gif) | Building Mobile Applications with Java.pdf | 2023-11-02 04:50 | 3.8M | |
![[ ]](/icons/layout.gif) | Building Machine Learning Systems with Python (en).pdf | 2023-11-03 03:42 | 6.2M | |
![[ ]](/icons/layout.gif) | Build_a_Career_in_Data_Science_by_Jacqueline_Nolis,_Emily_Robinson.pdf | 2023-11-03 03:35 | 9.6M | |
![[ ]](/icons/layout.gif) | Build_a_Career_in_Data_Science_by_Emily_Robinson,_Jacqueline_Nolis.pdf | 2023-11-02 11:16 | 12M | |
![[ ]](/icons/unknown.gif) | Build_Your_Own_NET_Language_and.chm | 2023-11-02 04:49 | 9.0M | |
![[ ]](/icons/layout.gif) | BugBounty Bootcamp by Vickie Li(@HackerVision).pdf | 2023-11-02 05:03 | 3.2M | |
![[ ]](/icons/layout.gif) | BugBountyBootcamp_final.pdf | 2023-11-02 05:02 | 10M | |
![[ ]](/icons/layout.gif) | Bud E. Smith Creating Web Pages For Dummies @englishbooks (2).pdf | 2023-11-02 05:29 | 9.1M | |
![[ ]](/icons/layout.gif) | Bootstrap for ASP.NET MVC [@ebookz] (2).pdf | 2023-11-02 05:29 | 8.0M | |
![[ ]](/icons/layout.gif) | Boolean_Functions_and_Computation_Models_Clote_and_Kranakis.pdf | 2023-11-02 05:07 | 7.0M | |
![[ ]](/icons/layout.gif) | Boolean Function Complexity - Paterson.pdf | 2023-11-02 05:07 | 8.8M | |
![[ ]](/icons/layout.gif) | Blockchain And Applications International Congress - Prieto.pdf | 2023-11-02 05:07 | 9.7M | |
![[ ]](/icons/layout.gif) | Black_Hat_Python,_2nd_Edition_Python_Programming_for_Hackers_and.pdf | 2023-11-02 05:03 | 4.6M | |
![[ ]](/icons/layout.gif) | Black Hat Rust.pdf | 2023-11-02 05:02 | 3.5M | |
![[ ]](/icons/layout.gif) | Biopython Tutorial and Cookbook (en).pdf | 2023-11-03 03:43 | 3.7M | |
![[ ]](/icons/layout.gif) | Bioinformatics_Programming_Using.pdf | 2023-11-02 04:50 | 4.1M | |
![[ ]](/icons/layout.gif) | Big_Data_Integration_Theory_Theory_and_Methods_of_Database_Mappings.pdf | 2023-11-02 05:07 | 6.2M | |
![[ ]](/icons/layout.gif) | Big Data Analytics.pdf | 2023-10-31 06:56 | 7.3M | |
![[ ]](/icons/layout.gif) | Big Data, Big Innovation.pdf | 2023-10-31 06:57 | 3.1M | |
![[ ]](/icons/layout.gif) | Bidirectional Transformations - Gibbons and Stevens.pdf | 2023-11-02 05:07 | 9.5M | |
![[ ]](/icons/layout.gif) | Best Practices for MITRE ATTCK Mapping.pdf | 2023-11-02 05:01 | 1.5M | |
![[ ]](/icons/layout.gif) | Best ChatGPT Cheat sheet .pdf | 2023-11-17 04:04 | 1.2M | |
![[ ]](/icons/layout.gif) | Belief_Functions_Theory_and_Applications_Denoeux_and_Masson.pdf | 2023-11-02 05:07 | 13M | |
![[ ]](/icons/layout.gif) | Being Geek.pdf | 2023-11-02 04:50 | 7.4M | |
![[ ]](/icons/layout.gif) | Beginning_Python_Visualization_Crafting (2).pdf | 2023-11-02 05:12 | 2.2M | |
![[ ]](/icons/layout.gif) | Beginning_Python_From_Novice_to (2).pdf | 2023-11-02 05:12 | 2.7M | |
![[ ]](/icons/compressed.gif) | Beginning_Programming_with_Python.zip | 2023-11-02 04:50 | 9.0M | |
![[ ]](/icons/compressed.gif) | Beginning_Programming_with_Java.zip | 2023-11-02 04:50 | 30M | |
![[ ]](/icons/layout.gif) | Beginning_PHP_and_MySQL__From_Novice_to_Professional.pdf | 2023-11-02 04:50 | 17M | |
![[ ]](/icons/layout.gif) | Beginning_Game_Development_with.pdf | 2023-11-02 04:51 | 7.6M | |
![[ ]](/icons/layout.gif) | Beginning_Android_Application_Development (2).pdf | 2023-11-02 05:23 | 22M | |
![[ ]](/icons/layout.gif) | Beginning Spring.pdf | 2023-11-02 04:50 | 8.2M | |
![[ ]](/icons/layout.gif) | Beginning Python - Using Python 2.6 and Python 3.1 (2010) (2).pdf | 2023-11-02 05:12 | 4.4M | |
![[ ]](/icons/layout.gif) | Beginning Python - Norton.pdf | 2023-11-02 05:07 | 3.5M | |
![[ ]](/icons/layout.gif) | Beginning Python - From Novice to Professional (2005) - BBL (2).pdf | 2023-11-02 05:12 | 13M | |
![[ ]](/icons/layout.gif) | Beginning Python (2005).pdf | 2023-11-02 04:50 | 17M | |
![[ ]](/icons/layout.gif) | Beginning Programming with Python for Dummies.pdf | 2023-11-02 04:50 | 10M | |
![[ ]](/icons/layout.gif) | Beginning Programming with Python for Dummies (2).pdf | 2023-11-02 05:15 | 10M | |
![[ ]](/icons/layout.gif) | Beginning Programming For Dummies@englishbooks.pdf | 2023-11-02 04:50 | 44M | |
![[ ]](/icons/unknown.gif) | Beginning Programming 4th Ed For Dummies@englishbooks.chm | 2023-11-02 04:50 | 7.6M | |
![[ ]](/icons/layout.gif) | Beginning POJOs.pdf | 2023-11-02 04:50 | 6.1M | |
![[ ]](/icons/layout.gif) | Beginning Oracle PLSQL, 2nd edition.pdf | 2023-11-02 04:50 | 15M | |
![[ ]](/icons/layout.gif) | Beginning Java Programming For Dummies@englishbooks.pdf | 2023-11-02 04:50 | 5.9M | |
![[ ]](/icons/layout.gif) | Beginning Java Programming.pdf | 2023-11-02 04:51 | 57M | |
![[ ]](/icons/layout.gif) | Beginning Data Science in R.pdf | 2023-11-02 09:57 | 6.5M | |
![[ ]](/icons/layout.gif) | Beginning C++ Through Game Programming 4e - Dawson.pdf | 2023-11-02 05:07 | 8.9M | |
![[ ]](/icons/layout.gif) | Beginning Apache Struts (2).pdf | 2023-11-02 05:16 | 4.3M | |
![[ ]](/icons/layout.gif) | Beginning AngularJS.pdf | 2023-11-02 04:50 | 2.6M | |
![[ ]](/icons/layout.gif) | Beginning Android ADK with Arduino (2012) (2).pdf | 2023-11-02 05:23 | 9.8M | |
![[ ]](/icons/layout.gif) | Beginning Android (2).pdf | 2023-11-02 05:23 | 27M | |
![[ ]](/icons/layout.gif) | Basics of MATLAB and Beyond - Knight.pdf | 2023-11-02 05:07 | 4.1M | |
![[ ]](/icons/layout.gif) | Basics of Compiler Design (Lulu).pdf | 2023-11-02 04:50 | 968K | |
![[ ]](/icons/layout.gif) | Basic_Concepts_in_Information_Theory_and_Coding_The_Adventures_of.pdf | 2023-11-02 05:07 | 7.2M | |
![[ ]](/icons/layout.gif) | Basic Optimization in Java Script (2).pdf | 2023-11-02 05:30 | 164K | |
![[ ]](/icons/layout.gif) | Balagurusamy - Object Oriented Programming with C++, 6e. TMH.pdf | 2023-11-03 07:08 | 21M | |
![[ ]](/icons/layout.gif) | BackTrack - Testing Wireless Network Security.pdf | 2023-11-02 05:01 | 4.3M | |
![[ ]](/icons/layout.gif) | BOKV1_6.pdf | 2023-11-02 05:12 | 7.1M | |
![[ ]](/icons/layout.gif) | BEGINNING ASP.NET SECURITY.pdf | 2023-11-02 04:50 | 27M | |
![[ ]](/icons/layout.gif) | Axioms and Hulls - Knuth.pdf | 2023-11-02 05:07 | 1.1M | |
![[ ]](/icons/layout.gif) | Autonomic Computing and Networking - Denko, Yang, and Zhang.pdf | 2023-11-02 05:07 | 12M | |
![[ ]](/icons/layout.gif) | Automated_Practical_Reasoning_Algebraic_Approaches_Pfalzgraf_and.pdf | 2023-11-02 05:07 | 5.0M | |
![[ ]](/icons/layout.gif) | Automated_Deduction_in_Equational_Logic_and_Cubic_Curves_McCune.pdf | 2023-11-02 05:07 | 3.1M | |
![[ ]](/icons/layout.gif) | Automate_the_Boring_Stuff_with_Python_Practical_Programming_For.pdf | 2023-11-02 05:07 | 17M | |
![[ ]](/icons/layout.gif) | Automata, Languages and Programming - Even and Kariv.pdf | 2023-11-02 05:07 | 15M | |
![[ ]](/icons/layout.gif) | Automata, Languages and Programming - Baeten.pdf | 2023-11-02 05:07 | 8.5M | |
![[ ]](/icons/layout.gif) | Autologic - Tennant.pdf | 2023-11-02 05:07 | 25M | |
![[ ]](/icons/layout.gif) | AutoCAD For Dummies 18e - Fane.pdf | 2023-11-02 05:07 | 12M | |
![[ ]](/icons/layout.gif) | Aspects_of_Molecular_Computing_Essays_Dedicated_to_Tom_Head_on_the.pdf | 2023-11-02 05:07 | 5.4M | |
![[ ]](/icons/layout.gif) | Artificial life VII - Bedau.pdf | 2023-11-02 05:07 | 199M | |
![[ ]](/icons/layout.gif) | Artificial life III - Langton.pdf | 2023-11-02 05:08 | 30M | |
![[ ]](/icons/layout.gif) | Artificial life An Overview - Langton.pdf | 2023-11-02 05:07 | 3.2M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_in_Finance_A_Python_Based_Guide_by_Yves.pdf | 2023-11-02 10:46 | 24M | |
![[ ]](/icons/layout.gif) | Artificial_Intelligence_A_Modern_Approach_3e_Russell_and_Norvig.pdf | 2023-11-02 05:07 | 13M | |
![[ ]](/icons/layout.gif) | Artificial Life II - Langton.pdf | 2023-11-02 05:08 | 40M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence The Basics - Warwick.pdf | 2023-11-02 05:07 | 1.1M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence.pdf | 2023-11-02 04:51 | 11M | |
![[ ]](/icons/layout.gif) | Artificial Intelligence. Fundamentals and Applications.pdf | 2023-10-27 10:54 | 9.8M | |
![[ ]](/icons/layout.gif) | Art_of_Programming_Contest_SE_for_uva (2).pdf | 2023-11-02 05:12 | 1.8M | |
![[ ]](/icons/layout.gif) | Art_Of_Computer_Programming,_The (2).pdf | 2023-11-02 05:30 | 10M | |
![[ ]](/icons/layout.gif) | Arduino_Workshop_A_Hands_On_Introduction_With_65_Projects_Boxall.pdf | 2023-11-02 05:07 | 16M | |
![[ ]](/icons/layout.gif) | Arduino_Cookbook_Recipes_to_Begin,_Expand,_and_Enhance_Your_Projects.pdf | 2023-11-02 05:07 | 12M | |
![[ ]](/icons/layout.gif) | Arduino_A_Technical_Reference_A_Handbook_For_Technicians,_Engineers.pdf | 2023-11-02 05:07 | 54M | |
![[ ]](/icons/layout.gif) | Architecting a Machine Learning Pipeline.pdf | 2023-11-02 11:17 | 1.5M | |
![[ ]](/icons/layout.gif) | Apress_Robbie_Matthews_Beginning.pdf | 2023-11-02 04:51 | 101M | |
![[ ]](/icons/layout.gif) | Apress_Pro_PHP_Patterns_Frameworks.pdf | 2023-11-02 04:51 | 5.8M | |
![[ ]](/icons/layout.gif) | Apress_Foundations_of_Python_3_Network (2).pdf | 2023-11-02 05:12 | 4.8M | |
![[ ]](/icons/layout.gif) | Apress_Coding_Interviews_Questions.pdf | 2023-11-02 04:51 | 1.6M | |
![[ ]](/icons/layout.gif) | Apress_Beginning_PHP_and_MySQL_E.pdf | 2023-11-02 04:51 | 12M | |
![[ ]](/icons/layout.gif) | Apress_Beginning_PHP_and_MySQL_5.pdf | 2023-11-02 04:51 | 18M | |
![[ ]](/icons/layout.gif) | Apress_Beginning_Ajax_with_PHP_From.pdf | 2023-11-02 04:51 | 3.9M | |
![[ ]](/icons/layout.gif) | Apress Beginning Android 4 (2012).pdf | 2023-11-02 04:51 | 28M | |
![[ ]](/icons/layout.gif) | Apress Beginning Android 4 (2012) (2).pdf | 2023-11-02 05:24 | 28M | |
![[ ]](/icons/layout.gif) | Apress Android Essentials (2008) (2).pdf | 2023-11-02 05:23 | 1.1M | |
![[ ]](/icons/layout.gif) | Apress Android Apps for Absolute Beginners (2011).pdf | 2023-11-02 04:51 | 68M | |
![[ ]](/icons/layout.gif) | Apress.Xamarin.Jul.2015.ISBN.1484202155.pdf | 2023-11-02 04:51 | 6.0M | |
![[ ]](/icons/layout.gif) | Apress.Pro.Android.3.Apr.2011.pdf | 2023-11-02 04:51 | 25M | |
![[ ]](/icons/layout.gif) | Apress.Pro.ASP.NET.MVC.pdf | 2023-11-02 04:51 | 22M | |
![[ ]](/icons/layout.gif) | Apress.Practical.Web.2.0.Applications.with.PHP.Dec.2007.pdf | 2023-11-02 04:51 | 6.7M | |
![[ ]](/icons/layout.gif) | Apress.Beginning.WF.Windows.Workflow.in.NET.4.0.pdf | 2023-11-02 04:51 | 4.3M | |
![[ ]](/icons/layout.gif) | Apress.Beginning.PHP.and.MySQL.3rd.Edition.Mar.2008-BBL.pdf | 2023-11-02 04:51 | 17M | |
![[ ]](/icons/layout.gif) | Apress-Magnus_Lie_Hetland-python_algorithms (2).pdf | 2023-11-02 05:16 | 4.7M | |
![[ ]](/icons/layout.gif) | Approximation Algorithms - Vazirani.pdf | 2023-11-02 05:07 | 8.1M | |
![[ ]](/icons/layout.gif) | Approximation,_Randomization_and_Combinatorial_Optimization_Algorithms.pdf | 2023-11-02 05:07 | 5.6M | |
![[ ]](/icons/layout.gif) | Approximate_Dynamic_Programming_Solving_the_Curses_of_Dimensionality.pdf | 2023-11-02 05:07 | 3.6M | |
![[ ]](/icons/layout.gif) | Applied WPF 4 in Context.pdf | 2023-11-02 04:51 | 6.5M | |
![[ ]](/icons/layout.gif) | Applied Semantics - Barthe.pdf | 2023-11-02 05:07 | 3.2M | |
![[ ]](/icons/layout.gif) | Applied Quantum Cryptography - Kollmitzer and Pivk.pdf | 2023-11-02 05:07 | 4.9M | |
![[ ]](/icons/layout.gif) | Applied Machine Learning with Python by Andrea Giussani (1).pdf | 2023-11-02 10:51 | 6.5M | |
![[ ]](/icons/layout.gif) | Applied Deep Learning (en).pdf | 2023-11-02 10:52 | 13M | |
![[ ]](/icons/layout.gif) | Applied Cryptography 2e - Schneier.pdf | 2023-11-02 05:07 | 4.7M | |
![[ ]](/icons/layout.gif) | Applications of Soft Computing Recent Trends - Tiwari.pdf | 2023-11-02 05:07 | 14M | |
![[ ]](/icons/layout.gif) | Applications of Process Algebra - Baeten.pdf | 2023-11-02 05:06 | 9.5M | |
![[ ]](/icons/layout.gif) | Applications of Evolutionary Computation - Esparcia-Alcazar.pdf | 2023-11-02 05:06 | 19M | |
![[ ]](/icons/layout.gif) | Applications_of_Soft_Computing_Updating_the_State_of_the_Art_Avineri.pdf | 2023-11-02 05:06 | 10M | |
![[ ]](/icons/layout.gif) | Applications_of_Soft_Computing_From_Theory_to_Praxis_Mehnen.pdf | 2023-11-02 05:06 | 8.1M | |
![[ ]](/icons/layout.gif) | Applications_of_Interval_Computations_Kearfott_and_Kreinovich.pdf | 2023-11-02 05:06 | 14M | |
![[ ]](/icons/layout.gif) | Applications_of_Categories_in_Computer_Science_Fourman,_Johnstone.pdf | 2023-11-02 05:06 | 6.4M | |
![[ ]](/icons/layout.gif) | Application.Security.for.the.Android.Platform (2).pdf | 2023-11-02 04:54 | 5.5M | |
![[ ]](/icons/layout.gif) | AppNee.com.Beginning.PHP.and.MySQL.4th.Edition.pdf | 2023-11-02 04:51 | 7.4M | |
![[ ]](/icons/layout.gif) | Apache CXF Web Service Development.pdf | 2023-11-02 04:51 | 4.4M | |
![[ ]](/icons/layout.gif) | Ant in Action, 2nd Edition.pdf | 2023-11-02 04:51 | 11M | |
![[ ]](/icons/layout.gif) | Angular_from_Theory_To_Practice.pdf | 2023-11-02 05:10 | 8.6M | |
![[ ]](/icons/layout.gif) | Angular_2_from_Theory_To_Practice.pdf | 2023-11-02 05:10 | 8.7M | |
![[ ]](/icons/layout.gif) | AngularJS by Example.pdf | 2023-11-02 04:51 | 4.6M | |
![[ ]](/icons/layout.gif) | AngularJS- Novice to Ninja.pdf | 2023-11-02 04:51 | 3.7M | |
![[ ]](/icons/layout.gif) | Android_Studio_3_0_Development_Essentials.pdf | 2023-11-02 05:10 | 37M | |
![[ ]](/icons/layout.gif) | Android_Application_Development_For_Dummies.pdf | 2023-11-02 04:52 | 9.9M | |
![[ ]](/icons/layout.gif) | Android Wireless Application Development Second Edition.pdf | 2023-11-02 04:52 | 13M | |
![[ ]](/icons/layout.gif) | Android Studio Essentials.pdf | 2023-11-02 04:52 | 14M | |
![[ ]](/icons/layout.gif) | Android Quick APIs Reference.pdf | 2023-11-02 04:52 | 2.4M | |
![[ ]](/icons/layout.gif) | Android Programming for Beginners - Horton.pdf | 2023-11-02 05:06 | 10M | |
![[ ]](/icons/layout.gif) | Android Programming Tutorials.pdf | 2023-11-02 04:52 | 15M | |
![[ ]](/icons/layout.gif) | Android Programming For Dummies All In One.pdf | 2023-11-01 06:55 | 26M | |
![[ ]](/icons/layout.gif) | Android Fully Loaded by Rob Huddleston.pdf | 2023-11-02 04:52 | 2.8M | |
![[ ]](/icons/layout.gif) | Android Forensics.pdf | 2023-11-02 04:52 | 39M | |
![[ ]](/icons/layout.gif) | AndroidForAllrus.pdf | 2023-11-02 04:52 | 6.4M | |
![[ ]](/icons/layout.gif) | Android Cookbook.pdf | 2023-11-02 04:52 | 8.5M | |
![[ ]](/icons/layout.gif) | Android Application Development in 24 Hours.pdf | 2023-11-02 04:52 | 27M | |
![[ ]](/icons/layout.gif) | Android Application Development from A to Z.pdf | 2023-11-02 04:52 | 903K | |
![[ ]](/icons/layout.gif) | Android Application Development All-in-One For Dummies.pdf | 2023-11-02 04:52 | 14M | |
![[ ]](/icons/layout.gif) | Android.pdf | 2023-11-02 04:52 | 9.8M | |
![[ ]](/icons/layout.gif) | Android.in.Action.3rd.Edition.pdf | 2023-11-02 04:52 | 15M | |
![[ ]](/icons/layout.gif) | Android.in.Action.2nd.Edition (3).pdf | 2023-11-02 05:23 | 18M | |
![[ ]](/icons/layout.gif) | Android.User.Interface.Development.Beginner.Guide (2).pdf | 2023-11-02 04:54 | 2.2M | |
![[ ]](/icons/layout.gif) | An_introduction_to_the_Analysis_of_Algorithms_2e_Sedgewick_and_Flajolet.pdf | 2023-11-02 05:06 | 3.0M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_the_Analysis.pdf | 2023-11-02 04:51 | 1.7M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Network_Programming.pdf | 2023-11-02 04:51 | 3.6M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Metaheuristics_for_Optimization_Chopard_and_Tomassin.pdf | 2023-11-02 05:06 | 7.5M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Kolmogorov_Complexity_and_Its_Applications_3e.pdf | 2023-11-02 05:06 | 6.7M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Kolmogorov_Complexity_and_Its_Applications_2e.pdf | 2023-11-02 05:06 | 34M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_GCC_for_the_GNU.pdf | 2023-11-02 04:51 | 526K | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Distance_Geometry_applied_to_Molecular_Geometry.pdf | 2023-11-02 05:06 | 1.4M | |
![[ ]](/icons/layout.gif) | An_Introduction_to_Computational_Learning_Theory_Kearns_and_Vazirani.pdf | 2023-11-02 05:06 | 24M | |
![[ ]](/icons/layout.gif) | An Introduction to Quantum Computing Algorithms - Pittenger.pdf | 2023-11-02 05:06 | 11M | |
![[ ]](/icons/layout.gif) | An Introduction to Programming using Python - Schneider.pdf | 2023-11-02 05:06 | 4.7M | |
![[ ]](/icons/layout.gif) | Ambient Intelligence - Weber, Rabaey, and Aarts.pdf | 2023-11-02 05:06 | 3.9M | |
![[ ]](/icons/layout.gif) | Algoritmhs_and_Data_Structures_With_Applications_to_Graphics_and.pdf | 2023-11-02 05:06 | 3.9M | |
![[ ]](/icons/unknown.gif) | Algorithms in Java, 3rd Ed, Part 1-4 - Robert Sedgewick.chm | 2023-11-02 04:52 | 5.4M | |
![[ ]](/icons/layout.gif) | Algorithms for Minimization without Derivatives - Brent.pdf | 2023-11-02 05:06 | 7.6M | |
![[ ]](/icons/layout.gif) | Algorithms for Dummies (en).pdf | 2023-11-03 03:43 | 7.2M | |
![[ ]](/icons/unknown.gif) | Algorithms for Compiler Design (O.G. Kagde, 2002).chm | 2023-11-02 04:53 | 11M | |
![[ ]](/icons/layout.gif) | Algorithms and Programming Problems and Solutions - Shen.pdf | 2023-11-02 05:06 | 21M | |
![[ ]](/icons/layout.gif) | Algorithms and Data Structures in CPlusPlus - Alan Parker.pdf | 2023-11-02 04:53 | 14M | |
![[ ]](/icons/layout.gif) | Algorithms and Data Structures in C++ - Parker.pdf | 2023-11-02 05:06 | 3.2M | |
![[ ]](/icons/layout.gif) | Algorithms and Data Structures - Niklaus Wirth.pdf | 2023-11-02 04:53 | 1.2M | |
![[ ]](/icons/layout.gif) | Algorithms and Data Structures - Dehne.pdf | 2023-11-02 05:06 | 30M | |
![[ ]](/icons/layout.gif) | Algorithms and Computation - Asano.pdf | 2023-11-02 05:06 | 6.7M | |
![[ ]](/icons/unknown.gif) | Algorithms_in_Java,_3rd_Ed,_Part.chm | 2023-11-02 04:52 | 4.2M | |
![[ ]](/icons/layout.gif) | Algorithms_and_Theory_of_Computation_Handbook_General_Conceopts.pdf | 2023-11-02 05:06 | 9.1M | |
![[ ]](/icons/layout.gif) | Algorithms_and_Programming_2nd_Ed.pdf | 2023-11-02 04:53 | 1.4M | |
![[ ]](/icons/layout.gif) | Algorithms_and_Programming_2nd_Ed (2).pdf | 2023-11-02 04:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Algorithms_and_Data_Structures_The_Basic_Toolbox_Mehlhorn_and_Sanders.pdf | 2023-11-02 05:06 | 2.0M | |
![[ ]](/icons/unknown.gif) | Algorithms_and_Data_Structures_The.chm | 2023-11-02 04:53 | 10M | |
![[ ]](/icons/layout.gif) | Algorithms_Sanjoy_Dasgupta,_Christos.pdf | 2023-11-02 04:52 | 3.3M | |
![[ ]](/icons/layout.gif) | Algorithms_In_C_Parts_1_4_Fundamentals (2).pdf | 2023-11-02 04:55 | 34M | |
![[ ]](/icons/layout.gif) | Algorithms_Illuminated_Part_2_Graph_Algorithms_and_Data_Structures.pdf | 2023-11-02 05:06 | 7.9M | |
![[ ]](/icons/layout.gif) | Algorithms Unplugged - Vocking.pdf | 2023-11-02 05:06 | 7.9M | |
![[ ]](/icons/layout.gif) | Algorithms Unlocked - Cormen.pdf | 2023-11-02 05:06 | 2.5M | |
![[ ]](/icons/layout.gif) | Algorithms Part I 4e - Sedgewick and Wayne.pdf | 2023-11-02 05:06 | 27M | |
![[ ]](/icons/layout.gif) | Algorithms Illuminated Part 1 The Basics - Roughgarden.pdf | 2023-11-02 05:06 | 5.8M | |
![[ ]](/icons/layout.gif) | Algorithms 4th Ed - Robert Sedgewick, Kevin Wayne (2011).pdf | 2023-11-02 04:53 | 24M | |
![[ ]](/icons/layout.gif) | Algorithms 4e - Sedgewick and Wayne.pdf | 2023-11-02 05:06 | 13M | |
![[ ]](/icons/layout.gif) | Algorithms — ESA _95 - Spirakis.pdf | 2023-11-02 05:06 | 11M | |
![[ ]](/icons/layout.gif) | Algorithmics Theory and Practice - Brassard and Bratley.pdf | 2023-11-02 05:06 | 3.9M | |
![[ ]](/icons/layout.gif) | Algorithmics The Spirit of Computing 3e - Harel.pdf | 2023-11-02 05:06 | 9.3M | |
![[ ]](/icons/layout.gif) | Algorithmic information theory - Chaitin.pdf | 2023-11-02 05:05 | 11M | |
![[ ]](/icons/layout.gif) | Algorithmic_Randomness_and_Complexity_Downey_and_Hirschfeldt.pdf | 2023-11-02 05:05 | 5.3M | |
![[ ]](/icons/layout.gif) | Algorithmic Number Theory - Buhler.pdf | 2023-11-02 05:05 | 4.3M | |
![[ ]](/icons/layout.gif) | Algorithmic Mathematics - Hougardy and Vygen.pdf | 2023-11-02 05:05 | 2.2M | |
![[ ]](/icons/layout.gif) | Algorithmic Learning Theory - Jantke.pdf | 2023-11-02 05:05 | 19M | |
![[ ]](/icons/layout.gif) | Algorithm and Complexity 2e - Wilf.pdf | 2023-11-02 05:05 | 2.0M | |
![[ ]](/icons/layout.gif) | Algorithm_Design_Jon_Kleinberg_and.pdf | 2023-11-02 04:53 | 3.3M | |
![[ ]](/icons/layout.gif) | Algorithm Theory - SWAT 2002 - M. Penttonen.pdf | 2023-11-02 04:52 | 6.8M | |
![[ ]](/icons/layout.gif) | Algorithm Design and Applications[A4].pdf | 2023-11-02 04:53 | 12M | |
![[ ]](/icons/layout.gif) | Algorithm Design - Kleinberg and Tardos.pdf | 2023-11-02 05:05 | 5.0M | |
![[ ]](/icons/layout.gif) | Algebraic_and_Coalgebraic_Methods_in_the_Mathematics_of_Program.pdf | 2023-11-02 05:05 | 2.9M | |
![[ ]](/icons/layout.gif) | Algebraic_Methods_Theory,_Tools_and_Applications_Wirsing_and_Bergstra.pdf | 2023-11-02 05:05 | 22M | |
![[ ]](/icons/layout.gif) | Algebraic Informatics - Winkler.pdf | 2023-11-02 05:05 | 2.7M | |
![[ ]](/icons/layout.gif) | Algebraic Cryptanalysis - Bard.pdf | 2023-11-02 05:05 | 2.0M | |
![[ ]](/icons/layout.gif) | Algebraic Approaches to Program Semantics - Manes and Arbib.pdf | 2023-11-02 05:05 | 21M | |
![[ ]](/icons/layout.gif) | Algebra_and_Coalgebra_in_Computer_Science_Corradini,_Klin,_and_Cirstea.pdf | 2023-11-02 05:05 | 4.3M | |
![[ ]](/icons/layout.gif) | Algebra, Geometry and Software Systems - Joswig and Takayama.pdf | 2023-11-02 05:05 | 11M | |
![[ ]](/icons/layout.gif) | Ajax For Dummies@englishbooks (2).pdf | 2023-11-02 04:55 | 8.0M | |
![[IMG]](/icons/image2.gif) | Agile_Leadership_Toolkit_Learning.jpg | 2023-11-02 05:10 | 92K | |
![[ ]](/icons/layout.gif) | Agile Data Science.pdf | 2023-11-02 09:55 | 12M | |
![[ ]](/icons/layout.gif) | Affective Computing - Picard.pdf | 2023-11-02 05:05 | 1.8M | |
![[ ]](/icons/layout.gif) | Advenctures_in_Computer_Science_From_Classical_Bits_to_Quantum_Bits.pdf | 2023-11-02 05:05 | 3.2M | |
![[ ]](/icons/layout.gif) | Advances in Proof Theory - Kahle, Strahm, and Studer.pdf | 2023-11-02 05:05 | 11M | |
![[ ]](/icons/layout.gif) | Advances in Cryptology — CRYPTO ’88 - Goldwasser.pdf | 2023-11-02 05:05 | 11M | |
![[ ]](/icons/layout.gif) | Advances in Computational Science and Computing - Xiong.pdf | 2023-11-02 05:05 | 44M | |
![[ ]](/icons/layout.gif) | Advances in Computational Intelligence - Yu and Sanchez.pdf | 2023-11-02 05:05 | 7.1M | |
![[ ]](/icons/layout.gif) | Advances_in_Pattern_Recognition_Carrasco_Ochoa,_Martinez_Trinidad.pdf | 2023-11-02 05:05 | 11M | |
![[ ]](/icons/layout.gif) | Advances_in_Nonlinear_Speech_Processing_Solé_Casals_and_Zaiats.pdf | 2023-11-02 05:05 | 6.1M | |
![[ ]](/icons/layout.gif) | Advances_in_Neural_Networks_Computational_and_Theoretical_Issues.pdf | 2023-11-02 05:05 | 29M | |
![[ ]](/icons/layout.gif) | Advances_in_Neural_Networks_Computational_Intelligence_for_ICT_Bassis.pdf | 2023-11-02 05:05 | 15M | |
![[ ]](/icons/layout.gif) | Advances_in_Machine_Learning_and_Data_Analysis_by_Sio_Iong_Ao_Burghard.pdf | 2023-11-02 10:51 | 4.7M | |
![[ ]](/icons/layout.gif) | Advances_in_Financial_Machine_Learning_by_Marcos_Lopez_de_Prado.pdf | 2023-11-02 11:27 | 8.5M | |
![[ ]](/icons/layout.gif) | Advanced_Topics_in_Information_Retrieval_Melucci_and_Baeza_Yates.pdf | 2023-11-02 05:05 | 10M | |
![[ ]](/icons/unknown.gif) | Advanced_PHP_for_Web_Professionals_2002.chm | 2023-11-02 04:53 | 5.6K | |
![[ ]](/icons/layout.gif) | Advanced_Intelligent_Paradigm_in_Computer_Games_Baba,_Jain,_and.pdf | 2023-11-02 05:05 | 4.5M | |
![[ ]](/icons/layout.gif) | Advanced_Guide_To_Python_3_Programming_by_John_Hunt_z_lib_org.pdf | 2023-11-02 10:47 | 23M | |
![[ ]](/icons/layout.gif) | Advanced_Deep_Learning_with_TensorFlow_2_and_Keras_Apply_DL,_GANs.pdf | 2023-11-02 10:51 | 20M | |
![[ ]](/icons/layout.gif) | Advanced_Deep_Learning_with_Keras.pdf | 2023-11-03 03:40 | 11M | |
![[ ]](/icons/layout.gif) | Advanced_API_Security_Securing_APIs_with_OAuth_2_0,_OpenID_Connect.pdf | 2023-10-31 06:56 | 2.7M | |
![[ ]](/icons/layout.gif) | Advanced Topics in Types and Programming Languages - Pierce.pdf | 2023-11-02 05:05 | 3.1M | |
![[ ]](/icons/layout.gif) | Advanced Topics in Java.pdf | 2023-11-02 04:53 | 7.7M | |
![[ ]](/icons/layout.gif) | Advanced Network Programming - Principles and Techniques.pdf | 2023-11-02 04:53 | 6.2M | |
![[ ]](/icons/layout.gif) | Advanced Metaprogramming in Classic C++ - Gennaro.pdf | 2023-11-02 05:05 | 2.8M | |
![[ ]](/icons/layout.gif) | Advanced Machine Learning with Python.pdf | 2023-11-02 10:47 | 2.1M | |
![[ ]](/icons/layout.gif) | Advanced Machine Learning with Python (en).pdf | 2023-11-03 03:42 | 2.1M | |
![[ ]](/icons/layout.gif) | Advanced Functional Programming - Jeuring and Jones.pdf | 2023-11-02 05:05 | 1.6M | |
![[ ]](/icons/layout.gif) | Advanced Data Structures - Brass.pdf | 2023-11-02 05:05 | 2.0M | |
![[ ]](/icons/layout.gif) | Advanced Data Mining Techniques - Olson and Delen.pdf | 2023-11-02 05:05 | 801K | |
![[ ]](/icons/layout.gif) | Advanced Azure Machine Learning.pdf | 2023-11-02 10:46 | 15M | |
![[ ]](/icons/layout.gif) | Adpating_Proofs_As_Programs_The_Curry_Howard_Protocol_Poernomo,.pdf | 2023-11-02 05:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | Adobe Photoshop CC Classroom in a Book (2019 Release).jpg | 2023-11-02 05:10 | 42K | |
![[ ]](/icons/layout.gif) | Addison_Wesley_The_Android_Developer's.pdf | 2023-11-02 04:53 | 3.4M | |
![[ ]](/icons/layout.gif) | Addison_Wesley_Donald_E_Knuth_The.pdf | 2023-11-02 04:53 | 54M | |
![[ ]](/icons/layout.gif) | Addison_Wesley_Donald_E_Knuth_The (7).pdf | 2023-11-02 05:33 | 64M | |
![[ ]](/icons/layout.gif) | Addison_Wesley_Donald_E_Knuth_The (6).pdf | 2023-11-02 05:33 | 43M | |
![[ ]](/icons/layout.gif) | Adam_Mechtley_and_Ryan_Trowbridge_Auth_Maya_Python_for_Games_and.pdf | 2023-11-02 04:59 | 8.2M | |
![[ ]](/icons/layout.gif) | Accurate Scientific Computations - Miranker and Toupin.pdf | 2023-11-02 05:05 | 3.4M | |
![[ ]](/icons/layout.gif) | Access Database Design and Programming 3e - Roman.pdf | 2023-11-02 05:05 | 2.3M | |
![[ ]](/icons/layout.gif) | A_Programming_Approach_to_Computability_Kfoury,_Moll,_and_Arbib.pdf | 2023-11-02 05:05 | 5.6M | |
![[ ]](/icons/layout.gif) | A_Practical_Introduction_to_Data.pdf | 2023-11-02 04:51 | 2.1M | |
![[ ]](/icons/layout.gif) | A_Practical_Guide_to_Boundary_Element_Methods_with_the_Software.pdf | 2023-11-02 05:05 | 4.6M | |
![[ ]](/icons/layout.gif) | A_List_of_Successes_That_Can_Change_the_World_Essays_Dedicated_to.pdf | 2023-11-02 05:05 | 21M | |
![[ ]](/icons/layout.gif) | A_Learner's_Guide_to_Programming.pdf | 2023-11-02 04:53 | 17M | |
![[ ]](/icons/layout.gif) | A_Hands_On_Introduction_to_Essential_Python_Libraries_and_Frameworks.pdf | 2023-11-10 03:47 | 1.4M | |
![[ ]](/icons/layout.gif) | A_Half_Century_of_Automata_Theory_Celebration_and_Inspiration_Salomaa.pdf | 2023-11-02 05:04 | 6.1M | |
![[ ]](/icons/layout.gif) | A_Guide_to_MATLAB_for_Beginners_and_Experienced_Users_Hunt,_Lipsman.pdf | 2023-11-02 05:04 | 4.8M | |
![[ ]](/icons/layout.gif) | A_Collection_of_Test_Problems_for_Constrained_Global_Optimization.pdf | 2023-11-02 05:04 | 4.2M | |
![[ ]](/icons/layout.gif) | A_Collection_of_Programming_Problems_and_Techniques_Maurer_and_Williams.pdf | 2023-11-02 05:04 | 15M | |
![[ ]](/icons/layout.gif) | A_Book_On_C_Programming_In_C_19984thAl.pdf | 2023-11-02 04:53 | 47M | |
![[ ]](/icons/layout.gif) | A_Basis_for_Theoretical_Computer_Science_Kfoury,_Moll,_and_Arbib.pdf | 2023-11-02 05:04 | 16M | |
![[ ]](/icons/layout.gif) | AWS Certified Cloud Practitioner Study Guide.pdf | 2023-11-02 05:10 | 13M | |
![[ ]](/icons/layout.gif) | A Theory of Shape Identification - Cao.pdf | 2023-11-02 05:05 | 52M | |
![[ ]](/icons/layout.gif) | A Smarter Way to Learn JavaScript - Meyers.pdf | 2023-11-02 05:05 | 1.7M | |
![[ ]](/icons/layout.gif) | ASP NET 3 5 For Dummies Feb 2008@englishbooks.pdf | 2023-11-02 04:51 | 9.8M | |
![[ ]](/icons/layout.gif) | ASP NET 2 0 Everyday Apps For Dummies@englishbooks.pdf | 2023-11-02 04:51 | 9.5M | |
![[ ]](/icons/layout.gif) | ASP NET 2 0 AIO Desk Reference For Dummies@englishbooks (2).pdf | 2023-11-02 05:28 | 18M | |
![[ ]](/icons/layout.gif) | ASP.NET 4.0 in Practice By Daniele Bochicchio.pdf | 2023-11-02 04:51 | 15M | |
![[ ]](/icons/layout.gif) | ASP,AJAX.pdf | 2023-11-02 05:15 | 6.5M | |
![[ ]](/icons/layout.gif) | A Programmer_s Introduction to C# - Gunnerson.pdf | 2023-11-02 05:05 | 1.0M | |
![[ ]](/icons/layout.gif) | A Primer on Scientific Programming with Python (2009).pdf | 2023-11-02 04:56 | 6.8M | |
![[ ]](/icons/layout.gif) | A Practical Guide to Sentiment Analysis - Cambria.pdf | 2023-11-02 05:05 | 2.5M | |
![[ ]](/icons/layout.gif) | ALGORITHMS - ROBERT SEDGEWICK.pdf | 2023-11-02 04:52 | 4.6M | |
![[ ]](/icons/layout.gif) | AI with Python (en).pdf | 2023-11-03 03:43 | 3.4M | |
![[ ]](/icons/layout.gif) | AI and Cybersecurity For Dummies.pdf | 2023-11-02 11:17 | 1.5M | |
![[ ]](/icons/layout.gif) | AI_for_Data_Science_Artificial_Intelligence_Frameworks_and_Functionality.pdf | 2023-11-02 10:46 | 1.9M | |
![[ ]](/icons/layout.gif) | AI_Crash_Course_A_Fun_and_Hands_On_Introduction_to_Reinforcement.pdf | 2023-11-02 10:51 | 9.4M | |
![[ ]](/icons/layout.gif) | AI_Crash_Course_A_Fun_and_Hands_On_Introduction_to_Reinforcement (2).pdf | 2023-11-02 10:52 | 9.4M | |
![[ ]](/icons/layout.gif) | A First Course in Database Systems 3e - Ullman and Widom.pdf | 2023-11-02 05:05 | 38M | |
![[ ]](/icons/layout.gif) | A Distributed Pi-Calculus - Hennessy.pdf | 2023-11-02 05:04 | 2.8M | |
![[ ]](/icons/layout.gif) | ADO.NET 4 Step by Step.pdf | 2023-11-02 04:53 | 8.4M | |
![[ ]](/icons/layout.gif) | A Concise Introduction to Data Structures using Java.pdf | 2023-11-02 04:53 | 1.3M | |
![[ ]](/icons/layout.gif) | ACM- ICPC from_baylor_to_baylor.pdf | 2023-11-02 04:53 | 11M | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.92 (for Python 3.0) (2009).pdf | 2023-11-02 04:53 | 609K | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.20 (for Python 2.x) (2005).pdf | 2023-11-02 04:53 | 337K | |
![[ ]](/icons/layout.gif) | @datascienceM An Introduction to Python Programming.pdf | 2023-11-03 03:34 | 8.0M | |
![[ ]](/icons/layout.gif) | @Magazinesy WhatsApp For Beginners - 9th Edition, 2022.pdf | 2023-11-17 10:51 | 45M | |
![[ ]](/icons/layout.gif) | @Magazinesy Instagram For Beginners - 9th Edition, 2022.pdf | 2023-11-17 10:51 | 38M | |
![[ ]](/icons/layout.gif) | 360055559_Shell_Scripting_Learn_Linux_Shell_Programming_Step_By.pdf | 2023-11-02 04:59 | 4.6M | |
![[ ]](/icons/layout.gif) | 277773689-Aptitude-Training-Students-Material.pdf | 2023-11-02 04:59 | 8.1M | |
![[ ]](/icons/layout.gif) | 1392629CE_FM_WB_Opt.pdf | 2023-11-03 09:33 | 13M | |
![[ ]](/icons/layout.gif) | 9899-2011-TC1.pdf | 2023-11-02 04:53 | 386K | |
![[ ]](/icons/layout.gif) | 9899-2011-Draft.pdf | 2023-11-02 04:53 | 1.6M | |
![[ ]](/icons/layout.gif) | 9899-1999.pdf | 2023-11-02 04:53 | 1.3M | |
![[ ]](/icons/layout.gif) | 9899-1999-TC3.pdf | 2023-11-02 04:53 | 93K | |
![[ ]](/icons/layout.gif) | 9899-1999-TC2.pdf | 2023-11-02 04:53 | 344K | |
![[ ]](/icons/unknown.gif) | 9899-1999-TC1.PDF | 2023-11-02 04:53 | 20K | |
![[ ]](/icons/layout.gif) | 9899-1990.pdf | 2023-11-02 04:53 | 13M | |
![[ ]](/icons/layout.gif) | 9899-1990-TC2.pdf | 2023-11-02 04:53 | 50K | |
![[ ]](/icons/layout.gif) | 9899-1990-TC1.pdf | 2023-11-02 04:53 | 77K | |
![[ ]](/icons/layout.gif) | 8086_Microprocessor_Architecture,_Programming_and_Interfacing_Bharat.pdf | 2023-11-02 09:15 | 19M | |
![[ ]](/icons/layout.gif) | 2006WroxProfessionalLamp-LinuxApacheMysqlPhp5WebDevelopment.pdf | 2023-11-02 04:53 | 7.1M | |
![[ ]](/icons/layout.gif) | 2005WileyBeginningPhp5ApacheAndMysqlWebDevelopment.pdf | 2023-11-02 04:53 | 14M | |
![[ ]](/icons/layout.gif) | 2005PrenticeHallPhp5PowerProgramming.pdf | 2023-11-02 04:53 | 9.7M | |
![[ ]](/icons/unknown.gif) | 2005Addison-WesleyPhp5.chm | 2023-11-02 04:53 | 17M | |
![[ ]](/icons/layout.gif) | 2004WileyPhp5ForDummies.pdf | 2023-11-02 04:53 | 6.4M | |
![[ ]](/icons/layout.gif) | 2004WileyPhp5AndMysqlBible.pdf | 2023-11-02 04:54 | 16M | |
![[ ]](/icons/layout.gif) | 1810.00736.pdf | 2023-11-02 11:27 | 2.7M | |
![[ ]](/icons/layout.gif) | 115_Java_Interview_Questions_and.pdf | 2023-11-02 04:54 | 946K | |
![[ ]](/icons/layout.gif) | 101 Labs_Wireshark .pdf | 2023-11-02 05:01 | 48M | |
![[ ]](/icons/layout.gif) | 97_Things_Every_Programmer_Should_Know.pdf | 2023-11-02 05:12 | 2.0M | |
![[ ]](/icons/layout.gif) | 70-412(MS)-Configuring-Advanced-w2012R2-Services.pdf | 2023-11-02 04:54 | 9.4M | |
![[ ]](/icons/layout.gif) | 21st_Century_C_C_Tips_From_The_New.pdf | 2023-11-02 04:54 | 7.2M | |
![[ ]](/icons/layout.gif) | 20 Python Libraries You Aren't Using (But Should).pdf | 2023-11-10 03:50 | 4.1M | |
![[ ]](/icons/layout.gif) | 10 marta ko‘proq.pdf | 2023-11-02 10:49 | 2.2M | |
![[ ]](/icons/layout.gif) | 5_6093688707527738751.pdf | 2023-11-06 06:46 | 2.6M | |
![[ ]](/icons/layout.gif) | 5_6093688707527738740.pdf | 2023-11-06 06:46 | 470K | |
![[ ]](/icons/layout.gif) | 2_Improving_Deep_Neural_Networks.pdf | 2023-11-02 11:16 | 1.0M | |
![[ ]](/icons/layout.gif) | 1.1 Notes for c Language.pdf | 2023-11-02 05:00 | 955K | |
![[ ]](/icons/layout.gif) | 01-oct-Introduction to SQL (Bobby Iliev).pdf | 2023-10-31 06:53 | 396K | |
![[ ]](/icons/layout.gif) | -MAQSAD- BY - SHDOLIMOV_5456611913.pdf | 2023-11-02 10:49 | 967K | |
![[ ]](/icons/layout.gif) | (by-Abhishek-Ratan)-Practical-Network-Automation.pdf | 2023-11-02 10:51 | 12M | |
![[ ]](/icons/layout.gif) | (Early Access) Black Hat Bash.pdf | 2023-11-02 05:01 | 6.2M | |
![[ ]](/icons/layout.gif) | 𝐌𝐢𝐜𝐫𝐨𝐬𝐨𝐟𝐭_𝐄𝐱𝐜𝐞𝐥_𝐅𝐨𝐫_𝐏𝐫𝐨𝐟𝐞𝐬𝐬𝐢𝐨𝐧𝐚𝐥𝐬!_.pdf | 2023-11-06 06:12 | 2.3M | |
![[ ]](/icons/layout.gif) | Черняк_Е_Введение_в_глубокое_обучение_2020.pdf | 2023-11-02 10:50 | 20M | |
![[ ]](/icons/layout.gif) | Грас Дж. - Data Science - 2021.pdf | 2023-11-02 10:46 | 25M | |
![[ ]](/icons/layout.gif) | Вирсански_Э_Генетические_алгоритмы_на_Python_2020.pdf | 2023-11-02 10:50 | 11M | |
![[ ]](/icons/layout.gif) | λ-Calculus and Computer Science Theory - Goos and Hartmanis.pdf | 2023-11-02 05:04 | 5.8M | |
|