![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1. Introduction to Wastewater Engineering.pdf | 2024-08-08 05:24 | 181K | |
| 3. Sewers Laying, Testing & Appurtenances.pdf | 2024-08-08 05:24 | 186K | |
| 11 Progress Report Formats.pdf | 2024-08-08 07:26 | 291K | |
| Bar Bending Schedule(BBS) .pdf | 2024-08-08 05:23 | 655K | |
| Bar Bending Schedule [BBS].pdf | 2024-08-08 05:23 | 376K | |
| Bolts and Bolted Connections for PDF.pdf | 2024-08-08 07:17 | 745K | |
| Bricks as Building Material - Short Notes.pdf | 2024-08-08 07:17 | 8.0M | |
| Bridge Engineering and Tunnelling Formulae Sheet.pdf | 2024-08-08 07:15 | 1.6M | |
| Building_Const_&_Materials_111+_MCQs_Simplified_Learning.pdf | 2024-08-08 07:15 | 737K | |
| Building_Materials_Timber_Part_1_Types,_Desired_Properties,_Strength.pdf | 2024-08-08 05:24 | 708K | |
| CAd .pdf | 2024-08-08 07:26 | 18M | |
| Cable bridge.pdf | 2024-08-08 05:23 | 1.0M | |
| Calculation note book for cantilever roof & canopy..pdf | 2024-08-08 05:23 | 686K | |
| Calculation notebook for mast tower.pdf | 2024-08-08 05:23 | 417K | |
| Calculation steps for designing a frame bridge.pdf | 2024-08-08 05:23 | 492K | |
| Chemical Characteristics of Waste Water PDF SL.pdf | 2024-08-08 07:15 | 149K | |
| Collection_&_Conveyance_of_Wastewater_by_Simplified_Learning.pdf | 2024-08-08 05:24 | 136K | |
| DO Sag Curve Interactive Sheet.pdf | 2024-08-08 07:26 | 721K | |
| DSS Basics SimplifiedLearning.pdf | 2024-08-08 05:24 | 560K | |
| Elevated Water Tank Analysis.pdf | 2024-08-08 07:26 | 2.2M | |
| Essentials of Transit Theodolite Interactive Sheets.pdf | 2024-08-08 07:26 | 659K | |
| Estimating & Costing Complete Formulae.pdf | 2024-08-08 07:15 | 3.4M | |
| Fluid Properties 99 MCQs by Simplified Learning.pdf | 2024-08-08 07:15 | 1.2M | |
| Formulae Fluid Mechanics PDF.pdf | 2024-08-08 07:15 | 14M | |
| Highway Engineering 400+ MCQs by Simplified Learning.pdf | 2024-08-08 05:24 | 1.8M | |
| How To Calculate Steel Dome .pdf | 2024-08-08 05:23 | 540K | |
| Interactive Quiz Bolts Failure in Connections.pdf | 2024-08-08 07:26 | 1.0M | |
| Interactive Quiz Plate Failure in Connections.pdf | 2024-08-08 07:26 | 1.1M | |
| Introduction to Connections for PDF.pdf | 2024-08-08 07:17 | 559K | |
| Joint Failures MCQs Simplified Learning.pdf | 2024-08-08 07:26 | 601K | |
| Lap Joint, Butt Joint and their Details PDF.pdf | 2024-08-08 07:26 | 653K | |
| MCQs for Activated Sludge Process.pdf | 2024-08-08 07:15 | 110K | |
| MCQs for Sedimentation of Waste Water.pdf | 2024-08-08 07:15 | 108K | |
| MCQs for Trickling Filters.pdf | 2024-08-08 07:15 | 109K | |
| PEDESTRIAN BOWSTRING BRIDGE.pdf | 2024-08-08 05:23 | 1.0M | |
| Parameters Regarding Structural Fasteners PDF.pdf | 2024-08-08 07:26 | 571K | |
| Physical Characteristics of Wastewater Simplified Learning.pdf | 2024-08-08 05:24 | 111K | |
| Preliminary Treatment of Waste Water MCQs.pdf | 2024-08-08 07:15 | 72K | |
| RCC Footing Details.pdf | 2024-08-08 05:23 | 570K | |
| Role of Quantity Surveyor.pdf | 2024-08-08 07:26 | 735K | |
| SURVEYING.pdf | 2024-08-08 05:23 | 18M | |
| Simplified Learning's Social Media Links.pdf | 2024-08-08 07:26 | 92K | |
| Structural fastners, details PDF.pdf | 2024-08-08 07:17 | 656K | |
| Surveying Problem Solving.pdf | 2024-08-08 05:23 | 3.6M | |
| Timber as Building Material Study Sheet.pdf | 2024-08-08 07:15 | 1.7M | |
| Timber as Building Material by Simplified Learning.pdf | 2024-08-08 05:24 | 737K | |
| Variation Orders and EOT.pdf | 2024-08-08 07:27 | 177K | |
| Waste Water Disposal - Natural Methods MCQs.pdf | 2024-08-08 07:15 | 90K | |
| Water Supply Engineering Formulae Sheet.pdf | 2024-08-08 07:15 | 3.9M | |
| Water_Supply_Engineering_110+_Objective_Questions_by_Simplified.pdf | 2024-08-08 05:24 | 384K | |
![[IMG]](/icons/image2.gif) | photo_2024-08-08_12-57-00.jpg | 2024-08-08 07:27 | 43K | |
|
|---|
