![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 𝐋𝐞𝐚𝐫𝐧 𝐒𝐐𝐋 𝐅𝐚𝐬𝐭 ! .pdf | 2024-09-12 06:37 | 514K | |
![[ ]](/icons/layout.gif) | 01 - The C Language.pdf | 2024-09-14 07:37 | 2.6M | |
![[ ]](/icons/layout.gif) | 02 - Variables and Data Storage.pdf | 2024-09-14 07:37 | 1.8M | |
![[ ]](/icons/layout.gif) | 03 - Sorting and Seaching Data.pdf | 2024-09-14 07:38 | 1.9M | |
![[ ]](/icons/layout.gif) | 04 - Data Files.pdf | 2024-09-14 07:37 | 1.9M | |
![[ ]](/icons/layout.gif) | 05 - Working with the Preprocessor.pdf | 2024-09-14 07:38 | 1.9M | |
![[ ]](/icons/layout.gif) | 06 - Working with Strings.pdf | 2024-09-14 07:37 | 965K | |
![[ ]](/icons/layout.gif) | 07 - Pointers and Memory Allocation.pdf | 2024-09-14 07:36 | 1.1M | |
![[ ]](/icons/layout.gif) | 08 - Functions.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 09 - Arrays.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 1-Introduction-What-is-Multimedia.pdf | 2024-09-14 07:46 | 262K | |
![[ ]](/icons/layout.gif) | 1.Computer Networks, 4th edition.pdf | 2024-09-14 07:45 | 30M | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2024-09-17 04:12 | 99K | |
![[ ]](/icons/layout.gif) | 2-sound-and-audio-system.pdf | 2024-09-14 07:44 | 413K | |
![[ ]](/icons/layout.gif) | 2. Computer-Networks-5th-Edition.pdf | 2024-09-14 07:33 | 8.1M | |
![[ ]](/icons/layout.gif) | 2.Data.And.Computer.Communications.8e.WilliamStallings.pdf | 2024-09-14 07:45 | 5.1M | |
![[IMG]](/icons/image2.gif) | 2.jpg | 2024-09-17 04:12 | 109K | |
![[ ]](/icons/layout.gif) | 3-Image-Graphics.pdf | 2024-09-14 07:44 | 430K | |
![[IMG]](/icons/image2.gif) | 3.jpg | 2024-09-17 04:12 | 108K | |
![[ ]](/icons/layout.gif) | 3_Curose_Ross_Computer_Networking_A_Top_down_Approach_Featuring.pdf | 2024-09-14 07:45 | 9.4M | |
![[ ]](/icons/layout.gif) | 4-Video-Animation.pdf | 2024-09-14 07:44 | 80K | |
![[IMG]](/icons/image2.gif) | 4.jpg | 2024-09-17 04:23 | 109K | |
![[ ]](/icons/layout.gif) | 5-Data-Compression.pdf | 2024-09-14 07:46 | 261K | |
![[IMG]](/icons/image2.gif) | 5.jpg | 2024-09-20 06:05 | 103K | |
![[ ]](/icons/layout.gif) | 6-b-User-Interfaces.pdf | 2024-09-14 07:44 | 11K | |
![[ ]](/icons/layout.gif) | 6-user-interface-design.pdf | 2024-09-14 07:44 | 786K | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2024-09-19 10:53 | 105K | |
![[ ]](/icons/layout.gif) | 7-Abstractions-for-Programming.pdf | 2024-09-14 07:44 | 239K | |
![[IMG]](/icons/image2.gif) | 7.jpg | 2024-09-20 06:03 | 104K | |
![[ ]](/icons/layout.gif) | 8-Multimedia-system-application.pdf | 2024-09-14 07:44 | 79K | |
![[IMG]](/icons/image2.gif) | 8.jpg | 2024-09-20 06:03 | 97K | |
![[ ]](/icons/layout.gif) | 10 - Bits and Bytes.pdf | 2024-09-14 07:36 | 925K | |
![[ ]](/icons/layout.gif) | 11 - Debugging.pdf | 2024-09-14 07:36 | 1.1M | |
![[ ]](/icons/layout.gif) | 12 - Standard Library Functions.pdf | 2024-09-14 07:36 | 1.1M | |
![[ ]](/icons/layout.gif) | 13 - Times and Dates.pdf | 2024-09-14 07:36 | 1.0M | |
![[ ]](/icons/layout.gif) | 14 - System Calls.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 14_days_of_Git.pdf | 2024-10-06 06:47 | 3.5M | |
![[ ]](/icons/layout.gif) | 15 - Portability.pdf | 2024-09-14 07:36 | 1.0M | |
![[ ]](/icons/layout.gif) | 16 - ANSI-ISO Standards.pdf | 2024-09-14 07:36 | 1.0M | |
![[ ]](/icons/layout.gif) | 17 - User Interface - Screen and Keyboard.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 18 - Writing and Compiling Your Programs.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 19 - Programming Style and Standards.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | 20 - Miscellaneous.pdf | 2024-09-14 07:36 | 1.9M | |
![[ ]](/icons/layout.gif) | 21 - Windows.pdf | 2024-09-14 07:36 | 1.0M | |
![[ ]](/icons/layout.gif) | 21st_Century_C_C_Tips_From_The_New.pdf | 2024-09-14 07:35 | 8.2M | |
![[ ]](/icons/layout.gif) | 25 Must-Know Excel Interview Questions💡.pdf | 2024-09-12 06:37 | 19M | |
![[ ]](/icons/layout.gif) | 30_Arduino™_Projects_for_the_Evil_Genius_Department_of_Control_PDFDrive.pdf | 2024-09-12 06:21 | 8.2M | |
![[ ]](/icons/layout.gif) | 100 Java Mistakes (2023).pdf | 2024-09-12 06:38 | 5.8M | |
![[ ]](/icons/layout.gif) | 100 Most Asked Java Interview QnA.pdf | 2024-09-12 06:37 | 244K | |
![[ ]](/icons/layout.gif) | 270+ Cyber Security Interview Questions and Answers.pdf | 2024-09-18 07:28 | 718K | |
![[ ]](/icons/layout.gif) | 271_AI Lect Notes.pdf | 2024-09-28 03:52 | 2.1M | |
![[ ]](/icons/layout.gif) | 300+ C Interview Questions and Answers.pdf | 2024-09-12 04:23 | 650K | |
![[ ]](/icons/layout.gif) | 800+ SQL Interview questions💡.pdf | 2024-09-12 06:37 | 2.1M | |
![[ ]](/icons/layout.gif) | 2024 Latest Previous year solved question paper.pdf | 2024-09-14 07:43 | 53K | |
![[ ]](/icons/layout.gif) | 307963-computer-graphics-by-verified-writer.pdf | 2024-09-14 07:43 | 7.0M | |
![[ ]](/icons/compressed.gif) | @CodeProgrammer Data Science Cheat Sheets.zip | 2024-09-16 05:31 | 596M | |
![[ ]](/icons/layout.gif) | A-Practical-Guide-to-Giving-and-Receiving-Employee-Feedback.pdf | 2024-09-13 05:06 | 1.4M | |
![[ ]](/icons/layout.gif) | A-Z in Python.pdf | 2024-10-13 05:46 | 9.0M | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.20 (for Python 2.x) (2005).pdf | 2024-09-14 07:35 | 751K | |
![[ ]](/icons/layout.gif) | A Byte of Python, v1.92 (for Python 3.0) (2009).pdf | 2024-09-14 07:35 | 938K | |
![[ ]](/icons/layout.gif) | A First Course in Artificial Intelligence ( PDFDrive ).pdf | 2024-09-14 07:32 | 25M | |
![[ ]](/icons/layout.gif) | AI Demystified - Alex David Pratt.pdf | 2024-10-21 11:06 | 1.1M | |
![[ ]](/icons/layout.gif) | AI_Curriculum_Handbook.pdf | 2024-09-28 03:51 | 5.4M | |
![[ ]](/icons/layout.gif) | AI_Russell_Norvig.pdf | 2024-09-28 03:47 | 20M | |
![[ ]](/icons/layout.gif) | A Primer on Scientific Programming with Python (2009).pdf | 2024-09-14 07:34 | 7.8M | |
![[ ]](/icons/layout.gif) | AWS_Certified_Cloud_Practitioner_CLF_C02_Cert_Guide_Pearson_IT_Certification.pdf | 2024-10-30 10:00 | 23M | |
![[ ]](/icons/layout.gif) | A_Book_On_C_Programming_In_C_19984thAl.pdf | 2024-09-14 07:36 | 49M | |
![[ ]](/icons/layout.gif) | A_Learner's_Guide_to_Programming.pdf | 2024-09-14 07:34 | 18M | |
![[ ]](/icons/layout.gif) | Abraham Silberschatz-Operating System Concepts (9th,2012_12).pdf | 2024-09-14 07:33 | 7.6M | |
![[ ]](/icons/layout.gif) | Absolute Beginner s Python Programming.pdf | 2024-09-12 06:38 | 14M | |
![[ ]](/icons/layout.gif) | Advanced Applications of Python Data Structures and Algorith.pdf | 2024-09-12 06:38 | 34M | |
![[ ]](/icons/layout.gif) | AdvancedC.pdf | 2024-09-14 07:37 | 5.8M | |
![[ ]](/icons/layout.gif) | Agile_Strategy_Management_in_the_Digital_Age_How_Dynamic_Balanced.pdf | 2024-09-13 05:06 | 2.8M | |
![[ ]](/icons/layout.gif) | Algorithms Data Structures = Programs [Wirth 1976-02].pdf | 2024-09-18 10:20 | 21M | |
![[ ]](/icons/layout.gif) | Algorithms_In_C_Parts_1_4_Fundamentals.pdf | 2024-09-14 07:35 | 35M | |
![[ ]](/icons/layout.gif) | Aligning Culture with the Bottom Line.pdf | 2024-09-13 05:06 | 2.2M | |
![[ ]](/icons/layout.gif) | An Introduction to Python Programming.pdf | 2024-09-12 06:38 | 8.0M | |
![[ ]](/icons/layout.gif) | Anthony_Molinaro,_Robert_de_Graaf_SQL_Cookbook_Query_Solutions_and.pdf | 2024-10-06 06:22 | 12M | |
![[ ]](/icons/layout.gif) | Apress_Foundations_of_Python_3_Network.pdf | 2024-09-14 07:39 | 4.8M | |
![[ ]](/icons/layout.gif) | Arduino Workshop.pdf | 2024-10-28 07:56 | 7.2M | |
![[ ]](/icons/layout.gif) | Azure Data Factory interview questions and aswers.pdf | 2024-10-13 05:40 | 243K | |
![[ ]](/icons/layout.gif) | BE_7_TECHNICAL_INSEM_STQA.pdf | 2024-09-14 07:46 | 6.1M | |
![[ ]](/icons/layout.gif) | Begin_to_Code_Building_apps_and_games_in_the_Cloud_Microsoft_Press.pdf | 2024-09-15 07:36 | 14M | |
![[ ]](/icons/layout.gif) | Beginning Java Objects.pdf | 2024-09-12 06:38 | 13M | |
![[ ]](/icons/layout.gif) | Beginning Python (2005).pdf | 2024-09-14 07:34 | 6.0M | |
![[ ]](/icons/layout.gif) | Beginning Python - From Novice to Professional (2005) - BBL.pdf | 2024-09-14 07:34 | 14M | |
![[ ]](/icons/layout.gif) | Beginning Python - Using Python 2.6 and Python 3.1 (2010).pdf | 2024-09-14 07:39 | 4.4M | |
![[ ]](/icons/layout.gif) | Beginning_Game_Development_with.pdf | 2024-09-14 07:39 | 8.1M | |
![[ ]](/icons/layout.gif) | Beginning_Python_From_Novice_to.pdf | 2024-09-14 07:34 | 3.2M | |
![[ ]](/icons/layout.gif) | Beginning_Python_Visualization_Crafting.pdf | 2024-09-14 07:34 | 2.7M | |
![[ ]](/icons/layout.gif) | Beginning_STM32_Developing_with_FreeRTOS,_libopencm3_and_GCC_PDFDrive.pdf | 2024-09-12 06:20 | 7.7M | |
![[ ]](/icons/layout.gif) | Bioinformatics_Programming_Using.pdf | 2024-09-14 07:34 | 3.6M | |
![[ ]](/icons/layout.gif) | Black_Hat_Python_Python_Programming_for_Hackers_and_Pentesters_No.pdf | 2024-10-01 09:54 | 11M | |
![[ ]](/icons/layout.gif) | Building_Your_Own_PC_Ed11_2024_.pdf | 2024-10-24 11:20 | 84M | |
![[ ]](/icons/layout.gif) | C++ How To Program 8th Edition.pdf | 2024-09-14 07:44 | 56M | |
![[ ]](/icons/layout.gif) | C - How to Program (2013)(7th)(Paul Deitel, Harvey Deitel).pdf | 2024-09-14 07:35 | 8.8M | |
![[ ]](/icons/layout.gif) | CCNP_Enterprise_Advanced_Routing_ENARSI_300_410_Official_Cert_Guide.pdf | 2024-10-23 11:25 | 50M | |
![[ ]](/icons/layout.gif) | CCNP_Enterprise_Design_ENSLD_300_420_Official_Cert_Guide_Cisco_Press.pdf | 2024-10-24 11:19 | 23M | |
![[ ]](/icons/layout.gif) | CCNP_and_CCIE_Enterprise_Core_ENCOR_350_401_Official_Cert_Guide.pdf | 2024-10-28 12:13 | 17M | |
![[ ]](/icons/layout.gif) | CLanguageTutorial.pdf | 2024-09-14 07:37 | 962K | |
![[ ]](/icons/layout.gif) | COA.pdf | 2024-09-14 07:45 | 7.7M | |
![[ ]](/icons/layout.gif) | CODING.pdf | 2024-09-25 09:32 | 104M | |
![[ ]](/icons/layout.gif) | COMPILERS_bk 2nd edition.pdf | 2024-09-14 07:33 | 59M | |
![[ ]](/icons/layout.gif) | COMPUTER PROGRAMMING FUNDAMENTALS (2024).pdf | 2024-10-17 04:49 | 16M | |
![[ ]](/icons/layout.gif) | C Primer Plus (2014)(6th)(Stephen Prata).pdf | 2024-09-14 07:35 | 9.1M | |
![[ ]](/icons/layout.gif) | C Programming - Ebook.pdf | 2024-09-14 07:37 | 1.8M | |
![[ ]](/icons/layout.gif) | C Puzzle Book, The (1982)(1st)(Alan R. Feuer).pdf | 2024-09-14 07:35 | 3.3M | |
![[ ]](/icons/layout.gif) | C The Complete Reference HARBERT SCH.pdf | 2024-09-14 07:37 | 7.5M | |
![[ ]](/icons/layout.gif) | C Traps And Pitfalls (1989)(1st)(Andrew Koenig).pdf | 2024-09-14 07:35 | 5.9M | |
![[ ]](/icons/layout.gif) | C Traps And Pitfalls.pdf | 2024-09-14 07:38 | 1.8M | |
![[ ]](/icons/layout.gif) | C_Book,_The_19912ndMike_Banahan.pdf | 2024-09-14 07:35 | 2.1M | |
![[ ]](/icons/layout.gif) | C_Interfaces_And_Implementations.pdf | 2024-09-14 07:35 | 3.0M | |
![[ ]](/icons/layout.gif) | C_Language_Ref_Man.pdf | 2024-09-14 07:38 | 1.9M | |
![[ ]](/icons/layout.gif) | C__Python_Coding_Manual_Ed20_2024.pdf | 2024-10-24 11:19 | 87M | |
![[ ]](/icons/layout.gif) | CherryPy_Essentials_Rapid_Python.pdf | 2024-09-14 07:34 | 4.1M | |
![[ ]](/icons/layout.gif) | Cisco_ThousandEyes_Digital_Experience_Monitoring_and_Troubleshooting.pdf | 2024-10-30 10:00 | 24M | |
![[ ]](/icons/layout.gif) | Coding Examples from Simple to Complex.pdf | 2024-09-24 10:16 | 3.8M | |
![[ ]](/icons/layout.gif) | Coding JavaScript (2024).pdf | 2024-10-01 10:16 | 1.9M | |
![[ ]](/icons/layout.gif) | Coding_JavaScript_Along_with_an_introduction_to_HTML_and_CSS_Independently.pdf | 2024-10-01 09:54 | 1.9M | |
![[ ]](/icons/layout.gif) | Communicating with Data (2024).pdf | 2024-09-25 04:03 | 2.5M | |
![[ ]](/icons/layout.gif) | CompTIA_Network+_Certification_All_in_One_Exam_Guide,_Eighth_Edition.pdf | 2024-10-17 04:50 | 58M | |
![[ ]](/icons/layout.gif) | Computer-Networking-Principles-Bonaventure-1-30-31-OTC1.pdf | 2024-09-14 07:45 | 11M | |
![[ ]](/icons/layout.gif) | Computer Graphics1 Cversion.pdf | 2024-09-14 07:38 | 21M | |
![[ ]](/icons/layout.gif) | Computer_Organization_and_Architecture_Designing_for_Performance.pdf | 2024-09-14 07:45 | 3.0M | |
![[ ]](/icons/layout.gif) | Core_Python_Applns_Pgmg_3rd_ed_W.pdf | 2024-09-14 07:39 | 10M | |
![[ ]](/icons/layout.gif) | DAA Oct - 2022.pdf | 2024-09-14 07:43 | 65K | |
![[ ]](/icons/layout.gif) | DAA Sep - 2023.pdf | 2024-09-14 07:43 | 16K | |
![[ ]](/icons/layout.gif) | DBMS book1 Silberschatz.pdf | 2024-09-14 07:33 | 17M | |
![[ ]](/icons/layout.gif) | DBMS insem 2023 solution_copy.pdf | 2024-09-14 07:43 | 1.9M | |
![[ ]](/icons/layout.gif) | Data-Structure-Algorithms-Text-Book-1.pdf | 2024-09-28 03:38 | 20M | |
![[ ]](/icons/layout.gif) | Data Mining with Python.pdf | 2024-09-12 04:23 | 4.6M | |
![[ ]](/icons/layout.gif) | Data Science & Big Data Analytics ( PDFDrive ).pdf | 2024-09-14 07:33 | 50M | |
![[ ]](/icons/layout.gif) | Data Science Practical Approach.pdf | 2024-09-14 07:32 | 70M | |
![[ ]](/icons/layout.gif) | Data Structures and Algorithms - Alfred V. Aho.pdf | 2024-09-14 07:43 | 6.6M | |
![[ ]](/icons/layout.gif) | Data Structures in Java.pdf | 2024-09-12 06:38 | 2.8M | |
![[ ]](/icons/layout.gif) | Data Structures the Fun Way.pdf | 2024-09-12 06:38 | 4.8M | |
![[ ]](/icons/layout.gif) | Data Warehouse and Business Intelligence.pdf | 2024-10-01 10:22 | 1.7M | |
![[ ]](/icons/layout.gif) | Data_Science_from_Scratch_First_Principles_with_Python_PDFDrive_.pdf | 2024-09-14 07:32 | 7.1M | |
![[ ]](/icons/layout.gif) | Data_Structures_and_Algorithm_Analysis_in_Java,_3rd_Edition_Mark.pdf | 2024-09-24 10:15 | 5.0M | |
![[ ]](/icons/layout.gif) | Data_Structures_and_Algorithms_Made_Easy_Data_Structures_and_Algorithmic.pdf | 2024-09-14 07:33 | 33M | |
![[ ]](/icons/layout.gif) | Database-Design-2nd-Edition-1560272109.pdf | 2024-09-14 07:34 | 2.7M | |
![[ ]](/icons/layout.gif) | Dive Into Python 3, r867 (2010).pdf | 2024-09-14 07:34 | 2.9M | |
![[ ]](/icons/layout.gif) | Eloquent_JavaScript-3rd Ed.pdf | 2024-09-14 07:43 | 2.2M | |
![[ ]](/icons/layout.gif) | Excel Formulas 🔥.pdf | 2024-09-12 06:37 | 451K | |
![[ ]](/icons/layout.gif) | Excel Smart Guide 📚.pdf | 2024-09-12 06:37 | 3.0M | |
![[ ]](/icons/layout.gif) | Expert Python Programming (2008).pdf | 2024-09-14 07:34 | 8.8M | |
![[ ]](/icons/layout.gif) | Expert_C_programming_Deep_C_secrets.pdf | 2024-09-14 07:35 | 3.2M | |
![[ ]](/icons/layout.gif) | Filter-Desing-complete-notes.pdf | 2024-09-14 07:46 | 718K | |
![[ ]](/icons/layout.gif) | Foundations of Agile Python Development (2008).pdf | 2024-09-14 07:34 | 6.3M | |
![[ ]](/icons/layout.gif) | Getting Started with Arduino v3_231014_210710.pdf | 2024-09-12 06:19 | 24M | |
![[ ]](/icons/layout.gif) | Grokking Data Structures-Manning (2024).pdf | 2024-10-15 03:07 | 17M | |
![[ ]](/icons/layout.gif) | Grokking the Java Interview.pdf | 2024-11-02 10:20 | 3.2M | |
![[ ]](/icons/layout.gif) | Guide to improve your Programming Logic .pdf | 2024-09-12 06:37 | 2.0M | |
![[ ]](/icons/layout.gif) | HTML And CSS Design And Build Websites.pdf | 2024-09-14 07:44 | 19M | |
![[ ]](/icons/layout.gif) | Hacking_Electronics_Learning_Electronics_with_Ard_230818_094742.pdf | 2024-09-12 06:19 | 7.7M | |
![[ ]](/icons/layout.gif) | Hands-On Data Structures and Algorithms with Python (2023).pdf | 2024-09-12 06:38 | 12M | |
![[ ]](/icons/layout.gif) | Head_First_C_A_Brain_Friendly_Guide.pdf | 2024-09-14 07:36 | 48M | |
![[ ]](/icons/layout.gif) | Hyperparameter Tuning for Machine and Deep Learning with R.pdf | 2024-10-01 10:22 | 3.8M | |
![[ ]](/icons/layout.gif) | ISE Quick Start Tutorial.pdf | 2024-09-14 07:45 | 656K | |
![[ ]](/icons/layout.gif) | ImagineFX_Presents_-_Sketchbook,_Volume_1_6th_Edition_2024.pdf | 2024-09-13 05:11 | 125M | |
![[ ]](/icons/layout.gif) | Internet Riches.pdf | 2024-09-20 05:29 | 7.6M | |
![[ ]](/icons/layout.gif) | Interview Preparation Websites .pdf | 2024-09-12 06:37 | 3.1M | |
![[ ]](/icons/layout.gif) | Intro.pdf | 2024-09-14 07:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Introduction_To_Computational_Modeling.pdf | 2024-09-14 07:35 | 9.5M | |
![[ ]](/icons/layout.gif) | Introduction to Computer Programming with Python.pdf | 2024-10-07 05:46 | 4.4M | |
![[ ]](/icons/layout.gif) | Introduction to Computer Science.pdf | 2024-09-14 07:37 | 5.2M | |
![[ ]](/icons/layout.gif) | Java - How To Program, 4th Edition (2002).pdf | 2024-09-18 10:28 | 14M | |
![[ ]](/icons/layout.gif) | Java Ebook .pdf | 2024-09-12 06:38 | 4.1M | |
![[ ]](/icons/layout.gif) | Java Programming Notes.pdf | 2024-09-12 06:37 | 3.2M | |
![[ ]](/icons/layout.gif) | Java_Programs.pdf | 2024-09-12 06:38 | 2.8M | |
![[ ]](/icons/layout.gif) | Java_The Complete Reference(7th edition).pdf | 2024-09-12 06:40 | 6.4M | |
![[ ]](/icons/layout.gif) | Java _ the complete reference, ninth edition ( PDFDrive ).pdf | 2024-09-14 07:33 | 79M | |
![[ ]](/icons/layout.gif) | Java to Kotlin_Final.pdf | 2024-10-06 06:22 | 2.7M | |
![[ ]](/icons/layout.gif) | Jesse Liberty. C++ Unleashed (SAMS).pdf | 2024-09-14 07:44 | 4.0M | |
![[ ]](/icons/layout.gif) | John_E_Hopcroft,_Rajeev_Motwani,_Jeffrey_D_Ullman_Introduction_to.pdf | 2024-09-14 07:32 | 5.7M | |
![[ ]](/icons/layout.gif) | Julia for Beginners.pdf | 2024-09-15 06:59 | 12M | |
![[ ]](/icons/layout.gif) | Kolban's Book on the ESP8266 and ESP32 ( PDFDrive ).pdf | 2024-09-12 06:20 | 6.4M | |
![[ ]](/icons/layout.gif) | Lang_B.pdf | 2024-10-06 06:31 | 16M | |
![[ ]](/icons/layout.gif) | Language_and_the_brain.pdf | 2024-10-15 03:07 | 336K | |
![[ ]](/icons/layout.gif) | Larry_L_Peterson,_Bruce_S_Davie_Computer_Networks_A_Systems_Approach.pdf | 2024-09-14 07:45 | 29M | |
![[ ]](/icons/layout.gif) | Learn Java in One Day and Learn It Well ( PDFDrive ).pdf | 2024-09-12 06:20 | 1.8M | |
![[ ]](/icons/layout.gif) | Learn_C#_in_One_Day_and_Learn_It_Well_C#_for_Beginners_with_Hands.pdf | 2024-09-12 06:20 | 1.0M | |
![[ ]](/icons/layout.gif) | Learn_CSS_in_One_Day_and_Learn_It_Well_Includes_HTML5_CSS_for_Beginners.pdf | 2024-09-12 06:21 | 798K | |
![[ ]](/icons/layout.gif) | Learn_Python_in_One_Day_and_Learn_It_Well_Python_for_Beginners_with.pdf | 2024-09-12 06:21 | 546K | |
![[ ]](/icons/layout.gif) | Learn_to_Program_in_Arduino_C_18_Lessons,_From_setup_to_Robots_PDFDrive.pdf | 2024-09-12 06:20 | 5.7M | |
![[ ]](/icons/layout.gif) | Learning_PHP,_MySQL,_Javascript,_CSS_&_HTML5_3rd_ed_Nixon_2014_06.pdf | 2024-09-14 07:34 | 20M | |
![[ ]](/icons/layout.gif) | LeetCode Questions 💡.pdf | 2024-09-12 06:37 | 2.6M | |
![[ ]](/icons/layout.gif) | Let Us C - Yashwant Kanetkar.pdf | 2024-09-14 07:38 | 7.8M | |
![[ ]](/icons/layout.gif) | Linux Coding Manual – September 2024.pdf | 2024-10-08 09:50 | 102M | |
![[ ]](/icons/layout.gif) | Linux_Linux_Command_Line,_Cover_all_essential_Linux_commands_A_complete.pdf | 2024-09-12 06:24 | 330K | |
![[ ]](/icons/layout.gif) | MATLAB.pdf | 2024-10-13 05:45 | 1.6M | |
![[ ]](/icons/layout.gif) | Make_Projects_Michael_Margolis_Make_an_Arduin_230811_162529.pdf | 2024-09-12 06:19 | 17M | |
![[ ]](/icons/layout.gif) | Mastering Python.pdf | 2024-09-12 06:38 | 3.1M | |
![[ ]](/icons/layout.gif) | Mastering Python for Web.pdf | 2024-10-06 06:21 | 5.4M | |
![[ ]](/icons/layout.gif) | Mastering_Algorithms_With_C_Useful.pdf | 2024-09-14 07:35 | 4.6M | |
![[ ]](/icons/layout.gif) | Mehlhorn-Sanders-Toolbox.pdf | 2024-09-14 07:34 | 3.0M | |
![[ ]](/icons/layout.gif) | Microsoft Word - range and domain cal 1.pdf | 2024-09-12 05:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Mindfulness_For_Dummies.pdf | 2024-10-09 04:26 | 3.4M | |
![[ ]](/icons/layout.gif) | Multimedia-Hardware.pdf | 2024-09-14 07:44 | 129K | |
![[ ]](/icons/layout.gif) | Natural Language Processing Practical.pdf | 2024-09-22 04:03 | 2.4M | |
![[ ]](/icons/layout.gif) | Numerical_Recipes_In_C_The_Art_Of.pdf | 2024-09-14 07:35 | 19M | |
![[ ]](/icons/layout.gif) | OBDD-Book.pdf | 2024-09-14 07:34 | 2.9M | |
![[ ]](/icons/layout.gif) | Object Oriented Programming.pdf | 2024-09-12 06:37 | 11M | |
![[ ]](/icons/layout.gif) | Object_Oriented_Programming_With.pdf | 2024-09-14 07:35 | 1.8M | |
![[ ]](/icons/layout.gif) | PRACTICAL_MATLAB®_FOR_ENGINEERS_PRACTICAL_MATLAB_PDFDrive_.pdf | 2024-09-12 06:24 | 7.2M | |
![[ ]](/icons/layout.gif) | PYTHON NOTES.pdf | 2024-09-12 06:39 | 64M | |
![[ ]](/icons/layout.gif) | PYTHON PROGRAMMING NOTES.pdf | 2024-09-18 11:15 | 1.5M | |
![[ ]](/icons/layout.gif) | Paresh_C__Sen_Principles_of_Elec(1).pdf | 2024-09-12 05:48 | 22M | |
![[ ]](/icons/layout.gif) | Pattern_Recognition_And_Image_Preprocessing_2Ed_,_M_Dekker,_2002T719S.pdf | 2024-09-14 07:46 | 574K | |
![[ ]](/icons/layout.gif) | Photoshop-for-Beginners-Oct-2023.pdf | 2024-10-29 04:10 | 52M | |
![[ ]](/icons/layout.gif) | Practical C Programming (1997)(3rd)(Steve Oualline).pdf | 2024-09-14 07:35 | 11M | |
![[ ]](/icons/layout.gif) | Presenting Data Effectively.pdf | 2024-09-28 07:19 | 10M | |
![[ ]](/icons/layout.gif) | Principles of Data Mining (2024).pdf | 2024-10-07 05:46 | 13M | |
![[ ]](/icons/layout.gif) | Professional C++ (Tech Today)-Wiley (2024).pdf | 2024-10-02 07:08 | 15M | |
![[ ]](/icons/layout.gif) | Programmable Logic Controllers 4th Edition (W Bolton).pdf | 2024-09-12 07:04 | 2.6M | |
![[ ]](/icons/layout.gif) | Programming_In_C_A_Complete_Introduction.pdf | 2024-09-14 07:35 | 3.6M | |
![[ ]](/icons/layout.gif) | Programming_with_Stm32_Getting_Started_with_the_Nu_231021_082140.pdf | 2024-09-12 06:17 | 47M | |
![[ ]](/icons/layout.gif) | Programming and Interfacing ATMEL's AVRs ( PDFDrive ).pdf | 2024-09-12 06:19 | 4.7M | |
![[ ]](/icons/layout.gif) | PySpark_Recipes_A_Problem_Solution_Approach_with_PySpark2_PDFDrive.pdf | 2024-10-13 05:42 | 3.2M | |
![[ ]](/icons/layout.gif) | Pyqs.pdf | 2024-09-14 07:43 | 104K | |
![[ ]](/icons/layout.gif) | Python---C---for-Beginners-Oct-2023.pdf | 2024-10-29 04:10 | 34M | |
![[ ]](/icons/layout.gif) | Python.pdf | 2024-09-12 06:37 | 2.3M | |
![[ ]](/icons/layout.gif) | Python 3 Web Development - Beginner's Guide (2011).pdf | 2024-09-14 07:43 | 2.7M | |
![[ ]](/icons/layout.gif) | Python Cheatsheet .pdf | 2024-09-12 06:37 | 1.5M | |
![[ ]](/icons/layout.gif) | Python Cookbook.pdf | 2024-10-22 05:35 | 3.4M | |
![[ ]](/icons/layout.gif) | Python Data Stracture.pdf | 2024-09-12 06:38 | 4.0M | |
![[ ]](/icons/layout.gif) | Python Data Structures (2023).pdf | 2024-09-12 06:38 | 6.1M | |
![[ ]](/icons/layout.gif) | Python Data Structures and Algorithms.pdf | 2024-10-02 06:50 | 11M | |
![[ ]](/icons/layout.gif) | Python Ebook Final.pdf | 2024-09-12 06:38 | 4.9M | |
![[ ]](/icons/layout.gif) | Python Flash Cards.pdf | 2024-09-12 06:17 | 1.0M | |
![[ ]](/icons/layout.gif) | Python For Everyone, Horstmann.pdf | 2024-09-14 07:44 | 110M | |
![[ ]](/icons/layout.gif) | Python Games Development using Pygame.pdf | 2024-10-01 10:16 | 4.7M | |
![[ ]](/icons/layout.gif) | Python Machine Learning.pdf | 2024-10-17 04:49 | 12M | |
![[ ]](/icons/layout.gif) | PythonNotesForProfessionals.pdf | 2024-09-12 06:54 | 6.1M | |
![[ ]](/icons/layout.gif) | Python Packages.pdf | 2024-09-12 04:23 | 2.8M | |
![[ ]](/icons/layout.gif) | Python Tips & Trics.pdf | 2024-09-12 06:37 | 3.0M | |
![[ ]](/icons/layout.gif) | Python_Preparation_Practice_Exams_Questions_with_Explanation.pdf | 2024-10-24 11:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Python for Engineers.pdf | 2024-10-30 09:59 | 2.5M | |
![[ ]](/icons/layout.gif) | Python programming workbook for machine learning with NumPy.pdf | 2024-09-15 06:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Pyton-Tricks ( PDFDrive ).pdf | 2024-09-12 06:20 | 1.6M | |
![[ ]](/icons/layout.gif) | React 18 for Beginners.pdf | 2024-10-30 09:59 | 2.2M | |
![[ ]](/icons/layout.gif) | Ritchie Kernighan The C Programming Language.pdf | 2024-09-14 07:37 | 21M | |
![[ ]](/icons/layout.gif) | Rust for Rustaceans.pdf | 2024-10-06 06:20 | 2.4M | |
![[ ]](/icons/layout.gif) | SQLAlchemy 2 In Practice.pdf | 2024-11-02 10:20 | 2.6M | |
![[ ]](/icons/layout.gif) | SQL COMMANDS💡.pdf | 2024-09-12 06:37 | 145K | |
![[ ]](/icons/layout.gif) | SQL Complete Notes .pdf | 2024-09-12 06:36 | 755K | |
![[ ]](/icons/layout.gif) | SQL Notes for Quick Revision.pdf | 2024-09-12 06:37 | 5.9M | |
![[ ]](/icons/layout.gif) | Sample FAQs.pdf | 2024-09-14 07:36 | 871K | |
![[ ]](/icons/layout.gif) | Serious_Cryptography_A_Practical_Introduction_to_Modern_Encryption.pdf | 2024-10-06 06:36 | 19M | |
![[ ]](/icons/layout.gif) | Serverless Handbook for frontend engineers (2024).pdf | 2024-10-13 05:46 | 28M | |
![[ ]](/icons/layout.gif) | Sitepoint_PHP_and_MySQL_Novice_to_Ninja_5th_Edition_www_gocit_vn.pdf | 2024-09-14 07:34 | 18M | |
![[ ]](/icons/layout.gif) | Sommerville-Software-Engineering-10ed.pdf | 2024-09-14 07:33 | 10M | |
![[ ]](/icons/layout.gif) | Speed_Up_Your_Python_with_Rust_Optimize_Python_performance_by_creating.pdf | 2024-10-06 06:22 | 7.0M | |
![[ ]](/icons/layout.gif) | Standard C Library, The (1992)(1st)(P. J. Plaucer).pdf | 2024-09-14 07:35 | 20M | |
![[ ]](/icons/layout.gif) | Standard library functions header files 1.pdf | 2024-09-14 07:36 | 869K | |
![[ ]](/icons/layout.gif) | Standard library functions header files 2.pdf | 2024-09-14 07:35 | 868K | |
![[ ]](/icons/layout.gif) | Supply-Chain-Planning-For-Dummies.pdf | 2024-10-30 09:56 | 3.0M | |
![[ ]](/icons/layout.gif) | Swipe👉 Advanced SQL❤️👨💻.pdf | 2024-09-12 06:37 | 4.1M | |
![[ ]](/icons/layout.gif) | The Art Of PostgreSQL.pdf | 2024-09-13 05:07 | 1.6M | |
![[ ]](/icons/layout.gif) | The Complete Chromebook User Manual – 12th Edition 2024.pdf | 2024-10-08 09:51 | 78M | |
![[ ]](/icons/layout.gif) | The Complete Python Coding Manual – 23th Edition 2024.pdf | 2024-10-08 09:51 | 100M | |
![[ ]](/icons/layout.gif) | The Python Interview Handbook 2023.pdf | 2024-09-12 06:38 | 25M | |
![[ ]](/icons/layout.gif) | The R Book.pdf | 2024-10-06 06:21 | 14M | |
![[ ]](/icons/layout.gif) | The_AVR_Microcontroller_and_Embedded_System_by_Muhammad_Ali_Mazidi.pdf | 2024-09-12 06:20 | 43M | |
![[ ]](/icons/layout.gif) | The_Book_of_Batch_Scripting_From_Fundamentals_to_Advanced_Automation.pdf | 2024-09-12 11:27 | 3.3M | |
![[ ]](/icons/layout.gif) | The_Complete_Chromebook_User_Manual_Ed23_2024_.pdf | 2024-10-07 10:43 | 78M | |
![[ ]](/icons/layout.gif) | The_Complete_Mac_Studio_User_Manual_Ed10.pdf | 2024-10-07 10:43 | 81M | |
![[ ]](/icons/layout.gif) | The_Developer's_Playbook_for_Large_Language_Model_Security_Building.pdf | 2024-09-12 04:29 | 2.3M | |
![[ ]](/icons/layout.gif) | The_Internet_of_things_do_it_yourself_projects_wi_231019_173710.pdf | 2024-09-12 06:17 | 22M | |
![[ ]](/icons/layout.gif) | The_Morgan_Kaufmann_Series_in_Data_Management_Systems_Jiawei_Han.pdf | 2024-09-14 07:33 | 12M | |
![[ ]](/icons/layout.gif) | Think Python (2023, 3rd Edition, Chapters 11-13).pdf | 2024-09-12 06:37 | 862K | |
![[ ]](/icons/layout.gif) | Time Series Forecasting using Python.pdf | 2024-09-17 04:22 | 3.2M | |
![[ ]](/icons/layout.gif) | Top 50 SQL Interview Questions 💡.pdf | 2024-09-12 06:37 | 1.7M | |
![[ ]](/icons/layout.gif) | Unit 4 Python R19.pdf | 2024-09-12 06:39 | 315K | |
![[ ]](/icons/layout.gif) | Web Applications with ASP.NET Core Blazor.pdf | 2024-09-22 04:03 | 6.2M | |
![[ ]](/icons/layout.gif) | Web_Hacking_Arsenal_A_Practical_Guide_to_Modern_Web_Pentesting_CRC.pdf | 2024-09-25 03:24 | 13M | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2024-09-23 at 8.08.56 AM.jpeg | 2024-09-25 03:30 | 135K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2024-09-23 at 8.29.02 PM.jpeg | 2024-09-25 03:30 | 154K | |
![[ ]](/icons/layout.gif) | WiFi_Hacking_for_Beginners_Learn.pdf | 2024-09-12 05:56 | 599K | |
![[ ]](/icons/layout.gif) | Widely Used Excel Shortcut Commands.pdf | 2024-09-12 06:37 | 322K | |
![[ ]](/icons/layout.gif) | Wiley - Programming In C.pdf | 2024-09-14 07:37 | 3.2M | |
![[ ]](/icons/layout.gif) | Writing_Solid_Code_Microsofts_Techniques.pdf | 2024-09-14 07:35 | 13M | |
![[ ]](/icons/layout.gif) | Writing_a_C_Compiler_Build_a_Real_Programming_Language_from_Scratch.pdf | 2024-11-02 10:22 | 10M | |
![[ ]](/icons/layout.gif) | X86_Assembly_Language_and_C_Fundamentals.pdf | 2024-09-14 07:35 | 5.4M | |
![[ ]](/icons/layout.gif) | achieve-diversity-through-growth-clarity-belonging.pdf | 2024-09-13 05:06 | 1.1M | |
![[ ]](/icons/layout.gif) | algorithms_toolbox_mehlhorn.pdf | 2024-09-14 07:34 | 2.0M | |
![[ ]](/icons/layout.gif) | an-introduction-to-data-structures-with-applications-2nbsped.pdf | 2024-09-18 10:15 | 124M | |
![[ ]](/icons/layout.gif) | c language (1c)_merged.pdf | 2024-09-12 06:40 | 55M | |
![[ ]](/icons/layout.gif) | classbk_Internet_of_Things_A_Hands_On_Approach_Arshdeep_Bahga,_Vijay.pdf | 2024-09-14 07:32 | 55M | |
![[ ]](/icons/layout.gif) | computer-graphics-by-sankarsan-sahoo.pdf | 2024-09-14 07:43 | 12M | |
![[ ]](/icons/layout.gif) | computer-graphics-by-verified-writer.pdf | 2024-09-14 07:43 | 7.1M | |
![[ ]](/icons/layout.gif) | cpp_231021_003645.pdf | 2024-09-12 06:17 | 7.7M | |
![[ ]](/icons/layout.gif) | cprogramming_tutorial.pdf | 2024-09-12 06:40 | 2.6M | |
![[ ]](/icons/layout.gif) | creating_your_mysql_database_practical_design_tips_and_techniques.pdf | 2024-09-14 07:34 | 1.9M | |
![[ ]](/icons/layout.gif) | cs8691 artificial intelligence notes.pdf | 2024-09-14 07:32 | 8.2M | |
![[ ]](/icons/layout.gif) | ctut (1).pdf | 2024-09-14 07:37 | 2.0M | |
![[ ]](/icons/layout.gif) | daa book1.pdf | 2024-09-14 07:33 | 28M | |
![[ ]](/icons/layout.gif) | daa book2.pdf | 2024-09-14 07:33 | 5.6M | |
![[ ]](/icons/layout.gif) | data-structures-using-c-facsimilenbsped-0131997467-9780131997462_compress.pdf | 2024-09-18 10:19 | 33M | |
![[ ]](/icons/layout.gif) | data_mining-arun_k_pujari.pdf | 2024-09-14 07:32 | 3.5M | |
![[ ]](/icons/layout.gif) | datascienceM Zero to Py (2023 - new release).pdf | 2024-09-12 06:38 | 1.9M | |
![[ ]](/icons/layout.gif) | diveintopython (2).pdf | 2024-09-14 07:39 | 1.2M | |
![[ ]](/icons/layout.gif) | diveintopython.pdf | 2024-09-14 07:34 | 1.4M | |
![[ ]](/icons/layout.gif) | dm-unit-3.pdf | 2024-09-14 07:42 | 6.1M | |
![[ ]](/icons/layout.gif) | dms-txt-book.pdf | 2024-10-04 10:29 | 19M | |
![[ ]](/icons/layout.gif) | hackercool.magazine.july.2024.pdf | 2024-10-01 10:12 | 11M | |
![[ ]](/icons/layout.gif) | intro_soft_.pdf | 2024-09-14 07:35 | 1.1M | |
![[ ]](/icons/layout.gif) | java(unit-6).pdf | 2024-09-12 06:40 | 13M | |
![[ ]](/icons/layout.gif) | java programming.pdf | 2024-09-12 06:41 | 88M | |
![[ ]](/icons/layout.gif) | kruse-data-structures-and-program-design-in-c-1991_compress.pdf | 2024-09-18 10:03 | 29M | |
![[ ]](/icons/layout.gif) | lecture1422914957.pdf | 2024-09-14 07:32 | 9.6M | |
![[ ]](/icons/layout.gif) | nodejsbasics.pdf | 2024-10-28 12:13 | 3.7M | |
![[ ]](/icons/layout.gif) | oxford-CTutorial.pdf | 2024-09-14 07:37 | 683K | |
![[ ]](/icons/layout.gif) | part1a.pdf | 2024-09-14 07:35 | 3.0M | |
![[ ]](/icons/layout.gif) | part1b.pdf | 2024-09-14 07:35 | 890K | |
![[ ]](/icons/layout.gif) | part2a.pdf | 2024-09-14 07:35 | 920K | |
![[ ]](/icons/layout.gif) | part2b.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | part3.pdf | 2024-09-14 07:36 | 1.8M | |
![[ ]](/icons/layout.gif) | part4.pdf | 2024-09-14 07:36 | 895K | |
![[ ]](/icons/layout.gif) | part5.pdf | 2024-09-14 07:36 | 891K | |
![[ ]](/icons/layout.gif) | part6.pdf | 2024-09-14 07:36 | 894K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-33-20.jpg | 2024-10-09 05:03 | 286K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-33-52.jpg | 2024-10-09 05:03 | 104K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-34-07.jpg | 2024-10-09 05:04 | 148K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-34-17.jpg | 2024-10-09 05:04 | 100K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-34-23.jpg | 2024-10-09 05:04 | 90K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-34-30.jpg | 2024-10-09 05:04 | 63K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-34-58.jpg | 2024-10-09 05:04 | 199K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-35-05.jpg | 2024-10-09 05:05 | 134K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-35-07.jpg | 2024-10-09 05:05 | 152K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-35-14.jpg | 2024-10-09 05:05 | 133K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-09_10-35-32.jpg | 2024-10-09 05:05 | 141K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-13_11-10-50.jpg | 2024-10-13 05:40 | 147K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-13_11-12-25.jpg | 2024-10-13 05:42 | 286K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-20_10-30-17.jpg | 2024-10-20 05:00 | 302K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-20_10-30-24.jpg | 2024-10-20 05:00 | 147K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-22_11-05-57.jpg | 2024-10-22 05:35 | 302K | |
![[IMG]](/icons/image2.gif) | photo_2024-10-28_17-43-11.jpg | 2024-10-28 12:13 | 70K | |
![[ ]](/icons/layout.gif) | principles_of_data_structures_using_c_and_c_v_das_230830_225644.pdf | 2024-09-12 06:19 | 2.4M | |
![[ ]](/icons/layout.gif) | programmind.pdf | 2024-09-12 06:38 | 2.6M | |
![[ ]](/icons/layout.gif) | python-1.pdf | 2024-09-12 06:36 | 3.6M | |
![[ ]](/icons/layout.gif) | python-3.pdf | 2024-09-12 06:37 | 1.9M | |
![[ ]](/icons/layout.gif) | python-web-frameworks.pdf | 2024-09-14 07:34 | 2.5M | |
![[ ]](/icons/layout.gif) | python .pdf | 2024-10-01 10:22 | 1.9M | |
![[ ]](/icons/layout.gif) | python Notes (2).pdf | 2024-09-12 06:39 | 1.4M | |
![[ ]](/icons/layout.gif) | python_tutorial.pdf | 2024-09-12 06:39 | 2.9M | |
![[ ]](/icons/layout.gif) | rest.pdf | 2024-09-28 03:55 | 33M | |
![[ ]](/icons/layout.gif) | sql-1 (2).pdf | 2024-09-12 06:37 | 2.2M | |
![[ ]](/icons/layout.gif) | sql-1.pdf | 2024-09-12 06:36 | 1.1M | |
![[ ]](/icons/layout.gif) | sql-2.pdf | 2024-09-12 06:36 | 381K | |
![[ ]](/icons/layout.gif) | sql.pdf | 2024-09-12 06:36 | 3.7M | |
![[ ]](/icons/layout.gif) | the Daily Dose of Data Science archive.pdf | 2024-10-22 05:35 | 88M | |
![[ ]](/icons/layout.gif) | timothywilliams.pdf | 2024-09-14 07:35 | 9.0M | |
|