![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 126676-probability-and-random-processes-by-rajiv-dash.pdf | 2024-09-14 07:44 | 13M | |
| AVR Microcontroller and Embedded Systems_vol_1.pdf | 2024-09-14 07:45 | 6.5M | |
| Advanced Image Processing with Python and OpenCV (2024).pdf | 2024-10-30 09:59 | 886K | |
| An_Introduction_to_Analog_and_Digital_Communications,_2nd_Edition.pdf | 2024-09-14 07:45 | 7.0M | |
| Antenna & Wave Propagation by A.K-Gautam.pdf | 2024-09-14 07:44 | 28M | |
| Antenna-propagation.pdf | 2024-09-14 07:44 | 320K | |
| Antenna Theory - Analysis and Design, Third Edition.pdf | 2024-09-14 07:44 | 21M | |
| Antennas and Radiowave Propagation -Collin.pdf | 2024-09-14 07:44 | 25M | |
| BSS NOTES.pdf | 2024-09-12 06:39 | 7.1M | |
| Background_for_signals_and_systems_II.pdf | 2024-09-12 05:48 | 182K | |
| Basic_Electronics_for_Scientists_and_Engineers_P_231015_223537.pdf | 2024-09-12 06:19 | 1.6M | |
| Bellamy - Digital Telephony (2000) (3rd.Ed).pdf | 2024-09-14 07:44 | 41M | |
| Boylestad 10th حلول.pdf | 2024-09-12 05:48 | 13M | |
| Boylestad 11th حلول.pdf | 2024-09-12 05:48 | 3.9M | |
| Chen_W_K_ed_Passive,_active,_and_digital_filters_3ed_,_CRC,_2009ISBN.pdf | 2024-09-14 07:46 | 13M | |
| Communication Systems - 4ed - Haykin.pdf | 2024-09-14 07:45 | 13M | |
| Communication Systems Engineering(2nd Edition).pdf | 2024-09-14 07:46 | 4.5M | |
| Communication Systems II Lecture Notes.pdf | 2024-09-14 07:45 | 4.0M | |
| Communication_Systems_An_Introduction.pdf | 2024-09-12 05:48 | 13M | |
| Control Systems by A. Anand Kumar.pdf | 2024-09-12 06:41 | 22M | |
| DIP Applications.pdf | 2024-09-14 07:46 | 2.1M | |
| DS aio 1_merged (1).pdf | 2024-09-12 06:40 | 55M | |
| Design_of_Analog_Filters_Rolf_Schaumann_&_Mac_E_Van_Valkenburg.pdf | 2024-09-14 07:46 | 13M | |
| Digital & Analog Communication Systems - Couch - 5ed.pdf | 2024-09-14 07:46 | 40M | |
| Digital Communications Fall Utah.pdf | 2024-09-14 07:45 | 1.5M | |
| Digital Design (3rd Ed)-Morris Mano.pdf | 2024-09-14 07:45 | 14M | |
| Digital Design by M. Morris Mano.pdf | 2024-09-12 06:07 | 12M | |
| Digital Systesm Design Using VHDL Roth.pdf | 2024-09-14 07:46 | 6.1M | |
| Discrete-Time Signal Processing - Oppenheim.pdf | 2024-09-14 07:43 | 7.7M | |
| ECE_202_TB_Copy.pdf | 2024-09-12 06:10 | 16M | |
| Electric Circuits by James S Kang 1.pdf | 2024-09-12 05:48 | 21M | |
| Electronic Devices and Circuit Theory - Boyelstad.pdf | 2024-09-12 06:29 | 21M | |
| Electronic_Devices_And_Circuits_by_S_Salivahanan_N_Suresh_Kumar.pdf | 2024-09-12 06:07 | 66M | |
| Electronic_Devices_and_Circuit_Theory_11th_Edition_by_Robert_L_Boylestad.pdf | 2024-09-12 06:38 | 26M | |
| Electronic_Devices_and_Circuit_Theory_Boylestad_and_Nashelsky.pdf | 2024-09-14 07:46 | 21M | |
| Embedded System Design-Solution Manual.pdf | 2024-09-14 07:45 | 346K | |
| Embedded_systems_introduction_to_ARM®_CortexTM_M_microcontrollers.pdf | 2024-09-12 06:38 | 9.0M | |
| Fast_and_Effective_Embedded_Systems_Design,_Second_Edition_Applying.pdf | 2024-09-12 06:24 | 12M | |
| Fundamentals_of_Electronics_Book_1_Electronic_Devices_and_Circuit.pdf | 2024-09-12 06:24 | 7.5M | |
| Fundamentals_of_Image_Processing.pdf | 2024-09-14 07:46 | 899K | |
| Fundamentals of Digital Electronics.pdf | 2024-09-14 07:45 | 537K | |
| Fundamentals of Electric Circuits Alexander 6th.pdf | 2024-09-12 05:48 | 12M | |
| Handbook_of_RF_and_Microwave_Power_Amplifiers_The_231015_222435.pdf | 2024-09-12 06:19 | 15M | |
| LINEAR AND DIGITAL IC APPLICATIONS (1).pdf | 2024-09-12 06:38 | 6.7M | |
| Learn_Electronics_with_Arduino_An_Illustrated_Beginner’s_Guide_to.pdf | 2024-09-12 06:17 | 50M | |
| Learn_Electronics_with_Raspberry_Pi_Physical_Computing_with_Circuits.pdf | 2024-09-12 06:20 | 19M | |
| Lecture Notes For Digital Electronics.pdf | 2024-09-14 07:45 | 217K | |
| Linear Control System Analysis and Design with MatLab, 2003.pdf | 2024-09-12 05:48 | 6.7M | |
| Linear_Circuits.pdf | 2024-09-12 06:10 | 9.1M | |
| ME.pdf | 2024-09-12 06:28 | 25M | |
| Microelectronic Circuits Muhammad H. Rashid.pdf | 2024-09-14 07:45 | 12M | |
| Microwave_Engineering_David_M_Pozar_4ed_Wiley_2012.pdf | 2024-09-14 07:43 | 15M | |
| Modern_Digital_And_Analog_Communications_Systems_B_P_Lathi_3rd_Ed.pdf | 2024-09-14 07:46 | 50M | |
| Network Analysis & Synthesis.pdf | 2024-09-12 06:13 | 44M | |
| Op Amps for Everyone ( PDFDrive ) (1).pdf | 2024-09-12 06:13 | 12M | |
| Optical_Fiber_Communications_Principles_and_Practice_3rd_Edition.pdf | 2024-09-14 07:44 | 14M | |
| PIC Microcontroller and Embedded Systems - Mazidi.pdf | 2024-09-14 07:46 | 59M | |
| REFERENCE Signals and Systems 2nd Ed.pdf | 2024-09-12 05:48 | 34M | |
| RF_Circuit_Design,_Second_Editionpdf_PDFDrive_231017_232926.pdf | 2024-09-12 06:17 | 31M | |
| Robert_CoughinOperational_Amplifiers_and_Linear_Integrated_Circuits.pdf | 2024-09-12 06:11 | 34M | |
| S3EStarter user Guide.pdf | 2024-09-14 07:45 | 8.8M | |
| SIGNALS & SYSTEMS.pdf | 2024-09-12 06:39 | 48M | |
| Schaums_outline_of_theory_and_problems_of_signal_and_systems_by.pdf | 2024-09-12 05:56 | 6.3M | |
| Signal_Processing_and_Linear_Systems_B_P_Lathi_Solutions_Manual.pdf | 2024-09-14 07:43 | 11M | |
| Signal and Systems-B.P.Lathi.pdf | 2024-09-14 07:44 | 32M | |
| Signals And Systems - Oppenheim.pdf | 2024-09-14 07:44 | 32M | |
| Signals_and_Systems,_2ed_A_V_Oppenheim_&_A_S_Willsky_Prentice_Hall.pdf | 2024-09-14 07:43 | 14M | |
| Signals and Systems 2e Oppenheim Solutions.pdf | 2024-09-14 07:44 | 27M | |
| Signals and systems - Chi Tsong chen.pdf | 2024-09-14 07:43 | 4.5M | |
| Singh_Network_Analysis_And_Synthesis_Mc_Graw_Hill_India_2013.pdf | 2024-09-12 05:56 | 44M | |
| Solid_State_Electronic_Devices_Global_Edition_by_Ben_G_Streetman.pdf | 2024-09-12 06:07 | 15M | |
| Solution_Manual_Communication_Systems.pdf | 2024-09-12 05:47 | 5.6M | |
| Solution_Manual_Introduction_to.pdf | 2024-09-12 05:47 | 12M | |
| Telecommunication System Engineering.pdf | 2024-09-14 07:44 | 8.0M | |
| Transparencies.pdf | 2024-09-14 07:36 | 1.2M | |
| VHDL Coding and Logic Synthesis with Synopsys.pdf | 2024-09-14 07:45 | 7.4M | |
| arm-based-microcontroller-projects-using-mbed_compress (1).pdf | 2024-09-12 06:17 | 56M | |
| classbk_Internet_of_Things_A_Hands_On_Approach_Arshdeep_Bahga,_Vijay.pdf | 2024-09-14 07:32 | 55M | |
| d-s-p-book-n-g-palan-pdf (1).pdf | 2024-09-12 06:11 | 25M | |
| digital_electronics_3rd_edition_by_godse_By_EasyEngineering_net.pdf | 2024-09-12 06:41 | 19M | |
| digital vlsi design with verilog (john williams).pdf | 2024-09-14 07:46 | 13M | |
| fundamental of DIP.pdf | 2024-09-14 07:46 | 5.1M | |
| gaikwad-Op-Amps-And-Linear-Integrated-Circuits-pdf (1).pdf | 2024-09-12 06:15 | 242M | |
| linear-integrated-circuit-2nd-edition-d-roy-choudhary.pdf | 2024-09-12 06:10 | 9.4M | |
| m-d-singh-k-b-khanchandani-power-electronics.pdf | 2024-09-12 06:11 | 58M | |
| modern-digital-and-analog-communication-systems-by-b-p-lathi.pdf | 2024-09-14 07:46 | 50M | |
| mpmc_textbook_godse.pdf | 2024-09-12 06:10 | 17M | |
| optical fiber communications by gerd keiser.pdf | 2024-09-14 07:44 | 21M | |
| parctical electronic for invertors.pdf | 2024-09-12 06:20 | 29M | |
| spm insem.pdf | 2024-09-14 07:43 | 86K | |
| spm insem 1.pdf | 2024-09-14 07:43 | 106K | |
| verilog reference guide.pdf | 2024-09-14 07:45 | 270K | |
| vhdl-tutorial.pdf | 2024-09-14 07:45 | 347K | |
|
|---|