![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | $$Electronic_Devices_Conventional_Current_Thomas_L_Floyd_Version.pdf | 2023-12-26 11:28 | 95M | |
| A_Beginners_Guide_to_Designing_Embedded_System_Applications_on_Arm.pdf | 2023-12-22 11:17 | 51M | |
| Advanced_Digital_Optical_Communications_by_Le_Nguyen_Binh_z_lib.pdf | 2023-12-26 11:24 | 44M | |
| Always_Learning_Gottapu_Sasi_Bhushana_Rao_Microwave_and_Radar_Engineering.pdf | 2023-12-26 11:28 | 18M | |
| Always_Learning_Robert_L_Boylestad_Introductory_circuit_analysis.pdf | 2023-12-26 11:28 | 44M | |
| Analog_and_Pulse_Circuits_by_Dayaydi_Lakshmaiah,_Taylor_Francis.pdf | 2023-12-26 11:23 | 17M | |
| Analog_electronics_with_LabVIEW_Prentice_Hall_PTR_National_Instruments.pdf | 2023-12-26 11:29 | 7.5M | |
| Analyzing_Circuit_The_Exercises_In_The_Laboratory_Engineering_Circuit.pdf | 2023-12-26 11:27 | 6.9M | |
| Antenna_Engineering_Theory_and_Problems_by_Levin,_Boris_z_lib_org.pdf | 2023-12-26 11:22 | 9.8M | |
| Basic_Electrical_and_Electronics_Engineering_For_RGPV_Subject_Code.pdf | 2023-12-26 11:28 | 19M | |
| Basic_Electronics_by_De,_Debashis_Ghatak,_Kamakhya_Prasad_z_lib.pdf | 2023-12-26 11:22 | 14M | |
| Ben_G_Streetman_Sanjay_Kumar_Banerjee_Solid_State_Electronic_Devices.pdf | 2023-12-26 11:29 | 15M | |
| Build_Your_Own_Transistor_Radios_A_Hobbyist’s_Guide_to_High_Performance.pdf | 2023-12-22 11:17 | 59M | |
| CMOS VLSI Design A Circuits and Systems Perspective.pdf | 2023-12-26 11:26 | 13M | |
| Circuit Engineering.pdf | 2023-12-22 11:17 | 1.2M | |
| Circuit Theory and Networks Analysis and Synthesis.pdf | 2023-12-26 11:29 | 14M | |
| Dennis_Roddy,_John_Coolen_Electronic_Communications_Pearson_Education.pdf | 2023-12-26 11:29 | 4.8M | |
| Designing Embedded Systems and the Internet of Things.pdf | 2023-12-20 06:45 | 25M | |
| Digital Fundamentals.pdf | 2023-12-22 11:17 | 55M | |
| Digital_Design_Global_Edition_M_Morris_Mano,_Michael_Ciletti_z_lib.pdf | 2023-12-26 11:25 | 19M | |
| Digital_Design_With_an_Introduction_to_the_Verilog_HDL,_VHDL,_and.pdf | 2023-12-26 11:25 | 17M | |
| Digital_Design_with_RTL_Design,_VHDL,_and_Verilog_Solution_Manual.pdf | 2023-12-26 11:24 | 2.9M | |
| Digital_Electronics_A_Practical_Approach_with_VHDL_Pearson_New_International.pdf | 2023-12-26 11:29 | 22M | |
| Digital_Fundamentals,_Global_Edition_by_Thomas_L_Floyd_z_lib_org (2).pdf | 2023-12-26 11:28 | 55M | |
| Digital_Systems_Design_Using_VHDL_3rd_Edition_Charles_H_Roth,_Lizy.pdf | 2023-12-26 11:24 | 14M | |
| Digital_integrated_circuits_a_design_perspective_by_Jan_M_Rabaey.pdf | 2023-12-26 11:29 | 11M | |
| ELECTRONIC_DEVICES_AND_INTEGRATED_CIRCUITS_by_B_P_Singh,_Rekha_Singh.pdf | 2023-12-26 11:29 | 14M | |
| Effective Coding with VHDL (Ricardo Jasinski) (z-lib.org).pdf | 2023-12-26 11:24 | 15M | |
| Effective_Threat_Investigation.pdf | 2023-12-19 05:29 | 24M | |
| Electronic Measurement and Instrumentation.pdf | 2023-12-26 11:29 | 35M | |
| Electronic_Circuits_Analysis_1_B_Visvesvara_Rao,_K_Bhaskara_Rama.pdf | 2023-12-26 11:28 | 28M | |
| Electronic_Circuits_IIB_Visvesvara_Rao,_K_Bhaskara_Rama_Murthy,.pdf | 2023-12-26 11:29 | 36M | |
| Electronic_Circuits_I_Beginner_Guide_THAMARAI,_SHYMALA_z_lib_org.pdf | 2023-12-26 11:24 | 16M | |
| Electronic_Devices_Conventional_Current_Thomas_L_Floyd_Version_Pearson.pdf | 2023-12-26 11:29 | 93M | |
| Electronic_Devices_and_Circuits_by_B_Visvesvara,_Rao_K_Bhaskara.pdf | 2023-12-26 11:27 | 11M | |
| Electronic_Measurements_Instrumentation_by_K_Lal_Kishore_z_lib_org.pdf | 2023-12-26 11:28 | 14M | |
| Electronic_communications_a_systems_approach_by_Gary_M_Miller_Jonathan (2).pdf | 2023-12-26 11:29 | 7.4M | |
| Electronics Engineering by U.A.Bakshi, A.P.Godse (z-lib.org).pdf | 2023-12-26 11:29 | 21M | |
| Electronics_All_in_One_For_Dummies,_3rd_Edition_Doug_Lowe_z_lib.pdf | 2023-12-26 11:24 | 84M | |
| Electronics_Fundamentals_Circuits,_Devices_and_Applications_Pearson.pdf | 2023-12-26 11:28 | 33M | |
| Engineering_Circuit_Analysis_by_William_Hayt,_Jack_Kemmerly,_Jaime.pdf | 2023-12-26 11:27 | 64M | |
| Fundamentals of Electric Circuits.pdf | 2023-12-26 11:29 | 12M | |
| GATE 2022 SOLUTIONS MICROPROCESSOR by Mechasoft (z-lib.org).pdf | 2023-12-26 11:27 | 4.2M | |
| GATE_2022_Electronics_and_Communication_Engineering_Guide_by_G_K.pdf | 2023-12-26 11:22 | 14M | |
| G_K_Publications_P_Ltd_GATE_2022_Electronics_and_Communication_Engineering.pdf | 2023-12-26 11:27 | 14M | |
| Gate 2022 Solutions Analog Circuits by ,,,, (z-lib.org).pdf | 2023-12-26 11:22 | 4.4M | |
| Jeffrey_S_Beasley,_Gary_M_Miller_Modern_Electronic_Communication.pdf | 2023-12-26 11:29 | 30M | |
| Jeffrey_S_Beasley_Electronic_Communications_A_Systems_Approach_Pearson.pdf | 2023-12-26 11:28 | 6.7M | |
| LINEAR_INTEGRATED_CIRCUITS_Beginner_Guide_by_THAMARAI,_SHYMALA_z.pdf | 2023-12-26 11:22 | 9.4M | |
| Michael_Ciletti_M_Morris_Mano_Digital_Design_Global_Edition_2018.pdf | 2023-12-26 11:23 | 19M | |
| Microelectronic Circuits-1.pdf | 2023-12-26 11:25 | 60M | |
| Microelectronic Circuits.pdf | 2023-12-26 11:25 | 53M | |
| Microelectronics Circuit Analysis and Design.pdf | 2023-12-26 11:25 | 83M | |
| Microwave Devices and Circuits by LIAO (z-lib.org).pdf | 2023-12-26 11:22 | 15M | |
| Mobile_Phones_and_Tablets_Repairs_A_Complete_Guide_for_Beginners.pdf | 2023-12-26 11:22 | 7.9M | |
| Modern Digital Electronics by R P Jain (z-lib.org).pdf | 2023-12-26 11:26 | 51M | |
| Modern_Systems_Analysis_and_Design,_Global_Edition,_9th_Edition.pdf | 2023-12-26 11:27 | 61M | |
| Muhammad_Ali_Mazidi,_Sarmad_Naimi,_Sepehr_Naimi_AVR_Microcontroller.pdf | 2023-12-26 11:29 | 43M | |
| Network_Analysis_and_Synthesis_by_S_K_Bhattacharya_z_lib_org.pdf | 2023-12-26 11:23 | 31M | |
| Power Electronics Handbook.pdf | 2023-12-22 11:17 | 116M | |
| Principles_Marketing,_Engineering_and_Analytics_Gary,Arvind,Arnaud.pdf | 2023-12-18 09:35 | 7.2M | |
| Principles_of_Electric_Circuits_Pearson_New_International_Edition.pdf | 2023-12-26 11:29 | 23M | |
| Principles of Electric Circuits 10th ed.pdf | 2023-12-26 11:29 | 25M | |
| Solid_State_Electronic_Devices_Global_Edition_Ben_G_Streetman_Sanjay.pdf | 2023-12-26 11:24 | 15M | |
| Solution Notes English.pdf | 2023-12-26 10:55 | 11M | |
| Understanding_Digital_Signal_Processing_with_MATLAB®_and_Solutions.pdf | 2023-12-26 11:23 | 18M | |
| VHDL Programming By Example.pdf | 2023-12-26 11:25 | 2.3M | |
| William_Kleitz_Digital_electronics_a_practical_approach_with_VHDL.pdf | 2023-12-26 11:29 | 32M | |
| [ EngineeringEBookspdf ] Electric Circuit Analysis.pdf | 2023-12-16 06:15 | 14M | |
| [ EngineeringEBookspdf ] Electronic Principles.pdf | 2023-12-16 06:15 | 27M | |
| [ EngineeringEBookspdf ] Gateway to ISRO.pdf | 2023-12-16 06:19 | 276M | |
| [ EngineeringEBookspdf ] Introduction to Electric Circu.pdf | 2023-12-16 06:18 | 9.7M | |
| [ EngineeringEBookspdf ] Principles of Modern Wireless.pdf | 2023-12-16 06:13 | 3.9M | |
| [ EngineeringEBookspdf ] Wireless Communication.pdf | 2023-12-16 06:24 | 5.3M | |
| _Electronics_Microelectronic_Circuits_Oxford_University_Press,_USA.pdf | 2023-12-26 11:24 | 5.5M | |
| _EngineeringEBookspdf_Gateway_to_IES_for_Electronics_&_Communication.pdf | 2023-12-16 06:15 | 161M | |
| antennas-and-wave-propagation-by-gsn-raju-8131701840.pdf | 2023-12-26 11:27 | 37K | |
|
|---|