![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1_Introduction.pdf | 2019-11-19 15:54 | 77K | |
| CSE GATE M.zip | 2019-11-19 15:50 | 155M | |
| Compiler Design-CS.pdf | 2019-11-19 15:39 | 7.3M | |
| Computer Network-CS.pdf | 2019-11-19 15:40 | 15M | |
| Computer Organization-CS.pdf | 2019-11-19 15:40 | 16M | |
| DBMS-CS.pdf | 2019-11-19 15:42 | 25M | |
| Data Structure-CS.pdf | 2019-11-19 15:41 | 30M | |
| Design Analysis and Algorithm-CS.pdf | 2019-11-19 15:44 | 33M | |
| Digital Logic-CS.pdf | 2019-11-19 15:46 | 14M | |
| Operating System-CS.pdf | 2019-11-19 15:47 | 12M | |
| Theory of Computation-CS.pdf | 2019-11-19 15:47 | 3.2M | |